messages
listlengths
2
2
images
images listlengths
1
1
[ { "role": "user", "content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Please suggest possible reactants for the given product." }, { "role": "assistant", "content": "[C][O][C][=Branch1][C][=O][C][Br].[O][=C][Branch2][Ring2][=C][C][C][C][C][C][Branch1][=N][C][=C][C][Branch1][C][F][=C][C][=C][Ring1][#Branch1][F][Branch2][Ring1][Ring1][S][=Branch1][C][=O][=Branch1][C][=O][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][C][C][Ring2][Ring1][Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][O]" } ]
[ { "role": "user", "content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> What is the SMILES formula of this molecule?" }, { "role": "assistant", "content": "The SMILES formula of this molecule is: CC(C)C1=CC2=CC(=CC3=C2C(=C1CO)C(=O)N3CCO)OC" } ]
[ { "role": "user", "content": "You are a chemical assistant that understands molecular structures, properties, and applications. Analyze the provided to describe this molecule concisely, including its key structural features, physical/chemical traits, uses, and safety considerations. <image> Describe this molecule." }, { "role": "assistant", "content": "The molecule is a natural product found in Allium ampeloprasum with data available." } ]
[ { "role": "user", "content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> What is the SMILES formula of this molecule?" }, { "role": "assistant", "content": "The SMILES formula of this molecule is: CC=CC(=O)OCC=C(C)CCC=C(C)C" } ]
[ { "role": "user", "content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Please suggest possible reactants for the given product." }, { "role": "assistant", "content": "[C][S][=Branch1][C][=O][=Branch1][C][=O][Cl].[O][C][C][C][O][C][=C][C][=N][C][=C][C][=C][C][=C][Ring1][#Branch2][Ring1][=Branch1]" } ]
[ { "role": "user", "content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Please suggest possible reactants for the given product." }, { "role": "assistant", "content": "[C][O][C][=Branch1][C][=O][/C][=C][/C][C][=C][Branch2][Ring1][Branch1][C][=C][C][=C][Branch1][O][O][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][Ring1][=C][N][Branch1][=Branch2][C][C][C][C][C][C][Ring1][=Branch1][N][=Ring2][Ring1][=Branch2]" } ]
[ { "role": "user", "content": "You are a chemical assistant that analyzes molecular structures and provides precise calculations for HOMO-LUMO gap energy. <image> I need to know the HOMO-LUMO gap energy of this molecule, could you please provide it?" }, { "role": "assistant", "content": "0.3157" } ]
[ { "role": "user", "content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Given the reactants and reagents provided, what is a possible product that can be formed?" }, { "role": "assistant", "content": "[C][C][C][O][C][Ring1][Branch1].[C][N][Branch1][C][C][C][=O].[Cl][C][Cl].[O].[O][=C][Branch1][C][Cl][C][=Branch1][C][=O][Cl].[O][=C][Branch1][C][O-1][O].[Na+1]" } ]
[ { "role": "user", "content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> What is the SMILES formula of this molecule?" }, { "role": "assistant", "content": "The SMILES formula of this molecule is: CCCC[Sn]CCCC.CCCC[Sn]CCCC.C1CC(=O)N[C@@H]1C(=O)O.C1CC(=O)N[C@@H]1C(=O)O.O" } ]
[ { "role": "user", "content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> What is the SMILES formula of this molecule?" }, { "role": "assistant", "content": "The SMILES formula of this molecule is: C=CCNC(=S)C1=NC=NN1" } ]
[ { "role": "user", "content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> Given the reactants and reagents provided, what is a possible product that can be formed?" }, { "role": "assistant", "content": "[C][C][C][C][N][C][=Branch1][C][=O][N][C][C][Branch2][Ring1][Ring2][O][C][=C][C][=C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][C][=C][Ring1][#Branch2][C][Ring1][#C]" } ]
[ { "role": "user", "content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Given the reactants and reagents provided, what is a possible product that can be formed?" }, { "role": "assistant", "content": "[C][C][C][O][C][Ring1][Branch1].[C][C][C][C][C][C].[O].[H-1].[Na+1]" } ]
[ { "role": "user", "content": "You are a chemical assistant that understands molecular structures, properties, and applications. Analyze the provided to describe this molecule concisely, including its key structural features, physical/chemical traits, uses, and safety considerations. <image> Describe this molecule." }, { "role": "assistant", "content": "The molecule is a natural product found in Homo sapiens with data available." } ]
[ { "role": "user", "content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> What is the SMILES formula of this molecule?" }, { "role": "assistant", "content": "The SMILES formula of this molecule is: CC1C2C(CC3C4(CCN3C2=O)C5=CC=CC=C5NC4=O)C(=CO1)C(=O)OC" } ]
[ { "role": "user", "content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> What is the SMILES formula of this molecule?" }, { "role": "assistant", "content": "The SMILES formula of this molecule is: CC1=CC=C(C=C1)[SnH](C2=CC=C(C=C2)C)C3=CC=C(C=C3)C" } ]
[ { "role": "user", "content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> Given the reactants and reagents provided, what is a possible product that can be formed?" }, { "role": "assistant", "content": "[O][=C][Branch1][C][O][C][C][C][N][Branch1][N][C][=C][C][=C][Branch1][C][F][C][=N][Ring1][#Branch1][C][C][Ring1][=N]" } ]
[ { "role": "user", "content": "You are a chemical assistant that analyzes molecular structures and provides precise calculations for HOMO-LUMO gap energy. <image> I need to know the HOMO-LUMO gap energy of this molecule, could you please provide it?" }, { "role": "assistant", "content": "0.0295" } ]
[ { "role": "user", "content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> Given the reactants and reagents provided, what is a possible product that can be formed?" }, { "role": "assistant", "content": "[O][=C][Branch2][Ring1][S][C][C][=Branch1][C][=O][N][C][C][N][Branch1][P][S][=Branch1][C][=O][=Branch1][C][=O][C][=C][C][=C][C][=C][Ring1][=Branch1][Cl][C][C][Ring1][S][N][C][=C][C][=C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][Ring1][N]" } ]
[ { "role": "user", "content": "You are a chemical assistant that understands molecular structures, properties, and applications. Analyze the provided to describe this molecule concisely, including its key structural features, physical/chemical traits, uses, and safety considerations. <image> Describe this molecule." }, { "role": "assistant", "content": "The molecule is a natural product found in Apis cerana with data available." } ]
[ { "role": "user", "content": "You are a chemical assistant that analyzes molecular structures and provides precise calculations for HOMO-LUMO gap energy. <image> I need to know the HOMO-LUMO gap energy of this molecule, could you please provide it?" }, { "role": "assistant", "content": "-0.1717" } ]
[ { "role": "user", "content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Given the reactants and reagents provided, what is a possible product that can be formed?" }, { "role": "assistant", "content": "[C][C][C][O][C][Ring1][Branch1].[C][C][O][C][=Branch1][C][=O][N][=N][C][=Branch1][C][=O][O][C][C].[C][C][O][C][Branch1][C][C][=O].[C][=C][C][=C][Branch2][Ring1][Ring2][P][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][Ring2][Ring1][Ring1]" } ]
[ { "role": "user", "content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Please suggest possible reactants for the given product." }, { "role": "assistant", "content": "[C][C@@H1][C][C][N][C][C@@H1][Ring1][=Branch1][C][=N][C][=C][C][=N][C][NH1][C][=C][C][=Ring1][Branch1][N][Ring1][N][Ring1][=Branch2].[O][=C][Branch1][C][Cl][N][C][C][C][C][C][Ring1][=Branch1]" } ]
[ { "role": "user", "content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Please suggest possible reactants for the given product." }, { "role": "assistant", "content": "[C][C][C][C][=Branch1][C][=O][Cl].[O][=C][Branch1][C][O][C][C][C][C][C][C][C][C][C][C][C][O]" } ]
[ { "role": "user", "content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> What is the SMILES formula of this molecule?" }, { "role": "assistant", "content": "The SMILES formula of this molecule is: CC(C(=O)O)OC1=CC2=C(C=C1)OC3=CC=CC=C3C2=O" } ]
[ { "role": "user", "content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Given the reactants and reagents provided, what is a possible product that can be formed?" }, { "role": "assistant", "content": "[C][C][N][Branch1][=Branch1][C][Branch1][C][C][C][C][Branch1][C][C][C].[C][C][O][P][=Branch1][C][=O][Branch1][Ring1][C][#N][O][C][C].[C][N][Branch1][C][C][C][=O].[O][=C][Branch1][C][O-1][O].[Na+1]" } ]
[ { "role": "user", "content": "You are a chemical assistant that understands molecular structures, properties, and applications. Analyze the provided to describe this molecule concisely, including its key structural features, physical/chemical traits, uses, and safety considerations. <image> Describe this molecule." }, { "role": "assistant", "content": "The molecule is a natural product found in Streptomyces hiroshimensis and Streptomyces roseoverticillatus with data available." } ]
[ { "role": "user", "content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Please suggest possible reactants for the given product." }, { "role": "assistant", "content": "[C][C][Branch1][C][C][C][=N][C][=C][Branch2][Ring2][Ring1][C][Branch1][N][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1][=C][Ring1][=N][C][Branch1][#Branch2][O][C][Branch1][C][C][Branch1][C][C][C][C][=Branch1][C][=O][O][C][N][C][C][Ring2][Ring1][Branch2][Branch1][C][C][C].[O][=C][Branch1][C][Cl][C][=C][C][=C][C][=C][Ring1][=Branch1]" } ]
[ { "role": "user", "content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Please suggest possible reactants for the given product." }, { "role": "assistant", "content": "[C][O][C][=C][C][=C][Branch1][Branch2][C][=C][C][=Branch1][C][=O][Cl][C][=C][Ring1][O][O][C].[C][C][=C][C][=C][Branch1][C][N][C][Branch1][=Branch1][C][=Branch1][C][=O][O][=C][Ring1][#Branch2]" } ]
[ { "role": "user", "content": "You are a chemical assistant that understands molecular structures, properties, and applications. Analyze the provided to describe this molecule concisely, including its key structural features, physical/chemical traits, uses, and safety considerations. <image> Describe this molecule." }, { "role": "assistant", "content": "The molecule is a natural product found in Garcinia scortechinii and Garcinia acuminata with data available." } ]
[ { "role": "user", "content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Given the reactants and reagents provided, what is a possible product that can be formed?" }, { "role": "assistant", "content": "[C][O].[Cl].[Na+1].[OH1-1]" } ]
[ { "role": "user", "content": "You are a chemical assistant that understands molecular structures, properties, and applications. Analyze the provided to describe this molecule concisely, including its key structural features, physical/chemical traits, uses, and safety considerations. <image> Describe this molecule." }, { "role": "assistant", "content": "The molecule is a natural product found in Tripterygium wilfordii with data available." } ]
[ { "role": "user", "content": "You are a chemical assistant that understands molecular structures, properties, and applications. Analyze the provided to describe this molecule concisely, including its key structural features, physical/chemical traits, uses, and safety considerations. <image> Describe this molecule." }, { "role": "assistant", "content": "The molecule is a pyrrolidinedicarboxylic acid." } ]
[ { "role": "user", "content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> Given the reactants and reagents provided, what is a possible product that can be formed?" }, { "role": "assistant", "content": "[N][C][C][C][O][C][=C][C][=C][NH1][N][=C][Branch2][Ring1][=Branch1][S][=Branch1][C][=O][=Branch1][C][=O][C][=C][C][=C][C][=C][C][=C][C][=C][Ring1][#Branch2][Ring1][=Branch1][C][Ring2][Ring1][C][=C][Ring2][Ring1][=Branch1]" } ]
[ { "role": "user", "content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Please suggest possible reactants for the given product." }, { "role": "assistant", "content": "[N][#C][C][=C][Branch1][C][F][C][=C][C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][=C][Ring1][#Branch2][N][C][=C][C][=C][C][=N][Ring1][=Branch1]" } ]
[ { "role": "user", "content": "You are a chemical assistant that understands molecular structures, properties, and applications. Analyze the provided to describe this molecule concisely, including its key structural features, physical/chemical traits, uses, and safety considerations. <image> Describe this molecule." }, { "role": "assistant", "content": "The molecule is a carbon atom." } ]
[ { "role": "user", "content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> Given the reactants and reagents provided, what is a possible product that can be formed?" }, { "role": "assistant", "content": "[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][=C][C][=C][Branch1][C][O][C][=C][Ring1][#Branch1]" } ]
[ { "role": "user", "content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Given the reactants and reagents provided, what is a possible product that can be formed?" }, { "role": "assistant", "content": "[C][C][C][C][C][C].[C][C][O][C][Branch1][C][C][=O]" } ]
[ { "role": "user", "content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Given the reactants and reagents provided, what is a possible product that can be formed?" }, { "role": "assistant", "content": "[C][O].[Pd]" } ]
[ { "role": "user", "content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> What is the SMILES formula of this molecule?" }, { "role": "assistant", "content": "The SMILES formula of this molecule is: CC1=CC=C(C=C1)S(=O)(=O)NC2=CC=CC=N2" } ]
[ { "role": "user", "content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> What is the SMILES formula of this molecule?" }, { "role": "assistant", "content": "The SMILES formula of this molecule is: CNC(=O)OC1CCCC(C1)N(CC2=CC=CC=C2)CC3=CC=CC=C3" } ]
[ { "role": "user", "content": "You are a chemical assistant that analyzes molecular structures and provides precise calculations for HOMO-LUMO gap energy. <image> I need to know the HOMO-LUMO gap energy of this molecule, could you please provide it?" }, { "role": "assistant", "content": "-0.2164" } ]
[ { "role": "user", "content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Please suggest possible reactants for the given product." }, { "role": "assistant", "content": "[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][N][C][C][Ring1][=Branch1].[C][C][=C][C][Branch1][Ring1][C][#N][=C][C][=C][Ring1][Branch2][Br]" } ]
[ { "role": "user", "content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Given the reactants and reagents provided, what is a possible product that can be formed?" }, { "role": "assistant", "content": "[C][S][Branch1][C][C][=O].[O][=C][Branch1][C][O-1][O-1].[K+1].[K+1]" } ]
[ { "role": "user", "content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> Given the reactants and reagents provided, what is a possible product that can be formed?" }, { "role": "assistant", "content": "[C][C][O][C][=C][C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][=C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][C][=C][Ring1][N][C][=Branch1][C][=O][O]" } ]
[ { "role": "user", "content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> What is the SMILES formula of this molecule?" }, { "role": "assistant", "content": "The SMILES formula of this molecule is: COC(=O)C1=CC2=C(C=CC3=CC=CC=C32)C=C1" } ]
[ { "role": "user", "content": "You are a chemical assistant that understands molecular structures, properties, and applications. Analyze the provided to describe this molecule concisely, including its key structural features, physical/chemical traits, uses, and safety considerations. <image> Describe this molecule." }, { "role": "assistant", "content": "The molecule is a carbohydrate acid derivative." } ]
[ { "role": "user", "content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Please suggest possible reactants for the given product." }, { "role": "assistant", "content": "[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][C][Branch1][C][O][C][C][Ring1][#Branch1].[Cl][C][=C][N][=C][C][Branch1][C][Cl][=N][Ring1][#Branch1]" } ]
[ { "role": "user", "content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> Given the reactants and reagents provided, what is a possible product that can be formed?" }, { "role": "assistant", "content": "[C][C][C][C][C][C][C][=C][C][=C][N][=C][Branch1][N][C][=C][C][=C][Branch1][C][O][C][=C][Ring1][#Branch1][S][C][Ring1][N][=C][Ring1][S]" } ]
[ { "role": "user", "content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> Given the reactants and reagents provided, what is a possible product that can be formed?" }, { "role": "assistant", "content": "[C][C][Branch1][C][C][Branch1][C][C][C][C][=C][Branch2][Ring1][C][N][C][=Branch1][C][=O][N][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1][N][Branch2][Ring1][C][C][=C][C][=C][C][Branch1][Branch2][C][C][C][=Branch1][C][=O][O][=C][Ring1][O][N][=Ring2][Ring1][O]" } ]
[ { "role": "user", "content": "You are a chemical assistant that analyzes molecular structures and provides precise calculations for HOMO-LUMO gap energy. <image> I need to know the HOMO-LUMO gap energy of this molecule, could you please provide it?" }, { "role": "assistant", "content": "-0.031" } ]
[ { "role": "user", "content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> Given the reactants and reagents provided, what is a possible product that can be formed?" }, { "role": "assistant", "content": "[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][N][Branch1][P][C][C][C][O][C][=C][C][=C][Branch1][Ring1][C][=O][C][=C][Ring1][Branch2][C][C][Ring2][Ring1][C]" } ]
[ { "role": "user", "content": "You are a chemical assistant that analyzes molecular structures and provides precise calculations for HOMO-LUMO gap energy. <image> I need to know the HOMO-LUMO gap energy of this molecule, could you please provide it?" }, { "role": "assistant", "content": "0.034" } ]
[ { "role": "user", "content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Given the reactants and reagents provided, what is a possible product that can be formed?" }, { "role": "assistant", "content": "[C][C][O][C][Branch1][C][C][=O].[C][N][Branch1][C][C][C][=O]" } ]
[ { "role": "user", "content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Please suggest possible reactants for the given product." }, { "role": "assistant", "content": "[C][C][Branch1][C][C][Branch1][C][C][Si][Branch1][C][C][Branch1][C][C][O][C][C@@H1][C][C@@H1][Branch1][C][O][C][C@@H1][Ring1][=Branch1][O][Si][Branch1][C][C][Branch1][C][C][C][Branch1][C][C][Branch1][C][C][C].[N][C][=N][C][=C][C][Branch1][C][Cl][=C][Ring1][#Branch1][N+1][=Branch1][C][=O][O-1]" } ]
[ { "role": "user", "content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Please suggest possible reactants for the given product." }, { "role": "assistant", "content": "[N][C][=C][Branch1][C][F][C][=C][C][=C][Ring1][#Branch1][O][C][C][C][Ring1][=Branch1].[O][=C][C][C][C][=Branch1][C][=O][N][Ring1][=Branch1][Cl]" } ]
[ { "role": "user", "content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Given the reactants and reagents provided, what is a possible product that can be formed?" }, { "role": "assistant", "content": "[C][C][=Branch1][C][=O][O][BH1-1][Branch1][#Branch1][O][C][Branch1][C][C][=O][O][C][Branch1][C][C][=O].[Cl][C][Cl].[Na+1]" } ]
[ { "role": "user", "content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> What is the SMILES formula of this molecule?" }, { "role": "assistant", "content": "The SMILES formula of this molecule is: CC1=CC=C(O1)SC" } ]
[ { "role": "user", "content": "You are a chemical assistant that analyzes molecular structures and provides precise calculations for HOMO-LUMO gap energy. <image> I need to know the HOMO-LUMO gap energy of this molecule, could you please provide it?" }, { "role": "assistant", "content": "0.0184" } ]
[ { "role": "user", "content": "You are a chemical assistant that understands molecular structures, properties, and applications. Analyze the provided to describe this molecule concisely, including its key structural features, physical/chemical traits, uses, and safety considerations. <image> Describe this molecule." }, { "role": "assistant", "content": "The molecule is a cyclopropanecarboxylate ester. It is an enantiomer of a (1S)-cis-(alphaR)-cyfluthrin." } ]
[ { "role": "user", "content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Given the reactants and reagents provided, what is a possible product that can be formed?" }, { "role": "assistant", "content": "[C][C][O].[Na+1].[OH1-1]" } ]
[ { "role": "user", "content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Please suggest possible reactants for the given product." }, { "role": "assistant", "content": "[C][C][O][C][=Branch1][C][=O][C][Branch2][Ring1][Ring2][N][C][=Branch1][C][=O][C][=C][C][=C][C][=C][Ring1][=Branch1][C][C][C][C][Ring1][=Branch1][C][C][=C][N][=C][Branch1][C][C][C][=C][Ring1][#Branch1][C][Ring2][Ring1][#Branch1]" } ]
[ { "role": "user", "content": "You are a chemical assistant that analyzes molecular structures and provides precise calculations for HOMO-LUMO gap energy. <image> I need to know the HOMO-LUMO gap energy of this molecule, could you please provide it?" }, { "role": "assistant", "content": "0.1673" } ]
[ { "role": "user", "content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> Given the reactants and reagents provided, what is a possible product that can be formed?" }, { "role": "assistant", "content": "[O][=C][Branch1][C][O][C][=C][C][=C][Branch2][Ring1][Ring1][N][C][=C][C][=N][C][=C][C][Branch1][C][Cl][=C][C][=C][Ring1][O][Ring1][#Branch1][C][=C][Ring2][Ring1][C]" } ]
[ { "role": "user", "content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Given the reactants and reagents provided, what is a possible product that can be formed?" }, { "role": "assistant", "content": "[C][S][Branch1][C][C][=O]" } ]
[ { "role": "user", "content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> What is the SMILES formula of this molecule?" }, { "role": "assistant", "content": "The SMILES formula of this molecule is: COC1=C(C(=CC=C1)OC)[N+](=O)[O-]" } ]
[ { "role": "user", "content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Please suggest possible reactants for the given product." }, { "role": "assistant", "content": "[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][O][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C].[C][C][Branch1][C][C][Branch1][C][N][C][=C][C][=C][Branch1][C][Br][C][=N][Ring1][#Branch1]" } ]
[ { "role": "user", "content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Please suggest possible reactants for the given product." }, { "role": "assistant", "content": "[C][N][Branch1][C][C][C][=Branch1][C][=O][C][Cl].[C][C@H1][Branch1][#C][N][C][=N][C][=N][C][NH1][C][=N][C][Ring1][=Branch2][=Ring1][Branch1][C][=N][C][=C][C][=C][C][=C][Ring1][=Branch1][N][Ring1][=Branch2][C@@H1][C][C][C][N][C][Ring1][=Branch1]" } ]
[ { "role": "user", "content": "You are a chemical assistant that analyzes molecular structures and provides precise calculations for HOMO-LUMO gap energy. <image> I need to know the HOMO-LUMO gap energy of this molecule, could you please provide it?" }, { "role": "assistant", "content": "0.298" } ]
[ { "role": "user", "content": "You are a chemical assistant that understands molecular structures, properties, and applications. Analyze the provided to describe this molecule concisely, including its key structural features, physical/chemical traits, uses, and safety considerations. <image> Describe this molecule." }, { "role": "assistant", "content": "The molecule is a phosphide of indium. It is a semiconductor used in high-power and high-frequency electronics because of its superior electron velocity with respect to the more common semiconductors silicon and gallium arsenide. It also has a direct bandgap, making it useful for optoelectronics devices like laser diodes. Metal phosphides are hydrolysed to phosphine upon contact with water or stomach acid. Phosphine is a colorless, flammable, explosive, and toxic gas. (L980, L986)" } ]
[ { "role": "user", "content": "You are a chemical assistant that analyzes molecular structures and provides precise calculations for HOMO-LUMO gap energy. <image> I need to know the HOMO-LUMO gap energy of this molecule, could you please provide it?" }, { "role": "assistant", "content": "-0.0152" } ]
[ { "role": "user", "content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Please suggest possible reactants for the given product." }, { "role": "assistant", "content": "[C][C][C][N][C][Ring1][Branch1].[F][C][=C][C][=C][C][Branch2][Ring1][C][N][C][=C][C][Branch1][C][Cl][=N][N][C][=C][N][=C][Ring1][#Branch2][Ring1][Branch1][=N][Ring1][P]" } ]
[ { "role": "user", "content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Please suggest possible reactants for the given product." }, { "role": "assistant", "content": "[C][C][C][C][O][C][=Branch1][C][=O][C][N][=C][Branch2][Ring1][C][N][C][C][C@H1][Branch1][C][N][C@H1][Branch1][Branch1][O][C][C][C][C][Ring1][O][O][C][=Ring1][S][C].[C][C][C][NH1][C][Branch1][=Branch1][C][=Branch1][C][=O][O][=N][C][=Ring1][Branch2][Cl]" } ]
[ { "role": "user", "content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> Given the reactants and reagents provided, what is a possible product that can be formed?" }, { "role": "assistant", "content": "[C][O][C][=C][C][=C][Branch1][=C][O][C][=C][C][=C][Branch1][C][Br][C][=C][Ring1][#Branch1][F][N][=C][N][=C][Ring1][#C][C][=C][Ring2][Ring1][Ring1][O][C][C][C][N]" } ]
[ { "role": "user", "content": "You are a chemical assistant that understands molecular structures, properties, and applications. Analyze the provided to describe this molecule concisely, including its key structural features, physical/chemical traits, uses, and safety considerations. <image> Describe this molecule." }, { "role": "assistant", "content": "The molecule is a natural product found in Piper nigrum with data available." } ]
[ { "role": "user", "content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Please suggest possible reactants for the given product." }, { "role": "assistant", "content": "[N][#C][C][=C][C][=N][C][Branch2][Ring1][Ring1][C][=C][C][=C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][C][=C][Ring1][#Branch2][=C][Ring1][S]" } ]
[ { "role": "user", "content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Given the reactants and reagents provided, what is a possible product that can be formed?" }, { "role": "assistant", "content": "[C][C][O].[O].[Na+1].[OH1-1]" } ]
[ { "role": "user", "content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> What is the SMILES formula of this molecule?" }, { "role": "assistant", "content": "The SMILES formula of this molecule is: CCCCCCCCCCCCCCCCCC(=O)NCCNCCNCCNCCN.CC(=O)O" } ]
[ { "role": "user", "content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Please suggest possible reactants for the given product." }, { "role": "assistant", "content": "[C][C][C][C][C][O][C][=N][C][Branch1][C][N][=C][N][=C][N][Branch1][=Branch2][C][C][=C][C][C][C][Ring1][=Branch1][C][Ring1][O][=N][Ring1][S]" } ]
[ { "role": "user", "content": "You are a chemical assistant that understands molecular structures, properties, and applications. Analyze the provided to describe this molecule concisely, including its key structural features, physical/chemical traits, uses, and safety considerations. <image> Describe this molecule." }, { "role": "assistant", "content": "The molecule is a natural product found in Laurencia with data available." } ]
[ { "role": "user", "content": "You are a chemical assistant that understands molecular structures, properties, and applications. Analyze the provided to describe this molecule concisely, including its key structural features, physical/chemical traits, uses, and safety considerations. <image> Describe this molecule." }, { "role": "assistant", "content": "The molecule is a natural product found in Withania somnifera with data available." } ]
[ { "role": "user", "content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Please suggest possible reactants for the given product." }, { "role": "assistant", "content": "[C][O][C][=Branch1][C][=O][C][N][C][=Branch1][C][=O][C][=C][C][=C][C][=Branch1][Ring2][=C][Ring1][=Branch1][C][=C][Branch2][Ring2][Branch2][C][Branch2][Ring1][#Branch1][C][=Branch1][C][=O][C][Branch1][Ring1][C][#N][C][=Branch1][C][=O][N][C][=C][C][=C][C][=C][Ring1][=Branch1][=N][N][Ring2][Ring1][Ring1][C][=C][C][=C][C][=C][Ring1][=Branch1][C][Ring2][Ring1][=N]" } ]
[ { "role": "user", "content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Please suggest possible reactants for the given product." }, { "role": "assistant", "content": "[C][O][C][=C][C][=C][C][=N][C][=C][Branch1][C][C][C][=C][Ring1][O][Ring1][#Branch1]" } ]
[ { "role": "user", "content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> Given the reactants and reagents provided, what is a possible product that can be formed?" }, { "role": "assistant", "content": "[I][C][C][C][C][C][Branch1][#Branch2][O][C][C][C][C][C][O][Ring1][=Branch1][C][Ring1][N]" } ]
[ { "role": "user", "content": "You are a chemical assistant that analyzes molecular structures and provides precise calculations for HOMO-LUMO gap energy. <image> I need to know the HOMO-LUMO gap energy of this molecule, could you please provide it?" }, { "role": "assistant", "content": "-0.2434" } ]
[ { "role": "user", "content": "You are a chemical assistant that analyzes molecular structures and provides precise calculations for HOMO-LUMO gap energy. <image> I need to know the HOMO-LUMO gap energy of this molecule, could you please provide it?" }, { "role": "assistant", "content": "-0.0107" } ]
[ { "role": "user", "content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> What is the SMILES formula of this molecule?" }, { "role": "assistant", "content": "The SMILES formula of this molecule is: CC(=O)C1=C2N(CCN2C(=O)C=C1C(=O)OC)C" } ]
[ { "role": "user", "content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Given the reactants and reagents provided, what is a possible product that can be formed?" }, { "role": "assistant", "content": "[C][O].[Na+1].[OH1-1]" } ]
[ { "role": "user", "content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> What is the SMILES formula of this molecule?" }, { "role": "assistant", "content": "The SMILES formula of this molecule is: CC(C)NCC(COC1=CC=CC2=NC(=O)N=C21)O" } ]
[ { "role": "user", "content": "You are a chemical assistant that understands molecular structures, properties, and applications. Analyze the provided to describe this molecule concisely, including its key structural features, physical/chemical traits, uses, and safety considerations. <image> Describe this molecule." }, { "role": "assistant", "content": "The molecule is a terpene lactone." } ]
[ { "role": "user", "content": "You are a chemical assistant that analyzes molecular structures and provides precise calculations for HOMO-LUMO gap energy. <image> I need to know the HOMO-LUMO gap energy of this molecule, could you please provide it?" }, { "role": "assistant", "content": "-0.2804" } ]
[ { "role": "user", "content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> Given the reactants and reagents provided, what is a possible product that can be formed?" }, { "role": "assistant", "content": "[C][C][C][N][Branch1][Ring2][C][C][C][C][C][O][C][C][N]" } ]
[ { "role": "user", "content": "You are a chemical assistant that analyzes molecular structures and provides precise calculations for HOMO-LUMO gap energy. <image> I need to know the HOMO-LUMO gap energy of this molecule, could you please provide it?" }, { "role": "assistant", "content": "-0.2258" } ]
[ { "role": "user", "content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> Given the reactants and reagents provided, what is a possible product that can be formed?" }, { "role": "assistant", "content": "[C][C][Branch1][C][C][O][C][=Branch1][C][=O][C][O][C][C][N][=C][C][=C][C][=C][N][Ring1][=Branch1][C][=Ring1][=Branch2][C][#C][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1]" } ]
[ { "role": "user", "content": "You are a chemical assistant that analyzes molecular structures and provides precise calculations for HOMO-LUMO gap energy. <image> I need to know the HOMO-LUMO gap energy of this molecule, could you please provide it?" }, { "role": "assistant", "content": "-0.2545" } ]
[ { "role": "user", "content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> What is the SMILES formula of this molecule?" }, { "role": "assistant", "content": "The SMILES formula of this molecule is: C1=CC=C(C=C1)C2(C3=CC=CC=C3C(=O)N2C4=CC=NC=C4)O" } ]
[ { "role": "user", "content": "You are a chemical assistant that analyzes molecular structures and provides precise calculations for HOMO-LUMO gap energy. <image> I need to know the HOMO-LUMO gap energy of this molecule, could you please provide it?" }, { "role": "assistant", "content": "-0.2342" } ]
[ { "role": "user", "content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Please suggest possible reactants for the given product." }, { "role": "assistant", "content": "[Br][C][C][C][C][Ring1][Ring1].[O][C][=C][C][=C][Branch1][C][Br][C][=C][Ring1][#Branch1][I]" } ]
[ { "role": "user", "content": "You are a chemical assistant that understands molecular structures, properties, and applications. Analyze the provided to describe this molecule concisely, including its key structural features, physical/chemical traits, uses, and safety considerations. <image> Describe this molecule." }, { "role": "assistant", "content": "The molecule is a guanidine derivative consisting of butane having guanidino groups at the 1- and 4-positions. It is a conjugate base of a 1,4-diguanidiniumylbutane. It derives from a hydride of a butane." } ]
[ { "role": "user", "content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Please suggest possible reactants for the given product." }, { "role": "assistant", "content": "[Cl][C][=N][C][=C][C][=C][C][=C][Ring1][=Branch1][N][=C][Ring1][#Branch2][N][C][C][N][C][C][Ring1][=Branch1].[O][C][C][C][C][C][=C][C][=C][C][=C][Ring1][=Branch1][O][Ring1][#Branch2]" } ]
[ { "role": "user", "content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> Given the reactants and reagents provided, what is a possible product that can be formed?" }, { "role": "assistant", "content": "[C][O][C][=Branch1][C][=O][C@H1][Branch1][Branch1][C][C][S][C][N][C][=Branch1][C][=O][C][=C][C][Branch2][Ring1][#Branch1][O][C][Branch1][N][C][N][C][=N][C][Branch1][C][C][=C][Ring1][=Branch1][C][=N][C][=C][S][Ring1][Branch1][=C][C][=C][Ring2][Ring1][Ring2][C][C][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1]" } ]