datasetId
large_stringlengths 6
116
| author
large_stringlengths 2
42
| last_modified
large_stringdate 2021-04-29 15:34:29
2025-06-25 02:40:10
| downloads
int64 0
3.97M
| likes
int64 0
7.74k
| tags
large listlengths 1
7.92k
| task_categories
large listlengths 0
48
| createdAt
large_stringdate 2022-03-02 23:29:22
2025-06-25 00:32:52
| trending_score
float64 0
64
| card
large_stringlengths 31
1.01M
|
|---|---|---|---|---|---|---|---|---|---|
Shehab01/rag_rndops_dataset_50 | Shehab01 | 2025-03-28T02:03:01Z | 17 | 0 | [
"size_categories:n<1K",
"format:parquet",
"modality:text",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"region:us"
] | [] | 2025-03-28T02:02:59Z | 0 | ---
dataset_info:
features:
- name: question
dtype: string
- name: answer
dtype: string
- name: type
dtype: string
- name: difficulty
dtype: string
- name: keywords
sequence: string
- name: source_file
dtype: string
splits:
- name: test
num_bytes: 32199
num_examples: 50
download_size: 18458
dataset_size: 32199
configs:
- config_name: default
data_files:
- split: test
path: data/test-*
---
|
Disclosures-SSRC/AI-Safety_Reliability_Reseach | Disclosures-SSRC | 2025-05-06T02:04:11Z | 4 | 0 | [
"task_categories:other",
"license:cc0-1.0",
"size_categories:1K<n<10K",
"format:csv",
"modality:tabular",
"modality:text",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"arxiv:2505.00174",
"region:us"
] | [
"other"
] | 2025-05-03T03:55:15Z | 0 | ---
license: cc0-1.0
task_categories:
- other
---
[Real-World Gaps in AI Governance Research](https://huggingface.co/papers/2505.00174)
Github repository: https://github.com/ssrc-ai-disclosures/ai-governance-research |
dgambettavuw/D_gen1_run1_llama2-7b_xlsum_doc1000_real96_synt32_vuw | dgambettavuw | 2024-12-23T15:48:52Z | 52 | 0 | [
"size_categories:1K<n<10K",
"format:parquet",
"modality:text",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"region:us"
] | [] | 2024-12-23T15:48:48Z | 0 | ---
dataset_info:
features:
- name: id
dtype: int64
- name: doc
dtype: string
splits:
- name: train
num_bytes: 694939
num_examples: 1000
download_size: 462733
dataset_size: 694939
configs:
- config_name: default
data_files:
- split: train
path: data/train-*
---
|
kaushalgawri/emotion_dataset_with_tags_and_descriptions_with_emotions_v3 | kaushalgawri | 2024-10-18T09:39:57Z | 14 | 0 | [
"size_categories:1K<n<10K",
"format:parquet",
"modality:tabular",
"modality:text",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"region:us"
] | [] | 2024-10-18T09:39:53Z | 0 | ---
dataset_info:
features:
- name: file_name
dtype: string
- name: speaker_id
dtype: string
- name: gender
dtype: string
- name: id
dtype: string
- name: style
dtype: string
- name: filepath
dtype: string
- name: text
dtype: string
- name: utterance_pitch_mean
dtype: float32
- name: utterance_pitch_std
dtype: float32
- name: snr
dtype: float64
- name: c50
dtype: float64
- name: speaking_rate
dtype: string
- name: phonemes
dtype: string
- name: stoi
dtype: float64
- name: si-sdr
dtype: float64
- name: pesq
dtype: float64
- name: pitch
dtype: string
- name: noise
dtype: string
- name: reverberation
dtype: string
- name: speech_monotony
dtype: string
- name: sdr_noise
dtype: string
- name: pesq_speech_quality
dtype: string
- name: text_description
dtype: string
- name: transcription_normalized
dtype: string
splits:
- name: train
num_bytes: 3986978
num_examples: 5962
- name: test
num_bytes: 1338348
num_examples: 2000
download_size: 1209401
dataset_size: 5325326
configs:
- config_name: default
data_files:
- split: train
path: data/train-*
- split: test
path: data/test-*
---
|
jhyun0414/practice_5 | jhyun0414 | 2024-10-23T12:24:18Z | 20 | 0 | [
"size_categories:1K<n<10K",
"format:parquet",
"modality:text",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"region:us"
] | [] | 2024-10-23T12:24:06Z | 0 | ---
dataset_info:
features:
- name: instruction
dtype: string
- name: output
dtype: string
- name: input
dtype: string
splits:
- name: train
num_bytes: 1532927
num_examples: 1398
download_size: 767236
dataset_size: 1532927
configs:
- config_name: default
data_files:
- split: train
path: data/train-*
---
|
Wenboz/ultrafeedback_rationale_Qwen2.5-14B-Instruct | Wenboz | 2025-02-17T03:14:06Z | 17 | 0 | [
"size_categories:n<1K",
"format:parquet",
"modality:tabular",
"modality:text",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"region:us"
] | [] | 2025-02-17T02:32:40Z | 0 | ---
dataset_info:
features:
- name: prompt
dtype: string
- name: prompt_id
dtype: string
- name: chosen
list:
- name: content
dtype: string
- name: role
dtype: string
- name: rejected
list:
- name: content
dtype: string
- name: role
dtype: string
- name: messages
list:
- name: content
dtype: string
- name: role
dtype: string
- name: score_chosen
dtype: float64
- name: score_rejected
dtype: float64
- name: chosen_aug
dtype: string
- name: rejected_aug
dtype: string
- name: chosen_rationale
sequence: string
- name: rejected_rationale
sequence: string
splits:
- name: train
num_bytes: 177221
num_examples: 8
download_size: 124425
dataset_size: 177221
configs:
- config_name: default
data_files:
- split: train
path: data/train-*
---
|
yumengzh/4entities_90d_novel_sentences_2021-01-03_2025-05-04 | yumengzh | 2025-05-08T16:25:50Z | 0 | 0 | [
"size_categories:1K<n<10K",
"format:parquet",
"modality:text",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"region:us"
] | [] | 2025-05-08T16:25:47Z | 0 | ---
dataset_info:
features:
- name: RP_DOCUMENT_ID
dtype: string
- name: TIMESTAMP_UTC
dtype: timestamp[ns]
- name: BLOCK_TEXT
dtype: string
- name: TITLE
dtype: string
- name: URL
dtype: string
- name: RP_ENTITY_ID
dtype: string
- name: ENTITY_NAME
dtype: string
- name: ENTITY_RELEVANCE
dtype: float64
splits:
- name: train
num_bytes: 3301841
num_examples: 3168
download_size: 1225263
dataset_size: 3301841
configs:
- config_name: default
data_files:
- split: train
path: data/train-*
---
|
abhi26/LITH-HT2 | abhi26 | 2025-02-21T22:45:02Z | 17 | 0 | [
"size_categories:1K<n<10K",
"format:parquet",
"modality:image",
"modality:text",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"region:us"
] | [] | 2025-02-13T07:55:10Z | 0 | ---
dataset_info:
features:
- name: image
dtype: image
- name: text
dtype: string
splits:
- name: train
num_bytes: 5891341.607
num_examples: 2739
- name: train_781
num_bytes: 49614358.0
num_examples: 781
download_size: 105204203
dataset_size: 55505699.607
configs:
- config_name: default
data_files:
- split: train
path: data/train-*
- split: train_781
path: data/train_781-*
---
|
qingy2024/NuminaMath-CoT-Verified-678k | qingy2024 | 2025-02-15T20:35:51Z | 39 | 0 | [
"language:en",
"size_categories:100K<n<1M",
"format:parquet",
"modality:text",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"region:us"
] | [] | 2025-02-08T23:05:25Z | 0 | ---
language:
- en
dataset_info:
features:
- name: question
dtype: string
- name: answer
dtype: string
splits:
- name: train
num_bytes: 173601656
num_examples: 678759
download_size: 102679773
dataset_size: 173601656
configs:
- config_name: default
data_files:
- split: train
path: data/train-*
---
|
samihormi/llama3.1_8b_instruct_MU_RedPajama-Data-1T_reservoir_eng_tokenized_random | samihormi | 2025-03-24T02:51:38Z | 7 | 0 | [
"size_categories:10K<n<100K",
"format:parquet",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"region:us"
] | [] | 2025-03-22T10:29:03Z | 0 | ---
dataset_info:
- config_name: arxiv
features:
- name: input_ids
sequence: int32
- name: attention_mask
sequence: int8
- name: labels
sequence: int64
splits:
- name: forget
num_bytes: 255013064
num_examples: 9574
- name: retain
num_bytes: 270009132
num_examples: 10137
download_size: 126563226
dataset_size: 525022196
- config_name: c4
features:
- name: input_ids
sequence: int32
- name: attention_mask
sequence: int8
- name: labels
sequence: int64
splits:
- name: forget
num_bytes: 878988
num_examples: 33
- name: retain
num_bytes: 27914528
num_examples: 1048
download_size: 2160585
dataset_size: 28793516
- config_name: stackexchange
features:
- name: input_ids
sequence: int32
- name: attention_mask
sequence: int8
- name: labels
sequence: int64
splits:
- name: forget
num_bytes: 27435080
num_examples: 1030
- name: retain
num_bytes: 27035540
num_examples: 1015
download_size: 3822545
dataset_size: 54470620
- config_name: wikipedia
features:
- name: input_ids
sequence: int32
- name: attention_mask
sequence: int8
- name: labels
sequence: int64
splits:
- name: forget
num_bytes: 80094452
num_examples: 3007
- name: retain
num_bytes: 73062548
num_examples: 2743
download_size: 35801044
dataset_size: 153157000
configs:
- config_name: arxiv
data_files:
- split: forget
path: arxiv/forget-*
- split: retain
path: arxiv/retain-*
- config_name: c4
data_files:
- split: forget
path: c4/forget-*
- split: retain
path: c4/retain-*
- config_name: stackexchange
data_files:
- split: forget
path: stackexchange/forget-*
- split: retain
path: stackexchange/retain-*
- config_name: wikipedia
data_files:
- split: forget
path: wikipedia/forget-*
- split: retain
path: wikipedia/retain-*
---
|
james-1111/x_dataset_0305158 | james-1111 | 2025-06-24T11:58:09Z | 1,206 | 0 | [
"task_categories:text-classification",
"task_categories:token-classification",
"task_categories:question-answering",
"task_categories:summarization",
"task_categories:text-generation",
"task_ids:sentiment-analysis",
"task_ids:topic-classification",
"task_ids:named-entity-recognition",
"task_ids:language-modeling",
"task_ids:text-scoring",
"task_ids:multi-class-classification",
"task_ids:multi-label-classification",
"task_ids:extractive-qa",
"task_ids:news-articles-summarization",
"multilinguality:multilingual",
"source_datasets:original",
"license:mit",
"size_categories:10M<n<100M",
"format:parquet",
"modality:text",
"library:datasets",
"library:dask",
"library:mlcroissant",
"library:polars",
"region:us"
] | [
"text-classification",
"token-classification",
"question-answering",
"summarization",
"text-generation"
] | 2025-01-25T07:10:23Z | 0 | ---
license: mit
multilinguality:
- multilingual
source_datasets:
- original
task_categories:
- text-classification
- token-classification
- question-answering
- summarization
- text-generation
task_ids:
- sentiment-analysis
- topic-classification
- named-entity-recognition
- language-modeling
- text-scoring
- multi-class-classification
- multi-label-classification
- extractive-qa
- news-articles-summarization
---
# Bittensor Subnet 13 X (Twitter) Dataset
<center>
<img src="https://huggingface.co/datasets/macrocosm-os/images/resolve/main/bittensor.png" alt="Data-universe: The finest collection of social media data the web has to offer">
</center>
<center>
<img src="https://huggingface.co/datasets/macrocosm-os/images/resolve/main/macrocosmos-black.png" alt="Data-universe: The finest collection of social media data the web has to offer">
</center>
## Dataset Description
- **Repository:** james-1111/x_dataset_0305158
- **Subnet:** Bittensor Subnet 13
- **Miner Hotkey:** 5FNEpTedLPFnPqoC8qEB56xnMNd12N4GiUwA1gwW385Rt8n3
### Miner Data Compliance Agreement
In uploading this dataset, I am agreeing to the [Macrocosmos Miner Data Compliance Policy](https://github.com/macrocosm-os/data-universe/blob/add-miner-policy/docs/miner_policy.md).
### Dataset Summary
This dataset is part of the Bittensor Subnet 13 decentralized network, containing preprocessed data from X (formerly Twitter). The data is continuously updated by network miners, providing a real-time stream of tweets for various analytical and machine learning tasks.
For more information about the dataset, please visit the [official repository](https://github.com/macrocosm-os/data-universe).
### Supported Tasks
The versatility of this dataset allows researchers and data scientists to explore various aspects of social media dynamics and develop innovative applications. Users are encouraged to leverage this data creatively for their specific research or business needs.
For example:
- Sentiment Analysis
- Trend Detection
- Content Analysis
- User Behavior Modeling
### Languages
Primary language: Datasets are mostly English, but can be multilingual due to decentralized ways of creation.
## Dataset Structure
### Data Instances
Each instance represents a single tweet with the following fields:
### Data Fields
- `text` (string): The main content of the tweet.
- `label` (string): Sentiment or topic category of the tweet.
- `tweet_hashtags` (list): A list of hashtags used in the tweet. May be empty if no hashtags are present.
- `datetime` (string): The date when the tweet was posted.
- `username_encoded` (string): An encoded version of the username to maintain user privacy.
- `url_encoded` (string): An encoded version of any URLs included in the tweet. May be empty if no URLs are present.
### Data Splits
This dataset is continuously updated and does not have fixed splits. Users should create their own splits based on their requirements and the data's timestamp.
## Dataset Creation
### Source Data
Data is collected from public tweets on X (Twitter), adhering to the platform's terms of service and API usage guidelines.
### Personal and Sensitive Information
All usernames and URLs are encoded to protect user privacy. The dataset does not intentionally include personal or sensitive information.
## Considerations for Using the Data
### Social Impact and Biases
Users should be aware of potential biases inherent in X (Twitter) data, including demographic and content biases. This dataset reflects the content and opinions expressed on X and should not be considered a representative sample of the general population.
### Limitations
- Data quality may vary due to the decentralized nature of collection and preprocessing.
- The dataset may contain noise, spam, or irrelevant content typical of social media platforms.
- Temporal biases may exist due to real-time collection methods.
- The dataset is limited to public tweets and does not include private accounts or direct messages.
- Not all tweets contain hashtags or URLs.
## Additional Information
### Licensing Information
The dataset is released under the MIT license. The use of this dataset is also subject to X Terms of Use.
### Citation Information
If you use this dataset in your research, please cite it as follows:
```
@misc{james-11112025datauniversex_dataset_0305158,
title={The Data Universe Datasets: The finest collection of social media data the web has to offer},
author={james-1111},
year={2025},
url={https://huggingface.co/datasets/james-1111/x_dataset_0305158},
}
```
### Contributions
To report issues or contribute to the dataset, please contact the miner or use the Bittensor Subnet 13 governance mechanisms.
## Dataset Statistics
[This section is automatically updated]
- **Total Instances:** 4521389
- **Date Range:** 2025-01-02T00:00:00Z to 2025-06-14T00:00:00Z
- **Last Updated:** 2025-06-24T11:58:08Z
### Data Distribution
- Tweets with hashtags: 5.76%
- Tweets without hashtags: 94.24%
### Top 10 Hashtags
For full statistics, please refer to the `stats.json` file in the repository.
| Rank | Topic | Total Count | Percentage |
|------|-------|-------------|-------------|
| 1 | NULL | 1112737 | 81.03% |
| 2 | #riyadh | 24082 | 1.75% |
| 3 | #マテムり | 15966 | 1.16% |
| 4 | #pbbcollab6thduoeviction | 11023 | 0.80% |
| 5 | #tiktok | 8638 | 0.63% |
| 6 | #箱根駅伝 | 8147 | 0.59% |
| 7 | #thameposeriesep9 | 7605 | 0.55% |
| 8 | #wtcfinal2025 | 6398 | 0.47% |
| 9 | #first_showcase | 6311 | 0.46% |
| 10 | #ad | 5465 | 0.40% |
## Update History
| Date | New Instances | Total Instances |
|------|---------------|-----------------|
| 2025-01-25T07:07:31Z | 453526 | 453526 |
| 2025-01-25T07:07:59Z | 453526 | 907052 |
| 2025-01-25T07:08:28Z | 453526 | 1360578 |
| 2025-01-25T07:08:56Z | 446896 | 1807474 |
| 2025-01-25T07:09:24Z | 446896 | 2254370 |
| 2025-01-25T07:09:52Z | 446896 | 2701266 |
| 2025-01-25T07:10:21Z | 446896 | 3148162 |
| 2025-01-25T07:10:51Z | 446896 | 3595058 |
| 2025-02-18T03:40:24Z | 467290 | 4062348 |
| 2025-06-24T11:58:08Z | 459041 | 4521389 |
|
himedia/ek-mockup-dataset | himedia | 2025-06-02T01:19:31Z | 5 | 0 | [
"size_categories:10K<n<100K",
"format:parquet",
"modality:tabular",
"modality:text",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"region:us"
] | [] | 2025-06-02T01:17:10Z | 0 | ---
dataset_info:
features:
- name: 신용등급
dtype: string
- name: 매출액
dtype: float64
- name: 영업이익
dtype: float64
- name: 당기순이익
dtype: float64
- name: 총자산
dtype: float64
- name: 총부채
dtype: float64
- name: 자본총계
dtype: float64
- name: 자본금
dtype: float64
- name: 영업활동현금흐름
dtype: float64
- name: 이자발생부채
dtype: float64
splits:
- name: train
num_bytes: 785600
num_examples: 10000
download_size: 848775
dataset_size: 785600
configs:
- config_name: default
data_files:
- split: train
path: data/train-*
---
|
thailevann/Government_services_QA_v2 | thailevann | 2025-05-26T02:03:33Z | 237 | 0 | [
"size_categories:10K<n<100K",
"format:parquet",
"modality:tabular",
"modality:text",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"region:us"
] | [] | 2025-05-22T08:47:13Z | 0 | ---
dataset_info:
features:
- name: instruction
dtype: string
- name: output
dtype: string
- name: label
dtype: int64
- name: relevant
dtype: string
- name: __index_level_0__
dtype: int64
- name: reason
dtype: string
- name: reason_classification
dtype: string
splits:
- name: train
num_bytes: 152355589
num_examples: 85272
download_size: 52134389
dataset_size: 152355589
configs:
- config_name: default
data_files:
- split: train
path: data/train-*
---
|
Shahradmz/ca_constitution_2 | Shahradmz | 2024-11-23T18:03:42Z | 22 | 0 | [
"license:mit",
"size_categories:10K<n<100K",
"format:parquet",
"modality:text",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"region:us"
] | [] | 2024-11-22T16:58:54Z | 0 | ---
license: mit
configs:
- config_name: default
data_files:
- split: train
path: data/train-*
- split: test
path: data/test-*
dataset_info:
features:
- name: prompt
dtype: string
- name: chosen
dtype: string
- name: rejected
dtype: string
- name: __index_level_0__
dtype: int64
splits:
- name: train
num_bytes: 11022628
num_examples: 30465
- name: test
num_bytes: 1939837
num_examples: 5377
download_size: 6938924
dataset_size: 12962465
---
|
captain66/adsconvert | captain66 | 2025-05-13T07:02:30Z | 0 | 0 | [
"license:cc-by-nc-4.0",
"size_categories:n<1K",
"format:parquet",
"modality:image",
"modality:text",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"region:us"
] | [] | 2025-05-13T07:00:00Z | 0 | ---
license: cc-by-nc-4.0
configs:
- config_name: default
data_files:
- split: train
path: data/train-*
dataset_info:
features:
- name: origin_image
dtype: image
- name: edit_prompt
dtype: string
- name: edited_image
dtype: image
splits:
- name: train
num_bytes: 9629137.0
num_examples: 101
download_size: 9623651
dataset_size: 9629137.0
---
|
minchyeom/bot3-tools | minchyeom | 2025-01-20T02:09:39Z | 25 | 0 | [
"size_categories:n<1K",
"format:parquet",
"modality:text",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"region:us"
] | [] | 2025-01-20T02:09:38Z | 0 | ---
dataset_info:
features:
- name: tool
dtype: string
- name: prompt
dtype: string
splits:
- name: train
num_bytes: 27991
num_examples: 400
download_size: 8351
dataset_size: 27991
configs:
- config_name: default
data_files:
- split: train
path: data/train-*
---
|
alymoosa/hrba-tech-sample | alymoosa | 2024-11-27T06:11:38Z | 14 | 0 | [
"language:en",
"size_categories:1K<n<10K",
"region:us",
"human-rights"
] | [] | 2024-11-26T03:09:24Z | 0 | ---
language:
- en
tags:
- human-rights
pretty_name: HRBA@Tech Sample Dataset
size_categories:
- 1K<n<10K
--- |
mc-ai/roleplay-dataset-daisy-v1 | mc-ai | 2025-03-31T16:21:30Z | 19 | 0 | [
"size_categories:n<1K",
"format:parquet",
"modality:text",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"region:us"
] | [] | 2025-03-31T16:20:05Z | 0 | ---
dataset_info:
features:
- name: ai_name
dtype: string
- name: ai_voice
dtype: string
- name: ai_setup
dtype: string
- name: ai_persona
dtype: string
- name: ai_scenario
dtype: string
- name: ai_output
dtype: string
- name: human_scenario
dtype: string
- name: transcripts
list:
- name: content
dtype: string
- name: role
dtype: string
- name: timestamp
dtype: string
splits:
- name: train
num_bytes: 384
num_examples: 2
download_size: 5552
dataset_size: 384
configs:
- config_name: default
data_files:
- split: train
path: data/train-*
---
|
KarsenWahal/newswire-partisanship-frequencies-1899 | KarsenWahal | 2025-02-28T15:40:34Z | 61 | 0 | [
"size_categories:10K<n<100K",
"format:parquet",
"modality:tabular",
"modality:text",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"region:us"
] | [] | 2025-02-28T15:40:29Z | 0 | ---
dataset_info:
features:
- name: article
dtype: string
- name: byline
dtype: string
- name: dates
sequence: string
- name: newspaper_metadata
list:
- name: lccn
dtype: string
- name: newspaper_city
dtype: string
- name: newspaper_state
dtype: string
- name: newspaper_title
dtype: string
- name: antitrust
dtype: int64
- name: civil_rights
dtype: int64
- name: crime
dtype: int64
- name: govt_regulation
dtype: int64
- name: labor_movement
dtype: int64
- name: politics
dtype: int64
- name: protests
dtype: int64
- name: ca_topic
dtype: string
- name: ner_words
sequence: string
- name: ner_labels
sequence: string
- name: wire_city
dtype: string
- name: wire_state
dtype: string
- name: wire_country
dtype: string
- name: wire_coordinates
sequence: float64
- name: wire_location_notes
dtype: string
- name: people_mentioned
list:
- name: person_gender
dtype: string
- name: person_name
dtype: string
- name: person_occupation
dtype: string
- name: wikidata_id
dtype: string
- name: cluster_size
dtype: int64
- name: year
dtype: int64
- name: phrase_counts
struct:
- name: abridg except
dtype: int64
- name: absolut just
dtype: int64
- name: accept adopt
dtype: int64
- name: accomplish leav
dtype: int64
- name: accord respect
dtype: int64
- name: account drought
dtype: int64
- name: account previous
dtype: int64
- name: acquisit island
dtype: int64
- name: act absenc
dtype: int64
- name: act honest
dtype: int64
- name: action line
dtype: int64
- name: addit cadet
dtype: int64
- name: adjutantgener armi
dtype: int64
- name: administr persist
dtype: int64
- name: admir oneil
dtype: int64
- name: affair also
dtype: int64
- name: affair american
dtype: int64
- name: african republ
dtype: int64
- name: african slave
dtype: int64
- name: african slaveri
dtype: int64
- name: aggreg tonnag
dtype: int64
- name: aggreg vote
dtype: int64
- name: ago build
dtype: int64
- name: agre line
dtype: int64
- name: alien one
dtype: int64
- name: allow mileag
dtype: int64
- name: allow perfect
dtype: int64
- name: also petit
dtype: int64
- name: altern proposit
dtype: int64
- name: alway full
dtype: int64
- name: american line
dtype: int64
- name: american peopl
dtype: int64
- name: amount commerc
dtype: int64
- name: annual profit
dtype: int64
- name: annual vacat
dtype: int64
- name: anoth chamber
dtype: int64
- name: antitrust act
dtype: int64
- name: appli territori
dtype: int64
- name: appoint cadet
dtype: int64
- name: appoint compet
dtype: int64
- name: appoint legislatur
dtype: int64
- name: appoint next
dtype: int64
- name: apport repres
dtype: int64
- name: approach campaign
dtype: int64
- name: appropri stream
dtype: int64
- name: approv secretari
dtype: int64
- name: arbitrari rule
dtype: int64
- name: argument counsel
dtype: int64
- name: armi budget
dtype: int64
- name: armi creat
dtype: int64
- name: armi philippin
dtype: int64
- name: armi regist
dtype: int64
- name: armi republ
dtype: int64
- name: armor cruiser
dtype: int64
- name: armor plant
dtype: int64
- name: arrang pair
dtype: int64
- name: articl import
dtype: int64
- name: ascertain upon
dtype: int64
- name: assert determin
dtype: int64
- name: assist engin
dtype: int64
- name: attent claim
dtype: int64
- name: author consolid
dtype: int64
- name: averag net
dtype: int64
- name: averag weight
dtype: int64
- name: baltimor potomac
dtype: int64
- name: banker broker
dtype: int64
- name: basi apportion
dtype: int64
- name: basi calcul
dtype: int64
- name: bay inlet
dtype: int64
- name: becam american
dtype: int64
- name: benefit bounti
dtype: int64
- name: benefit puerto
dtype: int64
- name: benevol assimil
dtype: int64
- name: besid great
dtype: int64
- name: besid pay
dtype: int64
- name: best safest
dtype: int64
- name: beyond direct
dtype: int64
- name: board children
dtype: int64
- name: board construct
dtype: int64
- name: board elect
dtype: int64
- name: bodi soldier
dtype: int64
- name: bounti bill
dtype: int64
- name: bounti export
dtype: int64
- name: bounti jumper
dtype: int64
- name: bounti provid
dtype: int64
- name: bounti upon
dtype: int64
- name: britain propos
dtype: int64
- name: british interest
dtype: int64
- name: build armor
dtype: int64
- name: build boat
dtype: int64
- name: build class
dtype: int64
- name: build navi
dtype: int64
- name: build purpos
dtype: int64
- name: build vessel
dtype: int64
- name: built contract
dtype: int64
- name: built navyyard
dtype: int64
- name: buncomb counti
dtype: int64
- name: bureau equip
dtype: int64
- name: bureau head
dtype: int64
- name: burial expens
dtype: int64
- name: buy state
dtype: int64
- name: calendar favor
dtype: int64
- name: calendar proceed
dtype: int64
- name: came servic
dtype: int64
- name: campaign fund
dtype: int64
- name: canada british
dtype: int64
- name: canal dug
dtype: int64
- name: canal railway
dtype: int64
- name: canvass return
dtype: int64
- name: capabl earn
dtype: int64
- name: cape nome
dtype: int64
- name: capita popul
dtype: int64
- name: captain list
dtype: int64
- name: captain regular
dtype: int64
- name: care insan
dtype: int64
- name: carpetbag govern
dtype: int64
- name: carri war
dtype: int64
- name: cast fortun
dtype: int64
- name: caus depreci
dtype: int64
- name: cede us
dtype: int64
- name: census make
dtype: int64
- name: census offic
dtype: int64
- name: cent bottl
dtype: int64
- name: cent dollar
dtype: int64
- name: cent firstclass
dtype: int64
- name: certain vessel
dtype: int64
- name: certif amount
dtype: int64
- name: certif section
dtype: int64
- name: chamber outsid
dtype: int64
- name: channel carri
dtype: int64
- name: charact whole
dtype: int64
- name: charg favor
dtype: int64
- name: charg hospit
dtype: int64
- name: charg vessel
dtype: int64
- name: cheaper gas
dtype: int64
- name: chicago burlington
dtype: int64
- name: chicago platform
dtype: int64
- name: chief engin
dtype: int64
- name: chief product
dtype: int64
- name: children guardian
dtype: int64
- name: cigar maker
dtype: int64
- name: circul note
dtype: int64
- name: circul secur
dtype: int64
- name: citi belong
dtype: int64
- name: citi chicago
dtype: int64
- name: citi light
dtype: int64
- name: citi nashvill
dtype: int64
- name: citi norfolk
dtype: int64
- name: citizen puerto
dtype: int64
- name: citizen soldieri
dtype: int64
- name: citizen unit
dtype: int64
- name: civil judici
dtype: int64
- name: civil war
dtype: int64
- name: civilian secretari
dtype: int64
- name: claim also
dtype: int64
- name: claim calendar
dtype: int64
- name: claim damag
dtype: int64
- name: claim proposit
dtype: int64
- name: claim state
dtype: int64
- name: claim unless
dtype: int64
- name: classif bill
dtype: int64
- name: claus adopt
dtype: int64
- name: clerk discharg
dtype: int64
- name: close investig
dtype: int64
- name: cloth educ
dtype: int64
- name: coal naval
dtype: int64
- name: coast geodet
dtype: int64
- name: coast survey
dtype: int64
- name: code bill
dtype: int64
- name: code code
dtype: int64
- name: code honor
dtype: int64
- name: code procedur
dtype: int64
- name: coeur dalen
dtype: int64
- name: coin govern
dtype: int64
- name: collect duti
dtype: int64
- name: colleg public
dtype: int64
- name: color men
dtype: int64
- name: color peopl
dtype: int64
- name: color product
dtype: int64
- name: color vote
dtype: int64
- name: color voter
dtype: int64
- name: combin control
dtype: int64
- name: come campaign
dtype: int64
- name: command offic
dtype: int64
- name: commenc build
dtype: int64
- name: commerc citi
dtype: int64
- name: commerc violat
dtype: int64
- name: commerc yet
dtype: int64
- name: commerci advantag
dtype: int64
- name: commerci enterpris
dtype: int64
- name: commerci valu
dtype: int64
- name: commission navig
dtype: int64
- name: compet take
dtype: int64
- name: comprehens plan
dtype: int64
- name: compress air
dtype: int64
- name: conclus irresist
dtype: int64
- name: concur suggest
dtype: int64
- name: confeder armi
dtype: int64
- name: confront proposit
dtype: int64
- name: congress ascertain
dtype: int64
- name: congression life
dtype: int64
- name: connect train
dtype: int64
- name: consid fiveminut
dtype: int64
- name: constitut appli
dtype: int64
- name: constitut appoint
dtype: int64
- name: constitut court
dtype: int64
- name: constitut extend
dtype: int64
- name: constitut follow
dtype: int64
- name: constitut uniform
dtype: int64
- name: construct reservoir
dtype: int64
- name: contest proceed
dtype: int64
- name: contest two
dtype: int64
- name: contigu territori
dtype: int64
- name: contract ship
dtype: int64
- name: contract vessel
dtype: int64
- name: controvert question
dtype: int64
- name: convent frame
dtype: int64
- name: convey made
dtype: int64
- name: cooli labor
dtype: int64
- name: correct conform
dtype: int64
- name: counti board
dtype: int64
- name: counti contain
dtype: int64
- name: counti result
dtype: int64
- name: countri publish
dtype: int64
- name: court admit
dtype: int64
- name: court jurisdict
dtype: int64
- name: credenti hon
dtype: int64
- name: credit said
dtype: int64
- name: crimin recrimin
dtype: int64
- name: cuba cuban
dtype: int64
- name: cuba porto
dtype: int64
- name: cuba puerto
dtype: int64
- name: cuba right
dtype: int64
- name: custom tariff
dtype: int64
- name: cutter servic
dtype: int64
- name: daili toil
dtype: int64
- name: dalla counti
dtype: int64
- name: danger line
dtype: int64
- name: deaf dumb
dtype: int64
- name: debtor properti
dtype: int64
- name: deficit postal
dtype: int64
- name: degrad labor
dtype: int64
- name: deliveri rout
dtype: int64
- name: demand admiss
dtype: int64
- name: demand surrend
dtype: int64
- name: demand use
dtype: int64
- name: deni seat
dtype: int64
- name: depreci rate
dtype: int64
- name: deputi appoint
dtype: int64
- name: deputi clerk
dtype: int64
- name: deriv just
dtype: int64
- name: determin accomplish
dtype: int64
- name: determin candid
dtype: int64
- name: determin contest
dtype: int64
- name: develop wonder
dtype: int64
- name: differ candid
dtype: int64
- name: director census
dtype: int64
- name: director made
dtype: int64
- name: disagr concur
dtype: int64
- name: disappear carriag
dtype: int64
- name: discharg everi
dtype: int64
- name: disciplin militia
dtype: int64
- name: discov mine
dtype: int64
- name: discuss charact
dtype: int64
- name: diseas germ
dtype: int64
- name: disfranchis negro
dtype: int64
- name: disord behavior
dtype: int64
- name: dispos territori
dtype: int64
- name: distinguish friend
dtype: int64
- name: divis issu
dtype: int64
- name: dollar equal
dtype: int64
- name: dollar silver
dtype: int64
- name: dollar subsidiari
dtype: int64
- name: doubt remov
dtype: int64
- name: duti announc
dtype: int64
- name: duti impost
dtype: int64
- name: duti legislatur
dtype: int64
- name: earn bill
dtype: int64
- name: educ given
dtype: int64
- name: educ qualif
dtype: int64
- name: eight half
dtype: int64
- name: either belliger
dtype: int64
- name: elect board
dtype: int64
- name: elect choic
dtype: int64
- name: elect commission
dtype: int64
- name: elect fail
dtype: int64
- name: elect franchis
dtype: int64
- name: elect unit
dtype: int64
- name: elector board
dtype: int64
- name: eleventh congression
dtype: int64
- name: els ever
dtype: int64
- name: empir great
dtype: int64
- name: employe war
dtype: int64
- name: encourag litig
dtype: int64
- name: endeavor impress
dtype: int64
- name: enemi silver
dtype: int64
- name: enforc payment
dtype: int64
- name: enter servic
dtype: int64
- name: enterpris want
dtype: int64
- name: entitl member
dtype: int64
- name: entitl offic
dtype: int64
- name: erect build
dtype: int64
- name: erect state
dtype: int64
- name: eri railroad
dtype: int64
- name: establish gold
dtype: int64
- name: establish lighthous
dtype: int64
- name: establish religion
dtype: int64
- name: everi oblig
dtype: int64
- name: everi silver
dtype: int64
- name: everi trust
dtype: int64
- name: exceed actual
dtype: int64
- name: except chief
dtype: int64
- name: except pacif
dtype: int64
- name: except particip
dtype: int64
- name: exchang coin
dtype: int64
- name: exchang gold
dtype: int64
- name: exchang pair
dtype: int64
- name: excit debat
dtype: int64
- name: execut appoint
dtype: int64
- name: exercis elect
dtype: int64
- name: exercis manner
dtype: int64
- name: exercis must
dtype: int64
- name: exercis offic
dtype: int64
- name: exig servic
dtype: int64
- name: exist five
dtype: int64
- name: exist gold
dtype: int64
- name: exist legislatur
dtype: int64
- name: expand currenc
dtype: int64
- name: expedit mail
dtype: int64
- name: expenditur mainten
dtype: int64
- name: expens aris
dtype: int64
- name: expir present
dtype: int64
- name: export gold
dtype: int64
- name: expressli forbid
dtype: int64
- name: extend report
dtype: int64
- name: extend territori
dtype: int64
- name: extortion charg
dtype: int64
- name: extract messag
dtype: int64
- name: fact court
dtype: int64
- name: factori govern
dtype: int64
- name: fail elect
dtype: int64
- name: fail fill
dtype: int64
- name: failur legislatur
dtype: int64
- name: famili soldier
dtype: int64
- name: familiar cours
dtype: int64
- name: far local
dtype: int64
- name: favor bimetal
dtype: int64
- name: favor servic
dtype: int64
- name: favor silver
dtype: int64
- name: feder armi
dtype: int64
- name: final examin
dtype: int64
- name: find statut
dtype: int64
- name: find verdict
dtype: int64
- name: first precinct
dtype: int64
- name: firstclass offic
dtype: int64
- name: fit discharg
dtype: int64
- name: fix ratio
dtype: int64
- name: fix size
dtype: int64
- name: flag everi
dtype: int64
- name: flag never
dtype: int64
- name: foreign fleet
dtype: int64
- name: foreign one
dtype: int64
- name: foreign ship
dtype: int64
- name: foreign vessel
dtype: int64
- name: form wealth
dtype: int64
- name: forti state
dtype: int64
- name: fortun war
dtype: int64
- name: foundat govern
dtype: int64
- name: four vessel
dtype: int64
- name: four year
dtype: int64
- name: freedom liberti
dtype: int64
- name: freight express
dtype: int64
- name: friend refer
dtype: int64
- name: full enjoy
dtype: int64
- name: full represent
dtype: int64
- name: fundament maxim
dtype: int64
- name: furnish currenc
dtype: int64
- name: furnish soldier
dtype: int64
- name: gas compani
dtype: int64
- name: gaslight compani
dtype: int64
- name: general corbin
dtype: int64
- name: general fund
dtype: int64
- name: general postoffic
dtype: int64
- name: general without
dtype: int64
- name: geodet survey
dtype: int64
- name: geolog survey
dtype: int64
- name: get vessel
dtype: int64
- name: give bounti
dtype: int64
- name: give represent
dtype: int64
- name: glori honor
dtype: int64
- name: goe sea
dtype: int64
- name: gold coin
dtype: int64
- name: gold except
dtype: int64
- name: gold provid
dtype: int64
- name: gold reserv
dtype: int64
- name: gold silver
dtype: int64
- name: gold standard
dtype: int64
- name: got gold
dtype: int64
- name: govern control
dtype: int64
- name: govern deriv
dtype: int64
- name: govern henc
dtype: int64
- name: govern injunct
dtype: int64
- name: govern theunit
dtype: int64
- name: govern yard
dtype: int64
- name: governor right
dtype: int64
- name: graduat annapoli
dtype: int64
- name: graduat corpor
dtype: int64
- name: great britain
dtype: int64
- name: great fight
dtype: int64
- name: great panic
dtype: int64
- name: great scheme
dtype: int64
- name: great transact
dtype: int64
- name: great trust
dtype: int64
- name: greenback redeem
dtype: int64
- name: greenback treasuri
dtype: int64
- name: grew great
dtype: int64
- name: guam philippin
dtype: int64
- name: gun mount
dtype: int64
- name: half rate
dtype: int64
- name: half section
dtype: int64
- name: happen recess
dtype: int64
- name: harbor manila
dtype: int64
- name: harbor order
dtype: int64
- name: harm come
dtype: int64
- name: haul flag
dtype: int64
- name: hawaiian languag
dtype: int64
- name: haypauncefot treati
dtype: int64
- name: health care
dtype: int64
- name: held servic
dtype: int64
- name: heroic struggl
dtype: int64
- name: high tide
dtype: int64
- name: highest pay
dtype: int64
- name: holder oblig
dtype: int64
- name: honest faith
dtype: int64
- name: horizont reduct
dtype: int64
- name: hospit connect
dtype: int64
- name: hour five
dtype: int64
- name: hour labor
dtype: int64
- name: human be
dtype: int64
- name: human christian
dtype: int64
- name: humili spectacl
dtype: int64
- name: hundr nine
dtype: int64
- name: hydrograph survey
dtype: int64
- name: illeg ballot
dtype: int64
- name: imit butter
dtype: int64
- name: immens expenditur
dtype: int64
- name: imperi polici
dtype: int64
- name: imposs secur
dtype: int64
- name: impost duti
dtype: int64
- name: improv mouth
dtype: int64
- name: improv navig
dtype: int64
- name: improv whether
dtype: int64
- name: incid war
dtype: int64
- name: incorpor union
dtype: int64
- name: increas salari
dtype: int64
- name: increas stand
dtype: int64
- name: increas volum
dtype: int64
- name: independ constitut
dtype: int64
- name: independ paper
dtype: int64
- name: independ second
dtype: int64
- name: indian commit
dtype: int64
- name: indirect contempt
dtype: int64
- name: industri combin
dtype: int64
- name: injustic state
dtype: int64
- name: inner circl
dtype: int64
- name: innoc helpless
dtype: int64
- name: inquiri found
dtype: int64
- name: instanc come
dtype: int64
- name: insuper obstacl
dtype: int64
- name: insur compani
dtype: int64
- name: intellig abil
dtype: int64
- name: intent becom
dtype: int64
- name: interest favor
dtype: int64
- name: interest upon
dtype: int64
- name: intern navig
dtype: int64
- name: intern revenu
dtype: int64
- name: internalrevenu offic
dtype: int64
- name: intim acquaint
dtype: int64
- name: investig believ
dtype: int64
- name: invit attent
dtype: int64
- name: involv valid
dtype: int64
- name: irish peopl
dtype: int64
- name: irrig indian
dtype: int64
- name: irrig scheme
dtype: int64
- name: island almost
dtype: int64
- name: island cost
dtype: int64
- name: island except
dtype: int64
- name: island sound
dtype: int64
- name: island without
dtype: int64
- name: issu attach
dtype: int64
- name: issu coin
dtype: int64
- name: issu fals
dtype: int64
- name: issu redempt
dtype: int64
- name: judgment friend
dtype: int64
- name: jurisdict belong
dtype: int64
- name: jurisdict control
dtype: int64
- name: jurisdict justic
dtype: int64
- name: jurisdict whatev
dtype: int64
- name: just pension
dtype: int64
- name: justic men
dtype: int64
- name: kingdom great
dtype: int64
- name: knot hour
dtype: int64
- name: knot speed
dtype: int64
- name: know understood
dtype: int64
- name: knowledg possess
dtype: int64
- name: knowledg question
dtype: int64
- name: knowledg secretari
dtype: int64
- name: labor commission
dtype: int64
- name: landscap architect
dtype: int64
- name: larg balanc
dtype: int64
- name: larg practic
dtype: int64
- name: larg stand
dtype: int64
- name: last forti
dtype: int64
- name: last found
dtype: int64
- name: late civil
dtype: int64
- name: lawyer upon
dtype: int64
- name: learn justic
dtype: int64
- name: leav chicago
dtype: int64
- name: legisl court
dtype: int64
- name: legisl philippin
dtype: int64
- name: legislatur fail
dtype: int64
- name: legislatur governor
dtype: int64
- name: legislatur met
dtype: int64
- name: legislatur opportun
dtype: int64
- name: legislatur order
dtype: int64
- name: legislatur question
dtype: int64
- name: legislatur submit
dtype: int64
- name: legislatur togeth
dtype: int64
- name: less within
dtype: int64
- name: letter distribut
dtype: int64
- name: letter otherwis
dtype: int64
- name: libertylov peopl
dtype: int64
- name: local engin
dtype: int64
- name: local mail
dtype: int64
- name: locat mine
dtype: int64
- name: longer open
dtype: int64
- name: loui state
dtype: int64
- name: lowest best
dtype: int64
- name: made boston
dtype: int64
- name: made fill
dtype: int64
- name: made locat
dtype: int64
- name: mail carri
dtype: int64
- name: mail divis
dtype: int64
- name: mail pay
dtype: int64
- name: maintain author
dtype: int64
- name: maintain pariti
dtype: int64
- name: maintain sovereignti
dtype: int64
- name: maintain tariff
dtype: int64
- name: mainten pariti
dtype: int64
- name: make cigar
dtype: int64
- name: make gold
dtype: int64
- name: make payabl
dtype: int64
- name: mani year
dtype: int64
- name: manifest duti
dtype: int64
- name: measur practic
dtype: int64
- name: men eight
dtype: int64
- name: men republ
dtype: int64
- name: men requir
dtype: int64
- name: merchandis import
dtype: int64
- name: metal time
dtype: int64
- name: might fail
dtype: int64
- name: militari civil
dtype: int64
- name: militari spirit
dtype: int64
- name: million twentyf
dtype: int64
- name: mine claim
dtype: int64
- name: mine upon
dtype: int64
- name: minimum punish
dtype: int64
- name: minimum salari
dtype: int64
- name: modus vivendi
dtype: int64
- name: monetari standard
dtype: int64
- name: mortgag place
dtype: int64
- name: motion colleagu
dtype: int64
- name: motiv influenc
dtype: int64
- name: much perhap
dtype: int64
- name: must degre
dtype: int64
- name: must elect
dtype: int64
- name: muster servic
dtype: int64
- name: name given
dtype: int64
- name: narrow limit
dtype: int64
- name: nation banker
dtype: int64
- name: nativ inhabit
dtype: int64
- name: natur appeal
dtype: int64
- name: natur color
dtype: int64
- name: naval court
dtype: int64
- name: naval depart
dtype: int64
- name: naval establish
dtype: int64
- name: naval offic
dtype: int64
- name: naval programm
dtype: int64
- name: navi depart
dtype: int64
- name: navi head
dtype: int64
- name: navig compani
dtype: int64
- name: near quit
dtype: int64
- name: necess commerc
dtype: int64
- name: necess proprieti
dtype: int64
- name: necess purchas
dtype: int64
- name: necessari enter
dtype: int64
- name: necessari principl
dtype: int64
- name: negro one
dtype: int64
- name: negro question
dtype: int64
- name: negro vote
dtype: int64
- name: never contend
dtype: int64
- name: newli acquir
dtype: int64
- name: news agent
dtype: int64
- name: nicaragua rout
dtype: int64
- name: nine half
dtype: int64
- name: nobodi believ
dtype: int64
- name: note circul
dtype: int64
- name: note treasuri
dtype: int64
- name: number male
dtype: int64
- name: numer strength
dtype: int64
- name: oblig public
dtype: int64
- name: occup public
dtype: int64
- name: occupi four
dtype: int64
- name: occur recess
dtype: int64
- name: ocean lake
dtype: int64
- name: offer premium
dtype: int64
- name: offic instructor
dtype: int64
- name: offic mint
dtype: int64
- name: offic sea
dtype: int64
- name: offici america
dtype: int64
- name: offici return
dtype: int64
- name: oh talk
dtype: int64
- name: old commiss
dtype: int64
- name: old soldier
dtype: int64
- name: omit statement
dtype: int64
- name: onehalf expenditur
dtype: int64
- name: opinion engin
dtype: int64
- name: opinion naval
dtype: int64
- name: opportun elect
dtype: int64
- name: organ failur
dtype: int64
- name: origin suppos
dtype: int64
- name: orphan asylum
dtype: int64
- name: other demand
dtype: int64
- name: output gold
dtype: int64
- name: output mine
dtype: int64
- name: outsid armi
dtype: int64
- name: outsid record
dtype: int64
- name: outstand treasuri
dtype: int64
- name: paid poll
dtype: int64
- name: paid railway
dtype: int64
- name: paidup capit
dtype: int64
- name: pain look
dtype: int64
- name: pair tile
dtype: int64
- name: paper currenc
dtype: int64
- name: pariti valu
dtype: int64
- name: parti alleg
dtype: int64
- name: parti arrest
dtype: int64
- name: parti demand
dtype: int64
- name: particular portion
dtype: int64
- name: pass experiment
dtype: int64
- name: pass valid
dtype: int64
- name: past war
dtype: int64
- name: pay amount
dtype: int64
- name: pay colonel
dtype: int64
- name: pay poll
dtype: int64
- name: pay superintend
dtype: int64
- name: pend contest
dtype: int64
- name: pension also
dtype: int64
- name: pension attorney
dtype: int64
- name: pension depart
dtype: int64
- name: pension desir
dtype: int64
- name: pension increas
dtype: int64
- name: peopl countri
dtype: int64
- name: peopl gold
dtype: int64
- name: peopl legislatur
dtype: int64
- name: peopl philippin
dtype: int64
- name: peopl puerto
dtype: int64
- name: peopl remedi
dtype: int64
- name: peopl remov
dtype: int64
- name: peopl tradit
dtype: int64
- name: period five
dtype: int64
- name: permit locat
dtype: int64
- name: personnel bill
dtype: int64
- name: philippin island
dtype: int64
- name: philippin war
dtype: int64
- name: place obstacl
dtype: int64
- name: place rank
dtype: int64
- name: place registr
dtype: int64
- name: place retir
dtype: int64
- name: place shipment
dtype: int64
- name: plain peopl
dtype: int64
- name: plan mutual
dtype: int64
- name: plate manufactur
dtype: int64
- name: platform just
dtype: int64
- name: pneumat tube
dtype: int64
- name: pneumatictub servic
dtype: int64
- name: polici administr
dtype: int64
- name: polici imperi
dtype: int64
- name: polit duti
dtype: int64
- name: poll tax
dtype: int64
- name: poor ignor
dtype: int64
- name: popul agricultur
dtype: int64
- name: popul negro
dtype: int64
- name: portland harbor
dtype: int64
- name: porto rico
dtype: int64
- name: possess far
dtype: int64
- name: possess mine
dtype: int64
- name: postoffic clerk
dtype: int64
- name: powerless prevent
dtype: int64
- name: present administr
dtype: int64
- name: present census
dtype: int64
- name: present compani
dtype: int64
- name: present legislatur
dtype: int64
- name: present mine
dtype: int64
- name: present sundri
dtype: int64
- name: presid restor
dtype: int64
- name: prevail believ
dtype: int64
- name: principl know
dtype: int64
- name: print bulletin
dtype: int64
- name: privat yard
dtype: int64
- name: privileg given
dtype: int64
- name: privileg immun
dtype: int64
- name: produc prosper
dtype: int64
- name: proof beyond
dtype: int64
- name: proper increas
dtype: int64
- name: properti prevent
dtype: int64
- name: propos erect
dtype: int64
- name: proposit noth
dtype: int64
- name: proposit relat
dtype: int64
- name: proprio vigor
dtype: int64
- name: provid ballot
dtype: int64
- name: provis thing
dtype: int64
- name: public domain
dtype: int64
- name: public servic
dtype: int64
- name: puerto rico
dtype: int64
- name: pure wholesom
dtype: int64
- name: purpos favor
dtype: int64
- name: purpos just
dtype: int64
- name: purpos retir
dtype: int64
- name: qualiti silver
dtype: int64
- name: question pension
dtype: int64
- name: question seat
dtype: int64
- name: railroad compani
dtype: int64
- name: railway postal
dtype: int64
- name: rare seed
dtype: int64
- name: reason faith
dtype: int64
- name: recess legislatur
dtype: int64
- name: recommend chief
dtype: int64
- name: redeem oblig
dtype: int64
- name: reform forc
dtype: int64
- name: refus admiss
dtype: int64
- name: refus elect
dtype: int64
- name: refus privileg
dtype: int64
- name: regard trust
dtype: int64
- name: regiment organ
dtype: int64
- name: registr book
dtype: int64
- name: reject ballot
dtype: int64
- name: relat parti
dtype: int64
- name: render absolut
dtype: int64
- name: render imposs
dtype: int64
- name: repeal war
dtype: int64
- name: report captain
dtype: int64
- name: represent floor
dtype: int64
- name: represent legislatur
dtype: int64
- name: reserv balanc
dtype: int64
- name: reserv fund
dtype: int64
- name: reserv territori
dtype: int64
- name: reservoir irrig
dtype: int64
- name: resist passag
dtype: int64
- name: result armi
dtype: int64
- name: retain offic
dtype: int64
- name: retir amount
dtype: int64
- name: retir circul
dtype: int64
- name: retir greenback
dtype: int64
- name: retir list
dtype: int64
- name: retir made
dtype: int64
- name: return gave
dtype: int64
- name: return regiment
dtype: int64
- name: return true
dtype: int64
- name: revenuecutt offic
dtype: int64
- name: revenuecutt servic
dtype: int64
- name: revolutionari claim
dtype: int64
- name: rican bill
dtype: int64
- name: rico island
dtype: int64
- name: right life
dtype: int64
- name: right trial
dtype: int64
- name: rob mani
dtype: int64
- name: roll compani
dtype: int64
- name: rule regul
dtype: int64
- name: sacr institut
dtype: int64
- name: said board
dtype: int64
- name: said island
dtype: int64
- name: said labor
dtype: int64
- name: said offic
dtype: int64
- name: said territori
dtype: int64
- name: said vacanc
dtype: int64
- name: sake human
dtype: int64
- name: sale butter
dtype: int64
- name: sale oleomargarin
dtype: int64
- name: save union
dtype: int64
- name: sea men
dtype: int64
- name: sea pay
dtype: int64
- name: seat whether
dtype: int64
- name: secondclass mail
dtype: int64
- name: secondclass matter
dtype: int64
- name: secret understand
dtype: int64
- name: secretari interior
dtype: int64
- name: secretari navi
dtype: int64
- name: secretari treasuri
dtype: int64
- name: secretari war
dtype: int64
- name: section charact
dtype: int64
- name: section drawn
dtype: int64
- name: secur consider
dtype: int64
- name: secur prompt
dtype: int64
- name: select elect
dtype: int64
- name: sentiment peopl
dtype: int64
- name: servic expedit
dtype: int64
- name: servic record
dtype: int64
- name: seven thousand
dtype: int64
- name: sever criticis
dtype: int64
- name: sever port
dtype: int64
- name: ship buy
dtype: int64
- name: ship cheapli
dtype: int64
- name: ship compet
dtype: int64
- name: ship equal
dtype: int64
- name: ship island
dtype: int64
- name: ship merchandis
dtype: int64
- name: ship upon
dtype: int64
- name: ship yard
dtype: int64
- name: shipbuild plant
dtype: int64
- name: shock moral
dtype: int64
- name: shore duti
dtype: int64
- name: shown disposit
dtype: int64
- name: sick leav
dtype: int64
- name: silver bullion
dtype: int64
- name: silver dollar
dtype: int64
- name: silver servic
dtype: int64
- name: sinc latter
dtype: int64
- name: sixth street
dtype: int64
- name: slackwat navig
dtype: int64
- name: slightest foundat
dtype: int64
- name: sober second
dtype: int64
- name: sold butter
dtype: int64
- name: soldier philippin
dtype: int64
- name: soldier question
dtype: int64
- name: solv question
dtype: int64
- name: soul great
dtype: int64
- name: sourc prosper
dtype: int64
- name: southern soldier
dtype: int64
- name: southwest quarter
dtype: int64
- name: sovereignti island
dtype: int64
- name: sovereignti jurisdict
dtype: int64
- name: spain cuba
dtype: int64
- name: spain treati
dtype: int64
- name: spanish treati
dtype: int64
- name: spanish war
dtype: int64
- name: spanishamerican war
dtype: int64
- name: special examin
dtype: int64
- name: spokesman administr
dtype: int64
- name: stand armi
dtype: int64
- name: standard oil
dtype: int64
- name: state armi
dtype: int64
- name: state board
dtype: int64
- name: state exclud
dtype: int64
- name: state execut
dtype: int64
- name: state illustr
dtype: int64
- name: state infantri
dtype: int64
- name: state inhabit
dtype: int64
- name: state note
dtype: int64
- name: state represent
dtype: int64
- name: state virtu
dtype: int64
- name: state vs
dtype: int64
- name: statement justic
dtype: int64
- name: stationeri room
dtype: int64
- name: street extens
dtype: int64
- name: street upon
dtype: int64
- name: strike railroad
dtype: int64
- name: strike suit
dtype: int64
- name: struggl peopl
dtype: int64
- name: subject express
dtype: int64
- name: subject went
dtype: int64
- name: submarin boat
dtype: int64
- name: subserv interest
dtype: int64
- name: subsist depart
dtype: int64
- name: sugar tobacco
dtype: int64
- name: sugar trust
dtype: int64
- name: suggest hour
dtype: int64
- name: suggest insert
dtype: int64
- name: suit section
dtype: int64
- name: sum must
dtype: int64
- name: sup ct
dtype: int64
- name: superintend naval
dtype: int64
- name: suppli execut
dtype: int64
- name: suppress fraud
dtype: int64
- name: suppress insurrect
dtype: int64
- name: suppress trust
dtype: int64
- name: swear support
dtype: int64
- name: sympathi struggl
dtype: int64
- name: system human
dtype: int64
- name: take clerk
dtype: int64
- name: tariff tax
dtype: int64
- name: tariff taxat
dtype: int64
- name: tax color
dtype: int64
- name: tax indian
dtype: int64
- name: tax tea
dtype: int64
- name: taxpay countri
dtype: int64
- name: temporari govern
dtype: int64
- name: term design
dtype: int64
- name: territori belong
dtype: int64
- name: territori cede
dtype: int64
- name: territori control
dtype: int64
- name: territori court
dtype: int64
- name: territori far
dtype: int64
- name: territori limit
dtype: int64
- name: territori provid
dtype: int64
- name: territori whether
dtype: int64
- name: test fit
dtype: int64
- name: test practic
dtype: int64
- name: test qualif
dtype: int64
- name: thirteen fourteen
dtype: int64
- name: thirteenth fourteenth
dtype: int64
- name: thirteenth street
dtype: int64
- name: thirti sixti
dtype: int64
- name: thirtyf forti
dtype: int64
- name: thirtyf hundr
dtype: int64
- name: thousand dollar
dtype: int64
- name: three court
dtype: int64
- name: three deleg
dtype: int64
- name: three regiment
dtype: int64
- name: throat american
dtype: int64
- name: throw vote
dtype: int64
- name: thus collect
dtype: int64
- name: thus opportun
dtype: int64
- name: thus see
dtype: int64
- name: ticket elect
dtype: int64
- name: time proof
dtype: int64
- name: time war
dtype: int64
- name: ton mail
dtype: int64
- name: tonnag capac
dtype: int64
- name: took tax
dtype: int64
- name: total blind
dtype: int64
- name: train arriv
dtype: int64
- name: train leav
dtype: int64
- name: train order
dtype: int64
- name: transfer railroad
dtype: int64
- name: treasuri note
dtype: int64
- name: treasuri present
dtype: int64
- name: trial juri
dtype: int64
- name: trial trip
dtype: int64
- name: tribun determin
dtype: int64
- name: troop philippin
dtype: int64
- name: troop state
dtype: int64
- name: true like
dtype: int64
- name: trust bill
dtype: int64
- name: trust countri
dtype: int64
- name: trust want
dtype: int64
- name: twentyf year
dtype: int64
- name: two year
dtype: int64
- name: understand investig
dtype: int64
- name: uniform throughout
dtype: int64
- name: unlaw cohabit
dtype: int64
- name: upon credit
dtype: int64
- name: upon critic
dtype: int64
- name: upon eastern
dtype: int64
- name: upon franchis
dtype: int64
- name: upon peopl
dtype: int64
- name: upon perman
dtype: int64
- name: upon pretext
dtype: int64
- name: upon pure
dtype: int64
- name: upon retir
dtype: int64
- name: upon settler
dtype: int64
- name: upon solid
dtype: int64
- name: upper cumberland
dtype: int64
- name: us hour
dtype: int64
- name: use postoffic
dtype: int64
- name: vacanc state
dtype: int64
- name: verdict upon
dtype: int64
- name: vessel author
dtype: int64
- name: vessel built
dtype: int64
- name: vessel name
dtype: int64
- name: vessel privat
dtype: int64
- name: vicious habit
dtype: int64
- name: volunt infantri
dtype: int64
- name: vote fraud
dtype: int64
- name: vote year
dtype: int64
- name: vs state
dtype: int64
- name: waiv claim
dtype: int64
- name: want seed
dtype: int64
- name: want suppos
dtype: int64
- name: war depart
dtype: int64
- name: war indemn
dtype: int64
- name: war philippin
dtype: int64
- name: war tax
dtype: int64
- name: war wage
dtype: int64
- name: way abridg
dtype: int64
- name: weight mail
dtype: int64
- name: whatev unless
dtype: int64
- name: whether governor
dtype: int64
- name: whole particular
dtype: int64
- name: within twenti
dtype: int64
- name: without guaranti
dtype: int64
- name: wonder result
dtype: int64
- name: word suit
dtype: int64
- name: word vacanc
dtype: int64
- name: worth labor
dtype: int64
- name: writ mandamus
dtype: int64
- name: write section
dtype: int64
- name: yard dock
dtype: int64
- name: year ago
dtype: int64
- name: yet word
dtype: int64
- name: phrase_scores
struct:
- name: abridg except
dtype: float64
- name: absolut just
dtype: float64
- name: accept adopt
dtype: float64
- name: accomplish leav
dtype: float64
- name: accord respect
dtype: float64
- name: account drought
dtype: float64
- name: account previous
dtype: float64
- name: acquisit island
dtype: float64
- name: act absenc
dtype: float64
- name: act honest
dtype: float64
- name: action line
dtype: float64
- name: addit cadet
dtype: float64
- name: adjutantgener armi
dtype: float64
- name: administr persist
dtype: float64
- name: admir oneil
dtype: float64
- name: affair also
dtype: float64
- name: affair american
dtype: float64
- name: african republ
dtype: float64
- name: african slave
dtype: float64
- name: african slaveri
dtype: float64
- name: aggreg tonnag
dtype: float64
- name: aggreg vote
dtype: float64
- name: ago build
dtype: float64
- name: agre line
dtype: float64
- name: alien one
dtype: float64
- name: allow mileag
dtype: float64
- name: allow perfect
dtype: float64
- name: also petit
dtype: float64
- name: altern proposit
dtype: float64
- name: alway full
dtype: float64
- name: american line
dtype: float64
- name: american peopl
dtype: float64
- name: amount commerc
dtype: float64
- name: annual profit
dtype: float64
- name: annual vacat
dtype: float64
- name: anoth chamber
dtype: float64
- name: antitrust act
dtype: float64
- name: appli territori
dtype: float64
- name: appoint cadet
dtype: float64
- name: appoint compet
dtype: float64
- name: appoint legislatur
dtype: float64
- name: appoint next
dtype: float64
- name: apport repres
dtype: float64
- name: approach campaign
dtype: float64
- name: appropri stream
dtype: float64
- name: approv secretari
dtype: float64
- name: arbitrari rule
dtype: float64
- name: argument counsel
dtype: float64
- name: armi budget
dtype: float64
- name: armi creat
dtype: float64
- name: armi philippin
dtype: float64
- name: armi regist
dtype: float64
- name: armi republ
dtype: float64
- name: armor cruiser
dtype: float64
- name: armor plant
dtype: float64
- name: arrang pair
dtype: float64
- name: articl import
dtype: float64
- name: ascertain upon
dtype: float64
- name: assert determin
dtype: float64
- name: assist engin
dtype: float64
- name: attent claim
dtype: float64
- name: author consolid
dtype: float64
- name: averag net
dtype: float64
- name: averag weight
dtype: float64
- name: baltimor potomac
dtype: float64
- name: banker broker
dtype: float64
- name: basi apportion
dtype: float64
- name: basi calcul
dtype: float64
- name: bay inlet
dtype: float64
- name: becam american
dtype: float64
- name: benefit bounti
dtype: float64
- name: benefit puerto
dtype: float64
- name: benevol assimil
dtype: float64
- name: besid great
dtype: float64
- name: besid pay
dtype: float64
- name: best safest
dtype: float64
- name: beyond direct
dtype: float64
- name: board children
dtype: float64
- name: board construct
dtype: float64
- name: board elect
dtype: float64
- name: bodi soldier
dtype: float64
- name: bounti bill
dtype: float64
- name: bounti export
dtype: float64
- name: bounti jumper
dtype: float64
- name: bounti provid
dtype: float64
- name: bounti upon
dtype: float64
- name: britain propos
dtype: float64
- name: british interest
dtype: float64
- name: build armor
dtype: float64
- name: build boat
dtype: float64
- name: build class
dtype: float64
- name: build navi
dtype: float64
- name: build purpos
dtype: float64
- name: build vessel
dtype: float64
- name: built contract
dtype: float64
- name: built navyyard
dtype: float64
- name: buncomb counti
dtype: float64
- name: bureau equip
dtype: float64
- name: bureau head
dtype: float64
- name: burial expens
dtype: float64
- name: buy state
dtype: float64
- name: calendar favor
dtype: float64
- name: calendar proceed
dtype: float64
- name: came servic
dtype: float64
- name: campaign fund
dtype: float64
- name: canada british
dtype: float64
- name: canal dug
dtype: float64
- name: canal railway
dtype: float64
- name: canvass return
dtype: float64
- name: capabl earn
dtype: float64
- name: cape nome
dtype: float64
- name: capita popul
dtype: float64
- name: captain list
dtype: float64
- name: captain regular
dtype: float64
- name: care insan
dtype: float64
- name: carpetbag govern
dtype: float64
- name: carri war
dtype: float64
- name: cast fortun
dtype: float64
- name: caus depreci
dtype: float64
- name: cede us
dtype: float64
- name: census make
dtype: float64
- name: census offic
dtype: float64
- name: cent bottl
dtype: float64
- name: cent dollar
dtype: float64
- name: cent firstclass
dtype: float64
- name: certain vessel
dtype: float64
- name: certif amount
dtype: float64
- name: certif section
dtype: float64
- name: chamber outsid
dtype: float64
- name: channel carri
dtype: float64
- name: charact whole
dtype: float64
- name: charg favor
dtype: float64
- name: charg hospit
dtype: float64
- name: charg vessel
dtype: float64
- name: cheaper gas
dtype: float64
- name: chicago burlington
dtype: float64
- name: chicago platform
dtype: float64
- name: chief engin
dtype: float64
- name: chief product
dtype: float64
- name: children guardian
dtype: float64
- name: cigar maker
dtype: float64
- name: circul note
dtype: float64
- name: circul secur
dtype: float64
- name: citi belong
dtype: float64
- name: citi chicago
dtype: float64
- name: citi light
dtype: float64
- name: citi nashvill
dtype: float64
- name: citi norfolk
dtype: float64
- name: citizen puerto
dtype: float64
- name: citizen soldieri
dtype: float64
- name: citizen unit
dtype: float64
- name: civil judici
dtype: float64
- name: civil war
dtype: float64
- name: civilian secretari
dtype: float64
- name: claim also
dtype: float64
- name: claim calendar
dtype: float64
- name: claim damag
dtype: float64
- name: claim proposit
dtype: float64
- name: claim state
dtype: float64
- name: claim unless
dtype: float64
- name: classif bill
dtype: float64
- name: claus adopt
dtype: float64
- name: clerk discharg
dtype: float64
- name: close investig
dtype: float64
- name: cloth educ
dtype: float64
- name: coal naval
dtype: float64
- name: coast geodet
dtype: float64
- name: coast survey
dtype: float64
- name: code bill
dtype: float64
- name: code code
dtype: float64
- name: code honor
dtype: float64
- name: code procedur
dtype: float64
- name: coeur dalen
dtype: float64
- name: coin govern
dtype: float64
- name: collect duti
dtype: float64
- name: colleg public
dtype: float64
- name: color men
dtype: float64
- name: color peopl
dtype: float64
- name: color product
dtype: float64
- name: color vote
dtype: float64
- name: color voter
dtype: float64
- name: combin control
dtype: float64
- name: come campaign
dtype: float64
- name: command offic
dtype: float64
- name: commenc build
dtype: float64
- name: commerc citi
dtype: float64
- name: commerc violat
dtype: float64
- name: commerc yet
dtype: float64
- name: commerci advantag
dtype: float64
- name: commerci enterpris
dtype: float64
- name: commerci valu
dtype: float64
- name: commission navig
dtype: float64
- name: compet take
dtype: float64
- name: comprehens plan
dtype: float64
- name: compress air
dtype: float64
- name: conclus irresist
dtype: float64
- name: concur suggest
dtype: float64
- name: confeder armi
dtype: float64
- name: confront proposit
dtype: float64
- name: congress ascertain
dtype: float64
- name: congression life
dtype: float64
- name: connect train
dtype: float64
- name: consid fiveminut
dtype: float64
- name: constitut appli
dtype: float64
- name: constitut appoint
dtype: float64
- name: constitut court
dtype: float64
- name: constitut extend
dtype: float64
- name: constitut follow
dtype: float64
- name: constitut uniform
dtype: float64
- name: construct reservoir
dtype: float64
- name: contest proceed
dtype: float64
- name: contest two
dtype: float64
- name: contigu territori
dtype: float64
- name: contract ship
dtype: float64
- name: contract vessel
dtype: float64
- name: controvert question
dtype: float64
- name: convent frame
dtype: float64
- name: convey made
dtype: float64
- name: cooli labor
dtype: float64
- name: correct conform
dtype: float64
- name: counti board
dtype: float64
- name: counti contain
dtype: float64
- name: counti result
dtype: float64
- name: countri publish
dtype: float64
- name: court admit
dtype: float64
- name: court jurisdict
dtype: float64
- name: credenti hon
dtype: float64
- name: credit said
dtype: float64
- name: crimin recrimin
dtype: float64
- name: cuba cuban
dtype: float64
- name: cuba porto
dtype: float64
- name: cuba puerto
dtype: float64
- name: cuba right
dtype: float64
- name: custom tariff
dtype: float64
- name: cutter servic
dtype: float64
- name: daili toil
dtype: float64
- name: dalla counti
dtype: float64
- name: danger line
dtype: float64
- name: deaf dumb
dtype: float64
- name: debtor properti
dtype: float64
- name: deficit postal
dtype: float64
- name: degrad labor
dtype: float64
- name: deliveri rout
dtype: float64
- name: demand admiss
dtype: float64
- name: demand surrend
dtype: float64
- name: demand use
dtype: float64
- name: deni seat
dtype: float64
- name: depreci rate
dtype: float64
- name: deputi appoint
dtype: float64
- name: deputi clerk
dtype: float64
- name: deriv just
dtype: float64
- name: determin accomplish
dtype: float64
- name: determin candid
dtype: float64
- name: determin contest
dtype: float64
- name: develop wonder
dtype: float64
- name: differ candid
dtype: float64
- name: director census
dtype: float64
- name: director made
dtype: float64
- name: disagr concur
dtype: float64
- name: disappear carriag
dtype: float64
- name: discharg everi
dtype: float64
- name: disciplin militia
dtype: float64
- name: discov mine
dtype: float64
- name: discuss charact
dtype: float64
- name: diseas germ
dtype: float64
- name: disfranchis negro
dtype: float64
- name: disord behavior
dtype: float64
- name: dispos territori
dtype: float64
- name: distinguish friend
dtype: float64
- name: divis issu
dtype: float64
- name: dollar equal
dtype: float64
- name: dollar silver
dtype: float64
- name: dollar subsidiari
dtype: float64
- name: doubt remov
dtype: float64
- name: duti announc
dtype: float64
- name: duti impost
dtype: float64
- name: duti legislatur
dtype: float64
- name: earn bill
dtype: float64
- name: educ given
dtype: float64
- name: educ qualif
dtype: float64
- name: eight half
dtype: float64
- name: either belliger
dtype: float64
- name: elect board
dtype: float64
- name: elect choic
dtype: float64
- name: elect commission
dtype: float64
- name: elect fail
dtype: float64
- name: elect franchis
dtype: float64
- name: elect unit
dtype: float64
- name: elector board
dtype: float64
- name: eleventh congression
dtype: float64
- name: els ever
dtype: float64
- name: empir great
dtype: float64
- name: employe war
dtype: float64
- name: encourag litig
dtype: float64
- name: endeavor impress
dtype: float64
- name: enemi silver
dtype: float64
- name: enforc payment
dtype: float64
- name: enter servic
dtype: float64
- name: enterpris want
dtype: float64
- name: entitl member
dtype: float64
- name: entitl offic
dtype: float64
- name: erect build
dtype: float64
- name: erect state
dtype: float64
- name: eri railroad
dtype: float64
- name: establish gold
dtype: float64
- name: establish lighthous
dtype: float64
- name: establish religion
dtype: float64
- name: everi oblig
dtype: float64
- name: everi silver
dtype: float64
- name: everi trust
dtype: float64
- name: exceed actual
dtype: float64
- name: except chief
dtype: float64
- name: except pacif
dtype: float64
- name: except particip
dtype: float64
- name: exchang coin
dtype: float64
- name: exchang gold
dtype: float64
- name: exchang pair
dtype: float64
- name: excit debat
dtype: float64
- name: execut appoint
dtype: float64
- name: exercis elect
dtype: float64
- name: exercis manner
dtype: float64
- name: exercis must
dtype: float64
- name: exercis offic
dtype: float64
- name: exig servic
dtype: float64
- name: exist five
dtype: float64
- name: exist gold
dtype: float64
- name: exist legislatur
dtype: float64
- name: expand currenc
dtype: float64
- name: expedit mail
dtype: float64
- name: expenditur mainten
dtype: float64
- name: expens aris
dtype: float64
- name: expir present
dtype: float64
- name: export gold
dtype: float64
- name: expressli forbid
dtype: float64
- name: extend report
dtype: float64
- name: extend territori
dtype: float64
- name: extortion charg
dtype: float64
- name: extract messag
dtype: float64
- name: fact court
dtype: float64
- name: factori govern
dtype: float64
- name: fail elect
dtype: float64
- name: fail fill
dtype: float64
- name: failur legislatur
dtype: float64
- name: famili soldier
dtype: float64
- name: familiar cours
dtype: float64
- name: far local
dtype: float64
- name: favor bimetal
dtype: float64
- name: favor servic
dtype: float64
- name: favor silver
dtype: float64
- name: feder armi
dtype: float64
- name: final examin
dtype: float64
- name: find statut
dtype: float64
- name: find verdict
dtype: float64
- name: first precinct
dtype: float64
- name: firstclass offic
dtype: float64
- name: fit discharg
dtype: float64
- name: fix ratio
dtype: float64
- name: fix size
dtype: float64
- name: flag everi
dtype: float64
- name: flag never
dtype: float64
- name: foreign fleet
dtype: float64
- name: foreign one
dtype: float64
- name: foreign ship
dtype: float64
- name: foreign vessel
dtype: float64
- name: form wealth
dtype: float64
- name: forti state
dtype: float64
- name: fortun war
dtype: float64
- name: foundat govern
dtype: float64
- name: four vessel
dtype: float64
- name: four year
dtype: float64
- name: freedom liberti
dtype: float64
- name: freight express
dtype: float64
- name: friend refer
dtype: float64
- name: full enjoy
dtype: float64
- name: full represent
dtype: float64
- name: fundament maxim
dtype: float64
- name: furnish currenc
dtype: float64
- name: furnish soldier
dtype: float64
- name: gas compani
dtype: float64
- name: gaslight compani
dtype: float64
- name: general corbin
dtype: float64
- name: general fund
dtype: float64
- name: general postoffic
dtype: float64
- name: general without
dtype: float64
- name: geodet survey
dtype: float64
- name: geolog survey
dtype: float64
- name: get vessel
dtype: float64
- name: give bounti
dtype: float64
- name: give represent
dtype: float64
- name: glori honor
dtype: float64
- name: goe sea
dtype: float64
- name: gold coin
dtype: float64
- name: gold except
dtype: float64
- name: gold provid
dtype: float64
- name: gold reserv
dtype: float64
- name: gold silver
dtype: float64
- name: gold standard
dtype: float64
- name: got gold
dtype: float64
- name: govern control
dtype: float64
- name: govern deriv
dtype: float64
- name: govern henc
dtype: float64
- name: govern injunct
dtype: float64
- name: govern theunit
dtype: float64
- name: govern yard
dtype: float64
- name: governor right
dtype: float64
- name: graduat annapoli
dtype: float64
- name: graduat corpor
dtype: float64
- name: great britain
dtype: float64
- name: great fight
dtype: float64
- name: great panic
dtype: float64
- name: great scheme
dtype: float64
- name: great transact
dtype: float64
- name: great trust
dtype: float64
- name: greenback redeem
dtype: float64
- name: greenback treasuri
dtype: float64
- name: grew great
dtype: float64
- name: guam philippin
dtype: float64
- name: gun mount
dtype: float64
- name: half rate
dtype: float64
- name: half section
dtype: float64
- name: happen recess
dtype: float64
- name: harbor manila
dtype: float64
- name: harbor order
dtype: float64
- name: harm come
dtype: float64
- name: haul flag
dtype: float64
- name: hawaiian languag
dtype: float64
- name: haypauncefot treati
dtype: float64
- name: health care
dtype: float64
- name: held servic
dtype: float64
- name: heroic struggl
dtype: float64
- name: high tide
dtype: float64
- name: highest pay
dtype: float64
- name: holder oblig
dtype: float64
- name: honest faith
dtype: float64
- name: horizont reduct
dtype: float64
- name: hospit connect
dtype: float64
- name: hour five
dtype: float64
- name: hour labor
dtype: float64
- name: human be
dtype: float64
- name: human christian
dtype: float64
- name: humili spectacl
dtype: float64
- name: hundr nine
dtype: float64
- name: hydrograph survey
dtype: float64
- name: illeg ballot
dtype: float64
- name: imit butter
dtype: float64
- name: immens expenditur
dtype: float64
- name: imperi polici
dtype: float64
- name: imposs secur
dtype: float64
- name: impost duti
dtype: float64
- name: improv mouth
dtype: float64
- name: improv navig
dtype: float64
- name: improv whether
dtype: float64
- name: incid war
dtype: float64
- name: incorpor union
dtype: float64
- name: increas salari
dtype: float64
- name: increas stand
dtype: float64
- name: increas volum
dtype: float64
- name: independ constitut
dtype: float64
- name: independ paper
dtype: float64
- name: independ second
dtype: float64
- name: indian commit
dtype: float64
- name: indirect contempt
dtype: float64
- name: industri combin
dtype: float64
- name: injustic state
dtype: float64
- name: inner circl
dtype: float64
- name: innoc helpless
dtype: float64
- name: inquiri found
dtype: float64
- name: instanc come
dtype: float64
- name: insuper obstacl
dtype: float64
- name: insur compani
dtype: float64
- name: intellig abil
dtype: float64
- name: intent becom
dtype: float64
- name: interest favor
dtype: float64
- name: interest upon
dtype: float64
- name: intern navig
dtype: float64
- name: intern revenu
dtype: float64
- name: internalrevenu offic
dtype: float64
- name: intim acquaint
dtype: float64
- name: investig believ
dtype: float64
- name: invit attent
dtype: float64
- name: involv valid
dtype: float64
- name: irish peopl
dtype: float64
- name: irrig indian
dtype: float64
- name: irrig scheme
dtype: float64
- name: island almost
dtype: float64
- name: island cost
dtype: float64
- name: island except
dtype: float64
- name: island sound
dtype: float64
- name: island without
dtype: float64
- name: issu attach
dtype: float64
- name: issu coin
dtype: float64
- name: issu fals
dtype: float64
- name: issu redempt
dtype: float64
- name: judgment friend
dtype: float64
- name: jurisdict belong
dtype: float64
- name: jurisdict control
dtype: float64
- name: jurisdict justic
dtype: float64
- name: jurisdict whatev
dtype: float64
- name: just pension
dtype: float64
- name: justic men
dtype: float64
- name: kingdom great
dtype: float64
- name: knot hour
dtype: float64
- name: knot speed
dtype: float64
- name: know understood
dtype: float64
- name: knowledg possess
dtype: float64
- name: knowledg question
dtype: float64
- name: knowledg secretari
dtype: float64
- name: labor commission
dtype: float64
- name: landscap architect
dtype: float64
- name: larg balanc
dtype: float64
- name: larg practic
dtype: float64
- name: larg stand
dtype: float64
- name: last forti
dtype: float64
- name: last found
dtype: float64
- name: late civil
dtype: float64
- name: lawyer upon
dtype: float64
- name: learn justic
dtype: float64
- name: leav chicago
dtype: float64
- name: legisl court
dtype: float64
- name: legisl philippin
dtype: float64
- name: legislatur fail
dtype: float64
- name: legislatur governor
dtype: float64
- name: legislatur met
dtype: float64
- name: legislatur opportun
dtype: float64
- name: legislatur order
dtype: float64
- name: legislatur question
dtype: float64
- name: legislatur submit
dtype: float64
- name: legislatur togeth
dtype: float64
- name: less within
dtype: float64
- name: letter distribut
dtype: float64
- name: letter otherwis
dtype: float64
- name: libertylov peopl
dtype: float64
- name: local engin
dtype: float64
- name: local mail
dtype: float64
- name: locat mine
dtype: float64
- name: longer open
dtype: float64
- name: loui state
dtype: float64
- name: lowest best
dtype: float64
- name: made boston
dtype: float64
- name: made fill
dtype: float64
- name: made locat
dtype: float64
- name: mail carri
dtype: float64
- name: mail divis
dtype: float64
- name: mail pay
dtype: float64
- name: maintain author
dtype: float64
- name: maintain pariti
dtype: float64
- name: maintain sovereignti
dtype: float64
- name: maintain tariff
dtype: float64
- name: mainten pariti
dtype: float64
- name: make cigar
dtype: float64
- name: make gold
dtype: float64
- name: make payabl
dtype: float64
- name: mani year
dtype: float64
- name: manifest duti
dtype: float64
- name: measur practic
dtype: float64
- name: men eight
dtype: float64
- name: men republ
dtype: float64
- name: men requir
dtype: float64
- name: merchandis import
dtype: float64
- name: metal time
dtype: float64
- name: might fail
dtype: float64
- name: militari civil
dtype: float64
- name: militari spirit
dtype: float64
- name: million twentyf
dtype: float64
- name: mine claim
dtype: float64
- name: mine upon
dtype: float64
- name: minimum punish
dtype: float64
- name: minimum salari
dtype: float64
- name: modus vivendi
dtype: float64
- name: monetari standard
dtype: float64
- name: mortgag place
dtype: float64
- name: motion colleagu
dtype: float64
- name: motiv influenc
dtype: float64
- name: much perhap
dtype: float64
- name: must degre
dtype: float64
- name: must elect
dtype: float64
- name: muster servic
dtype: float64
- name: name given
dtype: float64
- name: narrow limit
dtype: float64
- name: nation banker
dtype: float64
- name: nativ inhabit
dtype: float64
- name: natur appeal
dtype: float64
- name: natur color
dtype: float64
- name: naval court
dtype: float64
- name: naval depart
dtype: float64
- name: naval establish
dtype: float64
- name: naval offic
dtype: float64
- name: naval programm
dtype: float64
- name: navi depart
dtype: float64
- name: navi head
dtype: float64
- name: navig compani
dtype: float64
- name: near quit
dtype: float64
- name: necess commerc
dtype: float64
- name: necess proprieti
dtype: float64
- name: necess purchas
dtype: float64
- name: necessari enter
dtype: float64
- name: necessari principl
dtype: float64
- name: negro one
dtype: float64
- name: negro question
dtype: float64
- name: negro vote
dtype: float64
- name: never contend
dtype: float64
- name: newli acquir
dtype: float64
- name: news agent
dtype: float64
- name: nicaragua rout
dtype: float64
- name: nine half
dtype: float64
- name: nobodi believ
dtype: float64
- name: note circul
dtype: float64
- name: note treasuri
dtype: float64
- name: number male
dtype: float64
- name: numer strength
dtype: float64
- name: oblig public
dtype: float64
- name: occup public
dtype: float64
- name: occupi four
dtype: float64
- name: occur recess
dtype: float64
- name: ocean lake
dtype: float64
- name: offer premium
dtype: float64
- name: offic instructor
dtype: float64
- name: offic mint
dtype: float64
- name: offic sea
dtype: float64
- name: offici america
dtype: float64
- name: offici return
dtype: float64
- name: oh talk
dtype: float64
- name: old commiss
dtype: float64
- name: old soldier
dtype: float64
- name: omit statement
dtype: float64
- name: onehalf expenditur
dtype: float64
- name: opinion engin
dtype: float64
- name: opinion naval
dtype: float64
- name: opportun elect
dtype: float64
- name: organ failur
dtype: float64
- name: origin suppos
dtype: float64
- name: orphan asylum
dtype: float64
- name: other demand
dtype: float64
- name: output gold
dtype: float64
- name: output mine
dtype: float64
- name: outsid armi
dtype: float64
- name: outsid record
dtype: float64
- name: outstand treasuri
dtype: float64
- name: paid poll
dtype: float64
- name: paid railway
dtype: float64
- name: paidup capit
dtype: float64
- name: pain look
dtype: float64
- name: pair tile
dtype: float64
- name: paper currenc
dtype: float64
- name: pariti valu
dtype: float64
- name: parti alleg
dtype: float64
- name: parti arrest
dtype: float64
- name: parti demand
dtype: float64
- name: particular portion
dtype: float64
- name: pass experiment
dtype: float64
- name: pass valid
dtype: float64
- name: past war
dtype: float64
- name: pay amount
dtype: float64
- name: pay colonel
dtype: float64
- name: pay poll
dtype: float64
- name: pay superintend
dtype: float64
- name: pend contest
dtype: float64
- name: pension also
dtype: float64
- name: pension attorney
dtype: float64
- name: pension depart
dtype: float64
- name: pension desir
dtype: float64
- name: pension increas
dtype: float64
- name: peopl countri
dtype: float64
- name: peopl gold
dtype: float64
- name: peopl legislatur
dtype: float64
- name: peopl philippin
dtype: float64
- name: peopl puerto
dtype: float64
- name: peopl remedi
dtype: float64
- name: peopl remov
dtype: float64
- name: peopl tradit
dtype: float64
- name: period five
dtype: float64
- name: permit locat
dtype: float64
- name: personnel bill
dtype: float64
- name: philippin island
dtype: float64
- name: philippin war
dtype: float64
- name: place obstacl
dtype: float64
- name: place rank
dtype: float64
- name: place registr
dtype: float64
- name: place retir
dtype: float64
- name: place shipment
dtype: float64
- name: plain peopl
dtype: float64
- name: plan mutual
dtype: float64
- name: plate manufactur
dtype: float64
- name: platform just
dtype: float64
- name: pneumat tube
dtype: float64
- name: pneumatictub servic
dtype: float64
- name: polici administr
dtype: float64
- name: polici imperi
dtype: float64
- name: polit duti
dtype: float64
- name: poll tax
dtype: float64
- name: poor ignor
dtype: float64
- name: popul agricultur
dtype: float64
- name: popul negro
dtype: float64
- name: portland harbor
dtype: float64
- name: porto rico
dtype: float64
- name: possess far
dtype: float64
- name: possess mine
dtype: float64
- name: postoffic clerk
dtype: float64
- name: powerless prevent
dtype: float64
- name: present administr
dtype: float64
- name: present census
dtype: float64
- name: present compani
dtype: float64
- name: present legislatur
dtype: float64
- name: present mine
dtype: float64
- name: present sundri
dtype: float64
- name: presid restor
dtype: float64
- name: prevail believ
dtype: float64
- name: principl know
dtype: float64
- name: print bulletin
dtype: float64
- name: privat yard
dtype: float64
- name: privileg given
dtype: float64
- name: privileg immun
dtype: float64
- name: produc prosper
dtype: float64
- name: proof beyond
dtype: float64
- name: proper increas
dtype: float64
- name: properti prevent
dtype: float64
- name: propos erect
dtype: float64
- name: proposit noth
dtype: float64
- name: proposit relat
dtype: float64
- name: proprio vigor
dtype: float64
- name: provid ballot
dtype: float64
- name: provis thing
dtype: float64
- name: public domain
dtype: float64
- name: public servic
dtype: float64
- name: puerto rico
dtype: float64
- name: pure wholesom
dtype: float64
- name: purpos favor
dtype: float64
- name: purpos just
dtype: float64
- name: purpos retir
dtype: float64
- name: qualiti silver
dtype: float64
- name: question pension
dtype: float64
- name: question seat
dtype: float64
- name: railroad compani
dtype: float64
- name: railway postal
dtype: float64
- name: rare seed
dtype: float64
- name: reason faith
dtype: float64
- name: recess legislatur
dtype: float64
- name: recommend chief
dtype: float64
- name: redeem oblig
dtype: float64
- name: reform forc
dtype: float64
- name: refus admiss
dtype: float64
- name: refus elect
dtype: float64
- name: refus privileg
dtype: float64
- name: regard trust
dtype: float64
- name: regiment organ
dtype: float64
- name: registr book
dtype: float64
- name: reject ballot
dtype: float64
- name: relat parti
dtype: float64
- name: render absolut
dtype: float64
- name: render imposs
dtype: float64
- name: repeal war
dtype: float64
- name: report captain
dtype: float64
- name: represent floor
dtype: float64
- name: represent legislatur
dtype: float64
- name: reserv balanc
dtype: float64
- name: reserv fund
dtype: float64
- name: reserv territori
dtype: float64
- name: reservoir irrig
dtype: float64
- name: resist passag
dtype: float64
- name: result armi
dtype: float64
- name: retain offic
dtype: float64
- name: retir amount
dtype: float64
- name: retir circul
dtype: float64
- name: retir greenback
dtype: float64
- name: retir list
dtype: float64
- name: retir made
dtype: float64
- name: return gave
dtype: float64
- name: return regiment
dtype: float64
- name: return true
dtype: float64
- name: revenuecutt offic
dtype: float64
- name: revenuecutt servic
dtype: float64
- name: revolutionari claim
dtype: float64
- name: rican bill
dtype: float64
- name: rico island
dtype: float64
- name: right life
dtype: float64
- name: right trial
dtype: float64
- name: rob mani
dtype: float64
- name: roll compani
dtype: float64
- name: rule regul
dtype: float64
- name: sacr institut
dtype: float64
- name: said board
dtype: float64
- name: said island
dtype: float64
- name: said labor
dtype: float64
- name: said offic
dtype: float64
- name: said territori
dtype: float64
- name: said vacanc
dtype: float64
- name: sake human
dtype: float64
- name: sale butter
dtype: float64
- name: sale oleomargarin
dtype: float64
- name: save union
dtype: float64
- name: sea men
dtype: float64
- name: sea pay
dtype: float64
- name: seat whether
dtype: float64
- name: secondclass mail
dtype: float64
- name: secondclass matter
dtype: float64
- name: secret understand
dtype: float64
- name: secretari interior
dtype: float64
- name: secretari navi
dtype: float64
- name: secretari treasuri
dtype: float64
- name: secretari war
dtype: float64
- name: section charact
dtype: float64
- name: section drawn
dtype: float64
- name: secur consider
dtype: float64
- name: secur prompt
dtype: float64
- name: select elect
dtype: float64
- name: sentiment peopl
dtype: float64
- name: servic expedit
dtype: float64
- name: servic record
dtype: float64
- name: seven thousand
dtype: float64
- name: sever criticis
dtype: float64
- name: sever port
dtype: float64
- name: ship buy
dtype: float64
- name: ship cheapli
dtype: float64
- name: ship compet
dtype: float64
- name: ship equal
dtype: float64
- name: ship island
dtype: float64
- name: ship merchandis
dtype: float64
- name: ship upon
dtype: float64
- name: ship yard
dtype: float64
- name: shipbuild plant
dtype: float64
- name: shock moral
dtype: float64
- name: shore duti
dtype: float64
- name: shown disposit
dtype: float64
- name: sick leav
dtype: float64
- name: silver bullion
dtype: float64
- name: silver dollar
dtype: float64
- name: silver servic
dtype: float64
- name: sinc latter
dtype: float64
- name: sixth street
dtype: float64
- name: slackwat navig
dtype: float64
- name: slightest foundat
dtype: float64
- name: sober second
dtype: float64
- name: sold butter
dtype: float64
- name: soldier philippin
dtype: float64
- name: soldier question
dtype: float64
- name: solv question
dtype: float64
- name: soul great
dtype: float64
- name: sourc prosper
dtype: float64
- name: southern soldier
dtype: float64
- name: southwest quarter
dtype: float64
- name: sovereignti island
dtype: float64
- name: sovereignti jurisdict
dtype: float64
- name: spain cuba
dtype: float64
- name: spain treati
dtype: float64
- name: spanish treati
dtype: float64
- name: spanish war
dtype: float64
- name: spanishamerican war
dtype: float64
- name: special examin
dtype: float64
- name: spokesman administr
dtype: float64
- name: stand armi
dtype: float64
- name: standard oil
dtype: float64
- name: state armi
dtype: float64
- name: state board
dtype: float64
- name: state exclud
dtype: float64
- name: state execut
dtype: float64
- name: state illustr
dtype: float64
- name: state infantri
dtype: float64
- name: state inhabit
dtype: float64
- name: state note
dtype: float64
- name: state represent
dtype: float64
- name: state virtu
dtype: float64
- name: state vs
dtype: float64
- name: statement justic
dtype: float64
- name: stationeri room
dtype: float64
- name: street extens
dtype: float64
- name: street upon
dtype: float64
- name: strike railroad
dtype: float64
- name: strike suit
dtype: float64
- name: struggl peopl
dtype: float64
- name: subject express
dtype: float64
- name: subject went
dtype: float64
- name: submarin boat
dtype: float64
- name: subserv interest
dtype: float64
- name: subsist depart
dtype: float64
- name: sugar tobacco
dtype: float64
- name: sugar trust
dtype: float64
- name: suggest hour
dtype: float64
- name: suggest insert
dtype: float64
- name: suit section
dtype: float64
- name: sum must
dtype: float64
- name: sup ct
dtype: float64
- name: superintend naval
dtype: float64
- name: suppli execut
dtype: float64
- name: suppress fraud
dtype: float64
- name: suppress insurrect
dtype: float64
- name: suppress trust
dtype: float64
- name: swear support
dtype: float64
- name: sympathi struggl
dtype: float64
- name: system human
dtype: float64
- name: take clerk
dtype: float64
- name: tariff tax
dtype: float64
- name: tariff taxat
dtype: float64
- name: tax color
dtype: float64
- name: tax indian
dtype: float64
- name: tax tea
dtype: float64
- name: taxpay countri
dtype: float64
- name: temporari govern
dtype: float64
- name: term design
dtype: float64
- name: territori belong
dtype: float64
- name: territori cede
dtype: float64
- name: territori control
dtype: float64
- name: territori court
dtype: float64
- name: territori far
dtype: float64
- name: territori limit
dtype: float64
- name: territori provid
dtype: float64
- name: territori whether
dtype: float64
- name: test fit
dtype: float64
- name: test practic
dtype: float64
- name: test qualif
dtype: float64
- name: thirteen fourteen
dtype: float64
- name: thirteenth fourteenth
dtype: float64
- name: thirteenth street
dtype: float64
- name: thirti sixti
dtype: float64
- name: thirtyf forti
dtype: float64
- name: thirtyf hundr
dtype: float64
- name: thousand dollar
dtype: float64
- name: three court
dtype: float64
- name: three deleg
dtype: float64
- name: three regiment
dtype: float64
- name: throat american
dtype: float64
- name: throw vote
dtype: float64
- name: thus collect
dtype: float64
- name: thus opportun
dtype: float64
- name: thus see
dtype: float64
- name: ticket elect
dtype: float64
- name: time proof
dtype: float64
- name: time war
dtype: float64
- name: ton mail
dtype: float64
- name: tonnag capac
dtype: float64
- name: took tax
dtype: float64
- name: total blind
dtype: float64
- name: train arriv
dtype: float64
- name: train leav
dtype: float64
- name: train order
dtype: float64
- name: transfer railroad
dtype: float64
- name: treasuri note
dtype: float64
- name: treasuri present
dtype: float64
- name: trial juri
dtype: float64
- name: trial trip
dtype: float64
- name: tribun determin
dtype: float64
- name: troop philippin
dtype: float64
- name: troop state
dtype: float64
- name: true like
dtype: float64
- name: trust bill
dtype: float64
- name: trust countri
dtype: float64
- name: trust want
dtype: float64
- name: twentyf year
dtype: float64
- name: two year
dtype: float64
- name: understand investig
dtype: float64
- name: uniform throughout
dtype: float64
- name: unlaw cohabit
dtype: float64
- name: upon credit
dtype: float64
- name: upon critic
dtype: float64
- name: upon eastern
dtype: float64
- name: upon franchis
dtype: float64
- name: upon peopl
dtype: float64
- name: upon perman
dtype: float64
- name: upon pretext
dtype: float64
- name: upon pure
dtype: float64
- name: upon retir
dtype: float64
- name: upon settler
dtype: float64
- name: upon solid
dtype: float64
- name: upper cumberland
dtype: float64
- name: us hour
dtype: float64
- name: use postoffic
dtype: float64
- name: vacanc state
dtype: float64
- name: verdict upon
dtype: float64
- name: vessel author
dtype: float64
- name: vessel built
dtype: float64
- name: vessel name
dtype: float64
- name: vessel privat
dtype: float64
- name: vicious habit
dtype: float64
- name: volunt infantri
dtype: float64
- name: vote fraud
dtype: float64
- name: vote year
dtype: float64
- name: vs state
dtype: float64
- name: waiv claim
dtype: float64
- name: want seed
dtype: float64
- name: want suppos
dtype: float64
- name: war depart
dtype: float64
- name: war indemn
dtype: float64
- name: war philippin
dtype: float64
- name: war tax
dtype: float64
- name: war wage
dtype: float64
- name: way abridg
dtype: float64
- name: weight mail
dtype: float64
- name: whatev unless
dtype: float64
- name: whether governor
dtype: float64
- name: whole particular
dtype: float64
- name: within twenti
dtype: float64
- name: without guaranti
dtype: float64
- name: wonder result
dtype: float64
- name: word suit
dtype: float64
- name: word vacanc
dtype: float64
- name: worth labor
dtype: float64
- name: writ mandamus
dtype: float64
- name: write section
dtype: float64
- name: yard dock
dtype: float64
- name: year ago
dtype: float64
- name: yet word
dtype: float64
splits:
- name: train
num_bytes: 258515723
num_examples: 12643
download_size: 23362543
dataset_size: 258515723
configs:
- config_name: default
data_files:
- split: train
path: data/train-*
---
|
riotu-lab/ADMD | riotu-lab | 2025-02-13T13:10:04Z | 31 | 1 | [
"language:ar",
"license:mit",
"size_categories:n<1K",
"format:csv",
"modality:text",
"library:datasets",
"library:dask",
"library:mlcroissant",
"library:polars",
"region:us"
] | [] | 2025-02-13T12:46:37Z | 0 | ---
license: mit
language:
- ar
---
# Arabic Depth Mini Dataset (ADMD)
The **Arabic Depth Mini Dataset (ADMD)** is a compact yet highly challenging dataset designed to evaluate Arabic language models across diverse domains. It consists of **490 carefully curated questions** spanning **10 major domains** and **42 topics**. The dataset is manually reviewed and emphasizes linguistic accuracy, cultural alignment, and methodological rigor.
## Dataset Overview
### Categories and Topics
The dataset covers **42 topics** across **10 major domains**:
#### 1. Applied Sciences & Engineering
- Mechanical Engineering
- Computer Science
- Medicine
- Nutrition (includes Health & Fitness)
- Earth Science
#### 2. Natural Sciences
- Biology
- Cosmology
#### 3. Social Sciences & Humanities
- Psychology
- Sociology
- Anthropology
- Media & Communication
- Economics
#### 4. Islamic & Religious Studies
- Quranic Exegesis (Tafsir)
- Hadith
- Hadith Terminology (Mustalah)
- Islamic Jurisprudence (Fiqh)
- Principles of Islamic Jurisprudence (Usul Al-Fiqh)
- Inheritance Laws (Fara'id)
- Islamic Creed (Aqeedah)
- Quranic Recitation Rules (Tajweed)
- Quranic Readings (Qira’at)
- Biography of the Prophet (Seerah)
- Biographies of Islamic Scholars (Tarajim Al-Rijal)
#### 5. Linguistics & Literature
- Arabic Grammar (Nahw)
- Arabic Morphology (Sarf)
- Rhetoric (Balagha)
- Arabic Prosody & Poetic Meters (Arood & Qawafi)
- Poetry
- Arabic Language
- General Linguistics
- Arabic Linguistics
- Arabic Logic
#### 6. Philosophy & Logic
- Philosophy
- Arabic Logic
#### 7. Culture & Arts
- Music
- Folklore & Cultural Studies
#### 8. Mathematics & Computational Sciences
- Mathematics
- Machine Learning
#### 9. General & Miscellaneous Sciences
- General Sciences
- Cooking
#### 10. Historical & Genealogical Studies
- Genealogy (Ansab)
---
## Model Evaluation Results
The dataset was used to evaluate five leading language models:
1. **GPT-4**
2. **Claude 3.5 Sonnet**
3. **Gemini Flash 1.5**
4. **CommandR 100B**
5. **Qwen-Max 2.5**
### Performance Metrics
The evaluation was conducted manually, and the results were categorized as follows:
- **True (T):** The model answered correctly.
- **False (F):** The model answered incorrectly.
- **Partially-True (PT):** The model answered 60-80% correctly.
- **Partially-False (PF):** The model answered 20-30% correctly.
#### Overall Model Performance
| Model | True (%) | False (%) | Partially-True (%) | Partially-False (%) |
|---------------------|----------|-----------|--------------------|---------------------|
| Claude 3.5 Sonnet | 33.5 | 43.5 | 18.2 | 4.8 |
| CommandR 100B | 15.0 | 54.0 | 15.6 | 15.4 |
| Gemini Flash 1.5 | 22.1 | 56.2 | 12.0 | 9.7 |
| GPT-4 | 11.8 | 67.3 | 17.3 | 3.5 |
| Qwen-Max 2.5 | 13.1 | 57.4 | 17.8 | 11.7 |
#### Detailed Results by Domain
For detailed results by domain, refer to the tables below:
1. **[Claude 3.5 Sonnet Results](#claude-35-sonnet-results)**
2. **[GPT-4 Results](#gpt-4-results)**
3. **[Gemini Flash 1.5 Results](#gemini-flash-15-results)**
4. **[CommandR 100B Results](#commandr-100b-results)**
5. **[Qwen-Max 2.5 Results](#qwen-max-25-results)**
---
### Claude 3.5 Sonnet Results
| Field of Study | True (%) | False (%) | Partially-True (%) | Partially-False (%) |
|---------------------------------|----------|-----------|--------------------|---------------------|
| Applied Sciences & Engineering | 42.00 | 28.00 | 24.00 | 6.00 |
| Natural Sciences | 45.00 | 5.00 | 45.00 | 5.00 |
| Social Sciences & Humanities | 38.00 | 38.00 | 20.00 | 4.00 |
| Islamic & Religious Studies | 30.00 | 41.82 | 16.36 | 11.82 |
| Linguistics & Literature | 12.84 | 66.97 | 13.76 | 6.42 |
| Philosophy & Logic | 50.00 | 50.00 | 0.00 | 0.00 |
| Culture & Arts | 15.00 | 65.00 | 15.00 | 5.00 |
| Mathematics & Computational Sci.| 50.00 | 20.00 | 20.00 | 10.00 |
| General & Miscellaneous Sciences| 51.67 | 40.00 | 8.33 | 0.00 |
| Historical & Genealogical Studies| 0.00 | 80.00 | 20.00 | 0.00 |
---
### GPT-4 Results
| Field of Study | True (%) | False (%) | Partially-True (%) | Partially-False (%) |
|---------------------------------|----------|-----------|--------------------|---------------------|
| Applied Sciences & Engineering | 22.00 | 42.00 | 28.00 | 8.00 |
| Natural Sciences | 20.00 | 35.00 | 45.00 | 0.00 |
| Social Sciences & Humanities | 12.00 | 56.00 | 26.00 | 6.00 |
| Islamic & Religious Studies | 0.91 | 80.91 | 10.00 | 8.18 |
| Linguistics & Literature | 1.82 | 94.55 | 2.73 | 0.91 |
| Philosophy & Logic | 10.00 | 80.00 | 10.00 | 0.00 |
| Culture & Arts | 10.00 | 75.00 | 10.00 | 5.00 |
| Mathematics & Computational Sci.| 25.00 | 45.00 | 25.00 | 5.00 |
| General & Miscellaneous Sciences| 16.67 | 65.00 | 16.67 | 1.67 |
| Historical & Genealogical Studies| 0.00 | 100.00 | 0.00 | 0.00 |
---
### Gemini Flash 1.5 Results
| Field of Study | True (%) | False (%) | Partially-True (%) | Partially-False (%) |
|---------------------------------|----------|-----------|--------------------|---------------------|
| Applied Sciences & Engineering | 24.00 | 46.00 | 24.00 | 6.00 |
| Natural Sciences | 40.00 | 15.00 | 20.00 | 25.00 |
| Social Sciences & Humanities | 38.00 | 32.00 | 14.00 | 16.00 |
| Islamic & Religious Studies | 0.00 | 88.18 | 5.45 | 6.36 |
| Linguistics & Literature | 2.75 | 84.40 | 4.59 | 8.26 |
| Philosophy & Logic | 15.00 | 60.00 | 5.00 | 20.00 |
| Culture & Arts | 10.00 | 70.00 | 10.00 | 10.00 |
| Mathematics & Computational Sci.| 45.00 | 30.00 | 25.00 | 0.00 |
| General & Miscellaneous Sciences| 36.67 | 56.67 | 1.67 | 5.00 |
| Historical & Genealogical Studies| 10.00 | 80.00 | 10.00 | 0.00 |
---
### CommandR 100B Results
| Field of Study | True (%) | False (%) | Partially-True (%) | Partially-False (%) |
|---------------------------------|----------|-----------|--------------------|---------------------|
| Applied Sciences & Engineering | 30.00 | 52.00 | 6.00 | 12.00 |
| Natural Sciences | 30.00 | 15.00 | 50.00 | 5.00 |
| Social Sciences & Humanities | 18.00 | 46.00 | 20.00 | 16.00 |
| Islamic & Religious Studies | 3.64 | 69.09 | 10.00 | 17.27 |
| Linguistics & Literature | 4.55 | 82.73 | 3.64 | 9.09 |
| Philosophy & Logic | 10.00 | 45.00 | 15.00 | 30.00 |
| Culture & Arts | 15.00 | 70.00 | 5.00 | 10.00 |
| Mathematics & Computational Sci.| 25.00 | 30.00 | 25.00 | 20.00 |
| General & Miscellaneous Sciences| 13.33 | 60.00 | 11.67 | 15.00 |
| Historical & Genealogical Studies| 0.00 | 70.00 | 10.00 | 20.00 |
---
### Qwen-Max 2.5 Results
| Field of Study | True (%) | False (%) | Partially-True (%) | Partially-False (%) |
|---------------------------------|----------|-----------|--------------------|---------------------|
| Applied Sciences & Engineering | 20.00 | 42.00 | 18.00 | 20.00 |
| Natural Sciences | 20.00 | 15.00 | 40.00 | 25.00 |
| Social Sciences & Humanities | 18.00 | 42.00 | 24.00 | 16.00 |
| Islamic & Religious Studies | 4.55 | 80.00 | 5.45 | 10.00 |
| Linguistics & Literature | 1.82 | 90.00 | 3.64 | 4.55 |
| Philosophy & Logic | 15.00 | 70.00 | 5.00 | 10.00 |
| Culture & Arts | 5.00 | 85.00 | 10.00 | 0.00 |
| Mathematics & Computational Sci.| 20.00 | 30.00 | 35.00 | 15.00 |
| General & Miscellaneous Sciences| 26.67 | 50.00 | 16.67 | 6.67 |
| Historical & Genealogical Studies| 0.00 | 70.00 | 20.00 | 10.00 |
---
and for the dataset here are the splits names
| English Name | Arabic Translation |
|-------------------------|---------------------------|
| machine_learning | تعلم الآلة |
| Tafsir | التفسير |
| Grammar_Nahw | النحو |
| psycology | علم النفس |
| nutrition | التغذية |
| dialects | اللهجات |
| mechanic | الميكانيكا |
| biology | علم الأحياء |
| cosmology | علم الكون |
| Tarajem | التراجم |
| Morphology_Sarf | الصرف |
| Tajweed | التجويد |
| Balaghah | البلاغة |
| Orod_qawafi | العروض والقوافي |
| Fiqh | الفقه |
| Inheritance_mawarith | المواريث |
| Osol_fiqh | أصول الفقه |
| believe_Aqidah | العقيدة |
| Mostalah | المصطلح |
| Hadith | الحديث |
| Islamic_History | التاريخ الإسلامي |
| Maths | الرياضيات |
| linguistics | اللسانيات |
| Arabic_logic | المنطق العربي |
| Ansab | الأنساب |
| poety | الشعر |
| Qiraat | القراءات |
| old_music | الموسيقى القديمة |
| culture | الثقافة |
| philosophy | الفلسفة |
| geology | علم الأرض |
| language | اللغة |
| economics | الاقتصاد |
| sociology | علم الاجتماع |
| medicine | الطب |
| computer_science | علوم الحاسوب |
| Anthropology | علم الإنسان |
| media_com | الإعلام والاتصال |
| general_language | اللغة العامة |
| general_science | العلوم العامة |
| cooking | الطهي |
## Citation
If you use this dataset in your research, please cite the following paper:
```bibtex
@article{yourcitationkey,
title={Towards a Quality Arabic Evaluation Datasets: Theory, Current Practice, and Future Directions},
author={Your Name and Co-authors},
journal={Your Journal},
year={2024},
publisher={Your Publisher}
} |
LLM4Code/SATBench | LLM4Code | 2025-05-27T03:33:19Z | 0 | 1 | [
"license:apache-2.0",
"size_categories:1K<n<10K",
"format:json",
"modality:tabular",
"modality:text",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"arxiv:2505.14615",
"region:us"
] | [] | 2025-05-26T20:43:43Z | 0 | ---
license: apache-2.0
---
# SATBench: Benchmarking LLMs’ Logical Reasoning via Automated Puzzle Generation from SAT Formulas
**Paper**: https://arxiv.org/abs/2505.14615
## Dataset Summary
- **Size**: 2,100 puzzles
- **Format**: JSONL
## Data Fields
Each JSON object has the following fields:
| Field Name | Description |
|--------------------|-----------------------------------------------------------------------------|
| `dims` | List of integers describing the dimensional structure of variables |
| `num_vars` | Total number of variables |
| `num_clauses` | Total number of clauses in the CNF formula |
| `readable` | Readable CNF formula (e.g., in `(¬x(0,1) ∨ x(1,2)) ∧ ...` format) |
| `satisfiable` | Boolean: whether the formula is SAT or UNSAT |
| `scenario` | A natural language background context for the puzzle |
| `variable_mapping` | Mapping from variables to their real-world meanings |
| `conditions` | List of natural language constraints corresponding to the CNF clauses |
| `question` | Final natural language question to be answered by a model |
## Usage
You can load the dataset with:
```python
from datasets import load_dataset
satbench = load_dataset("LLM4Code/SATBench")
|
Jietson/Info_v0.9 | Jietson | 2025-05-04T10:00:32Z | 0 | 0 | [
"region:us"
] | [] | 2025-05-04T09:00:58Z | 0 | ---
dataset_info:
features:
- name: question_id
dtype: string
- name: qtype
dtype: int64
- name: image
dtype: image
- name: question
dtype: string
- name: answer
dtype: string
- name: instructions
dtype: string
splits:
- name: train
num_bytes: 18047717333.772
num_examples: 50844
download_size: 16646284631
dataset_size: 18047717333.772
configs:
- config_name: default
data_files:
- split: train
path: data/train-*
---
|
alea-institute/kl3m-data-dotgov-www.nws.noaa.gov | alea-institute | 2025-04-11T01:55:58Z | 51 | 0 | [
"size_categories:n<1K",
"format:parquet",
"modality:text",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"arxiv:2504.07854",
"arxiv:2503.17247",
"region:us"
] | [] | 2025-02-01T16:13:14Z | 0 | ---
dataset_info:
features:
- name: identifier
dtype: string
- name: dataset
dtype: string
- name: mime_type
dtype: string
- name: tokens
sequence: int64
splits:
- name: train
num_bytes: 29253
num_examples: 5
download_size: 9277
dataset_size: 29253
configs:
- config_name: default
data_files:
- split: train
path: data/train-*
---
# KL3M Data Project
> **Note**: This page provides general information about the KL3M Data Project. Additional details specific to this dataset will be added in future updates. For complete information, please visit the [GitHub repository](https://github.com/alea-institute/kl3m-data) or refer to the [KL3M Data Project paper](https://arxiv.org/abs/2504.07854).
## Description
This dataset is part of the [ALEA Institute's](https://aleainstitute.ai/) KL3M Data Project, which provides copyright-clean training resources for large language models.
## Dataset Details
- **Format**: Parquet files containing document text and metadata
- **License**: [CC BY 4.0](https://creativecommons.org/licenses/by/4.0/)
- **Tokenizer**: The `tokens` field uses the [kl3m-004-128k-cased](https://huggingface.co/alea-institute/kl3m-004-128k-cased) tokenizer, a case-sensitive 128K vocabulary tokenizer optimized for legal, financial, and enterprise documents
## Abstract
Practically all large language models have been pre-trained on data that is subject to global uncertainty related to copyright infringement and breach of contract. This creates potential risk for users and developers due to this uncertain legal status. The KL3M Data Project directly confronts this critical issue by introducing the largest comprehensive training data pipeline that minimizes risks related to copyright or breach of contract.
The foundation of this project is a corpus of over 132 million documents and trillions of tokens spanning 16 different sources that have been verified to meet the strict copyright and licensing protocol detailed in the project. We are releasing the entire pipeline, including:
1. The source code to acquire and process these documents
2. The original document formats with associated provenance and metadata
3. Extracted content in a standardized format
4. Pre-tokenized representations of the documents
5. Various mid- and post-train resources such as question-answer, summarization, conversion, drafting, classification, prediction, and conversational data
All of these resources are freely available to the public on S3, Hugging Face, and GitHub under CC-BY terms. We are committed to continuing this project in furtherance of a more ethical, legal, and sustainable approach to the development and use of AI models.
## Legal Basis
This dataset is fully compliant with copyright law and contractual terms. The content is included based on the following legal foundation:
- Public domain materials
- US government works
- Open access content under permissive licenses
- Content explicitly licensed for AI training
## Papers
For more information about the KL3M Data Project, please refer to:
- [The KL3M Data Project: Copyright-Clean Training Resources for Large Language Models](https://arxiv.org/abs/2504.07854)
- [KL3M Tokenizers: A Family of Domain-Specific and Character-Level Tokenizers for Legal, Financial, and Preprocessing Applications](https://arxiv.org/abs/2503.17247)
## Citation
If you use this dataset in your research, please cite:
```bibtex
@misc{bommarito2025kl3mdata,
title={The KL3M Data Project: Copyright-Clean Training Resources for Large Language Models},
author={Bommarito II, Michael J. and Bommarito, Jillian and Katz, Daniel Martin},
year={2025},
eprint={2504.07854},
archivePrefix={arXiv},
primaryClass={cs.CL}
}
```
```bibtex
@misc{bommarito2025kl3m,
title={KL3M Tokenizers: A Family of Domain-Specific and Character-Level Tokenizers for Legal, Financial, and Preprocessing Applications},
author={Bommarito II, Michael J. and Katz, Daniel Martin and Bommarito, Jillian},
year={2025},
eprint={2503.17247},
archivePrefix={arXiv},
primaryClass={cs.CL}
}
```
## About ALEA
The ALEA Institute is a non-profit research organization focused on advancing AI for business, law, and governance. Learn more at [https://aleainstitute.ai/](https://aleainstitute.ai/). |
AiSalsman/Example_Sales_Calls | AiSalsman | 2025-01-19T08:08:12Z | 25 | 1 | [
"language:sv",
"license:llama3.2",
"size_categories:n<1K",
"format:json",
"modality:text",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"region:us",
"finance"
] | [] | 2025-01-07T21:35:42Z | 0 | ---
license: llama3.2
language:
- sv
tags:
- finance
pretty_name: Sales Calls
--- |
darthPanda/cvqa_edit3 | darthPanda | 2024-12-31T15:52:37Z | 63 | 0 | [
"size_categories:n<1K",
"format:parquet",
"modality:image",
"modality:text",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"region:us"
] | [] | 2024-12-31T15:52:26Z | 0 | ---
dataset_info:
features:
- name: image
dtype: image
- name: ID
dtype: string
- name: Subset
dtype: string
- name: Question
dtype: string
- name: Translated Question
dtype: string
- name: Options
sequence: string
- name: Translated Options
sequence: string
- name: Label
dtype: int64
- name: Category
dtype: string
- name: Image Type
dtype: string
- name: Image Source
dtype: string
- name: License
dtype: string
splits:
- name: test
num_bytes: 212281731.51821864
num_examples: 439
download_size: 210846756
dataset_size: 212281731.51821864
configs:
- config_name: default
data_files:
- split: test
path: data/test-*
---
|
hrhraj/eval_ACT_so100_dice_red_v1 | hrhraj | 2025-05-08T14:58:31Z | 31 | 0 | [
"task_categories:robotics",
"license:apache-2.0",
"size_categories:1K<n<10K",
"format:parquet",
"modality:tabular",
"modality:timeseries",
"modality:video",
"library:datasets",
"library:dask",
"library:mlcroissant",
"library:polars",
"region:us",
"LeRobot",
"so100",
"dice",
"red",
"eval",
"act"
] | [
"robotics"
] | 2025-05-08T04:58:50Z | 0 | ---
license: apache-2.0
task_categories:
- robotics
tags:
- LeRobot
- so100
- dice
- red
- eval
- act
configs:
- config_name: default
data_files: data/*/*.parquet
---
This dataset was created using [LeRobot](https://github.com/huggingface/lerobot).
## Dataset Description
- **Homepage:** [More Information Needed]
- **Paper:** [More Information Needed]
- **License:** apache-2.0
## Dataset Structure
[meta/info.json](meta/info.json):
```json
{
"codebase_version": "v2.1",
"robot_type": "so100",
"total_episodes": 1,
"total_frames": 301,
"total_tasks": 1,
"total_videos": 3,
"total_chunks": 1,
"chunks_size": 1000,
"fps": 30,
"splits": {
"train": "0:1"
},
"data_path": "data/chunk-{episode_chunk:03d}/episode_{episode_index:06d}.parquet",
"video_path": "videos/chunk-{episode_chunk:03d}/{video_key}/episode_{episode_index:06d}.mp4",
"features": {
"action": {
"dtype": "float32",
"shape": [
6
],
"names": [
"main_shoulder_pan",
"main_shoulder_lift",
"main_elbow_flex",
"main_wrist_flex",
"main_wrist_roll",
"main_gripper"
]
},
"observation.state": {
"dtype": "float32",
"shape": [
6
],
"names": [
"main_shoulder_pan",
"main_shoulder_lift",
"main_elbow_flex",
"main_wrist_flex",
"main_wrist_roll",
"main_gripper"
]
},
"observation.images.laptop": {
"dtype": "video",
"shape": [
480,
640,
3
],
"names": [
"height",
"width",
"channels"
],
"info": {
"video.height": 480,
"video.width": 640,
"video.codec": "av1",
"video.pix_fmt": "yuv420p",
"video.is_depth_map": false,
"video.fps": 30,
"video.channels": 3,
"has_audio": false
}
},
"observation.images.phone": {
"dtype": "video",
"shape": [
480,
640,
3
],
"names": [
"height",
"width",
"channels"
],
"info": {
"video.height": 480,
"video.width": 640,
"video.codec": "av1",
"video.pix_fmt": "yuv420p",
"video.is_depth_map": false,
"video.fps": 30,
"video.channels": 3,
"has_audio": false
}
},
"observation.images.gripper": {
"dtype": "video",
"shape": [
480,
640,
3
],
"names": [
"height",
"width",
"channels"
],
"info": {
"video.height": 480,
"video.width": 640,
"video.codec": "av1",
"video.pix_fmt": "yuv420p",
"video.is_depth_map": false,
"video.fps": 30,
"video.channels": 3,
"has_audio": false
}
},
"timestamp": {
"dtype": "float32",
"shape": [
1
],
"names": null
},
"frame_index": {
"dtype": "int64",
"shape": [
1
],
"names": null
},
"episode_index": {
"dtype": "int64",
"shape": [
1
],
"names": null
},
"index": {
"dtype": "int64",
"shape": [
1
],
"names": null
},
"task_index": {
"dtype": "int64",
"shape": [
1
],
"names": null
}
}
}
```
## Citation
**BibTeX:**
```bibtex
[More Information Needed]
``` |
gpunahar4/tools_dataset_final | gpunahar4 | 2025-05-16T10:48:24Z | 0 | 0 | [
"size_categories:1K<n<10K",
"format:parquet",
"modality:text",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"region:us"
] | [] | 2025-05-16T10:48:21Z | 0 | ---
dataset_info:
features:
- name: image
struct:
- name: path
dtype: string
- name: conditioning_image
struct:
- name: path
dtype: string
- name: caption
dtype: string
- name: yolo_annotation
dtype: string
splits:
- name: train
num_bytes: 1073376
num_examples: 4000
download_size: 135121
dataset_size: 1073376
configs:
- config_name: default
data_files:
- split: train
path: data/train-*
---
|
loluvulol/princesses-of-color-dataset | loluvulol | 2025-04-06T02:38:17Z | 12 | 0 | [
"size_categories:n<1K",
"format:parquet",
"modality:image",
"modality:text",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"region:us"
] | [] | 2025-04-06T02:37:55Z | 0 | ---
dataset_info:
features:
- name: image
dtype: image
- name: text
dtype: string
splits:
- name: train
num_bytes: 2224242.0
num_examples: 4
download_size: 2225643
dataset_size: 2224242.0
configs:
- config_name: default
data_files:
- split: train
path: data/train-*
---
|
limingme/hssd_dataset_old | limingme | 2025-04-28T14:50:59Z | 23 | 0 | [
"size_categories:100K<n<1M",
"format:parquet",
"modality:text",
"library:datasets",
"library:dask",
"library:mlcroissant",
"library:polars",
"region:us"
] | [] | 2025-04-28T14:50:47Z | 0 | ---
dataset_info:
features:
- name: building_name
dtype: string
- name: scene_graph
struct:
- name: links
sequence: string
- name: nodes
struct:
- name: agent
list:
- name: id
dtype: string
- name: location
dtype: string
- name: asset
list:
- name: affordances
sequence: string
- name: attributes
sequence: 'null'
- name: id
dtype: string
- name: room
dtype: string
- name: building
list:
- name: id
dtype: string
- name: floor
list:
- name: id
dtype: string
- name: object
list:
- name: affordances
sequence: string
- name: id
dtype: string
- name: parent
dtype: string
- name: room
dtype: string
- name: states
struct:
- name: is_clean
dtype: bool
- name: is_filled
dtype: bool
- name: is_powered_on
dtype: bool
- name: type
dtype: string
- name: room
list:
- name: id
dtype: string
- name: task
dtype: string
- name: scene_from_episodes
sequence: string
- name: num_objects
dtype: int64
- name: data_category
dtype: string
splits:
- name: train
num_bytes: 768976716
num_examples: 111751
- name: val
num_bytes: 7416652
num_examples: 1000
download_size: 21544557
dataset_size: 776393368
configs:
- config_name: default
data_files:
- split: train
path: data/train-*
- split: val
path: data/val-*
---
|
Soraki5th/distilled-vn-gen-llm | Soraki5th | 2025-03-24T08:34:41Z | 16 | 0 | [
"license:apache-2.0",
"size_categories:n<1K",
"format:json",
"modality:text",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"region:us"
] | [] | 2025-03-24T08:34:03Z | 0 | ---
license: apache-2.0
---
|
SaharAiPurafi/purafi | SaharAiPurafi | 2025-03-25T12:42:40Z | 21 | 0 | [
"task_categories:text-generation",
"language:ar",
"size_categories:1M<n<10M",
"format:parquet",
"modality:text",
"library:datasets",
"library:dask",
"library:mlcroissant",
"library:polars",
"region:us"
] | [
"text-generation"
] | 2025-03-25T08:46:09Z | 0 | ---
task_categories:
- text-generation
language:
- ar
--- |
iagoalves/dataset_test_dialect_rewrite | iagoalves | 2024-10-16T05:26:31Z | 20 | 0 | [
"size_categories:n<1K",
"format:parquet",
"modality:text",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"region:us"
] | [] | 2024-10-16T05:26:30Z | 0 | ---
dataset_info:
features:
- name: text
dtype: string
- name: dialect
dtype: string
- name: gpt4
dtype: string
- name: check
dtype: bool
- name: ruim
dtype: bool
splits:
- name: train
num_bytes: 338942
num_examples: 580
download_size: 210485
dataset_size: 338942
configs:
- config_name: default
data_files:
- split: train
path: data/train-*
---
|
jkazdan/Llama-3.2-3B-Instruct-original-0-hexphi | jkazdan | 2025-01-02T23:38:43Z | 15 | 0 | [
"size_categories:n<1K",
"format:parquet",
"modality:text",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"region:us"
] | [] | 2025-01-02T23:38:32Z | 0 | ---
dataset_info:
features:
- name: prompt
dtype: string
- name: response
dtype: string
splits:
- name: train
num_bytes: 220842
num_examples: 300
download_size: 120363
dataset_size: 220842
configs:
- config_name: default
data_files:
- split: train
path: data/train-*
---
|
BasedLukas/so101_test_6 | BasedLukas | 2025-05-04T22:35:46Z | 0 | 0 | [
"task_categories:robotics",
"license:apache-2.0",
"region:us",
"LeRobot",
"so101",
"tutorial"
] | [
"robotics"
] | 2025-05-04T22:35:40Z | 0 | ---
license: apache-2.0
task_categories:
- robotics
tags:
- LeRobot
- so101
- tutorial
configs:
- config_name: default
data_files: data/*/*.parquet
---
This dataset was created using [LeRobot](https://github.com/huggingface/lerobot).
## Dataset Description
- **Homepage:** [More Information Needed]
- **Paper:** [More Information Needed]
- **License:** apache-2.0
## Dataset Structure
[meta/info.json](meta/info.json):
```json
{
"codebase_version": "v2.1",
"robot_type": "so101",
"total_episodes": 3,
"total_frames": 870,
"total_tasks": 1,
"total_videos": 6,
"total_chunks": 1,
"chunks_size": 1000,
"fps": 60,
"splits": {
"train": "0:3"
},
"data_path": "data/chunk-{episode_chunk:03d}/episode_{episode_index:06d}.parquet",
"video_path": "videos/chunk-{episode_chunk:03d}/{video_key}/episode_{episode_index:06d}.mp4",
"features": {
"action": {
"dtype": "float32",
"shape": [
6
],
"names": [
"main_shoulder_pan",
"main_shoulder_lift",
"main_elbow_flex",
"main_wrist_flex",
"main_wrist_roll",
"main_gripper"
]
},
"observation.state": {
"dtype": "float32",
"shape": [
6
],
"names": [
"main_shoulder_pan",
"main_shoulder_lift",
"main_elbow_flex",
"main_wrist_flex",
"main_wrist_roll",
"main_gripper"
]
},
"observation.images.pov": {
"dtype": "video",
"shape": [
480,
640,
3
],
"names": [
"height",
"width",
"channels"
],
"info": {
"video.height": 480,
"video.width": 640,
"video.codec": "av1",
"video.pix_fmt": "yuv420p",
"video.is_depth_map": false,
"video.fps": 60,
"video.channels": 3,
"has_audio": false
}
},
"observation.images.overhead": {
"dtype": "video",
"shape": [
360,
640,
3
],
"names": [
"height",
"width",
"channels"
],
"info": {
"video.height": 360,
"video.width": 640,
"video.codec": "av1",
"video.pix_fmt": "yuv420p",
"video.is_depth_map": false,
"video.fps": 60,
"video.channels": 3,
"has_audio": false
}
},
"timestamp": {
"dtype": "float32",
"shape": [
1
],
"names": null
},
"frame_index": {
"dtype": "int64",
"shape": [
1
],
"names": null
},
"episode_index": {
"dtype": "int64",
"shape": [
1
],
"names": null
},
"index": {
"dtype": "int64",
"shape": [
1
],
"names": null
},
"task_index": {
"dtype": "int64",
"shape": [
1
],
"names": null
}
}
}
```
## Citation
**BibTeX:**
```bibtex
[More Information Needed]
``` |
japdong/eii-droid | japdong | 2025-05-17T13:39:33Z | 11 | 0 | [
"task_categories:robotics",
"license:apache-2.0",
"size_categories:1K<n<10K",
"modality:image",
"region:us",
"LeRobot",
"eii-droid",
"panda",
"rlds"
] | [
"robotics"
] | 2025-05-17T05:34:40Z | 0 | ---
license: apache-2.0
task_categories:
- robotics
tags:
- LeRobot
- eii-droid
- panda
- rlds
configs:
- config_name: default
data_files: data/*/*.parquet
---
This dataset was created using [LeRobot](https://github.com/huggingface/lerobot).
## Dataset Description
- **Homepage:** [More Information Needed]
- **Paper:** [More Information Needed]
- **License:** apache-2.0
## Dataset Structure
[meta/info.json](meta/info.json):
```json
{
"codebase_version": "v2.0",
"robot_type": "panda",
"total_episodes": 16,
"total_frames": 6874,
"total_tasks": 1,
"total_videos": 0,
"total_chunks": 1,
"chunks_size": 1000,
"fps": 15,
"splits": {
"train": "0:16"
},
"data_path": "data/chunk-{episode_chunk:03d}/episode_{episode_index:06d}.parquet",
"video_path": "videos/chunk-{episode_chunk:03d}/{video_key}/episode_{episode_index:06d}.mp4",
"features": {
"image": {
"dtype": "image",
"shape": [
180,
320,
3
],
"names": [
"height",
"width",
"channel"
]
},
"wrist_image": {
"dtype": "image",
"shape": [
180,
320,
3
],
"names": [
"height",
"width",
"channel"
]
},
"joint_position": {
"dtype": "float64",
"shape": [
7
],
"names": [
"joint_position"
]
},
"gripper_position": {
"dtype": "float64",
"shape": [
1
],
"names": [
"gripper_position"
]
},
"actions": {
"dtype": "float64",
"shape": [
7
],
"names": [
"actions"
]
},
"timestamp": {
"dtype": "float32",
"shape": [
1
],
"names": null
},
"frame_index": {
"dtype": "int64",
"shape": [
1
],
"names": null
},
"episode_index": {
"dtype": "int64",
"shape": [
1
],
"names": null
},
"index": {
"dtype": "int64",
"shape": [
1
],
"names": null
},
"task_index": {
"dtype": "int64",
"shape": [
1
],
"names": null
}
}
}
```
## Citation
**BibTeX:**
```bibtex
[More Information Needed]
``` |
RyanYr/reflect_math-test_t6_crtc | RyanYr | 2025-04-20T15:25:57Z | 18 | 0 | [
"size_categories:n<1K",
"format:parquet",
"modality:text",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"region:us"
] | [] | 2025-03-29T22:34:48Z | 0 | ---
dataset_info:
features:
- name: problem
dtype: string
- name: solution
dtype: string
- name: answer
dtype: string
- name: subject
dtype: string
- name: level
dtype: int64
- name: unique_id
dtype: string
- name: response@0
sequence: string
- name: response@1
sequence: string
- name: response@2
sequence: string
- name: response@3
sequence: string
- name: response@4
sequence: string
- name: response@5
sequence: string
- name: response@6
sequence: string
- name: response@7
sequence: string
- name: response@8
sequence: string
- name: response@9
sequence: string
- name: response@10
sequence: string
- name: response@11
sequence: string
splits:
- name: train
num_bytes: 7811875
num_examples: 500
download_size: 3242910
dataset_size: 7811875
configs:
- config_name: default
data_files:
- split: train
path: data/train-*
---
|
konwoo/er-irl-k10000-1 | konwoo | 2025-04-20T04:20:05Z | 17 | 0 | [
"size_categories:10K<n<100K",
"format:parquet",
"modality:text",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"region:us"
] | [] | 2025-04-20T04:15:19Z | 0 | ---
dataset_info:
features:
- name: text
dtype: string
splits:
- name: validation
num_bytes: 9866115
num_examples: 1000
- name: train
num_bytes: 98460295
num_examples: 10000
download_size: 71477883
dataset_size: 108326410
configs:
- config_name: default
data_files:
- split: validation
path: data/validation-*
- split: train
path: data/train-*
---
|
archivartaunik/Gemini_transcription_chunk_size_1_file | archivartaunik | 2025-04-05T11:55:37Z | 17 | 0 | [
"size_categories:n<1K",
"format:parquet",
"modality:audio",
"modality:text",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"region:us"
] | [] | 2025-04-05T11:55:32Z | 0 | ---
dataset_info:
features:
- name: File Name
dtype: string
- name: Status
dtype: string
- name: Transcription
dtype: string
- name: Retries
dtype: int64
- name: Last Updated
dtype: string
- name: audio
dtype: audio
splits:
- name: train
num_bytes: 7106949.0
num_examples: 109
download_size: 6762628
dataset_size: 7106949.0
configs:
- config_name: default
data_files:
- split: train
path: data/train-*
---
|
TinySnowy/Hllama3.1_8b_instruct_MU_RedPajama-Data-1T_reservoir_eng_tokenized_normal | TinySnowy | 2025-03-22T17:23:53Z | 8 | 0 | [
"size_categories:10K<n<100K",
"format:parquet",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"region:us"
] | [] | 2025-03-22T17:22:15Z | 0 | ---
dataset_info:
- config_name: arxiv
features:
- name: input_ids
sequence: int32
- name: attention_mask
sequence: int8
- name: labels
sequence: int64
splits:
- name: retain
num_bytes: 270009132
num_examples: 10137
download_size: 65134766
dataset_size: 270009132
- config_name: c4
features:
- name: input_ids
sequence: int32
- name: attention_mask
sequence: int8
- name: labels
sequence: int64
splits:
- name: retain
num_bytes: 27914528
num_examples: 1048
download_size: 2083817
dataset_size: 27914528
- config_name: stackexchange
features:
- name: input_ids
sequence: int32
- name: attention_mask
sequence: int8
- name: labels
sequence: int64
splits:
- name: retain
num_bytes: 27035540
num_examples: 1015
download_size: 1846732
dataset_size: 27035540
- config_name: wikipedia
features:
- name: input_ids
sequence: int32
- name: attention_mask
sequence: int8
- name: labels
sequence: int64
splits:
- name: retain
num_bytes: 73062548
num_examples: 2743
download_size: 16950216
dataset_size: 73062548
configs:
- config_name: arxiv
data_files:
- split: retain
path: arxiv/retain-*
- config_name: c4
data_files:
- split: retain
path: c4/retain-*
- config_name: stackexchange
data_files:
- split: retain
path: stackexchange/retain-*
- config_name: wikipedia
data_files:
- split: retain
path: wikipedia/retain-*
---
|
rikeshsilwalekg/call-conversation-llm-tokenized-Llama-3.2-1B-Instruct-maxseq-2048-augmented | rikeshsilwalekg | 2025-03-09T07:31:47Z | 32 | 0 | [
"size_categories:100K<n<1M",
"format:parquet",
"library:datasets",
"library:dask",
"library:mlcroissant",
"library:polars",
"region:us"
] | [] | 2025-03-09T07:31:20Z | 0 | ---
dataset_info:
features:
- name: input_ids
sequence: int32
- name: attention_mask
sequence: int8
splits:
- name: train
num_bytes: 1194445392
num_examples: 116554
download_size: 17818537
dataset_size: 1194445392
configs:
- config_name: default
data_files:
- split: train
path: data/train-*
---
|
1231czx/llama31_2e6_packed_add76k_ep2tmp07 | 1231czx | 2024-12-25T16:56:16Z | 54 | 0 | [
"size_categories:10K<n<100K",
"format:parquet",
"modality:text",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"region:us"
] | [] | 2024-12-25T16:56:14Z | 0 | ---
dataset_info:
features:
- name: idx
dtype: int64
- name: gt
dtype: string
- name: prompt
dtype: string
- name: level
dtype: string
- name: type
dtype: string
- name: solution
dtype: string
- name: my_solu
sequence: string
- name: pred
sequence: string
- name: rewards
sequence: bool
splits:
- name: train
num_bytes: 57768564
num_examples: 15000
download_size: 19808307
dataset_size: 57768564
configs:
- config_name: default
data_files:
- split: train
path: data/train-*
---
|
mmmanuel/code_preference_pair | mmmanuel | 2025-06-02T11:27:19Z | 0 | 0 | [
"size_categories:10K<n<100K",
"format:parquet",
"modality:text",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"region:us"
] | [] | 2025-06-02T10:16:33Z | 0 | ---
dataset_info:
features:
- name: prompt
dtype: string
- name: chosen
dtype: string
- name: rejected
dtype: string
- name: source
dtype: string
splits:
- name: train
num_bytes: 200107263
num_examples: 54024
download_size: 95387368
dataset_size: 200107263
configs:
- config_name: default
data_files:
- split: train
path: data/train-*
---
|
aliMohammad16/einstein_answers | aliMohammad16 | 2025-03-11T12:52:37Z | 23 | 0 | [
"task_categories:question-answering",
"task_categories:text-generation",
"task_categories:sentence-similarity",
"language:en",
"license:apache-2.0",
"size_categories:n<1K",
"format:json",
"modality:text",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"region:us",
"chemistry",
"code",
"synthetic"
] | [
"question-answering",
"text-generation",
"sentence-similarity"
] | 2025-02-27T11:26:42Z | 0 | ---
license: apache-2.0
task_categories:
- question-answering
- text-generation
- sentence-similarity
language:
- en
tags:
- chemistry
- code
- synthetic
pretty_name: What would Einstein say?
size_categories:
- 1K<n<10K
---
# What would Einstein Say?
This dataset contains a set of questions and answers, mimicking Einstein's approach to answer general scientific and philosophical queries.
The data points have been generated synthetically, however the factual correctness of the data is ensured, not guaranteed whatsoever.
|
copeda/samsum_max_500 | copeda | 2024-11-07T02:23:54Z | 21 | 0 | [
"size_categories:10K<n<100K",
"format:parquet",
"modality:text",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"region:us"
] | [] | 2024-11-07T02:23:44Z | 0 | ---
dataset_info:
features:
- name: id
dtype: string
- name: input
dtype: string
- name: output
dtype: string
splits:
- name: train
num_bytes: 7880251.450846192
num_examples: 12857
- name: test
num_bytes: 985567.7322050772
num_examples: 1608
- name: validation
num_bytes: 984954.8169487307
num_examples: 1607
- name: discarded
num_bytes: 679242.0
num_examples: 297
download_size: 6742895
dataset_size: 10530016.0
configs:
- config_name: default
data_files:
- split: train
path: data/train-*
- split: test
path: data/test-*
- split: validation
path: data/validation-*
- split: discarded
path: data/discarded-*
---
|
stefanbschneider/lfqa_preprocessed | stefanbschneider | 2025-02-07T16:15:42Z | 38 | 0 | [
"task_categories:question-answering",
"task_categories:text2text-generation",
"language:en",
"license:mit",
"size_categories:100K<n<1M",
"format:parquet",
"modality:text",
"library:datasets",
"library:dask",
"library:mlcroissant",
"library:polars",
"region:us"
] | [
"question-answering",
"text2text-generation"
] | 2025-02-07T09:36:54Z | 0 | ---
dataset_info:
features:
- name: question
dtype: string
- name: answer
dtype: string
- name: context
sequence: string
splits:
- name: train
num_bytes: 1103867201.974574
num_examples: 218894
- name: validation
num_bytes: 14929675.549668875
num_examples: 2904
download_size: 651254676
dataset_size: 1118796877.5242429
configs:
- config_name: default
data_files:
- split: train
path: data/train-*
- split: validation
path: data/validation-*
license: mit
task_categories:
- question-answering
- text2text-generation
language:
- en
size_categories:
- 100K<n<1M
---
# Dataset Card for "stefanbschneider/lfqa_preprocessed"
## Table of Contents
- [Table of Contents](#table-of-contents)
- [Dataset Description](#dataset-description)
- [Dataset Summary](#dataset-summary)
- [Dataset Structure](#dataset-structure)
- [Data Instances](#data-instances)
- [Data Fields](#data-fields)
- [Data Splits](#data-splits)
- [Additional Information](#additional-information)
- [Licensing Information](#licensing-information)
## Dataset Description
The dataset contains simple, long-form answers to questions and corresponding contexts.
Similar to ELI5 but with context.
This dataset is a filtered version of [LLukas22/lfqa_preprocessed](https://huggingface.co/datasets/LLukas22/lfqa_preprocessed),
which in turn is a processed and simplified version of of [vblagoje's](https://huggingface.co/vblagoje) *[lfqa_support_docs](https://huggingface.co/datasets/vblagoje/lfqa_support_docs)* and *[lfqa](https://huggingface.co/datasets/vblagoje/lfqa)* datasets.
This dataset (stefanbschneider/lfqa_preprocessed) has filtered out overly long answers (around 3%).
It can be reproduced with the notebook `process-lfqa-dataset.ipynb`.
LLukas22/lfqa_preprocessed | stefanbschneider/lfqa_preprocessed
:-------------------------:|:-------------------------:
 | 
Max answer length: 26123 chars | Max answer length: 7035 chars (more than 3x shorter)
Num answers (train): 226147 | Num answers (train): 218894 (~3% less)
Details of the original LFQA dataset: [https://towardsdatascience.com/long-form-qa-beyond-eli5-an-updated-dataset-and-approach-319cb841aabb](https://towardsdatascience.com/long-form-qa-beyond-eli5-an-updated-dataset-and-approach-319cb841aabb)
## Dataset Structure
### Data Instances
An example of 'train' looks as follows.
```json
{
"question": "what's the difference between a forest and a wood?",
"answer": "They're used interchangeably a lot. You'll get different answers from different resources, but the ...",
"context": [
"Wood is divided, according to its botanical origin, into two kinds: softwoods, ...",
"Processing and products differs especially with regard to the distinction between softwood and hardwood ..."
]
}
```
### Data Fields
The data fields are the same among all splits.
- `question`: a `string` feature.
- `answer`: a `string` feature.
- `context`: a list feature containing `string` features.
### Data Splits
| name |train|validation|
|----------|----:|---------:|
| |218894| 2904|
## Additional Information
### Licensing Information
This dataset is distributed under the MIT licence. |
alea-institute/kl3m-filter-data-dotgov-www.gao.gov | alea-institute | 2025-02-04T15:22:25Z | 15 | 0 | [
"size_categories:n<1K",
"format:parquet",
"modality:text",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"region:us"
] | [] | 2025-02-04T15:22:23Z | 0 | ---
dataset_info:
features:
- name: identifier
dtype: string
- name: dataset
dtype: string
- name: mime_type
dtype: string
- name: score
dtype: float64
- name: tokens
sequence: int64
splits:
- name: train
num_bytes: 13781717
num_examples: 929
download_size: 2953282
dataset_size: 13781717
configs:
- config_name: default
data_files:
- split: train
path: data/train-*
---
|
zhaooooooo/images | zhaooooooo | 2025-01-02T15:20:24Z | 13 | 0 | [
"license:apache-2.0",
"region:us"
] | [] | 2025-01-02T15:20:24Z | 0 | ---
license: apache-2.0
---
|
ZixuanKe/cfa_extracted_exercise_sup_sample_from_policy_v1.1_dpo_binarized_train_chunk_8 | ZixuanKe | 2024-11-13T18:43:51Z | 16 | 0 | [
"size_categories:n<1K",
"format:parquet",
"modality:text",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"region:us"
] | [] | 2024-11-13T18:43:50Z | 0 | ---
dataset_info:
features:
- name: prompt
dtype: string
- name: rejected
dtype: string
- name: chosen
dtype: string
splits:
- name: train
num_bytes: 1168253
num_examples: 633
download_size: 288232
dataset_size: 1168253
configs:
- config_name: default
data_files:
- split: train
path: data/train-*
---
|
supergoose/flan_combined_task789_pawsx_french_english_translation | supergoose | 2025-03-03T00:40:07Z | 15 | 0 | [
"size_categories:n<1K",
"format:parquet",
"modality:text",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"region:us"
] | [] | 2025-03-03T00:40:07Z | 0 | ---
dataset_info:
features:
- name: inputs
dtype: string
- name: targets
dtype: string
- name: _template_idx
dtype: int64
- name: _task_source
dtype: string
- name: _task_name
dtype: string
- name: _template_type
dtype: string
splits:
- name: train
num_bytes: 618180
num_examples: 745
download_size: 188497
dataset_size: 618180
configs:
- config_name: default
data_files:
- split: train
path: data/train-*
---
|
argilla-internal-testing/test_import_dataset_from_hub_with_classlabel_af3ca91e-ca8c-4d6b-a2f4-4814e0738658 | argilla-internal-testing | 2024-10-22T13:42:30Z | 18 | 0 | [
"size_categories:n<1K",
"format:parquet",
"modality:text",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"region:us"
] | [] | 2024-10-22T13:42:29Z | 0 | ---
dataset_info:
features:
- name: text
dtype: string
- name: label
dtype:
class_label:
names:
'0': positive
'1': negative
splits:
- name: train
num_bytes: 111
num_examples: 3
download_size: 1454
dataset_size: 111
configs:
- config_name: default
data_files:
- split: train
path: data/train-*
---
|
emrecan/nli_tr_for_simcse | emrecan | 2023-01-25T16:56:04Z | 56 | 1 | [
"task_categories:text-classification",
"task_ids:semantic-similarity-scoring",
"task_ids:text-scoring",
"source_datasets:nli_tr",
"language:tr",
"size_categories:100K<n<1M",
"format:csv",
"modality:text",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"region:us"
] | [
"text-classification"
] | 2022-03-22T12:01:59Z | 0 | ---
language:
- tr
size_categories:
- 100K<n<1M
source_datasets:
- nli_tr
task_categories:
- text-classification
task_ids:
- semantic-similarity-scoring
- text-scoring
---
# NLI-TR for Supervised SimCSE
This dataset is a modified version of [NLI-TR](https://huggingface.co/datasets/nli_tr) dataset. Its intended use is to train Supervised [SimCSE](https://github.com/princeton-nlp/SimCSE) models for sentence-embeddings. Steps followed to produce this dataset are listed below:
1. Merge train split of snli_tr and multinli_tr subsets.
2. Find every premise that has an entailment hypothesis **and** a contradiction hypothesis.
3. Write found triplets into sent0 (premise), sent1 (entailment hypothesis), hard_neg (contradiction hypothesis) format.
See this [Colab Notebook](https://colab.research.google.com/drive/1Ysq1SpFOa7n1X79x2HxyWjfKzuR_gDQV?usp=sharing) for training and evaluation on Turkish sentences. |
carlfeynman/Bharat_NanoFiQA2018_hi | carlfeynman | 2025-01-21T03:26:21Z | 45 | 0 | [
"task_categories:text-retrieval",
"task_ids:document-retrieval",
"multilinguality:monolingual",
"source_datasets:NanoFiQA2018",
"language:hi",
"license:cc-by-4.0",
"size_categories:1K<n<10K",
"format:parquet",
"modality:text",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"region:us",
"text-retrieval"
] | [
"text-retrieval"
] | 2025-01-21T03:21:04Z | 0 |
---
language:
- hi
license: cc-by-4.0
multilinguality:
- monolingual
source_datasets:
- NanoFiQA2018
task_categories:
- text-retrieval
task_ids:
- document-retrieval
tags:
- text-retrieval
dataset_info:
- config_name: corpus
features:
- name: _id
dtype: string
- name: text
dtype: string
splits:
- name: train
- config_name: qrels
features:
- name: query-id
dtype: string
- name: corpus-id
dtype: string
splits:
- name: train
- config_name: queries
features:
- name: _id
dtype: string
- name: text
dtype: string
splits:
- name: train
configs:
- config_name: corpus
data_files:
- split: train
path: corpus/train-*
- config_name: qrels
data_files:
- split: train
path: qrels/train-*
- config_name: queries
data_files:
- split: train
path: queries/train-*
---
# Bharat-NanoBEIR: Indian Language Information Retrieval Dataset
## Overview
This dataset is part of the Bharat-NanoBEIR collection, which provides information retrieval datasets for Indian languages. It is derived from the NanoBEIR project, which offers smaller versions of BEIR datasets containing 50 queries and up to 10K documents each.
## Dataset Description
This particular dataset is the Hindi version of the NanoFiQA2018 dataset, specifically adapted for information retrieval tasks. The translation and adaptation maintain the core structure of the original NanoBEIR while making it accessible for Hindi language processing.
## Usage
This dataset is designed for:
- Information Retrieval (IR) system development in Hindi
- Evaluation of multilingual search capabilities
- Cross-lingual information retrieval research
- Benchmarking Hindi language models for search tasks
## Dataset Structure
The dataset consists of three main components:
1. **Corpus**: Collection of documents in Hindi
2. **Queries**: Search queries in Hindi
3. **QRels**: Relevance judgments connecting queries to relevant documents
## Citation
If you use this dataset, please cite:
```
@misc{bharat-nanobeir,
title={Bharat-NanoBEIR: Indian Language Information Retrieval Datasets},
year={2024},
url={https://huggingface.co/datasets/carlfeynman/Bharat_NanoFiQA2018_hi}
}
```
## Additional Information
- **Language**: Hindi (hi)
- **License**: CC-BY-4.0
- **Original Dataset**: NanoBEIR
- **Domain**: Information Retrieval
## License
This dataset is licensed under CC-BY-4.0. Please see the LICENSE file for details.
|
RashmiNaik/ebay_products_dataset_for_llm | RashmiNaik | 2025-01-14T10:42:41Z | 17 | 0 | [
"size_categories:1K<n<10K",
"format:parquet",
"modality:text",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"region:us"
] | [] | 2025-01-14T10:42:40Z | 0 | ---
dataset_info:
features:
- name: inputs
dtype: string
- name: outputs
struct:
- name: General Category
dtype: string
- name: Keywords
dtype: string
- name: Parent Category
dtype: string
- name: Primary Category
dtype: string
splits:
- name: train
num_bytes: 3407756
num_examples: 4342
download_size: 437402
dataset_size: 3407756
configs:
- config_name: default
data_files:
- split: train
path: data/train-*
---
|
m-newhauser/rag-synthetic-distilabel | m-newhauser | 2025-04-15T14:14:22Z | 28 | 0 | [
"size_categories:1K<n<10K",
"format:parquet",
"modality:text",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"region:us"
] | [] | 2025-04-15T14:14:20Z | 0 | ---
dataset_info:
features:
- name: context
dtype: string
- name: anchor
dtype: string
- name: human_positive
dtype: string
- name: synthetic_positive
dtype: string
- name: synthetic_negative
dtype: string
splits:
- name: train
num_bytes: 5123747
num_examples: 4989
download_size: 1133732
dataset_size: 5123747
configs:
- config_name: default
data_files:
- split: train
path: data/train-*
---
|
damienD13/activate_coffee_machine_003 | damienD13 | 2025-06-09T15:11:08Z | 0 | 0 | [
"license:apache-2.0",
"region:us"
] | [] | 2025-06-09T15:11:08Z | 0 | ---
license: apache-2.0
---
|
wentingzhao/mbpp_Qwen2.5-Coder-3B-Instruct_temp0.1_num8_generated_code | wentingzhao | 2025-04-29T00:22:07Z | 22 | 0 | [
"size_categories:n<1K",
"format:parquet",
"modality:text",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"region:us"
] | [] | 2025-04-29T00:22:05Z | 0 | ---
dataset_info:
features:
- name: task_id
dtype: int32
- name: text
dtype: string
- name: code
dtype: string
- name: test_list
sequence: string
- name: test_setup_code
dtype: string
- name: challenge_test_list
sequence: string
- name: generated_code
sequence: string
- name: gt_rewards
sequence: float64
- name: execution_rewards
sequence: float64
splits:
- name: test
num_bytes: 5306330
num_examples: 500
download_size: 922047
dataset_size: 5306330
configs:
- config_name: default
data_files:
- split: test
path: data/test-*
---
|
pixelbombe/synth-dent-test | pixelbombe | 2024-11-04T14:24:42Z | 25 | 0 | [
"task_categories:text-generation",
"language:de",
"license:llama3.2",
"size_categories:n<1K",
"format:csv",
"modality:text",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"region:us"
] | [
"text-generation"
] | 2024-11-04T14:04:52Z | 0 | ---
license: llama3.2
task_categories:
- text-generation
language:
- de
size_categories:
- n<1K
--- |
Tandogan/dpo_dataset_final | Tandogan | 2025-05-20T10:36:27Z | 0 | 0 | [
"size_categories:10K<n<100K",
"format:parquet",
"modality:text",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"region:us"
] | [] | 2025-05-20T10:36:12Z | 0 | ---
dataset_info:
features:
- name: prompt
dtype: string
- name: chosen
dtype: string
- name: rejected
dtype: string
- name: dataset
dtype: string
splits:
- name: train
num_bytes: 64918774.41073196
num_examples: 18591
- name: valid
num_bytes: 8115283.29463402
num_examples: 2324
- name: test
num_bytes: 8115283.29463402
num_examples: 2324
download_size: 43710351
dataset_size: 81149340.99999999
configs:
- config_name: default
data_files:
- split: train
path: data/train-*
- split: valid
path: data/valid-*
- split: test
path: data/test-*
---
|
argilla-internal-testing/test_import_dataset_from_hub_with_classlabel_1d64a45f-9ba1-49b9-8343-e7b96f622c48 | argilla-internal-testing | 2025-02-17T10:43:38Z | 16 | 0 | [
"size_categories:n<1K",
"format:parquet",
"modality:text",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"region:us"
] | [] | 2025-02-17T10:43:37Z | 0 | ---
dataset_info:
features:
- name: text
dtype: string
- name: label
dtype:
class_label:
names:
'0': positive
'1': negative
splits:
- name: train
num_bytes: 111
num_examples: 3
download_size: 1256
dataset_size: 111
configs:
- config_name: default
data_files:
- split: train
path: data/train-*
---
|
rafaelcf/ultrafeedback-dpo-authoritative-high-temp-flavor | rafaelcf | 2025-06-04T01:23:45Z | 0 | 0 | [
"size_categories:10K<n<100K",
"format:parquet",
"modality:text",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"region:us"
] | [] | 2025-06-04T01:23:30Z | 0 | ---
dataset_info:
features:
- name: flavor_prompt
dtype: string
- name: prompt_id
dtype: string
- name: prompt
dtype: string
- name: rejected
list:
- name: content
dtype: string
- name: role
dtype: string
- name: chosen
list:
- name: content
dtype: string
- name: role
dtype: string
splits:
- name: train
num_bytes: 136373358
num_examples: 29717
- name: validation
num_bytes: 9182045
num_examples: 1967
download_size: 77632506
dataset_size: 145555403
configs:
- config_name: default
data_files:
- split: train
path: data/train-*
- split: validation
path: data/validation-*
---
|
SolaraFinch/Code_generation | SolaraFinch | 2025-02-13T03:36:51Z | 16 | 0 | [
"license:apache-2.0",
"region:us"
] | [] | 2025-02-13T03:10:12Z | 0 | ---
license: apache-2.0
---
|
TAUR-dev/SIE_EVAL__Countdown3arg_BoN__rl-ckpt-150__samples__bf_evaluated | TAUR-dev | 2025-06-17T04:49:48Z | 0 | 0 | [
"size_categories:1K<n<10K",
"format:parquet",
"modality:tabular",
"modality:text",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"region:us"
] | [] | 2025-06-17T04:49:45Z | 0 | ---
dataset_info:
features:
- name: doc_id
dtype: int64
- name: doc
dtype: string
- name: target
dtype: string
- name: arguments
dtype: string
- name: exact_match
dtype: int64
- name: extracted_answers
dtype: string
- name: source_file
dtype: string
- name: info
dtype: string
- name: eval_type
dtype: string
- name: response_to_evaluate
dtype: string
- name: row_idx
dtype: int64
- name: gen_idx
dtype: int64
- name: eval_extracted_answer
dtype: string
- name: answer_extraction_llm_prompt
dtype: string
- name: answer_extraction_reasoning
dtype: string
- name: answer_idx
dtype: int64
- name: answer_is_correct
dtype: bool
- name: answer_judgement_reasoning
dtype: string
- name: answer_judgement_llm_prompt
dtype: string
- name: internal_answers_per_gen
sequence:
sequence: string
- name: internal_answers_is_correct_per_gen
sequence:
sequence: bool
- name: internal_answers_judgement_reasoning_per_gen
sequence:
sequence: string
- name: internal_answers_judgement_llm_prompt_per_gen
sequence:
sequence: string
- name: responses_to_evaluate
sequence: string
- name: eval_extracted_answers
sequence: string
- name: answer_is_corrects
sequence: bool
- name: mock_budget_force_convo
list:
- name: content
dtype: string
- name: role
dtype: string
splits:
- name: train
num_bytes: 114896505
num_examples: 1604
download_size: 26010426
dataset_size: 114896505
configs:
- config_name: default
data_files:
- split: train
path: data/train-*
---
|
livebench/liveswebench | livebench | 2025-03-31T15:56:01Z | 510 | 1 | [
"language:en",
"size_categories:n<1K",
"format:json",
"modality:text",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"region:us"
] | [] | 2025-03-31T15:41:09Z | 0 | ---
pretty_name: LiveSWEBench
language:
- en
size_categories:
- 1K<n<10K
---
# LiveSWEBench Tasks
This dataset contains all task instances for the [LiveSWEBench](https://liveswebench.ai) benchmark. Tasks are stored in the following format:
1. repo_name (str): the name of the repository for this task
2. task_num (int): the original PR number for the task, used now as an identifier
3. gold_patch (str): the actual changes made in the PR to resolve the issue in this task
4. test_patch (str): the changes made to test files to validate the task solution
5. edit_patch (str): a subset of the gold patch containing changes to just one file
6. autocomplete_patch (str): a subset of hunks from the gold patch for the autocomplete task
7. prompt (str): the prompt for the agent task
8. edit_prompt (str): the prompt used for the edit task
9. autocopmlete_prompts (str): one line snippet for each hunk in autocomplete_patch, to be pasted to trigger the autocomplete
10. commit (str): the base commit hash for the task |
dgambettavuw/D_gen5_run1_llama2-7b_wiki_doc1000_real96_synt32_vuw | dgambettavuw | 2024-12-21T07:15:31Z | 16 | 0 | [
"size_categories:1K<n<10K",
"format:parquet",
"modality:text",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"region:us"
] | [] | 2024-12-21T07:15:27Z | 0 | ---
dataset_info:
features:
- name: id
dtype: int64
- name: doc
dtype: string
splits:
- name: train
num_bytes: 618205
num_examples: 1000
download_size: 381071
dataset_size: 618205
configs:
- config_name: default
data_files:
- split: train
path: data/train-*
---
|
MS-ML/synth1_2x4.7M | MS-ML | 2025-01-16T11:54:58Z | 12 | 1 | [
"license:cc-by-4.0",
"size_categories:10M<n<100M",
"modality:text",
"region:us"
] | [] | 2024-12-02T11:47:56Z | 0 | ---
license: cc-by-4.0
---
# Synthetic mass spectra dataset No. 1
This is the first iteration of the GC-EI-MS synthetic dataset generated by NEIMS and RASSP models from 4.7 million structures downloaded from ZINC.
In two folders **neims_custom_gen**, **rassp_custom_gen** there are two sets of *train*, *valid* and *test* splits in jsonl format. The compounds
in train splits (same as for valid and test) are identical, the difference is in the source of the synthetic spectra.
## Spectra generators
For generating this dataset, we used custom-trained NEIMS and RASSP models. We did this step because RASSP model is not publicly available and we wanted to
have more control over potential dataleaks in the context of further models stemming from this dataset. For better reproducibility we make the NIST splits
used for training NEIMS and RASSP models available in our [GitHub repository] (#TODO)
## Dataset creation
To uniformly cover the chemical space, we first scraped 1.8 billion SMILES strings from the ZINC20 library using the 2D-standard-annotated-druglike query.
From this dataset, we extracted a random sample of 30 million noncorrupted SMILES strings shorter than 100 characters. Further, we canonicalized, deduplicated,
and stripped the SMILES of stereochemical information, as stereochemistry is not reliably translated into spectra and cannot be accurately detected.
Additionally, we removed all NIST 20 compounds to prevent data leakage during the testing of our trained model in the future.
To evaluate the impact of RASSP and NEIMS respective spectrum prediction capabilities on SpecTUS performance, we created two identical sets of spectra generated
by each model. RASSP's strict input filters reduced the dataset to approximately 4.7 million compounds. In total, the pretraining datasets comprises 4.7 million
unique compounds and 9.4 million unique spectra.
Lastly, we split each synthetic dataset into training, validation, and test sets using a 0.9:0.05:0.05 ratio. The splitting process was random, but corresponding
splits (training, validation, and test sets) for the NEIMS and RASSP-generated spectra contained the same compounds. Each training set contained 4.2 million spectra,
while the validation and test sets each consisted of 234 thousand spectra.
## Size
```text
train.jsonl 4214986
valid.jsonl 234166
test.jsonl 234166
TOTAL 4683318
```
## Data format
Each line of every file is a json comprising three items:
```text
{"intensity":[0.01,0.08,0.06,0.05 ... 0.02,0.79,0.34,0.12],
"mz":[18,27,28,29,38,39,40,41,42,43, ... 202,203,270,271,272,299,300,301],
"smiles":"CCC(C)C1CCCCN1C(=O)CNc1cccc(C#N)c1"}
```
From the nature of the NEIMS spectra predictor, all NEIMS-generated peak intensities are in 2 decimals precision. RASSP generated intensities are not restricted in this way,
so to save storage we rounded them up to 6 decimal places which is beyond recognition for our model in the downstream task.
The full code we used for acquiring the compounds from the ZINC 20 library, sampling the SMILES strings, generating synthetic spectra using
custom-trained NEIMS and RASSP models and using the dataset for training a model can be found in [our GitHub repository] (TODO).
Our [preprint] (TODO) provides more information about the task background, the final finetuned model, and the experiments.
[NEIMS]: https://github.com/brain-research/deep-molecular-massspec
[RASSP]: https://github.com/thejonaslab/rassp-public
[our GitHub repository]: !TODO!
[preprint]: !TODO! |
supergoose/buzz_sources_155_smarty | supergoose | 2024-11-10T20:28:26Z | 18 | 0 | [
"size_categories:n<1K",
"format:parquet",
"modality:text",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"region:us"
] | [] | 2024-11-10T20:28:23Z | 0 | ---
dataset_info:
features:
- name: conversations
list:
- name: from
dtype: string
- name: value
dtype: string
- name: source
dtype: string
- name: stack
dtype: string
splits:
- name: train
num_bytes: 1088730
num_examples: 723
download_size: 355009
dataset_size: 1088730
configs:
- config_name: default
data_files:
- split: train
path: data/train-*
---
|
glossAPI/dimodis_logotexnia | glossAPI | 2024-11-06T10:49:23Z | 260 | 0 | [
"language:el",
"license:other",
"size_categories:n<1K",
"format:parquet",
"modality:text",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"region:us"
] | [] | 2024-11-06T10:20:07Z | 0 | ---
license: other
license_name: copyrights
license_link: LICENSE
language:
- el
---
**Πληροφορίες για τα δεδομένα**
Το παρόν dataset περιλαμβάνει κείμενα της ελληνικής γλώσσας χρονολογούμενα από τον 12ο έως και τον 18ο/19ο αιώνα. Περιέχουν αποσπάσματα από αντιπροσωπευτικά έργα της ελληνικής γραμματείας (θρησκευτικά κείμενα, ιπποτικό μυθιστόρημα, Πτωχοπροδρομικά, επική ποίηση, κρητική λογοτεχνία κ.λπ.) καθώς και διδακτικές προτάσεις, που συνοδεύουν αυτόν τον τόσο σημαντικό όγκο κειμένων.
Τα αρχεία προσφέρονται σε μορφή csv, ώστε να είναι διαθέσιμα τυχόν σχόλια αλλά και τα metadata τους. Σημειώνεται πως έχει διατηρηθεί ο συλλαβισμός, μαζί με κάποια επιπλέον στοιχεία των χειρογράφων (αστερίσκοι, τελείες, αρίθμηση του χειρογράφου).
Πηγή Δεδομένων:
© Copyright 2015 Κέντρο Ελληνικής Γλώσσας
Με επιφύλαξη παντός δικαιώματος.
Αυτό το σύνολο δεδομένων περιέχει επεξεργασμένα δεδομένα που προέρχονται από πόρους που ανήκουν στο Κέντρο Ελληνικής Γλώσσας. Τα αρχικά πνευματικά δικαιώματα παραμένουν στο Κέντρο Ελληνικής Γλώσσας.
Για οποιοδήποτε ζήτημα, επικοινωνήστε: [email protected]
**Dataset info**
In this dataset, the user will find Greek texts of various periods: from the 12th until the 18th/19th century. It includes fragments from well-known literature texts (Christian texts, Ptochoprodromika, Cretan literature, medieval courtly romance, epic poetry) as well as teaching strategies related to them.
The archives are uploaded as CSV, accompanied by comments and their metadata. It is worth mentioning that, is some cases, the spelling is maintained and certain manuscript data (asterisks, gaps and periods, manuscript numbers) haven’t been erased.
Source Data:
© Copyright 2015 Κέντρο Ελληνικής Γλώσσας (Center for the Greek Language)
All rights reserved.
This dataset contains processed data derived from resources owned by the Center for the Greek Language. The original copyrights remain with the Center for the Greek Language.
For feedback contact: [email protected]
|
tomap1410/StockManagement | tomap1410 | 2025-04-17T06:36:43Z | 17 | 0 | [
"size_categories:n<1K",
"format:parquet",
"modality:text",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"region:us"
] | [] | 2025-04-16T17:40:07Z | 0 | ---
dataset_info:
features:
- name: task
dtype: string
- name: goals
dtype: int64
- name: description
dtype: string
- name: complete
dtype: string
- name: store_place
dtype: string
- name: email_working
dtype: string
- name: id
dtype: string
splits:
- name: train
num_bytes: 512
num_examples: 5
download_size: 3249
dataset_size: 512
configs:
- config_name: default
data_files:
- split: train
path: data/train-*
---
|
ZhangYuX1012/tinyimagenet_test | ZhangYuX1012 | 2025-03-11T11:34:10Z | 14 | 0 | [
"size_categories:1K<n<10K",
"format:parquet",
"modality:image",
"modality:text",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"region:us"
] | [] | 2025-03-11T11:33:51Z | 0 | ---
dataset_info:
features:
- name: id
dtype: string
- name: prompt
dtype: string
- name: answer
dtype: string
- name: choices
dtype: string
- name: ground_truth
dtype: string
- name: images
sequence: image
splits:
- name: train
num_bytes: 5523237.21293848
num_examples: 1000
download_size: 9378595
dataset_size: 5523237.21293848
configs:
- config_name: default
data_files:
- split: train
path: data/train-*
---
|
sickgpt/001_MedQA | sickgpt | 2024-12-27T07:45:56Z | 20 | 0 | [
"size_categories:10K<n<100K",
"format:parquet",
"modality:text",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"region:us"
] | [] | 2024-12-27T07:45:35Z | 0 | ---
dataset_info:
features:
- name: meta_info
dtype: string
- name: question
dtype: string
- name: answer_idx
dtype: string
- name: answer
dtype: string
- name: options
list:
- name: key
dtype: string
- name: value
dtype: string
splits:
- name: train
num_bytes: 9765366
num_examples: 10178
- name: test
num_bytes: 1248299
num_examples: 1273
- name: validation
num_bytes: 1220927
num_examples: 1272
download_size: 6704273
dataset_size: 12234592
---
# Dataset Card for "001_MedQA"
[More Information needed](https://github.com/huggingface/datasets/blob/main/CONTRIBUTING.md#how-to-contribute-to-the-dataset-cards) |
sergeytata/hackathon-task6 | sergeytata | 2025-06-14T17:58:36Z | 0 | 0 | [
"task_categories:robotics",
"license:apache-2.0",
"size_categories:1K<n<10K",
"format:parquet",
"modality:tabular",
"modality:timeseries",
"modality:video",
"library:datasets",
"library:dask",
"library:mlcroissant",
"library:polars",
"region:us",
"LeRobot"
] | [
"robotics"
] | 2025-06-14T17:58:18Z | 0 | ---
license: apache-2.0
task_categories:
- robotics
tags:
- LeRobot
configs:
- config_name: default
data_files: data/*/*.parquet
---
This dataset was created using [LeRobot](https://github.com/huggingface/lerobot).
## Dataset Description
- **Homepage:** [More Information Needed]
- **Paper:** [More Information Needed]
- **License:** apache-2.0
## Dataset Structure
[meta/info.json](meta/info.json):
```json
{
"codebase_version": "v2.1",
"robot_type": "so101_follower",
"total_episodes": 6,
"total_frames": 4722,
"total_tasks": 1,
"total_videos": 12,
"total_chunks": 1,
"chunks_size": 1000,
"fps": 30,
"splits": {
"train": "0:6"
},
"data_path": "data/chunk-{episode_chunk:03d}/episode_{episode_index:06d}.parquet",
"video_path": "videos/chunk-{episode_chunk:03d}/{video_key}/episode_{episode_index:06d}.mp4",
"features": {
"action": {
"dtype": "float32",
"shape": [
6
],
"names": [
"shoulder_pan.pos",
"shoulder_lift.pos",
"elbow_flex.pos",
"wrist_flex.pos",
"wrist_roll.pos",
"gripper.pos"
]
},
"observation.state": {
"dtype": "float32",
"shape": [
6
],
"names": [
"shoulder_pan.pos",
"shoulder_lift.pos",
"elbow_flex.pos",
"wrist_flex.pos",
"wrist_roll.pos",
"gripper.pos"
]
},
"observation.images.top": {
"dtype": "video",
"shape": [
720,
1280,
3
],
"names": [
"height",
"width",
"channels"
],
"info": {
"video.height": 720,
"video.width": 1280,
"video.codec": "av1",
"video.pix_fmt": "yuv420p",
"video.is_depth_map": false,
"video.fps": 30,
"video.channels": 3,
"has_audio": false
}
},
"observation.images.front": {
"dtype": "video",
"shape": [
720,
1280,
3
],
"names": [
"height",
"width",
"channels"
],
"info": {
"video.height": 720,
"video.width": 1280,
"video.codec": "av1",
"video.pix_fmt": "yuv420p",
"video.is_depth_map": false,
"video.fps": 30,
"video.channels": 3,
"has_audio": false
}
},
"timestamp": {
"dtype": "float32",
"shape": [
1
],
"names": null
},
"frame_index": {
"dtype": "int64",
"shape": [
1
],
"names": null
},
"episode_index": {
"dtype": "int64",
"shape": [
1
],
"names": null
},
"index": {
"dtype": "int64",
"shape": [
1
],
"names": null
},
"task_index": {
"dtype": "int64",
"shape": [
1
],
"names": null
}
}
}
```
## Citation
**BibTeX:**
```bibtex
[More Information Needed]
``` |
olinguyen/uplimit-finetuningllm-week1 | olinguyen | 2024-10-20T06:10:22Z | 22 | 0 | [
"size_categories:n<1K",
"format:parquet",
"modality:tabular",
"modality:text",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"library:distilabel",
"region:us",
"synthetic",
"distilabel",
"rlaif"
] | [] | 2024-10-20T06:03:06Z | 0 | ---
size_categories: n<1K
dataset_info:
features:
- name: instruction
dtype: string
- name: quality
list:
- name: status
dtype: string
- name: user_id
dtype: string
- name: value
dtype: string
- name: metadata
dtype: string
- name: avg_rating
dtype: float64
- name: num_responses
dtype: int64
- name: agreement_ratio
dtype: float64
- name: raw_responses
sequence: int64
- name: kind
dtype: string
- name: cluster_description
dtype: string
- name: topic
dtype: string
- name: generation
dtype: string
- name: distilabel_metadata
struct:
- name: raw_input_text_generation
list:
- name: content
dtype: string
- name: role
dtype: string
- name: raw_output_text_generation
dtype: string
- name: model_name
dtype: string
splits:
- name: train
num_bytes: 61279
num_examples: 12
download_size: 55654
dataset_size: 61279
configs:
- config_name: default
data_files:
- split: train
path: data/train-*
tags:
- synthetic
- distilabel
- rlaif
---
<p align="left">
<a href="https://github.com/argilla-io/distilabel">
<img src="https://raw.githubusercontent.com/argilla-io/distilabel/main/docs/assets/distilabel-badge-light.png" alt="Built with Distilabel" width="200" height="32"/>
</a>
</p>
# Dataset Card for uplimit-finetuningllm-week1
This dataset has been created with [distilabel](https://distilabel.argilla.io/).
## Evaluation using EleutherAI/pythia-160m
| Tasks |Version|Filter|n-shot| Metric | |Value | |Stderr|
|---------|------:|------|-----:|-----------------------|---|-----:|---|------|
|hellaswag| 1|none | 0|acc |↑ |0.2872|± |0.0045|
| | |none | 0|acc_norm |↑ |0.3082|± |0.0046|
|ifeval | 4|none | 0|inst_level_loose_acc |↑ |0.2818|± | N/A|
| | |none | 0|inst_level_strict_acc |↑ |0.2794|± | N/A|
| | |none | 0|prompt_level_loose_acc |↑ |0.1701|± |0.0162|
| | |none | 0|prompt_level_strict_acc|↑ |0.1664|± |0.0160|
## Evaluation using llama-3.2-1b-instruct
| Tasks |Version|Filter|n-shot| Metric | |Value | |Stderr|
|---------|------:|------|-----:|-----------------------|---|-----:|---|------|
|hellaswag| 1|none | 0|acc |↑ |0.4514|± |0.0045|
| | |none | 0|acc_norm |↑ |0.6071|± |0.0049|
|ifeval | 4|none | 0|inst_level_loose_acc |↑ |0.5479|± | N/A|
| | |none | 0|inst_level_strict_acc |↑ |0.4940|± | N/A|
| | |none | 0|prompt_level_loose_acc |↑ |0.4103|± |0.0212|
| | |none | 0|prompt_level_strict_acc|↑ |0.3548|± |0.0206|
## Dataset Summary
This dataset contains a `pipeline.yaml` which can be used to reproduce the pipeline that generated it in distilabel using the `distilabel` CLI:
```console
distilabel pipeline run --config "https://huggingface.co/datasets/olinguyen/uplimit-finetuningllm-week1/raw/main/pipeline.yaml"
```
or explore the configuration:
```console
distilabel pipeline info --config "https://huggingface.co/datasets/olinguyen/uplimit-finetuningllm-week1/raw/main/pipeline.yaml"
```
## Dataset structure
The examples have the following structure per configuration:
<details><summary> Configuration: default </summary><hr>
```json
{
"agreement_ratio": 1.0,
"avg_rating": 5.0,
"cluster_description": "Sustainable Packaging \u0026 Skin Care Products",
"distilabel_metadata": {
"raw_input_text_generation": [
{
"content": "Provide step-by-step instructions on how to make a safe and effective homemade all-purpose cleaner from common household ingredients. The guide should include measurements, tips for storing the cleaner, and additional variations or scents that can be added. Additionally, the guide should be written in clear and concise language, with helpful visuals or photographs to aid in the process.",
"role": "user"
}
],
"raw_output_text_generation": " \n\n## Step 1: Gather Ingredients\nTo create your homemade all-purpose cleaner, you will need the following ingredients:\n- 1 cup water\n- 1/2 cup white vinegar\n- 2 tablespoons castile soap (preferably fragrance-free)\n- Optional: 10 drops of lemon essential oil for a fresh scent\n\n## Step 2: Mix the Cleaning Solution\nIn a small bowl, combine the water and white vinegar. Stir until they are well mixed.\n\n## Step 3: Add Castile Soap\nAdd the castile soap to the mixture and stir until it is fully dissolved.\n\n## Step 4: Adjust the Consistency\nIf the solution is too thick, add a bit more water. If it\u0027s too thin, add a bit more castile soap.\n\n## Step 5: Store the Cleaner\nTransfer the cleaning solution to an airtight container such as a glass jar or spray bottle. Label the container with the date and contents.\n\n## Step 6: Add Optional Essential Oil (Optional)\nIf using essential oils, add the 10 drops to the solution and mix well.\n\n## Step 7: Variations and Scents\nYou can customize your cleaner by adding different essential oils for unique fragrances.\n- Tea tree oil: Known for its antiseptic properties, adds a nice clean smell.\n- Lemon oil: Brightens up the space with a citrusy aroma.\n- Eucalyptus oil: Relieves respiratory issues, has a refreshing scent.\n\n## Step 8: Additional Tips\n- Always test a small area before using any new cleaner to ensure it doesn\u0027t damage surfaces.\n- Use this cleaner in well-ventilated areas to avoid inhaling fumes.\n- For tougher stains, let the cleaner sit for a few minutes before scrubbing.\n\nThe final answer is:\n\n**Homemade All-Purpose Cleaner Recipe**\n\nIngredients:\n- 1 cup water\n- 1/2 cup white vinegar\n- 2 tablespoons castile soap (fragrance-free)\n- Optional: 10 drops of lemon essential oil for a fresh scent\n\nInstructions:\n1. Mix the water and white vinegar in a bowl.\n2. Add the castile soap and stir until dissolved.\n3. Transfer the mixture to an airtight container.\n4. Add optional essential oils if desired.\n5. Store in a cool, dry place.\n\nVariations and Scents:\n- Tea tree oil for antiseptic properties\n- Lemon oil for a bright, citrusy aroma\n- Eucalyptus"
},
"generation": " \n\n## Step 1: Gather Ingredients\nTo create your homemade all-purpose cleaner, you will need the following ingredients:\n- 1 cup water\n- 1/2 cup white vinegar\n- 2 tablespoons castile soap (preferably fragrance-free)\n- Optional: 10 drops of lemon essential oil for a fresh scent\n\n## Step 2: Mix the Cleaning Solution\nIn a small bowl, combine the water and white vinegar. Stir until they are well mixed.\n\n## Step 3: Add Castile Soap\nAdd the castile soap to the mixture and stir until it is fully dissolved.\n\n## Step 4: Adjust the Consistency\nIf the solution is too thick, add a bit more water. If it\u0027s too thin, add a bit more castile soap.\n\n## Step 5: Store the Cleaner\nTransfer the cleaning solution to an airtight container such as a glass jar or spray bottle. Label the container with the date and contents.\n\n## Step 6: Add Optional Essential Oil (Optional)\nIf using essential oils, add the 10 drops to the solution and mix well.\n\n## Step 7: Variations and Scents\nYou can customize your cleaner by adding different essential oils for unique fragrances.\n- Tea tree oil: Known for its antiseptic properties, adds a nice clean smell.\n- Lemon oil: Brightens up the space with a citrusy aroma.\n- Eucalyptus oil: Relieves respiratory issues, has a refreshing scent.\n\n## Step 8: Additional Tips\n- Always test a small area before using any new cleaner to ensure it doesn\u0027t damage surfaces.\n- Use this cleaner in well-ventilated areas to avoid inhaling fumes.\n- For tougher stains, let the cleaner sit for a few minutes before scrubbing.\n\nThe final answer is:\n\n**Homemade All-Purpose Cleaner Recipe**\n\nIngredients:\n- 1 cup water\n- 1/2 cup white vinegar\n- 2 tablespoons castile soap (fragrance-free)\n- Optional: 10 drops of lemon essential oil for a fresh scent\n\nInstructions:\n1. Mix the water and white vinegar in a bowl.\n2. Add the castile soap and stir until dissolved.\n3. Transfer the mixture to an airtight container.\n4. Add optional essential oils if desired.\n5. Store in a cool, dry place.\n\nVariations and Scents:\n- Tea tree oil for antiseptic properties\n- Lemon oil for a bright, citrusy aroma\n- Eucalyptus",
"instruction": "Provide step-by-step instructions on how to make a safe and effective homemade all-purpose cleaner from common household ingredients. The guide should include measurements, tips for storing the cleaner, and additional variations or scents that can be added. Additionally, the guide should be written in clear and concise language, with helpful visuals or photographs to aid in the process.",
"kind": "synthetic",
"metadata": "{\"source\": \"ultrachat\", \"kind\": \"synthetic\", \"evolved_from\": null}",
"model_name": "/tmp/llama-3.2-1b-instruct",
"num_responses": 2,
"quality": [
{
"status": "submitted",
"user_id": "d23b12c2-b601-490e-b5b3-2040eb393a00",
"value": "4"
},
{
"status": "submitted",
"user_id": "e2bdd868-f28e-46fc-9254-a6ec1e291889",
"value": "4"
}
],
"raw_responses": [
5,
5
],
"topic": "Environmental Issues"
}
```
This subset can be loaded as:
```python
from datasets import load_dataset
ds = load_dataset("olinguyen/uplimit-finetuningllm-week1", "default")
```
Or simply as it follows, since there's only one configuration and is named `default`:
```python
from datasets import load_dataset
ds = load_dataset("olinguyen/uplimit-finetuningllm-week1")
```
</details>
|
Lots-of-LoRAs/task143_odd-man-out_classification_generate_category | Lots-of-LoRAs | 2025-01-03T17:47:02Z | 10 | 0 | [
"task_categories:text-generation",
"annotations_creators:crowdsourced",
"language_creators:crowdsourced",
"language:en",
"license:apache-2.0",
"size_categories:1K<n<10K",
"format:parquet",
"modality:text",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"arxiv:2204.07705",
"arxiv:2407.00066",
"region:us"
] | [
"text-generation"
] | 2025-01-03T17:47:00Z | 0 | ---
annotations_creators:
- crowdsourced
language_creators:
- crowdsourced
language:
- en
license:
- apache-2.0
task_categories:
- text-generation
pretty_name: task143_odd-man-out_classification_generate_category
dataset_info:
config_name: plain_text
features:
- name: input
dtype: string
- name: output
dtype: string
- name: id
dtype: string
splits:
- name: train
num_examples: 5200
- name: valid
num_examples: 650
- name: test
num_examples: 650
---
# Dataset Card for Natural Instructions (https://github.com/allenai/natural-instructions) Task: task143_odd-man-out_classification_generate_category
## Dataset Description
- **Homepage:** https://github.com/allenai/natural-instructions
- **Paper:** https://arxiv.org/abs/2204.07705
- **Paper:** https://arxiv.org/abs/2407.00066
- **Point of Contact:** [Rickard Brüel Gabrielsson](mailto:[email protected])
## Additional Information
### Citation Information
The following paper introduces the corpus in detail. If you use the corpus in published work, please cite it:
```bibtex
@misc{wang2022supernaturalinstructionsgeneralizationdeclarativeinstructions,
title={Super-NaturalInstructions: Generalization via Declarative Instructions on 1600+ NLP Tasks},
author={Yizhong Wang and Swaroop Mishra and Pegah Alipoormolabashi and Yeganeh Kordi and Amirreza Mirzaei and Anjana Arunkumar and Arjun Ashok and Arut Selvan Dhanasekaran and Atharva Naik and David Stap and Eshaan Pathak and Giannis Karamanolakis and Haizhi Gary Lai and Ishan Purohit and Ishani Mondal and Jacob Anderson and Kirby Kuznia and Krima Doshi and Maitreya Patel and Kuntal Kumar Pal and Mehrad Moradshahi and Mihir Parmar and Mirali Purohit and Neeraj Varshney and Phani Rohitha Kaza and Pulkit Verma and Ravsehaj Singh Puri and Rushang Karia and Shailaja Keyur Sampat and Savan Doshi and Siddhartha Mishra and Sujan Reddy and Sumanta Patro and Tanay Dixit and Xudong Shen and Chitta Baral and Yejin Choi and Noah A. Smith and Hannaneh Hajishirzi and Daniel Khashabi},
year={2022},
eprint={2204.07705},
archivePrefix={arXiv},
primaryClass={cs.CL},
url={https://arxiv.org/abs/2204.07705},
}
```
More details can also be found in the following paper:
```bibtex
@misc{brüelgabrielsson2024compressserveservingthousands,
title={Compress then Serve: Serving Thousands of LoRA Adapters with Little Overhead},
author={Rickard Brüel-Gabrielsson and Jiacheng Zhu and Onkar Bhardwaj and Leshem Choshen and Kristjan Greenewald and Mikhail Yurochkin and Justin Solomon},
year={2024},
eprint={2407.00066},
archivePrefix={arXiv},
primaryClass={cs.DC},
url={https://arxiv.org/abs/2407.00066},
}
```
### Contact Information
For any comments or questions, please email [Rickard Brüel Gabrielsson](mailto:[email protected])
|
andlyu/norm_blue_salad_cc | andlyu | 2025-05-20T21:15:37Z | 0 | 0 | [
"task_categories:robotics",
"license:apache-2.0",
"size_categories:10K<n<100K",
"format:parquet",
"modality:tabular",
"modality:timeseries",
"modality:video",
"library:datasets",
"library:dask",
"library:mlcroissant",
"library:polars",
"region:us",
"LeRobot",
"so100",
"tutorial"
] | [
"robotics"
] | 2025-05-20T21:14:23Z | 0 | ---
license: apache-2.0
task_categories:
- robotics
tags:
- LeRobot
- so100
- tutorial
configs:
- config_name: default
data_files: data/*/*.parquet
---
This dataset was created using [LeRobot](https://github.com/huggingface/lerobot).
## Dataset Description
- **Homepage:** [More Information Needed]
- **Paper:** [More Information Needed]
- **License:** apache-2.0
## Dataset Structure
[meta/info.json](meta/info.json):
```json
{
"codebase_version": "v2.1",
"robot_type": "so100",
"total_episodes": 100,
"total_frames": 29444,
"total_tasks": 1,
"total_videos": 400,
"total_chunks": 1,
"chunks_size": 1000,
"fps": 30,
"splits": {
"train": "0:100"
},
"data_path": "data/chunk-{episode_chunk:03d}/episode_{episode_index:06d}.parquet",
"video_path": "videos/chunk-{episode_chunk:03d}/{video_key}/episode_{episode_index:06d}.mp4",
"features": {
"action": {
"dtype": "float32",
"shape": [
6
],
"names": [
"main_shoulder_pan",
"main_shoulder_lift",
"main_elbow_flex",
"main_wrist_flex",
"main_wrist_roll",
"main_gripper"
]
},
"observation.state": {
"dtype": "float32",
"shape": [
6
],
"names": [
"main_shoulder_pan",
"main_shoulder_lift",
"main_elbow_flex",
"main_wrist_flex",
"main_wrist_roll",
"main_gripper"
]
},
"observation.images.base": {
"dtype": "video",
"shape": [
480,
640,
3
],
"names": [
"height",
"width",
"channels"
],
"info": {
"video.fps": 30.0,
"video.height": 480,
"video.width": 640,
"video.channels": 3,
"video.codec": "av1",
"video.pix_fmt": "yuv420p",
"video.is_depth_map": false,
"has_audio": false
}
},
"observation.images.base_right": {
"dtype": "video",
"shape": [
480,
640,
3
],
"names": [
"height",
"width",
"channels"
],
"info": {
"video.fps": 30.0,
"video.height": 480,
"video.width": 640,
"video.channels": 3,
"video.codec": "av1",
"video.pix_fmt": "yuv420p",
"video.is_depth_map": false,
"has_audio": false
}
},
"observation.images.arm": {
"dtype": "video",
"shape": [
480,
640,
3
],
"names": [
"height",
"width",
"channels"
],
"info": {
"video.fps": 30.0,
"video.height": 480,
"video.width": 640,
"video.channels": 3,
"video.codec": "av1",
"video.pix_fmt": "yuv420p",
"video.is_depth_map": false,
"has_audio": false
}
},
"observation.images.gripper": {
"dtype": "video",
"shape": [
480,
640,
3
],
"names": [
"height",
"width",
"channels"
],
"info": {
"video.fps": 30.0,
"video.height": 480,
"video.width": 640,
"video.channels": 3,
"video.codec": "av1",
"video.pix_fmt": "yuv420p",
"video.is_depth_map": false,
"has_audio": false
}
},
"timestamp": {
"dtype": "float32",
"shape": [
1
],
"names": null
},
"frame_index": {
"dtype": "int64",
"shape": [
1
],
"names": null
},
"episode_index": {
"dtype": "int64",
"shape": [
1
],
"names": null
},
"index": {
"dtype": "int64",
"shape": [
1
],
"names": null
},
"task_index": {
"dtype": "int64",
"shape": [
1
],
"names": null
}
}
}
```
## Citation
**BibTeX:**
```bibtex
[More Information Needed]
``` |
qizekun/Open6DOR_V2 | qizekun | 2025-03-12T21:19:11Z | 31 | 1 | [
"task_categories:robotics",
"language:en",
"license:apache-2.0",
"size_categories:1K<n<10K",
"arxiv:2502.13143",
"region:us"
] | [
"robotics"
] | 2025-02-18T21:00:59Z | 0 | ---
license: apache-2.0
task_categories:
- robotics
language:
- en
pretty_name: Open6DOR V2
size_categories:
- 1K<n<10K
---
# Open6DOR V2
Paper_link: https://arxiv.org/abs/2502.13143
<br>
Project Page: https://qizekun.github.io/sofar/
<br>
Github Code: https://github.com/qizekun/SoFar
This dataset originates from Open6DOR, the Benchmarking Open-instruction for 6-DoF Object Rearrangement.
We removed the erroneous data from Open6DOR V1 and eliminated parts that required manual judgment to facilitate replication.
Open6DOR V2 contains ~4500 tasks for 6-DoF object rearrangement & spatial relationship evaluation.
The evaluation baseline is [SoFar](https://github.com/qizekun/SoFar), a 6-DoF system for spatial reasoning and robotic manipulation.
Download the [open6dor_v2.zip](https://huggingface.co/datasets/qizekun/Open6DOR_V2/blob/main/open6dor_v2.zip) and extract it to `./datasets/open6dor_v2/`.
The overall directory structure should be:
```
│SoFar/datasets/open6dor_v2/
├── task_refine_pos/
│ ├── behind
│ └── ...
├── task_refine_rot/
│ └── rot_ins
└── task_refine_6dof/
├── behind
│ ├── Place_the_apple_behind_the_bottle_on_the_table.__upright
│ └── ...
└── ...
```
| Data file name | Size |
|--------------------------------------------------------------------------------------------------|---------:|
| [open6dor_v2.zip](https://huggingface.co/datasets/qizekun/Open6DOR_V2/blob/main/open6dor_v2.zip) | 1.89 GB |
| task_refine_pos | 20.41 GB |
| task_refine_rot | 12.84 GB |
| task_refine_6dof | 21.99 GB |
|
mkemka/rec04 | mkemka | 2025-06-14T02:05:24Z | 0 | 0 | [
"task_categories:robotics",
"region:us",
"phosphobot",
"so100",
"phospho-dk"
] | [
"robotics"
] | 2025-06-14T02:05:20Z | 0 |
---
tags:
- phosphobot
- so100
- phospho-dk
task_categories:
- robotics
---
# rec04
**This dataset was generated using a [phospho starter pack](https://robots.phospho.ai).**
This dataset contains a series of episodes recorded with a robot and multiple cameras. It can be directly used to train a policy using imitation learning. It's compatible with LeRobot and RLDS.
|
Ayush-Singh/RM-Bench-safety-refuse-Mistral-7B-Instruct-v0.1-yesno | Ayush-Singh | 2025-01-20T09:17:18Z | 7 | 0 | [
"size_categories:n<1K",
"format:parquet",
"modality:tabular",
"modality:text",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"region:us"
] | [] | 2025-01-20T09:17:17Z | 0 | ---
dataset_info:
features:
- name: id
dtype: int64
- name: prompt
dtype: string
- name: subset
dtype: string
- name: chosen_1
dtype: string
- name: chosen_2
dtype: string
- name: chosen_3
dtype: string
- name: rejected_1
dtype: string
- name: rejected_2
dtype: string
- name: rejected_3
dtype: string
- name: chosen_1_yes_prob
dtype: float64
- name: chosen_1_no_prob
dtype: float64
- name: rejected_1_yes_prob
dtype: float64
- name: rejected_1_no_prob
dtype: float64
- name: chosen_2_yes_prob
dtype: float64
- name: chosen_2_no_prob
dtype: float64
- name: rejected_2_yes_prob
dtype: float64
- name: rejected_2_no_prob
dtype: float64
- name: chosen_3_yes_prob
dtype: float64
- name: chosen_3_no_prob
dtype: float64
- name: rejected_3_yes_prob
dtype: float64
- name: rejected_3_no_prob
dtype: float64
splits:
- name: train
num_bytes: 1578314
num_examples: 284
download_size: 828972
dataset_size: 1578314
configs:
- config_name: default
data_files:
- split: train
path: data/train-*
---
|
argilla-internal-testing/test_import_dataset_from_hub_with_classlabel_f78b00e2-a53a-479c-b3ec-3d8f9302baf3 | argilla-internal-testing | 2024-12-11T13:49:15Z | 16 | 0 | [
"size_categories:n<1K",
"format:parquet",
"modality:text",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"region:us"
] | [] | 2024-12-11T13:49:14Z | 0 | ---
dataset_info:
features:
- name: text
dtype: string
- name: label
dtype:
class_label:
names:
'0': positive
'1': negative
splits:
- name: train
num_bytes: 111
num_examples: 3
download_size: 1256
dataset_size: 111
configs:
- config_name: default
data_files:
- split: train
path: data/train-*
---
|
NLP-FBK/e3c-sentences-ES-native | NLP-FBK | 2025-01-20T08:24:30Z | 18 | 0 | [
"size_categories:1K<n<10K",
"format:parquet",
"modality:text",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"region:us"
] | [] | 2025-01-09T10:20:29Z | 0 | ---
dataset_info:
features:
- name: sentence
dtype: string
- name: entities
list:
- name: id
dtype: string
- name: offsets
sequence: int64
- name: role
dtype: string
- name: semantic_type_id
dtype: string
- name: text
dtype: string
- name: type
dtype: string
- name: original_text
dtype: string
- name: original_id
dtype: string
splits:
- name: train
num_bytes: 1478359.1975308643
num_examples: 455
- name: test
num_bytes: 1910494.962962963
num_examples: 588
- name: validation
num_bytes: 295671.83950617287
num_examples: 91
download_size: 404531
dataset_size: 3684526.0000000005
configs:
- config_name: default
data_files:
- split: train
path: data/train-*
- split: test
path: data/test-*
- split: validation
path: data/validation-*
---
|
iknow-lab/wildguardmix-test-ko | iknow-lab | 2024-10-19T07:26:24Z | 35 | 0 | [
"task_categories:text-classification",
"language:ko",
"license:odc-by",
"size_categories:1K<n<10K",
"format:parquet",
"modality:tabular",
"modality:text",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"arxiv:2406.18495",
"region:us"
] | [
"text-classification"
] | 2024-10-19T07:24:10Z | 0 | ---
license: odc-by
task_categories:
- text-classification
language:
- ko
size_categories:
- 1K<n<10K
---
- Original dataset: [allenai/wildguardmix](https://huggingface.co/datasets/allenai/wildguardmix)
- Translated by [nayohan/llama3-instrucTrans-enko-8b](https://huggingface.co/nayohan/llama3-instrucTrans-enko-8b)
```
@misc{wildguard2024,
title={WildGuard: Open One-Stop Moderation Tools for Safety Risks, Jailbreaks, and Refusals of LLMs},
author={Seungju Han and Kavel Rao and Allyson Ettinger and Liwei Jiang and Bill Yuchen Lin and Nathan Lambert and Yejin Choi and Nouha Dziri},
year={2024},
eprint={2406.18495},
archivePrefix={arXiv},
primaryClass={cs.CL},
url={https://arxiv.org/abs/2406.18495},
}
``` |
dmitriihook/qwq-32b-planning-mystery-1-24k-greedy | dmitriihook | 2025-04-08T01:34:42Z | 236 | 0 | [
"size_categories:n<1K",
"format:parquet",
"modality:text",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"library:distilabel",
"region:us",
"synthetic",
"distilabel",
"rlaif"
] | [] | 2025-04-08T01:34:34Z | 0 | ---
size_categories: n<1K
dataset_info:
features:
- name: query
dtype: string
- name: instance_id
dtype: string
- name: Number of blocks
dtype: int64
- name: generation
dtype: string
- name: distilabel_metadata
struct:
- name: raw_input_text_generation_0
list:
- name: content
dtype: string
- name: role
dtype: string
- name: raw_output_text_generation_0
dtype: string
- name: statistics_text_generation_0
struct:
- name: input_tokens
dtype: int64
- name: output_tokens
dtype: int64
- name: model_name
dtype: string
splits:
- name: train
num_bytes: 45813081
num_examples: 350
download_size: 12884468
dataset_size: 45813081
configs:
- config_name: default
data_files:
- split: train
path: data/train-*
tags:
- synthetic
- distilabel
- rlaif
---
<p align="left">
<a href="https://github.com/argilla-io/distilabel">
<img src="https://raw.githubusercontent.com/argilla-io/distilabel/main/docs/assets/distilabel-badge-light.png" alt="Built with Distilabel" width="200" height="32"/>
</a>
</p>
# Dataset Card for qwq-32b-planning-mystery-1-24k-greedy
This dataset has been created with [distilabel](https://distilabel.argilla.io/).
## Dataset Summary
This dataset contains a `pipeline.yaml` which can be used to reproduce the pipeline that generated it in distilabel using the `distilabel` CLI:
```console
distilabel pipeline run --config "https://huggingface.co/datasets/dmitriihook/qwq-32b-planning-mystery-1-24k-greedy/raw/main/pipeline.yaml"
```
or explore the configuration:
```console
distilabel pipeline info --config "https://huggingface.co/datasets/dmitriihook/qwq-32b-planning-mystery-1-24k-greedy/raw/main/pipeline.yaml"
```
## Dataset structure
The examples have the following structure per configuration:
<details><summary> Configuration: default </summary><hr>
```json
{
"Number of blocks": 4,
"distilabel_metadata": {
"raw_input_text_generation_0": [
{
"content": "I am playing with a set of objects. Here are the actions I can do\n\n Attack object\n Feast object from another object\n Succumb object\n Overcome object from another object\n\nI have the following restrictions on my actions:\n To perform Attack action, the following facts need to be true: Province object, Planet object, Harmony.\n Once Attack action is performed the following facts will be true: Pain object.\n Once Attack action is performed the following facts will be false: Province object, Planet object, Harmony.\n To perform Succumb action, the following facts need to be true: Pain object.\n Once Succumb action is performed the following facts will be true: Province object, Planet object, Harmony. \n Once Succumb action is performed the following facts will be false: Pain object.\n To perform Overcome action, the following needs to be true: Province other object, Pain object.\n Once Overcome action is performed the following will be true: Harmony, Province object, Object Craves other object.\n Once Overcome action is performed the following will be false: Province other object, Pain object.\n To perform Feast action, the following needs to be true: Object Craves other object, Province object, Harmony.\n Once Feast action is performed the following will be true: Pain object, Province other object.\n Once Feast action is performed the following will be false:, Object Craves other object, Province object, Harmony.\n\nHere is an example problem:\n\n[STATEMENT]\nAs initial conditions I have that, province Block B, province Block C, harmony, Block C craves Block A, planet Block A, planet Block B.\nMy goal is to have that Block A craves Block C and Block B craves Block A.\n\nMy plan is as follows:\n\n[PLAN]\nfeast Block C from Block A\nsuccumb Block C\nattack Block A\novercome Block A from Block C\nattack Block B\novercome Block B from Block A\n[PLAN END]\n\nHere is another example:\n\n[STATEMENT]\nAs initial conditions I have that, province Block B, harmony, Block A craves Block D, Block B craves Block C, Block C craves Block A, planet Block D.\nMy goal is to have that Block C craves Block D, Block A craves Block C and Block B craves Block A.\n\nMy plan is as follows:\n\n[PLAN]\nfeast Block B from Block C\nsuccumb Block B\nfeast Block C from Block A\nsuccumb Block C\nfeast Block A from Block D\nsuccumb Block A\nattack Block C\novercome Block C from Block D\nattack Block A\novercome Block A from Block C\nattack Block B\novercome Block B from Block A\n[PLAN END]\nHere is the problem to solve:\n\n[STATEMENT]\nAs initial conditions I have that: Block C craves Block B, harmony, planet Block A, planet Block B, planet Block D, province Block A, province Block C and province Block D.\nMy goal is for the following to be true: Block A craves Block D, Block B craves Block C and Block D craves Block B.\n\nMy plan is as follows:",
"role": "user"
}
],
"raw_output_text_generation_0": "Okay, let\u0027s see. I need to solve this problem where the initial conditions are given, and I have to come up with a plan using the actions provided to reach the goal. Let me start by understanding the problem step by step.\n\nFirst, let me parse the initial conditions and the goal clearly.\n\n**Initial Conditions:**\n- Block C craves Block B (so \"Object Craves other object\" for C and B)\n- Harmony exists (Harmony fact is true)\n- Planet Block A, Planet Block B, Planet Block D (so all these blocks are on a planet)\n- Province Block A, Province Block C, Province Block D (so these are in a province, but what about Block B? Wait, the initial conditions don\u0027t mention province for Block B. Wait, the problem says \"province Block A, province Block C and province Block D.\" So Block B is not in a province? Hmm, but the planets include Block B. Wait, the planets are A, B, D. So Block B is on a planet but not in a province? Or maybe the province is a separate fact. Let me check the problem again.\n\nWait, the problem says: \"province Block A, province Block C and province Block D.\" So Block B is not in a province. So the provinces are A, C, D. Planets are A, B, D. So Block B is on a planet but not in a province. Interesting.\n\n**Goal:**\n- Block A craves Block D (so \"Object Craves other object\" for A and D)\n- Block B craves Block C (so B craves C)\n- Block D craves Block B (D craves B)\n\nSo I need to manipulate the actions to get these cravings and other conditions.\n\nLet me recall the actions and their preconditions and effects.\n\nThe actions are:\n\n1. **Attack object**\n - Requires: Province object, Planet object, Harmony.\n - After: Pain object becomes true. Province and Planet of the object, and Harmony become false.\n\n2. **Succumb object**\n - Requires: Pain object.\n - After: Province, Planet, Harmony become true again. Pain becomes false.\n\n3. **Overcome object from another object**\n - Requires: Province of the other object, Pain of the object.\n - After: Harmony becomes true, Province of the object becomes true, and the object now craves the other object. The other\u0027s province and Pain of the object are removed.\n\n4. **Feast object from another object**\n - Requires: Object craves the other, Province of the object, Harmony.\n - After: Pain of the object becomes true, Province of the other becomes true (since the object\u0027s province is removed?), and the object\u0027s craving is removed, along with Harmony and the object\u0027s province.\n\nWait, let me recheck the exact effects for each action to be precise.\n\nFor **Feast object from another object**:\n- Requires: Object Craves other object, Province object, Harmony.\n- After:\n - True: Pain object, Province other object.\n - False: Object Craves other object, Province object, Harmony.\n\nSo after Feast, the object\u0027s province is removed (since it\u0027s set to false), and the other object\u0027s province is set to true. Also, the craving is removed, and Harmony is gone, but Pain is added to the object.\n\nFor **Overcome object from another object**:\n- Requires: Province of the other object (so \"Province other object\"), Pain of the object (Pain object).\n- After:\n - True: Harmony, Province object, Object Craves other object (so the object now craves the other).\n - False: Province other object, Pain object.\n\nSo Overcome requires that the other has a province and the object has pain. Then, after overcoming, the object gains province and the craving for the other, the other loses province, and pain is gone, and harmony is restored.\n\n**Succumb** requires Pain object, and after, removes Pain, restores Province, Planet, and Harmony for the object.\n\n**Attack** requires Province, Planet, and Harmony for the object. After, Pain is added, and those three are removed.\n\nNow, the goal is to get the cravings as specified. Let\u0027s see the initial state again.\n\nInitial cravings:\n- Block C craves Block B (C\u2192B)\nGoal cravings:\n- A\u2192D, B\u2192C, D\u2192B.\n\nSo, need to create A craving D, B craving C (already C craves B, but B needs to crave C?), and D craving B.\n\nWait, the goal is Block B craves Block C (so B\u2192C), and D\u2192B. So B\u0027s craving is new, as initial only C\u2192B. D\u0027s craving is new (D\u2192B). A\u0027s craving is new (A\u2192D).\n\nSo, how can we create these cravings?\n\nCravings are created via Overcome actions. Because Overcome\u0027s effect includes \"Object Craves other object\". So when you overcome object from another, the object starts craving the other.\n\nSo to get A\u2192D, we need to have A overcome from D? Let me think.\n\nWait, Overcome object from another object: the object is the first parameter, and the other is the second. So Overcome A from D would mean that A is the object, D is the other. The effect would be that A craves D. So yes, that would create A\u2192D.\n\nSimilarly, to get B\u2192C, we need to have B overcome from C. So Overcome B from C would make B crave C.\n\nTo get D\u2192B, we need Overcome D from B, so D craves B.\n\nSo the plan needs to involve these Overcome actions. But each Overcome requires certain preconditions.\n\nLet me outline the steps needed.\n\nFirst, let\u0027s note the initial conditions again:\n\nInitial facts:\n\n- Province: A, C, D (so Block A, C, D are in provinces; Block B is not)\n- Planet: A, B, D (so all except maybe C? Wait, the problem says \"planet Block A, planet Block B, planet Block D\". So Block C is not on a planet? Wait, but the initial conditions also mention \"province Block C\". Hmm, but the problem says \"province Block A, province Block C and province Block D.\" So Block C is in a province, but is it on a planet? The problem says \"planet Block A, planet Block B, planet Block D.\" So Block C is not on a planet. Wait, but the Attack action requires Planet object. So if an object is not on a planet, you can\u0027t attack it. Hmm, that might be important.\n\nWait, the initial conditions for the problem are:\n\n\"As initial conditions I have that: Block C craves Block B, harmony, planet Block A, planet Block B, planet Block D, province Block A, province Block C and province Block D.\"\n\nSo, the planets are A, B, D. So Block C is not on a planet. Therefore, any action involving Block C as the object in Attack would require Planet object, which would fail for Block C. So attacking Block C is not possible unless we can get it on a planet again. But how?\n\nHmm, that\u0027s a point to note. Since Block C is not on a planet, we can\u0027t attack it. So any actions involving attacking Block C would be invalid unless we first get it on a planet again. But how?\n\nAlternatively, maybe through Succumb? Let\u0027s see. If an object has Pain, then Succumb would restore Planet, Province, and Harmony. So if we can get Pain on Block C, then Succumb would put it back on a planet and province.\n\nBut let\u0027s see the plan step by step.\n\nFirst, the goal cravings are A\u2192D, B\u2192C, D\u2192B.\n\nLet me think of the steps needed to create each craving.\n\n1. To get A\u2192D: Need to perform Overcome A from D. The preconditions for Overcome A from D are:\n\n - Province of the other object (D\u0027s province must be true). Since D is in province initially, that\u0027s okay.\n\n - Pain of the object (A must have Pain). So before Overcome A from D, A must have Pain.\n\n So to get Pain on A, we can attack A. Because Attack on A would require Province A (which it has), Planet A (yes), and Harmony (which is present initially). So attacking A would give Pain A, and remove Province A, Planet A, and Harmony.\n\n But after attacking A, Harmony is gone, so we can\u0027t do Feast or Attack again until we restore Harmony via Succumb.\n\n Alternatively, maybe after attacking, we can succumb to restore Harmony, but that would also restore Province and Planet.\n\n Hmm, this is getting complex. Let\u0027s try to outline possible steps.\n\nLet me try to think of a possible path.\n\nFirst, let\u0027s see the goal cravings. Let\u0027s see if we can get each craving through Overcome actions.\n\nFor B\u2192C: Overcome B from C. But to do that, the preconditions are:\n\n- Province of the other (C\u0027s province must be true). Since C is in province, that\u0027s okay.\n\n- Pain of B (B must have Pain). But B is not in a province (initially), so can we attack B?\n\nWait, B is on a planet (Planet B is true), but is it in a province? No, the provinces are A, C, D. So B is not in a province. Therefore, to attack B, we need Province B, which it doesn\u0027t have. So can\u0027t attack B directly. Hmm, so how to get Pain on B?\n\nAlternatively, maybe through Feast? Let\u0027s see.\n\nFeast requires that the object craves another, has province, and harmony.\n\nSuppose we can get B to crave something, then Feast it. But initially, B doesn\u0027t crave anything. The initial cravings are only C\u2192B.\n\nAlternatively, maybe we can get B to crave something via Overcome, but that requires Pain first.\n\nHmm, this is tricky. Let\u0027s see.\n\nAlternatively, maybe we can first get Pain on A via attacking A, then use that to proceed.\n\nLet me try to outline a possible plan step by step.\n\nFirst, let\u0027s see the initial state:\n\n- Harmony is present.\n\n- Province: A, C, D.\n\n- Planet: A, B, D.\n\n- Cravings: C\u2192B.\n\nGoal: A\u2192D, B\u2192C, D\u2192B.\n\nLet me think of the steps needed for each craving.\n\nStarting with A\u2192D:\n\nTo get A\u2192D via Overcome A from D:\n\n- Need Province D (which is true).\n\n- Need Pain A.\n\nTo get Pain A, attack A. Let\u0027s try that.\n\nAction 1: Attack A.\n\nPreconditions for Attack A:\n\n- Province A (yes), Planet A (yes), Harmony (yes). So okay.\n\nAfter Attack A:\n\n- Pain A is true.\n\n- Province A, Planet A, Harmony are false.\n\nSo now, Harmony is gone. So any actions requiring Harmony (like Feast or Attack again) can\u0027t be done until Harmony is restored.\n\nBut we can do Succumb on A to restore Harmony.\n\nAction 2: Succumb A.\n\nPrecondition: Pain A (yes).\n\nAfter Succumb A:\n\n- Province A, Planet A, Harmony are true again.\n\n- Pain A is false.\n\nSo now, Harmony is back. Now, can we proceed?\n\nBut we need Pain A again for Overcome A from D. Hmm, so maybe we need to attack again?\n\nAlternatively, perhaps after attacking and succumbing, we can do another attack?\n\nWait, but let\u0027s see the plan so far:\n\nAfter Attack A and Succumb A, we\u0027re back to the initial state except that we\u0027ve done those actions. Not helpful.\n\nAlternatively, maybe after attacking A, before succumbing, we can do Overcome A from D?\n\nWait, after Attack A, Pain A is true, Province A is false, Planet A is false, Harmony is false.\n\nSo to do Overcome A from D:\n\n- The other is D, which has Province D (still true? Wait, after Attack A, the Province of D is still true because the attack was on A. So Province D is still true.\n\n- Pain A is true (from the attack).\n\nSo the preconditions are met (Province D is true, Pain A is true). So Overcome A from D can be done even without Harmony, because Overcome\u0027s preconditions don\u0027t require Harmony.\n\nWait, Overcome\u0027s preconditions are only Province of the other (D\u0027s province) and Pain of the object (A). So yes, even if Harmony is false, that\u0027s okay.\n\nSo after Attack A, we can do Overcome A from D.\n\nLet me check:\n\nAfter Attack A:\n\n- Pain A is true.\n\n- Province A is false, Planet A is false, Harmony is false.\n\nThen, Overcome A from D:\n\n- Precondition: Province D (yes), Pain A (yes).\n\n- Effects:\n\n - True: Harmony, Province A, A craves D.\n\n - False: Province D (so D\u0027s province is removed), Pain A.\n\nSo after Overcome A from D:\n\n- Harmony is true again.\n\n- Province A is true (so A is back in province).\n\n- A craves D (good, that\u0027s one goal).\n\n- Province D is now false (since it was set to false in the effect).\n\n- Pain A is false.\n\nSo that\u0027s a good step. So the sequence would be:\n\n1. Attack A\n\n2. Overcome A from D\n\nThis gives us A craving D, and also restores Harmony, and moves D out of province (Province D becomes false).\n\nBut after this, D is no longer in a province. Hmm, but maybe that\u0027s okay.\n\nNow, moving on to the next craving: B\u2192C.\n\nTo get B\u2192C via Overcome B from C.\n\nThe preconditions for Overcome B from C are:\n\n- Province of the other (C\u0027s province must be true).\n\n- Pain of B (B must have Pain).\n\nCurrently, after the first two steps:\n\n- C\u0027s province: Let\u0027s see. The initial Province C was true. The first two actions (Attack A and Overcome A from D) didn\u0027t affect C\u0027s province. So Province C is still true.\n\nSo Province C is true, so that\u0027s okay.\n\nNow, Pain B must be true. How to get Pain B?\n\nTo get Pain B, we can attack B. But to attack B, we need:\n\n- Province B (must be true), Planet B (yes), Harmony (must be true).\n\nCurrently, after the first two steps, Harmony is true (from Overcome A from D\u0027s effect). But does B have Province?\n\nInitially, B was not in a province. The Attack A and Overcome A from D didn\u0027t affect B\u0027s province. So Province B is still false. So can\u0027t attack B yet.\n\nHmm, so how to get Province B?\n\nAlternatively, maybe through Feast?\n\nWait, to get Province B, perhaps via Succumb? But to Succumb B, we need Pain B. But to get Pain B, we need to attack B, which requires Province B. So that\u0027s a loop.\n\nAlternatively, maybe we can get B into a province via Feast?\n\nFeast requires that the object craves another, has province, and harmony.\n\nSuppose we can get B to crave something, then Feast it. But B doesn\u0027t crave anything initially. Unless we can get B to crave via Overcome, but that requires Pain first.\n\nHmm, this is a problem. Let\u0027s think differently.\n\nPerhaps we need to get B into a province through another action.\n\nWait, when you do Feast on an object, the effect includes setting Province of the other object to true. For example, if you do Feast X from Y, then after Feast, Province Y becomes true (since the other is Y). Wait, let me check the Feast effects again.\n\nFeast object from another object:\n\nAfter effects:\n\n- True: Pain object, Province other object.\n\n- False: Object Craves other object, Province object, Harmony.\n\nSo, if I do Feast on X from Y, then the other is Y, so Province Y becomes true (if it wasn\u0027t already?), but actually, the effect is that Province other object becomes true. Wait, no, the effect is that Province other object is set to true? Or is it that the Province of the other is set to true?\n\nWait, the description says:\n\nOnce Feast action is performed the following will be true: Pain object, Province other object.\n\nAh, so after Feast, Province of the other object becomes true. So if the other was not in a province, it now is. If it was already in a province, it stays?\n\nWait, the effect is that Province other object is set to true. So regardless of previous state, it becomes true.\n\nSo, for example, if I do Feast on A from B, then after that, Province B becomes true (even if it wasn\u0027t before).\n\nSo maybe we can use Feast to get B into a province.\n\nBut to do Feast on B from something, we need:\n\n- B must crave that other object.\n\n- B must have Province (but initially B doesn\u0027t have province, so that\u0027s a problem).\n\nWait, the preconditions for Feast are:\n\n- Object (B) craves other object.\n\n- Province of the object (B must have province).\n\n- Harmony.\n\nSo to do Feast on B from another, B must have province. But B doesn\u0027t have it. So that\u0027s not possible.\n\nHmm. Alternatively, maybe we can get B into a province via Overcome?\n\nWait, Overcome requires that the other has province and the object has pain. Let\u0027s see.\n\nSuppose we can get Pain on B somehow, then do Overcome B from some other object that has province.\n\nBut how to get Pain on B?\n\nAlternatively, maybe we can attack another object that can lead to B getting into a province.\n\nAlternatively, let\u0027s think of another path.\n\nLet me consider the current state after the first two steps (Attack A and Overcome A from D):\n\n- Harmony is true.\n\n- Province A is true (from Overcome\u0027s effect).\n\n- Province C is still true (since we didn\u0027t touch it).\n\n- Province D is now false (because Overcome A from D set Province D to false).\n\n- A craves D (good).\n\n- Pain A is false.\n\nNow, to get B into a province, perhaps we can do a Feast on another object that can lead to B\u0027s province being set.\n\nWait, for example, if we do Feast on C from B, but that requires:\n\n- C craves B (which it does).\n\n- Province C (yes, it\u0027s true).\n\n- Harmony (yes).\n\nSo, let\u0027s try that.\n\nAction 3: Feast C from B.\n\nWait, but the Feast action is \"Feast object from another object\". So the object is C, and the other is B.\n\nSo preconditions:\n\n- C craves B (yes).\n\n- Province C (yes).\n\n- Harmony (yes).\n\nSo that\u0027s okay.\n\nAfter Feast C from B:\n\n- Pain C becomes true.\n\n- Province B becomes true (since the other is B, so Province other (B) is set to true.\n\n- The following are set to false: C craves B (so that craving is removed), Province C (so C\u0027s province is now false), Harmony (set to false).\n\nSo after this action:\n\n- Province B is now true (good, so B is in province).\n\n- C\u0027s province is false.\n\n- Harmony is now false.\n\n- Pain C is true.\n\n- C no longer craves B.\n\nSo now, B is in province. Now, we can attack B?\n\nLet\u0027s see.\n\nAction 4: Attack B.\n\nPreconditions:\n\n- Province B (yes, now true).\n\n- Planet B (yes).\n\n- Harmony (currently false, so can\u0027t do this).\n\nHmm, Harmony is false now because of the Feast. So can\u0027t attack B yet.\n\nAlternatively, maybe we can succumb C to remove Pain C and restore Harmony?\n\nWait, after Feast C from B, Pain C is true. So we can do Succumb C.\n\nAction 4: Succumb C.\n\nPreconditions: Pain C (yes).\n\nAfter Succumb C:\n\n- Province C, Planet C (wait, Planet C was not mentioned in initial conditions. Wait, the initial planets were A, B, D. So Planet C is false initially. So after Succumb C, does Planet C get set to true?\n\nWait, the Succumb action\u0027s effects are:\n\nOnce Succumb is performed, the following will be true: Province object, Planet object, Harmony.\n\nWait, the description says:\n\nOnce Succumb action is performed the following facts will be true: Province object, Planet object, Harmony.\n\nWait, so when you succumb an object, it restores Province, Planet, and Harmony for that object. Wait, but Harmony is a global fact, not per object. Wait, the problem\u0027s description might have a mistake here. Let me check again.\n\nLooking back at the problem\u0027s action descriptions:\n\nFor Succumb:\n\n\"Once Succumb action is performed the following facts will be true: Province object, Planet object, Harmony.\"\n\nWait, Harmony is a global fact, so when you succumb an object, does it set Harmony to true globally, or per the object? The problem says \"Harmony\" without specifying the object, so probably it\u0027s a global fact. But the way it\u0027s written might mean that Harmony is set to true, but also the object\u0027s Province and Planet are set to true.\n\nWait, the problem says:\n\n\"For Succumb action, the following needs to be true: Pain object.\n\nOnce Succumb action is performed the following will be true: Province object, Planet object, Harmony.\n\nOnce Succumb action is performed the following will be false: Pain object.\"\n\nSo, the effects are:\n\n- Province of the object becomes true.\n\n- Planet of the object becomes true.\n\n- Harmony becomes true (global).\n\nAnd Pain of the object becomes false.\n\nSo, in the case of Succumb C:\n\n- Province C becomes true again (since it was set to false by the Feast).\n\n- Planet C becomes true (previously it was false, since initial planets were A, B, D).\n\n- Harmony becomes true (since it was false after the Feast).\n\n- Pain C becomes false.\n\nSo after Action 4 (Succumb C):\n\n- Province C is true again.\n\n- Planet C is now true.\n\n- Harmony is true again.\n\n- Pain C is false.\n\nSo now, Harmony is back, and B is in province (from the Feast action). So now, we can proceed to attack B.\n\nAction 5: Attack B.\n\nPreconditions:\n\n- Province B (yes, from Feast).\n\n- Planet B (yes, it was always there).\n\n- Harmony (yes, restored by Succumb C).\n\nSo Attack B can be done.\n\nAfter Attack B:\n\n- Pain B becomes true.\n\n- Province B, Planet B, Harmony are set to false.\n\nSo now:\n\n- Pain B is true.\n\n- Province B is false (again).\n\n- Planet B is false (but initially it was true, but after attack, it\u0027s now false).\n\n- Harmony is false.\n\nNow, to do Overcome B from C to get B\u2192C.\n\nThe Overcome B from C requires:\n\n- Province of the other (C\u0027s province must be true).\n\n- Pain of B (yes, it\u0027s true).\n\nC\u0027s province is still true (from Succumb C), so that\u0027s okay.\n\nSo Action 6: Overcome B from C.\n\nPreconditions met.\n\nAfter Overcome B from C:\n\n- True: Harmony, Province B, B craves C.\n\n- False: Province C (since the other is C, so Province C is set to false), Pain B.\n\nSo effects:\n\n- Harmony becomes true.\n\n- Province B is set to true.\n\n- B now craves C (good).\n\n- Province C is set to false.\n\n- Pain B is false.\n\nSo now, after this action:\n\n- Harmony is true.\n\n- Province B is true.\n\n- B craves C (goal achieved for B\u2192C).\n\n- Province C is now false.\n\n- Pain B is gone.\n\nNow, moving on to the third craving: D\u2192B.\n\nTo get D\u2192B, we need to perform Overcome D from B.\n\nThe preconditions for Overcome D from B are:\n\n- Province of the other (B\u0027s province must be true).\n\n- Pain of D (D must have Pain).\n\nCurrently, after the above steps:\n\n- B\u0027s province is true (from Overcome B from C\u0027s effect).\n\n- D\u0027s province: Let\u0027s track D\u0027s province.\n\nAfter the first two actions (Attack A and Overcome A from D), D\u0027s province was set to false.\n\nThen, in the subsequent steps, Feast C from B didn\u0027t affect D\u0027s province. Succumb C didn\u0027t affect D. Attack B didn\u0027t affect D. Overcome B from C also didn\u0027t affect D\u0027s province. So D\u0027s province remains false.\n\nSo to do Overcome D from B, we need:\n\n- Province of B (yes, it\u0027s true).\n\n- Pain of D (so need to get Pain D).\n\nHow to get Pain D?\n\nWe can attack D. Let\u0027s see.\n\nTo attack D, need:\n\n- Province D (must be true).\n\n- Planet D (yes, it was there initially).\n\n- Harmony (must be true).\n\nCurrently, Harmony is true (from Overcome B from C\u0027s effect).\n\nBut D\u0027s province is false (from Overcome A from D\u0027s effect). So can\u0027t attack D yet.\n\nHmm, so need to get D into a province.\n\nHow?\n\nPerhaps via Feast?\n\nTo Feast on D from another object, but let\u0027s see.\n\nSuppose we do Feast D from something. Let\u0027s see.\n\nFeast D from B, for example.\n\nPreconditions:\n\n- D must crave B (initially, D doesn\u0027t crave anything. The initial cravings were only C\u2192B. So D\u0027s cravings are not set yet. Unless we can get D to crave something via Overcome, but that requires Pain first.\n\nAlternatively, maybe we can get D to crave via Overcome, but that requires Pain first.\n\nAlternatively, to get D into a province, perhaps via another Overcome?\n\nAlternatively, let\u0027s see if we can get D into a province through Feast.\n\nSuppose we do Feast on another object that can lead to D\u0027s province being set.\n\nWait, for example, if we do Feast on C from D, but C\u0027s province is currently false (from Overcome B from C\u0027s effect). Let\u0027s see:\n\nFeast C from D would require:\n\n- C craves D (does C crave anything? Initially, C craved B, but after Feast C from B, that craving was removed. Then, after Overcome B from C, B now craves C, but C\u0027s cravings? Let\u0027s track.\n\nAfter Feast C from B, C\u0027s craving for B was removed. Then, in subsequent steps, no other actions affected C\u0027s cravings except maybe Overcome B from C. Overcome B from C makes B crave C, but doesn\u0027t affect C\u0027s cravings. So C has no cravings now.\n\nSo C doesn\u0027t crave D, so can\u0027t do Feast C from D.\n\nAlternatively, maybe we can get D to crave something via Overcome, but that requires Pain first.\n\nAlternatively, let\u0027s think of another path.\n\nAlternatively, let\u0027s see if we can get D into a province via Succumb.\n\nTo Succumb D, we need Pain D. To get Pain D, we need to attack D, but can\u0027t because D\u0027s province is false.\n\nHmm.\n\nAlternatively, perhaps we can do a Feast on another object that can set D\u0027s province.\n\nWait, let\u0027s think of the Feast action again. The Feast on X from Y sets Province Y to true. So if we can do a Feast where the other is D, then Province D will be set to true.\n\nFor example, if we do Feast on A from D (but A\u0027s province is true now? Let\u0027s check current state after the previous steps.\n\nCurrent state after Overcome B from C:\n\n- Province A: After Overcome A from D, Province A was set to true. Then, no actions have affected it since. So yes, Province A is true.\n\n- Harmony is true.\n\nSo, to do Feast A from D:\n\n- Precondition: A must crave D (which it does, from the first Overcome A from D).\n\n- Province A (yes).\n\n- Harmony (yes).\n\nSo that\u0027s possible.\n\nAction 7: Feast A from D.\n\nPreconditions met.\n\nAfter Feast A from D:\n\n- Pain A becomes true.\n\n- Province D becomes true (since the other is D).\n\n- The following are set to false: A craves D (so that\u0027s removed), Province A (so A\u0027s province is now false), Harmony (set to false).\n\nSo after this:\n\n- Province D is now true (good, so D is in province).\n\n- A\u0027s province is false.\n\n- Harmony is false.\n\n- Pain A is true.\n\n- A no longer craves D (which is bad, since that was a goal. Oh no, that\u0027s a problem.)\n\nWait, but the goal requires A to crave D. So this action would remove that craving. So this is bad. So we can\u0027t do that.\n\nHmm, so that\u0027s a problem. So perhaps we need to avoid that.\n\nAlternatively, maybe we can do Feast on D from another object where the other is something else, but that might not help.\n\nAlternatively, let\u0027s see if there\u0027s another way to get D into a province without losing A\u0027s craving.\n\nAlternatively, perhaps we can first get Pain D via another method.\n\nWait, let\u0027s think of another approach. Let\u0027s see what we have so far:\n\nAfter the steps up to Overcome B from C (actions 1-6):\n\n- A craves D (from Overcome A from D, but then if we do Feast A from D, that would remove it, so we can\u0027t do that).\n\n- B craves C (good).\n\n- D\u0027s province is still false (since after Overcome A from D, D\u0027s province was set to false, and hasn\u0027t been set back).\n\nSo to get D into province, perhaps we can do a Feast on another object that can set D\u0027s province.\n\nWait, for example, if we do Feast on B from D, but B\u0027s province is true (from Overcome B from C\u0027s effect). Let\u0027s see:\n\nFeast B from D requires:\n\n- B craves D (does B crave anything? B now craves C from the Overcome B from C, so no craving for D).\n\nSo that won\u0027t work.\n\nAlternatively, maybe we can get D to crave something via Overcome, but that requires Pain first.\n\nAlternatively, perhaps we can attack D via another method.\n\nWait, to attack D, we need Province D (must be true), Planet D (yes), Harmony (must be true).\n\nCurrently, Harmony is true (from Overcome B from C\u0027s effect). But D\u0027s province is false. So can\u0027t attack D yet.\n\nHmm.\n\nAlternatively, maybe we can do a Feast on C from D, but C\u0027s province is currently false (from Overcome B from C\u0027s effect). Let\u0027s see:\n\nFeast C from D requires:\n\n- C craves D (C doesn\u0027t crave anything).\n\nNo.\n\nAlternatively, maybe we can get C to crave D via Overcome, but that requires Pain on C.\n\nWait, C currently has no Pain. Let\u0027s see:\n\nAfter the steps so far, C\u0027s Pain was set to true after Feast C from B, then Succumb C removed Pain C. So Pain C is false now.\n\nHmm.\n\nAlternatively, let\u0027s try to get D into province via Overcome.\n\nWait, Overcome requires that the other has province and the object has Pain.\n\nSuppose we can get Pain on D somehow, then Overcome D from something that has province.\n\nBut how to get Pain on D?\n\nAlternatively, maybe we can attack another object that can lead to D\u0027s province being set.\n\nAlternatively, let\u0027s think of another path.\n\nLet me recap the current state after the first six actions (up to Overcome B from C):\n\n- Goals achieved so far: A\u2192D (yes, from Overcome A from D), B\u2192C (yes).\n\n- Remaining goal: D\u2192B.\n\nTo get D\u2192B, need Overcome D from B.\n\nPreconditions:\n\n- Province of B (yes, it\u0027s true).\n\n- Pain of D (need Pain D).\n\nSo need to get Pain D.\n\nTo get Pain D, need to attack D. To attack D, need Province D (must be true), Planet D (yes), Harmony (must be true).\n\nSo to get Province D, perhaps we can do a Feast on another object where the other is D, which would set Province D to true.\n\nFor example, if we do Feast on A from D (but that would remove A\u0027s craving for D, which is bad).\n\nAlternatively, maybe Feast on C from D, but C doesn\u0027t crave D.\n\nAlternatively, maybe Feast on D from another object where the other is something else, but that won\u0027t set D\u0027s province.\n\nAlternatively, perhaps we can do a Feast on D from itself? Not sure if that\u0027s allowed. The action is \"Feast object from another object\", so the other must be different.\n\nHmm.\n\nAlternatively, maybe we can do a Feast on another object that can set D\u0027s province without losing A\u0027s craving.\n\nWait, let\u0027s see:\n\nSuppose we do Feast on B from D. But B\u0027s province is true, so:\n\nFeast B from D requires:\n\n- B craves D (B craves C, not D).\n\nNo.\n\nAlternatively, maybe we can get B to crave D via Overcome, but that would require Pain on B first.\n\nWait, B\u0027s Pain is currently false (after Overcome B from C).\n\nHmm.\n\nAlternatively, let\u0027s try to get D into province via another Overcome.\n\nWait, Overcome requires that the other has province and the object has Pain.\n\nSuppose we can get Pain on D via some other way.\n\nAlternatively, perhaps we can attack another object that can lead to D\u0027s province being set.\n\nWait, if we do Attack on C, but C\u0027s province is currently false (from Overcome B from C\u0027s effect). So can\u0027t attack C.\n\nHmm.\n\nAlternatively, maybe we can do a Feast on D from another object where the other is in province.\n\nWait, let\u0027s think of the following:\n\nSuppose we do Feast on D from B. But D doesn\u0027t crave B. Unless we can get D to crave B via Overcome.\n\nWait, to get D to crave B, we need to do Overcome D from B, but that requires Pain D and Province B (which is true). But to do Overcome D from B, we need Pain D first.\n\nThis is a loop.\n\nHmm, this is getting really tangled. Maybe I need to try a different approach.\n\nLet me think of the steps needed for D\u2192B.\n\nTo get D\u2192B via Overcome D from B:\n\n- Need Pain D.\n\n- Need Province B (which is true).\n\nSo how to get Pain D?\n\nAttack D requires Province D (must be true), Planet D (yes), Harmony (must be true).\n\nSo to attack D, we need Province D to be true. How to get that?\n\nPerhaps via Feast on another object where the other is D.\n\nFor example, if we can do Feast on A from D (even though it removes A\u0027s craving), but maybe that\u0027s the only way.\n\nLet me try that path.\n\nContinuing from after the first six actions (A\u2192D and B\u2192C achieved):\n\nAction 7: Feast A from D.\n\nPreconditions:\n\n- A craves D (yes).\n\n- Province A (currently, after Overcome B from C, Province A was set to true in the first Overcome, but then after that, was it changed? Let\u0027s see:\n\nAfter Overcome A from D (action 2), Province A was set to true. Then, in subsequent steps, the only action affecting A\u0027s province was the Feast C from B (action 3), which didn\u0027t affect A. Then, the Overcome B from C (action 6) also didn\u0027t affect A\u0027s province. So Province A is still true.\n\n- Harmony (yes, from Overcome B from C\u0027s effect).\n\nSo Feast A from D can be done.\n\nAfter this:\n\n- Pain A is true.\n\n- Province D is set to true (good).\n\n- The following are set to false: A craves D (bad, but we need that), Province A (so A\u0027s province is now false), Harmony (set to false).\n\nNow, D is in province (Province D is true). Harmony is now false.\n\nNow, we can attack D.\n\nAction 8: Attack D.\n\nPreconditions:\n\n- Province D (yes).\n\n- Planet D (yes).\n\n- Harmony (currently false, so can\u0027t do this).\n\nHmm, Harmony is false now. So can\u0027t attack D yet.\n\nAlternatively, we can succumb A to restore Harmony.\n\nAction 8: Succumb A.\n\nPreconditions: Pain A (yes, from Feast A from D).\n\nAfter Succumb A:\n\n- Province A, Planet A, Harmony are set to true.\n\n- Pain A is false.\n\nNow, Harmony is true again.\n\nNow, we can attack D.\n\nAction 9: Attack D.\n\nPreconditions met.\n\nAfter Attack D:\n\n- Pain D is true.\n\n- Province D, Planet D, Harmony are set to false.\n\nNow, Harmony is false again.\n\nNow, to do Overcome D from B:\n\nPreconditions:\n\n- Province of B (yes, it\u0027s true).\n\n- Pain of D (yes).\n\nSo can do Overcome D from B.\n\nAction 10: Overcome D from B.\n\nEffects:\n\n- True: Harmony, Province D, D craves B.\n\n- False: Province B (so B\u0027s province is now false), Pain D.\n\nSo after this:\n\n- Harmony is true.\n\n- Province D is true (from Overcome\u0027s effect).\n\n- D craves B (good).\n\n- Province B is now false.\n\n- Pain D is false.\n\nNow, check the goals:\n\n- A craves D: Unfortunately, after Feast A from D (action 7), that craving was removed. So this is a problem.\n\nHmm, so this path doesn\u0027t work because we lost A\u0027s craving for D.\n\nSo that\u0027s an issue. So perhaps we need to find another way to get D into province without losing A\u0027s craving.\n\nAlternative idea: Maybe instead of doing Feast A from D, we can do another action to get D into province.\n\nWait, let\u0027s backtrack.\n\nAfter the first six actions (A\u2192D and B\u2192C achieved):\n\nWe need to get D into province to attack it for Pain D.\n\nAnother way to get D into province is via Overcome.\n\nSuppose we can do Overcome on D from another object that has province and D has Pain.\n\nBut D has no Pain yet. To get Pain D, need to attack D, but can\u0027t because D\u0027s province is false.\n\nHmm.\n\nAlternatively, maybe we can do a Feast on D from another object where the other is in province, but D doesn\u0027t crave anything.\n\nWait, unless we can get D to crave something via Overcome.\n\nWait, to get D to crave something, we need to do Overcome D from X, which requires Pain D and Province X.\n\nBut to get Pain D, need to attack D, which requires Province D.\n\nThis is a loop.\n\nHmm.\n\nAlternatively, maybe we can get D into province via Succumb.\n\nTo Succumb D, we need Pain D. To get Pain D, need to attack D, which requires Province D.\n\nSo again, loop.\n\nHmm.\n\nPerhaps the only way is to proceed with the previous path but find a way to restore A\u0027s craving for D.\n\nAfter doing Feast A from D (action 7), we lost A\u0027s craving. But maybe after Overcome D from B (action 10), we can do another Overcome to get A\u0027s craving back.\n\nWait, let\u0027s see:\n\nAfter action 10 (Overcome D from B):\n\n- D craves B (good).\n\n- A\u0027s craving for D is gone.\n\nTo get A to crave D again, we need to do Overcome A from D again.\n\nBut to do that:\n\n- Need Province D (yes, it\u0027s true from Overcome D from B\u0027s effect).\n\n- Pain A must be true.\n\nHow to get Pain A?\n\nWe can attack A again.\n\nLet\u0027s see:\n\nAfter action 10, the state is:\n\n- Harmony is true.\n\n- Province D is true.\n\n- D craves B.\n\n- Province B is false (from Overcome D from B\u0027s effect).\n\n- A\u0027s province is false (from Feast A from D\u0027s effect, and then Succumb A restored Province A to true, but then after Attack D, Harmony was set to false, but then Overcome D from B set Harmony to true again. Wait, let me retrace:\n\nAfter Action 7 (Feast A from D):\n\n- Province A is false.\n\nAction 8 (Succumb A):\n\n- Province A is set to true again.\n\nAction 9 (Attack D):\n\n- Harmony is set to false.\n\nAction 10 (Overcome D from B):\n\n- Harmony is set to true again.\n\nSo after action 10:\n\n- Province A is true (from Succumb A\u0027s effect, and no subsequent actions affecting it).\n\nSo to attack A again:\n\nAction 11: Attack A.\n\nPreconditions:\n\n- Province A (yes).\n\n- Planet A (yes, since after Succumb A, Planet A was set to true).\n\n- Harmony (yes).\n\nSo yes.\n\nAfter Attack A:\n\n- Pain A is true.\n\n- Province A, Planet A, Harmony are set to false.\n\nNow, can we do Overcome A from D?\n\nPreconditions:\n\n- Province D (yes).\n\n- Pain A (yes).\n\nSo yes.\n\nAction 12: Overcome A from D.\n\nEffects:\n\n- True: Harmony, Province A, A craves D.\n\n- False: Province D (so D\u0027s province is now false), Pain A.\n\nSo after this:\n\n- A craves D again (good).\n\n- Province D is now false.\n\n- Harmony is true.\n\n- Province A is true.\n\nNow, the goals are:\n\n- A\u2192D: yes.\n\n- B\u2192C: yes (from earlier).\n\n- D\u2192B: yes (from Overcome D from B).\n\nSo all goals are achieved.\n\nBut let\u0027s check the sequence of actions:\n\n1. Attack A\n\n2. Overcome A from D\n\n3. Feast C from B\n\n4. Succumb C\n\n5. Attack B\n\n6. Overcome B from C\n\n7. Feast A from D\n\n8. Succumb A\n\n9. Attack D\n\n10. Overcome D from B\n\n11. Attack A\n\n12. Overcome A from D\n\nHmm, that\u0027s a lot of steps, but maybe it works. However, this requires going through losing and regaining A\u0027s craving, which might be necessary.\n\nBut let\u0027s verify each step\u0027s preconditions and effects carefully.\n\nLet me go through each step again:\n\n1. **Attack A**:\n\n - Pre: Province A (yes), Planet A (yes), Harmony (yes).\n\n - Post: Pain A (true), Province A (false), Planet A (false), Harmony (false).\n\n2. **Overcome A from D**:\n\n - Pre: Province D (yes, initial), Pain A (yes).\n\n - Post: Harmony (true), Province A (true), A craves D (yes).\n\n - Also, Province D (false), Pain A (false).\n\n3. **Feast C from B**:\n\n - Pre: C craves B (yes), Province C (yes), Harmony (yes).\n\n - Post: Pain C (true), Province B (true).\n\n - Also, C\u0027s craving for B removed, Province C (false), Harmony (false).\n\n4. **Succumb C**:\n\n - Pre: Pain C (yes).\n\n - Post: Province C (true), Planet C (true), Harmony (true).\n\n - Pain C (false).\n\n5. **Attack B**:\n\n - Pre: Province B (yes from Feast), Planet B (yes), Harmony (yes).\n\n - Post: Pain B (true), Province B (false), Planet B (false), Harmony (false).\n\n6. **Overcome B from C**:\n\n - Pre: Province C (yes), Pain B (yes).\n\n - Post: Harmony (true), Province B (true), B craves C (yes).\n\n - Province C (false), Pain B (false).\n\n7. **Feast A from D**:\n\n - Pre: A craves D (yes), Province A (yes), Harmony (yes).\n\n - Post: Pain A (true), Province D (true).\n\n - A\u0027s craving removed, Province A (false), Harmony (false).\n\n8. **Succumb A**:\n\n - Pre: Pain A (yes).\n\n - Post: Province A (true), Planet A (true), Harmony (true).\n\n - Pain A (false).\n\n9. **Attack D**:\n\n - Pre: Province D (yes from Feast), Planet D (yes), Harmony (yes).\n\n - Post: Pain D (true), Province D (false), Planet D (false), Harmony (false).\n\n10. **Overcome D from B**:\n\n - Pre: Province B (yes from Overcome B from C), Pain D (yes).\n\n - Post: Harmony (true), Province D (true), D craves B (yes).\n\n - Province B (false), Pain D (false).\n\n11. **Attack A**:\n\n - Pre: Province A (yes from Succumb A), Planet A (yes from Succumb A), Harmony (yes from Overcome D from B).\n\n - Post: Pain A (true), Province A (false), Planet A (false), Harmony (false).\n\n12. **Overcome A from D**:\n\n - Pre: Province D (yes from Overcome D from B), Pain A (yes).\n\n - Post: Harmony (true), Province A (true), A craves D (yes).\n\n - Province D (false), Pain A (false).\n\nAfter these steps, all goals are achieved:\n\n- A craves D (yes).\n\n- B craves C (yes).\n\n- D craves B (yes).\n\nNow, let\u0027s check if there are any other constraints or if any steps are invalid.\n\nWait, in step 10, Overcome D from B requires Province of the other (B\u0027s province must be true). But after Overcome B from C (step 6), Province B was set to true. Then, in step 10\u0027s preconditions, Province B is still true until step 10\u0027s effect sets it to false. So yes, step 10 is okay.\n\nAlso, step 12\u0027s Overcome A from D requires Province D (which was set to true in step 10\u0027s effect). So that\u0027s okay.\n\nThis seems to work, but it\u0027s a long plan. Let me see if there\u0027s a shorter path.\n\nAlternatively, maybe there\u0027s a way to avoid losing A\u0027s craving for D.\n\nLet me think again.\n\nAfter achieving A\u2192D and B\u2192C, we need to get D\u2192B.\n\nTo get D into province without losing A\u0027s craving:\n\nPerhaps instead of doing Feast A from D, we can do another Overcome.\n\nWait, to get D into province, maybe we can do Overcome on another object that can lead to D\u0027s province.\n\nAlternatively, let\u0027s see:\n\nAfter step 6 (Overcome B from C):\n\n- D\u0027s province is false (from step 2\u0027s Overcome A from D).\n\n- To get D into province, perhaps we can do Feast on D from another object where the other is in province.\n\nWait, for example, if we do Feast on C from D, but C\u0027s province is false (from step 6\u0027s effect).\n\nAlternatively, maybe we can get C back into province via Succumb.\n\nWait, C\u0027s province is false after step 3 (Feast C from B), but after step 4 (Succumb C), it\u0027s back to true.\n\nWait, after step 6 (Overcome B from C), Province C was set to false (because Overcome B from C\u0027s effect sets Province other (C) to false).\n\nSo after step 6, Province C is false.\n\nHmm.\n\nAlternatively, maybe we can do a Feast on C from D, but C doesn\u0027t crave D.\n\nHmm.\n\nAlternatively, perhaps we can do a Feast on D from C, but D doesn\u0027t crave C.\n\nHmm.\n\nAlternatively, maybe we can get D to crave something via Overcome, but that requires Pain D.\n\nTo get Pain D, need to attack D, but can\u0027t because D\u0027s province is false.\n\nHmm.\n\nAlternatively, maybe we can do a Feast on B from D, but B craves C, not D.\n\nHmm.\n\nThis seems really stuck. The previous path, though long, works. Maybe that\u0027s the way to go.\n\nAlternatively, let\u0027s see if there\u0027s another way to get D into province without using Feast A from D.\n\nSuppose after step 6 (Overcome B from C), we do the following:\n\nAction 7: Attack C.\n\nWait, can we attack C?\n\nTo attack C, need:\n\n- Province C (currently false, from Overcome B from C\u0027s effect).\n\n- Planet C (after step 4\u0027s Succumb C, Planet C is true).\n\n- Harmony (yes).\n\nSo Province C is false, so can\u0027t attack C.\n\nHmm.\n\nAlternatively, maybe we can do a Feast on B from D, but B doesn\u0027t crave D.\n\nHmm.\n\nAlternatively, maybe we can do a Feast on D from B, but D doesn\u0027t crave B.\n\nHmm.\n\nAlternatively, perhaps we can do a Feast on D from another object where the other is in province.\n\nWait, for example, if we do Feast on D from A, but A\u0027s province is true (from step 2\u0027s Overcome A from D).\n\nFeast D from A requires:\n\n- D craves A (no).\n\nSo no.\n\nHmm.\n\nAlternatively, maybe we can get D to crave A via Overcome, then Feast.\n\nBut to get D to crave A, need Overcome D from A, which requires Pain D and Province A.\n\nPain D is needed, but can\u0027t get that yet.\n\nHmm.\n\nAlternatively, let\u0027s try the initial path but see if there\u0027s a shorter way.\n\nWait, after step 6 (Overcome B from C), we have:\n\n- A craves D (good).\n\n- B craves C (good).\n\n- Need D\u2192B.\n\nTo get D into province:\n\nPerhaps we can do a Feast on C from D, but C\u0027s province is false (from step 6\u0027s effect).\n\nWait, C\u0027s province is false, so can\u0027t do Feast on C from D unless C has province.\n\nAlternatively, maybe we can get C back into province via Succumb.\n\nAction 7: Succumb C.\n\nPreconditions: Pain C (is C in Pain? Let\u0027s see.\n\nAfter step 6 (Overcome B from C), Pain B was set to false. C\u0027s Pain was last set in step 3 (Feast C from B) to true, then step 4 (Succumb C) set it to false. Then step 6\u0027s Overcome B from C doesn\u0027t affect Pain C. So Pain C is false.\n\nSo can\u0027t succumb C again.\n\nHmm.\n\nAlternatively, maybe we can attack C to get Pain C, then succumb.\n\nAction 7: Attack C.\n\nBut to attack C, need Province C (false), so can\u0027t.\n\nHmm.\n\nThis is really challenging. Maybe the initial path is the only way, even if it\u0027s long.\n\nAlternatively, let\u0027s see if we can do the Overcome D from B without needing to set D\u0027s province first.\n\nWait, Overcome D from B requires Province of the other (B\u0027s province must be true). B\u0027s province is true after step 6.\n\nAnd Pain of D must be true.\n\nTo get Pain D, we can attack D, but need Province D.\n\nAlternatively, maybe we can do Overcome D from B even if D is not in province, but the Overcome action doesn\u0027t require D\u0027s province, only the other\u0027s (B\u0027s).\n\nWait, the Overcome action\u0027s preconditions are:\n\n- Province of the other (B\u0027s province must be true).\n\n- Pain of the object (D must have Pain).\n\nSo D\u0027s province doesn\u0027t matter. So if we can get Pain D without having D in province, then we can do Overcome D from B.\n\nBut how to get Pain D without Province D?\n\nHmm, the only way to get Pain D is via Attack D, which requires Province D.\n\nSo that\u0027s a dead end.\n\nHmm.\n\nAlternatively, maybe we can get Pain D via Feast.\n\nWait, Feast on D from another object would give Pain D.\n\nWait, the Feast action\u0027s effects include Pain object (the object is D in this case).\n\nSo if we do Feast D from X, then Pain D would be true.\n\nTo do Feast D from X:\n\n- D must crave X.\n\n- Province D must be true.\n\n- Harmony must be true.\n\nSo if we can get D to crave something and get D into province, then we can do Feast D from X to get Pain D.\n\nBut this requires getting D into province first.\n\nHmm.\n\nAlternatively, maybe we can do the following:\n\nAfter step 6 (Overcome B from C):\n\n- Do Feast on D from A (but D doesn\u0027t crave A).\n\nNo.\n\nAlternatively, perhaps we can do Overcome D from A to make D crave A, then Feast.\n\nBut to do Overcome D from A:\n\n- Province of A (yes).\n\n- Pain D (need Pain D).\n\nSo again, stuck.\n\nHmm.\n\nGiven the time I\u0027ve spent and the complexity, I think the initial path I outlined, even though it\u0027s long, is the way to go. Let me write that plan step by step.\n\nThe plan would be:\n\n1. Attack Block A\n\n2. Overcome Block A from Block D\n\n3. Feast Block C from Block B\n\n4. Succumb Block C\n\n5. Attack Block B\n\n6. Overcome Block B from Block C\n\n7. Feast Block A from Block D\n\n8. Succumb Block A\n\n9. Attack Block D\n\n10. Overcome Block D from Block B\n\n11. Attack Block A\n\n12. Overcome Block A from Block D\n\nBut let me check if step 12\u0027s Overcome A from D can be done after step 10\u0027s Overcome D from B.\n\nAfter step 10:\n\n- Province D is true (from Overcome D from B\u0027s effect).\n\n- Pain A is false (since last Pain A was from step 7\u0027s Feast, then step 8\u0027s Succumb removed it, then step 11\u0027s Attack gives Pain A again, but step 12\u0027s Overcome requires Pain A.\n\nWait, step 11 is Attack A, which gives Pain A true.\n\nThen step 12 is Overcome A from D, which requires Pain A (yes), and Province D (yes).\n\nSo that works.\n\nYes, this plan should work.\n\nAlternatively, maybe there\u0027s a shorter path, but given the time constraints, I\u0027ll proceed with this plan.\n\u003c/think\u003e\n\n[PLAN]\nattack Block A\novercome Block A from Block D\nfeast Block C from Block B\nsuccumb Block C\nattack Block B\novercome Block B from Block C\nfeast Block A from Block D\nsuccumb Block A\nattack Block D\novercome Block D from Block B\nattack Block A\novercome Block A from Block D\n[PLAN END]",
"statistics_text_generation_0": {
"input_tokens": 670,
"output_tokens": 11731
}
},
"generation": "Okay, let\u0027s see. I need to solve this problem where the initial conditions are given, and I have to come up with a plan using the actions provided to reach the goal. Let me start by understanding the problem step by step.\n\nFirst, let me parse the initial conditions and the goal clearly.\n\n**Initial Conditions:**\n- Block C craves Block B (so \"Object Craves other object\" for C and B)\n- Harmony exists (Harmony fact is true)\n- Planet Block A, Planet Block B, Planet Block D (so all these blocks are on a planet)\n- Province Block A, Province Block C, Province Block D (so these are in a province, but what about Block B? Wait, the initial conditions don\u0027t mention province for Block B. Wait, the problem says \"province Block A, province Block C and province Block D.\" So Block B is not in a province? Hmm, but the planets include Block B. Wait, the planets are A, B, D. So Block B is on a planet but not in a province? Or maybe the province is a separate fact. Let me check the problem again.\n\nWait, the problem says: \"province Block A, province Block C and province Block D.\" So Block B is not in a province. So the provinces are A, C, D. Planets are A, B, D. So Block B is on a planet but not in a province. Interesting.\n\n**Goal:**\n- Block A craves Block D (so \"Object Craves other object\" for A and D)\n- Block B craves Block C (so B craves C)\n- Block D craves Block B (D craves B)\n\nSo I need to manipulate the actions to get these cravings and other conditions.\n\nLet me recall the actions and their preconditions and effects.\n\nThe actions are:\n\n1. **Attack object**\n - Requires: Province object, Planet object, Harmony.\n - After: Pain object becomes true. Province and Planet of the object, and Harmony become false.\n\n2. **Succumb object**\n - Requires: Pain object.\n - After: Province, Planet, Harmony become true again. Pain becomes false.\n\n3. **Overcome object from another object**\n - Requires: Province of the other object, Pain of the object.\n - After: Harmony becomes true, Province of the object becomes true, and the object now craves the other object. The other\u0027s province and Pain of the object are removed.\n\n4. **Feast object from another object**\n - Requires: Object craves the other, Province of the object, Harmony.\n - After: Pain of the object becomes true, Province of the other becomes true (since the object\u0027s province is removed?), and the object\u0027s craving is removed, along with Harmony and the object\u0027s province.\n\nWait, let me recheck the exact effects for each action to be precise.\n\nFor **Feast object from another object**:\n- Requires: Object Craves other object, Province object, Harmony.\n- After:\n - True: Pain object, Province other object.\n - False: Object Craves other object, Province object, Harmony.\n\nSo after Feast, the object\u0027s province is removed (since it\u0027s set to false), and the other object\u0027s province is set to true. Also, the craving is removed, and Harmony is gone, but Pain is added to the object.\n\nFor **Overcome object from another object**:\n- Requires: Province of the other object (so \"Province other object\"), Pain of the object (Pain object).\n- After:\n - True: Harmony, Province object, Object Craves other object (so the object now craves the other).\n - False: Province other object, Pain object.\n\nSo Overcome requires that the other has a province and the object has pain. Then, after overcoming, the object gains province and the craving for the other, the other loses province, and pain is gone, and harmony is restored.\n\n**Succumb** requires Pain object, and after, removes Pain, restores Province, Planet, and Harmony for the object.\n\n**Attack** requires Province, Planet, and Harmony for the object. After, Pain is added, and those three are removed.\n\nNow, the goal is to get the cravings as specified. Let\u0027s see the initial state again.\n\nInitial cravings:\n- Block C craves Block B (C\u2192B)\nGoal cravings:\n- A\u2192D, B\u2192C, D\u2192B.\n\nSo, need to create A craving D, B craving C (already C craves B, but B needs to crave C?), and D craving B.\n\nWait, the goal is Block B craves Block C (so B\u2192C), and D\u2192B. So B\u0027s craving is new, as initial only C\u2192B. D\u0027s craving is new (D\u2192B). A\u0027s craving is new (A\u2192D).\n\nSo, how can we create these cravings?\n\nCravings are created via Overcome actions. Because Overcome\u0027s effect includes \"Object Craves other object\". So when you overcome object from another, the object starts craving the other.\n\nSo to get A\u2192D, we need to have A overcome from D? Let me think.\n\nWait, Overcome object from another object: the object is the first parameter, and the other is the second. So Overcome A from D would mean that A is the object, D is the other. The effect would be that A craves D. So yes, that would create A\u2192D.\n\nSimilarly, to get B\u2192C, we need to have B overcome from C. So Overcome B from C would make B crave C.\n\nTo get D\u2192B, we need Overcome D from B, so D craves B.\n\nSo the plan needs to involve these Overcome actions. But each Overcome requires certain preconditions.\n\nLet me outline the steps needed.\n\nFirst, let\u0027s note the initial conditions again:\n\nInitial facts:\n\n- Province: A, C, D (so Block A, C, D are in provinces; Block B is not)\n- Planet: A, B, D (so all except maybe C? Wait, the problem says \"planet Block A, planet Block B, planet Block D\". So Block C is not on a planet? Wait, but the initial conditions also mention \"province Block C\". Hmm, but the problem says \"province Block A, province Block C and province Block D.\" So Block C is in a province, but is it on a planet? The problem says \"planet Block A, planet Block B, planet Block D.\" So Block C is not on a planet. Wait, but the Attack action requires Planet object. So if an object is not on a planet, you can\u0027t attack it. Hmm, that might be important.\n\nWait, the initial conditions for the problem are:\n\n\"As initial conditions I have that: Block C craves Block B, harmony, planet Block A, planet Block B, planet Block D, province Block A, province Block C and province Block D.\"\n\nSo, the planets are A, B, D. So Block C is not on a planet. Therefore, any action involving Block C as the object in Attack would require Planet object, which would fail for Block C. So attacking Block C is not possible unless we can get it on a planet again. But how?\n\nHmm, that\u0027s a point to note. Since Block C is not on a planet, we can\u0027t attack it. So any actions involving attacking Block C would be invalid unless we first get it on a planet again. But how?\n\nAlternatively, maybe through Succumb? Let\u0027s see. If an object has Pain, then Succumb would restore Planet, Province, and Harmony. So if we can get Pain on Block C, then Succumb would put it back on a planet and province.\n\nBut let\u0027s see the plan step by step.\n\nFirst, the goal cravings are A\u2192D, B\u2192C, D\u2192B.\n\nLet me think of the steps needed to create each craving.\n\n1. To get A\u2192D: Need to perform Overcome A from D. The preconditions for Overcome A from D are:\n\n - Province of the other object (D\u0027s province must be true). Since D is in province initially, that\u0027s okay.\n\n - Pain of the object (A must have Pain). So before Overcome A from D, A must have Pain.\n\n So to get Pain on A, we can attack A. Because Attack on A would require Province A (which it has), Planet A (yes), and Harmony (which is present initially). So attacking A would give Pain A, and remove Province A, Planet A, and Harmony.\n\n But after attacking A, Harmony is gone, so we can\u0027t do Feast or Attack again until we restore Harmony via Succumb.\n\n Alternatively, maybe after attacking, we can succumb to restore Harmony, but that would also restore Province and Planet.\n\n Hmm, this is getting complex. Let\u0027s try to outline possible steps.\n\nLet me try to think of a possible path.\n\nFirst, let\u0027s see the goal cravings. Let\u0027s see if we can get each craving through Overcome actions.\n\nFor B\u2192C: Overcome B from C. But to do that, the preconditions are:\n\n- Province of the other (C\u0027s province must be true). Since C is in province, that\u0027s okay.\n\n- Pain of B (B must have Pain). But B is not in a province (initially), so can we attack B?\n\nWait, B is on a planet (Planet B is true), but is it in a province? No, the provinces are A, C, D. So B is not in a province. Therefore, to attack B, we need Province B, which it doesn\u0027t have. So can\u0027t attack B directly. Hmm, so how to get Pain on B?\n\nAlternatively, maybe through Feast? Let\u0027s see.\n\nFeast requires that the object craves another, has province, and harmony.\n\nSuppose we can get B to crave something, then Feast it. But initially, B doesn\u0027t crave anything. The initial cravings are only C\u2192B.\n\nAlternatively, maybe we can get B to crave something via Overcome, but that requires Pain first.\n\nHmm, this is tricky. Let\u0027s see.\n\nAlternatively, maybe we can first get Pain on A via attacking A, then use that to proceed.\n\nLet me try to outline a possible plan step by step.\n\nFirst, let\u0027s see the initial state:\n\n- Harmony is present.\n\n- Province: A, C, D.\n\n- Planet: A, B, D.\n\n- Cravings: C\u2192B.\n\nGoal: A\u2192D, B\u2192C, D\u2192B.\n\nLet me think of the steps needed for each craving.\n\nStarting with A\u2192D:\n\nTo get A\u2192D via Overcome A from D:\n\n- Need Province D (which is true).\n\n- Need Pain A.\n\nTo get Pain A, attack A. Let\u0027s try that.\n\nAction 1: Attack A.\n\nPreconditions for Attack A:\n\n- Province A (yes), Planet A (yes), Harmony (yes). So okay.\n\nAfter Attack A:\n\n- Pain A is true.\n\n- Province A, Planet A, Harmony are false.\n\nSo now, Harmony is gone. So any actions requiring Harmony (like Feast or Attack again) can\u0027t be done until Harmony is restored.\n\nBut we can do Succumb on A to restore Harmony.\n\nAction 2: Succumb A.\n\nPrecondition: Pain A (yes).\n\nAfter Succumb A:\n\n- Province A, Planet A, Harmony are true again.\n\n- Pain A is false.\n\nSo now, Harmony is back. Now, can we proceed?\n\nBut we need Pain A again for Overcome A from D. Hmm, so maybe we need to attack again?\n\nAlternatively, perhaps after attacking and succumbing, we can do another attack?\n\nWait, but let\u0027s see the plan so far:\n\nAfter Attack A and Succumb A, we\u0027re back to the initial state except that we\u0027ve done those actions. Not helpful.\n\nAlternatively, maybe after attacking A, before succumbing, we can do Overcome A from D?\n\nWait, after Attack A, Pain A is true, Province A is false, Planet A is false, Harmony is false.\n\nSo to do Overcome A from D:\n\n- The other is D, which has Province D (still true? Wait, after Attack A, the Province of D is still true because the attack was on A. So Province D is still true.\n\n- Pain A is true (from the attack).\n\nSo the preconditions are met (Province D is true, Pain A is true). So Overcome A from D can be done even without Harmony, because Overcome\u0027s preconditions don\u0027t require Harmony.\n\nWait, Overcome\u0027s preconditions are only Province of the other (D\u0027s province) and Pain of the object (A). So yes, even if Harmony is false, that\u0027s okay.\n\nSo after Attack A, we can do Overcome A from D.\n\nLet me check:\n\nAfter Attack A:\n\n- Pain A is true.\n\n- Province A is false, Planet A is false, Harmony is false.\n\nThen, Overcome A from D:\n\n- Precondition: Province D (yes), Pain A (yes).\n\n- Effects:\n\n - True: Harmony, Province A, A craves D.\n\n - False: Province D (so D\u0027s province is removed), Pain A.\n\nSo after Overcome A from D:\n\n- Harmony is true again.\n\n- Province A is true (so A is back in province).\n\n- A craves D (good, that\u0027s one goal).\n\n- Province D is now false (since it was set to false in the effect).\n\n- Pain A is false.\n\nSo that\u0027s a good step. So the sequence would be:\n\n1. Attack A\n\n2. Overcome A from D\n\nThis gives us A craving D, and also restores Harmony, and moves D out of province (Province D becomes false).\n\nBut after this, D is no longer in a province. Hmm, but maybe that\u0027s okay.\n\nNow, moving on to the next craving: B\u2192C.\n\nTo get B\u2192C via Overcome B from C.\n\nThe preconditions for Overcome B from C are:\n\n- Province of the other (C\u0027s province must be true).\n\n- Pain of B (B must have Pain).\n\nCurrently, after the first two steps:\n\n- C\u0027s province: Let\u0027s see. The initial Province C was true. The first two actions (Attack A and Overcome A from D) didn\u0027t affect C\u0027s province. So Province C is still true.\n\nSo Province C is true, so that\u0027s okay.\n\nNow, Pain B must be true. How to get Pain B?\n\nTo get Pain B, we can attack B. But to attack B, we need:\n\n- Province B (must be true), Planet B (yes), Harmony (must be true).\n\nCurrently, after the first two steps, Harmony is true (from Overcome A from D\u0027s effect). But does B have Province?\n\nInitially, B was not in a province. The Attack A and Overcome A from D didn\u0027t affect B\u0027s province. So Province B is still false. So can\u0027t attack B yet.\n\nHmm, so how to get Province B?\n\nAlternatively, maybe through Feast?\n\nWait, to get Province B, perhaps via Succumb? But to Succumb B, we need Pain B. But to get Pain B, we need to attack B, which requires Province B. So that\u0027s a loop.\n\nAlternatively, maybe we can get B into a province via Feast?\n\nFeast requires that the object craves another, has province, and harmony.\n\nSuppose we can get B to crave something, then Feast it. But B doesn\u0027t crave anything initially. Unless we can get B to crave via Overcome, but that requires Pain first.\n\nHmm, this is a problem. Let\u0027s think differently.\n\nPerhaps we need to get B into a province through another action.\n\nWait, when you do Feast on an object, the effect includes setting Province of the other object to true. For example, if you do Feast X from Y, then after Feast, Province Y becomes true (since the other is Y). Wait, let me check the Feast effects again.\n\nFeast object from another object:\n\nAfter effects:\n\n- True: Pain object, Province other object.\n\n- False: Object Craves other object, Province object, Harmony.\n\nSo, if I do Feast on X from Y, then the other is Y, so Province Y becomes true (if it wasn\u0027t already?), but actually, the effect is that Province other object becomes true. Wait, no, the effect is that Province other object is set to true? Or is it that the Province of the other is set to true?\n\nWait, the description says:\n\nOnce Feast action is performed the following will be true: Pain object, Province other object.\n\nAh, so after Feast, Province of the other object becomes true. So if the other was not in a province, it now is. If it was already in a province, it stays?\n\nWait, the effect is that Province other object is set to true. So regardless of previous state, it becomes true.\n\nSo, for example, if I do Feast on A from B, then after that, Province B becomes true (even if it wasn\u0027t before).\n\nSo maybe we can use Feast to get B into a province.\n\nBut to do Feast on B from something, we need:\n\n- B must crave that other object.\n\n- B must have Province (but initially B doesn\u0027t have province, so that\u0027s a problem).\n\nWait, the preconditions for Feast are:\n\n- Object (B) craves other object.\n\n- Province of the object (B must have province).\n\n- Harmony.\n\nSo to do Feast on B from another, B must have province. But B doesn\u0027t have it. So that\u0027s not possible.\n\nHmm. Alternatively, maybe we can get B into a province via Overcome?\n\nWait, Overcome requires that the other has province and the object has pain. Let\u0027s see.\n\nSuppose we can get Pain on B somehow, then do Overcome B from some other object that has province.\n\nBut how to get Pain on B?\n\nAlternatively, maybe we can attack another object that can lead to B getting into a province.\n\nAlternatively, let\u0027s think of another path.\n\nLet me consider the current state after the first two steps (Attack A and Overcome A from D):\n\n- Harmony is true.\n\n- Province A is true (from Overcome\u0027s effect).\n\n- Province C is still true (since we didn\u0027t touch it).\n\n- Province D is now false (because Overcome A from D set Province D to false).\n\n- A craves D (good).\n\n- Pain A is false.\n\nNow, to get B into a province, perhaps we can do a Feast on another object that can lead to B\u0027s province being set.\n\nWait, for example, if we do Feast on C from B, but that requires:\n\n- C craves B (which it does).\n\n- Province C (yes, it\u0027s true).\n\n- Harmony (yes).\n\nSo, let\u0027s try that.\n\nAction 3: Feast C from B.\n\nWait, but the Feast action is \"Feast object from another object\". So the object is C, and the other is B.\n\nSo preconditions:\n\n- C craves B (yes).\n\n- Province C (yes).\n\n- Harmony (yes).\n\nSo that\u0027s okay.\n\nAfter Feast C from B:\n\n- Pain C becomes true.\n\n- Province B becomes true (since the other is B, so Province other (B) is set to true.\n\n- The following are set to false: C craves B (so that craving is removed), Province C (so C\u0027s province is now false), Harmony (set to false).\n\nSo after this action:\n\n- Province B is now true (good, so B is in province).\n\n- C\u0027s province is false.\n\n- Harmony is now false.\n\n- Pain C is true.\n\n- C no longer craves B.\n\nSo now, B is in province. Now, we can attack B?\n\nLet\u0027s see.\n\nAction 4: Attack B.\n\nPreconditions:\n\n- Province B (yes, now true).\n\n- Planet B (yes).\n\n- Harmony (currently false, so can\u0027t do this).\n\nHmm, Harmony is false now because of the Feast. So can\u0027t attack B yet.\n\nAlternatively, maybe we can succumb C to remove Pain C and restore Harmony?\n\nWait, after Feast C from B, Pain C is true. So we can do Succumb C.\n\nAction 4: Succumb C.\n\nPreconditions: Pain C (yes).\n\nAfter Succumb C:\n\n- Province C, Planet C (wait, Planet C was not mentioned in initial conditions. Wait, the initial planets were A, B, D. So Planet C is false initially. So after Succumb C, does Planet C get set to true?\n\nWait, the Succumb action\u0027s effects are:\n\nOnce Succumb is performed, the following will be true: Province object, Planet object, Harmony.\n\nWait, the description says:\n\nOnce Succumb action is performed the following facts will be true: Province object, Planet object, Harmony.\n\nWait, so when you succumb an object, it restores Province, Planet, and Harmony for that object. Wait, but Harmony is a global fact, not per object. Wait, the problem\u0027s description might have a mistake here. Let me check again.\n\nLooking back at the problem\u0027s action descriptions:\n\nFor Succumb:\n\n\"Once Succumb action is performed the following facts will be true: Province object, Planet object, Harmony.\"\n\nWait, Harmony is a global fact, so when you succumb an object, does it set Harmony to true globally, or per the object? The problem says \"Harmony\" without specifying the object, so probably it\u0027s a global fact. But the way it\u0027s written might mean that Harmony is set to true, but also the object\u0027s Province and Planet are set to true.\n\nWait, the problem says:\n\n\"For Succumb action, the following needs to be true: Pain object.\n\nOnce Succumb action is performed the following will be true: Province object, Planet object, Harmony.\n\nOnce Succumb action is performed the following will be false: Pain object.\"\n\nSo, the effects are:\n\n- Province of the object becomes true.\n\n- Planet of the object becomes true.\n\n- Harmony becomes true (global).\n\nAnd Pain of the object becomes false.\n\nSo, in the case of Succumb C:\n\n- Province C becomes true again (since it was set to false by the Feast).\n\n- Planet C becomes true (previously it was false, since initial planets were A, B, D).\n\n- Harmony becomes true (since it was false after the Feast).\n\n- Pain C becomes false.\n\nSo after Action 4 (Succumb C):\n\n- Province C is true again.\n\n- Planet C is now true.\n\n- Harmony is true again.\n\n- Pain C is false.\n\nSo now, Harmony is back, and B is in province (from the Feast action). So now, we can proceed to attack B.\n\nAction 5: Attack B.\n\nPreconditions:\n\n- Province B (yes, from Feast).\n\n- Planet B (yes, it was always there).\n\n- Harmony (yes, restored by Succumb C).\n\nSo Attack B can be done.\n\nAfter Attack B:\n\n- Pain B becomes true.\n\n- Province B, Planet B, Harmony are set to false.\n\nSo now:\n\n- Pain B is true.\n\n- Province B is false (again).\n\n- Planet B is false (but initially it was true, but after attack, it\u0027s now false).\n\n- Harmony is false.\n\nNow, to do Overcome B from C to get B\u2192C.\n\nThe Overcome B from C requires:\n\n- Province of the other (C\u0027s province must be true).\n\n- Pain of B (yes, it\u0027s true).\n\nC\u0027s province is still true (from Succumb C), so that\u0027s okay.\n\nSo Action 6: Overcome B from C.\n\nPreconditions met.\n\nAfter Overcome B from C:\n\n- True: Harmony, Province B, B craves C.\n\n- False: Province C (since the other is C, so Province C is set to false), Pain B.\n\nSo effects:\n\n- Harmony becomes true.\n\n- Province B is set to true.\n\n- B now craves C (good).\n\n- Province C is set to false.\n\n- Pain B is false.\n\nSo now, after this action:\n\n- Harmony is true.\n\n- Province B is true.\n\n- B craves C (goal achieved for B\u2192C).\n\n- Province C is now false.\n\n- Pain B is gone.\n\nNow, moving on to the third craving: D\u2192B.\n\nTo get D\u2192B, we need to perform Overcome D from B.\n\nThe preconditions for Overcome D from B are:\n\n- Province of the other (B\u0027s province must be true).\n\n- Pain of D (D must have Pain).\n\nCurrently, after the above steps:\n\n- B\u0027s province is true (from Overcome B from C\u0027s effect).\n\n- D\u0027s province: Let\u0027s track D\u0027s province.\n\nAfter the first two actions (Attack A and Overcome A from D), D\u0027s province was set to false.\n\nThen, in the subsequent steps, Feast C from B didn\u0027t affect D\u0027s province. Succumb C didn\u0027t affect D. Attack B didn\u0027t affect D. Overcome B from C also didn\u0027t affect D\u0027s province. So D\u0027s province remains false.\n\nSo to do Overcome D from B, we need:\n\n- Province of B (yes, it\u0027s true).\n\n- Pain of D (so need to get Pain D).\n\nHow to get Pain D?\n\nWe can attack D. Let\u0027s see.\n\nTo attack D, need:\n\n- Province D (must be true).\n\n- Planet D (yes, it was there initially).\n\n- Harmony (must be true).\n\nCurrently, Harmony is true (from Overcome B from C\u0027s effect).\n\nBut D\u0027s province is false (from Overcome A from D\u0027s effect). So can\u0027t attack D yet.\n\nHmm, so need to get D into a province.\n\nHow?\n\nPerhaps via Feast?\n\nTo Feast on D from another object, but let\u0027s see.\n\nSuppose we do Feast D from something. Let\u0027s see.\n\nFeast D from B, for example.\n\nPreconditions:\n\n- D must crave B (initially, D doesn\u0027t crave anything. The initial cravings were only C\u2192B. So D\u0027s cravings are not set yet. Unless we can get D to crave something via Overcome, but that requires Pain first.\n\nAlternatively, maybe we can get D to crave via Overcome, but that requires Pain first.\n\nAlternatively, to get D into a province, perhaps via another Overcome?\n\nAlternatively, let\u0027s see if we can get D into a province through Feast.\n\nSuppose we do Feast on another object that can lead to D\u0027s province being set.\n\nWait, for example, if we do Feast on C from D, but C\u0027s province is currently false (from Overcome B from C\u0027s effect). Let\u0027s see:\n\nFeast C from D would require:\n\n- C craves D (does C crave anything? Initially, C craved B, but after Feast C from B, that craving was removed. Then, after Overcome B from C, B now craves C, but C\u0027s cravings? Let\u0027s track.\n\nAfter Feast C from B, C\u0027s craving for B was removed. Then, in subsequent steps, no other actions affected C\u0027s cravings except maybe Overcome B from C. Overcome B from C makes B crave C, but doesn\u0027t affect C\u0027s cravings. So C has no cravings now.\n\nSo C doesn\u0027t crave D, so can\u0027t do Feast C from D.\n\nAlternatively, maybe we can get D to crave something via Overcome, but that requires Pain first.\n\nAlternatively, let\u0027s think of another path.\n\nAlternatively, let\u0027s see if we can get D into a province via Succumb.\n\nTo Succumb D, we need Pain D. To get Pain D, we need to attack D, but can\u0027t because D\u0027s province is false.\n\nHmm.\n\nAlternatively, perhaps we can do a Feast on another object that can set D\u0027s province.\n\nWait, let\u0027s think of the Feast action again. The Feast on X from Y sets Province Y to true. So if we can do a Feast where the other is D, then Province D will be set to true.\n\nFor example, if we do Feast on A from D (but A\u0027s province is true now? Let\u0027s check current state after the previous steps.\n\nCurrent state after Overcome B from C:\n\n- Province A: After Overcome A from D, Province A was set to true. Then, no actions have affected it since. So yes, Province A is true.\n\n- Harmony is true.\n\nSo, to do Feast A from D:\n\n- Precondition: A must crave D (which it does, from the first Overcome A from D).\n\n- Province A (yes).\n\n- Harmony (yes).\n\nSo that\u0027s possible.\n\nAction 7: Feast A from D.\n\nPreconditions met.\n\nAfter Feast A from D:\n\n- Pain A becomes true.\n\n- Province D becomes true (since the other is D).\n\n- The following are set to false: A craves D (so that\u0027s removed), Province A (so A\u0027s province is now false), Harmony (set to false).\n\nSo after this:\n\n- Province D is now true (good, so D is in province).\n\n- A\u0027s province is false.\n\n- Harmony is false.\n\n- Pain A is true.\n\n- A no longer craves D (which is bad, since that was a goal. Oh no, that\u0027s a problem.)\n\nWait, but the goal requires A to crave D. So this action would remove that craving. So this is bad. So we can\u0027t do that.\n\nHmm, so that\u0027s a problem. So perhaps we need to avoid that.\n\nAlternatively, maybe we can do Feast on D from another object where the other is something else, but that might not help.\n\nAlternatively, let\u0027s see if there\u0027s another way to get D into a province without losing A\u0027s craving.\n\nAlternatively, perhaps we can first get Pain D via another method.\n\nWait, let\u0027s think of another approach. Let\u0027s see what we have so far:\n\nAfter the steps up to Overcome B from C (actions 1-6):\n\n- A craves D (from Overcome A from D, but then if we do Feast A from D, that would remove it, so we can\u0027t do that).\n\n- B craves C (good).\n\n- D\u0027s province is still false (since after Overcome A from D, D\u0027s province was set to false, and hasn\u0027t been set back).\n\nSo to get D into province, perhaps we can do a Feast on another object that can set D\u0027s province.\n\nWait, for example, if we do Feast on B from D, but B\u0027s province is true (from Overcome B from C\u0027s effect). Let\u0027s see:\n\nFeast B from D requires:\n\n- B craves D (does B crave anything? B now craves C from the Overcome B from C, so no craving for D).\n\nSo that won\u0027t work.\n\nAlternatively, maybe we can get D to crave something via Overcome, but that requires Pain first.\n\nAlternatively, perhaps we can attack D via another method.\n\nWait, to attack D, we need Province D (must be true), Planet D (yes), Harmony (must be true).\n\nCurrently, Harmony is true (from Overcome B from C\u0027s effect). But D\u0027s province is false. So can\u0027t attack D yet.\n\nHmm.\n\nAlternatively, maybe we can do a Feast on C from D, but C\u0027s province is currently false (from Overcome B from C\u0027s effect). Let\u0027s see:\n\nFeast C from D requires:\n\n- C craves D (C doesn\u0027t crave anything).\n\nNo.\n\nAlternatively, maybe we can get C to crave D via Overcome, but that requires Pain on C.\n\nWait, C currently has no Pain. Let\u0027s see:\n\nAfter the steps so far, C\u0027s Pain was set to true after Feast C from B, then Succumb C removed Pain C. So Pain C is false now.\n\nHmm.\n\nAlternatively, let\u0027s try to get D into province via Overcome.\n\nWait, Overcome requires that the other has province and the object has Pain.\n\nSuppose we can get Pain on D somehow, then Overcome D from something that has province.\n\nBut how to get Pain on D?\n\nAlternatively, maybe we can attack another object that can lead to D\u0027s province being set.\n\nAlternatively, let\u0027s think of another path.\n\nLet me recap the current state after the first six actions (up to Overcome B from C):\n\n- Goals achieved so far: A\u2192D (yes, from Overcome A from D), B\u2192C (yes).\n\n- Remaining goal: D\u2192B.\n\nTo get D\u2192B, need Overcome D from B.\n\nPreconditions:\n\n- Province of B (yes, it\u0027s true).\n\n- Pain of D (need Pain D).\n\nSo need to get Pain D.\n\nTo get Pain D, need to attack D. To attack D, need Province D (must be true), Planet D (yes), Harmony (must be true).\n\nSo to get Province D, perhaps we can do a Feast on another object where the other is D, which would set Province D to true.\n\nFor example, if we do Feast on A from D (but that would remove A\u0027s craving for D, which is bad).\n\nAlternatively, maybe Feast on C from D, but C doesn\u0027t crave D.\n\nAlternatively, maybe Feast on D from another object where the other is something else, but that won\u0027t set D\u0027s province.\n\nAlternatively, perhaps we can do a Feast on D from itself? Not sure if that\u0027s allowed. The action is \"Feast object from another object\", so the other must be different.\n\nHmm.\n\nAlternatively, maybe we can do a Feast on another object that can set D\u0027s province without losing A\u0027s craving.\n\nWait, let\u0027s see:\n\nSuppose we do Feast on B from D. But B\u0027s province is true, so:\n\nFeast B from D requires:\n\n- B craves D (B craves C, not D).\n\nNo.\n\nAlternatively, maybe we can get B to crave D via Overcome, but that would require Pain on B first.\n\nWait, B\u0027s Pain is currently false (after Overcome B from C).\n\nHmm.\n\nAlternatively, let\u0027s try to get D into province via another Overcome.\n\nWait, Overcome requires that the other has province and the object has Pain.\n\nSuppose we can get Pain on D via some other way.\n\nAlternatively, perhaps we can attack another object that can lead to D\u0027s province being set.\n\nWait, if we do Attack on C, but C\u0027s province is currently false (from Overcome B from C\u0027s effect). So can\u0027t attack C.\n\nHmm.\n\nAlternatively, maybe we can do a Feast on D from another object where the other is in province.\n\nWait, let\u0027s think of the following:\n\nSuppose we do Feast on D from B. But D doesn\u0027t crave B. Unless we can get D to crave B via Overcome.\n\nWait, to get D to crave B, we need to do Overcome D from B, but that requires Pain D and Province B (which is true). But to do Overcome D from B, we need Pain D first.\n\nThis is a loop.\n\nHmm, this is getting really tangled. Maybe I need to try a different approach.\n\nLet me think of the steps needed for D\u2192B.\n\nTo get D\u2192B via Overcome D from B:\n\n- Need Pain D.\n\n- Need Province B (which is true).\n\nSo how to get Pain D?\n\nAttack D requires Province D (must be true), Planet D (yes), Harmony (must be true).\n\nSo to attack D, we need Province D to be true. How to get that?\n\nPerhaps via Feast on another object where the other is D.\n\nFor example, if we can do Feast on A from D (even though it removes A\u0027s craving), but maybe that\u0027s the only way.\n\nLet me try that path.\n\nContinuing from after the first six actions (A\u2192D and B\u2192C achieved):\n\nAction 7: Feast A from D.\n\nPreconditions:\n\n- A craves D (yes).\n\n- Province A (currently, after Overcome B from C, Province A was set to true in the first Overcome, but then after that, was it changed? Let\u0027s see:\n\nAfter Overcome A from D (action 2), Province A was set to true. Then, in subsequent steps, the only action affecting A\u0027s province was the Feast C from B (action 3), which didn\u0027t affect A. Then, the Overcome B from C (action 6) also didn\u0027t affect A\u0027s province. So Province A is still true.\n\n- Harmony (yes, from Overcome B from C\u0027s effect).\n\nSo Feast A from D can be done.\n\nAfter this:\n\n- Pain A is true.\n\n- Province D is set to true (good).\n\n- The following are set to false: A craves D (bad, but we need that), Province A (so A\u0027s province is now false), Harmony (set to false).\n\nNow, D is in province (Province D is true). Harmony is now false.\n\nNow, we can attack D.\n\nAction 8: Attack D.\n\nPreconditions:\n\n- Province D (yes).\n\n- Planet D (yes).\n\n- Harmony (currently false, so can\u0027t do this).\n\nHmm, Harmony is false now. So can\u0027t attack D yet.\n\nAlternatively, we can succumb A to restore Harmony.\n\nAction 8: Succumb A.\n\nPreconditions: Pain A (yes, from Feast A from D).\n\nAfter Succumb A:\n\n- Province A, Planet A, Harmony are set to true.\n\n- Pain A is false.\n\nNow, Harmony is true again.\n\nNow, we can attack D.\n\nAction 9: Attack D.\n\nPreconditions met.\n\nAfter Attack D:\n\n- Pain D is true.\n\n- Province D, Planet D, Harmony are set to false.\n\nNow, Harmony is false again.\n\nNow, to do Overcome D from B:\n\nPreconditions:\n\n- Province of B (yes, it\u0027s true).\n\n- Pain of D (yes).\n\nSo can do Overcome D from B.\n\nAction 10: Overcome D from B.\n\nEffects:\n\n- True: Harmony, Province D, D craves B.\n\n- False: Province B (so B\u0027s province is now false), Pain D.\n\nSo after this:\n\n- Harmony is true.\n\n- Province D is true (from Overcome\u0027s effect).\n\n- D craves B (good).\n\n- Province B is now false.\n\n- Pain D is false.\n\nNow, check the goals:\n\n- A craves D: Unfortunately, after Feast A from D (action 7), that craving was removed. So this is a problem.\n\nHmm, so this path doesn\u0027t work because we lost A\u0027s craving for D.\n\nSo that\u0027s an issue. So perhaps we need to find another way to get D into province without losing A\u0027s craving.\n\nAlternative idea: Maybe instead of doing Feast A from D, we can do another action to get D into province.\n\nWait, let\u0027s backtrack.\n\nAfter the first six actions (A\u2192D and B\u2192C achieved):\n\nWe need to get D into province to attack it for Pain D.\n\nAnother way to get D into province is via Overcome.\n\nSuppose we can do Overcome on D from another object that has province and D has Pain.\n\nBut D has no Pain yet. To get Pain D, need to attack D, but can\u0027t because D\u0027s province is false.\n\nHmm.\n\nAlternatively, maybe we can do a Feast on D from another object where the other is in province, but D doesn\u0027t crave anything.\n\nWait, unless we can get D to crave something via Overcome.\n\nWait, to get D to crave something, we need to do Overcome D from X, which requires Pain D and Province X.\n\nBut to get Pain D, need to attack D, which requires Province D.\n\nThis is a loop.\n\nHmm.\n\nAlternatively, maybe we can get D into province via Succumb.\n\nTo Succumb D, we need Pain D. To get Pain D, need to attack D, which requires Province D.\n\nSo again, loop.\n\nHmm.\n\nPerhaps the only way is to proceed with the previous path but find a way to restore A\u0027s craving for D.\n\nAfter doing Feast A from D (action 7), we lost A\u0027s craving. But maybe after Overcome D from B (action 10), we can do another Overcome to get A\u0027s craving back.\n\nWait, let\u0027s see:\n\nAfter action 10 (Overcome D from B):\n\n- D craves B (good).\n\n- A\u0027s craving for D is gone.\n\nTo get A to crave D again, we need to do Overcome A from D again.\n\nBut to do that:\n\n- Need Province D (yes, it\u0027s true from Overcome D from B\u0027s effect).\n\n- Pain A must be true.\n\nHow to get Pain A?\n\nWe can attack A again.\n\nLet\u0027s see:\n\nAfter action 10, the state is:\n\n- Harmony is true.\n\n- Province D is true.\n\n- D craves B.\n\n- Province B is false (from Overcome D from B\u0027s effect).\n\n- A\u0027s province is false (from Feast A from D\u0027s effect, and then Succumb A restored Province A to true, but then after Attack D, Harmony was set to false, but then Overcome D from B set Harmony to true again. Wait, let me retrace:\n\nAfter Action 7 (Feast A from D):\n\n- Province A is false.\n\nAction 8 (Succumb A):\n\n- Province A is set to true again.\n\nAction 9 (Attack D):\n\n- Harmony is set to false.\n\nAction 10 (Overcome D from B):\n\n- Harmony is set to true again.\n\nSo after action 10:\n\n- Province A is true (from Succumb A\u0027s effect, and no subsequent actions affecting it).\n\nSo to attack A again:\n\nAction 11: Attack A.\n\nPreconditions:\n\n- Province A (yes).\n\n- Planet A (yes, since after Succumb A, Planet A was set to true).\n\n- Harmony (yes).\n\nSo yes.\n\nAfter Attack A:\n\n- Pain A is true.\n\n- Province A, Planet A, Harmony are set to false.\n\nNow, can we do Overcome A from D?\n\nPreconditions:\n\n- Province D (yes).\n\n- Pain A (yes).\n\nSo yes.\n\nAction 12: Overcome A from D.\n\nEffects:\n\n- True: Harmony, Province A, A craves D.\n\n- False: Province D (so D\u0027s province is now false), Pain A.\n\nSo after this:\n\n- A craves D again (good).\n\n- Province D is now false.\n\n- Harmony is true.\n\n- Province A is true.\n\nNow, the goals are:\n\n- A\u2192D: yes.\n\n- B\u2192C: yes (from earlier).\n\n- D\u2192B: yes (from Overcome D from B).\n\nSo all goals are achieved.\n\nBut let\u0027s check the sequence of actions:\n\n1. Attack A\n\n2. Overcome A from D\n\n3. Feast C from B\n\n4. Succumb C\n\n5. Attack B\n\n6. Overcome B from C\n\n7. Feast A from D\n\n8. Succumb A\n\n9. Attack D\n\n10. Overcome D from B\n\n11. Attack A\n\n12. Overcome A from D\n\nHmm, that\u0027s a lot of steps, but maybe it works. However, this requires going through losing and regaining A\u0027s craving, which might be necessary.\n\nBut let\u0027s verify each step\u0027s preconditions and effects carefully.\n\nLet me go through each step again:\n\n1. **Attack A**:\n\n - Pre: Province A (yes), Planet A (yes), Harmony (yes).\n\n - Post: Pain A (true), Province A (false), Planet A (false), Harmony (false).\n\n2. **Overcome A from D**:\n\n - Pre: Province D (yes, initial), Pain A (yes).\n\n - Post: Harmony (true), Province A (true), A craves D (yes).\n\n - Also, Province D (false), Pain A (false).\n\n3. **Feast C from B**:\n\n - Pre: C craves B (yes), Province C (yes), Harmony (yes).\n\n - Post: Pain C (true), Province B (true).\n\n - Also, C\u0027s craving for B removed, Province C (false), Harmony (false).\n\n4. **Succumb C**:\n\n - Pre: Pain C (yes).\n\n - Post: Province C (true), Planet C (true), Harmony (true).\n\n - Pain C (false).\n\n5. **Attack B**:\n\n - Pre: Province B (yes from Feast), Planet B (yes), Harmony (yes).\n\n - Post: Pain B (true), Province B (false), Planet B (false), Harmony (false).\n\n6. **Overcome B from C**:\n\n - Pre: Province C (yes), Pain B (yes).\n\n - Post: Harmony (true), Province B (true), B craves C (yes).\n\n - Province C (false), Pain B (false).\n\n7. **Feast A from D**:\n\n - Pre: A craves D (yes), Province A (yes), Harmony (yes).\n\n - Post: Pain A (true), Province D (true).\n\n - A\u0027s craving removed, Province A (false), Harmony (false).\n\n8. **Succumb A**:\n\n - Pre: Pain A (yes).\n\n - Post: Province A (true), Planet A (true), Harmony (true).\n\n - Pain A (false).\n\n9. **Attack D**:\n\n - Pre: Province D (yes from Feast), Planet D (yes), Harmony (yes).\n\n - Post: Pain D (true), Province D (false), Planet D (false), Harmony (false).\n\n10. **Overcome D from B**:\n\n - Pre: Province B (yes from Overcome B from C), Pain D (yes).\n\n - Post: Harmony (true), Province D (true), D craves B (yes).\n\n - Province B (false), Pain D (false).\n\n11. **Attack A**:\n\n - Pre: Province A (yes from Succumb A), Planet A (yes from Succumb A), Harmony (yes from Overcome D from B).\n\n - Post: Pain A (true), Province A (false), Planet A (false), Harmony (false).\n\n12. **Overcome A from D**:\n\n - Pre: Province D (yes from Overcome D from B), Pain A (yes).\n\n - Post: Harmony (true), Province A (true), A craves D (yes).\n\n - Province D (false), Pain A (false).\n\nAfter these steps, all goals are achieved:\n\n- A craves D (yes).\n\n- B craves C (yes).\n\n- D craves B (yes).\n\nNow, let\u0027s check if there are any other constraints or if any steps are invalid.\n\nWait, in step 10, Overcome D from B requires Province of the other (B\u0027s province must be true). But after Overcome B from C (step 6), Province B was set to true. Then, in step 10\u0027s preconditions, Province B is still true until step 10\u0027s effect sets it to false. So yes, step 10 is okay.\n\nAlso, step 12\u0027s Overcome A from D requires Province D (which was set to true in step 10\u0027s effect). So that\u0027s okay.\n\nThis seems to work, but it\u0027s a long plan. Let me see if there\u0027s a shorter path.\n\nAlternatively, maybe there\u0027s a way to avoid losing A\u0027s craving for D.\n\nLet me think again.\n\nAfter achieving A\u2192D and B\u2192C, we need to get D\u2192B.\n\nTo get D into province without losing A\u0027s craving:\n\nPerhaps instead of doing Feast A from D, we can do another Overcome.\n\nWait, to get D into province, maybe we can do Overcome on another object that can lead to D\u0027s province.\n\nAlternatively, let\u0027s see:\n\nAfter step 6 (Overcome B from C):\n\n- D\u0027s province is false (from step 2\u0027s Overcome A from D).\n\n- To get D into province, perhaps we can do Feast on D from another object where the other is in province.\n\nWait, for example, if we do Feast on C from D, but C\u0027s province is false (from step 6\u0027s effect).\n\nAlternatively, maybe we can get C back into province via Succumb.\n\nWait, C\u0027s province is false after step 3 (Feast C from B), but after step 4 (Succumb C), it\u0027s back to true.\n\nWait, after step 6 (Overcome B from C), Province C was set to false (because Overcome B from C\u0027s effect sets Province other (C) to false).\n\nSo after step 6, Province C is false.\n\nHmm.\n\nAlternatively, maybe we can do a Feast on C from D, but C doesn\u0027t crave D.\n\nHmm.\n\nAlternatively, perhaps we can do a Feast on D from C, but D doesn\u0027t crave C.\n\nHmm.\n\nAlternatively, maybe we can get D to crave something via Overcome, but that requires Pain D.\n\nTo get Pain D, need to attack D, but can\u0027t because D\u0027s province is false.\n\nHmm.\n\nAlternatively, maybe we can do a Feast on B from D, but B craves C, not D.\n\nHmm.\n\nThis seems really stuck. The previous path, though long, works. Maybe that\u0027s the way to go.\n\nAlternatively, let\u0027s see if there\u0027s another way to get D into province without using Feast A from D.\n\nSuppose after step 6 (Overcome B from C), we do the following:\n\nAction 7: Attack C.\n\nWait, can we attack C?\n\nTo attack C, need:\n\n- Province C (currently false, from Overcome B from C\u0027s effect).\n\n- Planet C (after step 4\u0027s Succumb C, Planet C is true).\n\n- Harmony (yes).\n\nSo Province C is false, so can\u0027t attack C.\n\nHmm.\n\nAlternatively, maybe we can do a Feast on B from D, but B doesn\u0027t crave D.\n\nHmm.\n\nAlternatively, maybe we can do a Feast on D from B, but D doesn\u0027t crave B.\n\nHmm.\n\nAlternatively, perhaps we can do a Feast on D from another object where the other is in province.\n\nWait, for example, if we do Feast on D from A, but A\u0027s province is true (from step 2\u0027s Overcome A from D).\n\nFeast D from A requires:\n\n- D craves A (no).\n\nSo no.\n\nHmm.\n\nAlternatively, maybe we can get D to crave A via Overcome, then Feast.\n\nBut to get D to crave A, need Overcome D from A, which requires Pain D and Province A.\n\nPain D is needed, but can\u0027t get that yet.\n\nHmm.\n\nAlternatively, let\u0027s try the initial path but see if there\u0027s a shorter way.\n\nWait, after step 6 (Overcome B from C), we have:\n\n- A craves D (good).\n\n- B craves C (good).\n\n- Need D\u2192B.\n\nTo get D into province:\n\nPerhaps we can do a Feast on C from D, but C\u0027s province is false (from step 6\u0027s effect).\n\nWait, C\u0027s province is false, so can\u0027t do Feast on C from D unless C has province.\n\nAlternatively, maybe we can get C back into province via Succumb.\n\nAction 7: Succumb C.\n\nPreconditions: Pain C (is C in Pain? Let\u0027s see.\n\nAfter step 6 (Overcome B from C), Pain B was set to false. C\u0027s Pain was last set in step 3 (Feast C from B) to true, then step 4 (Succumb C) set it to false. Then step 6\u0027s Overcome B from C doesn\u0027t affect Pain C. So Pain C is false.\n\nSo can\u0027t succumb C again.\n\nHmm.\n\nAlternatively, maybe we can attack C to get Pain C, then succumb.\n\nAction 7: Attack C.\n\nBut to attack C, need Province C (false), so can\u0027t.\n\nHmm.\n\nThis is really challenging. Maybe the initial path is the only way, even if it\u0027s long.\n\nAlternatively, let\u0027s see if we can do the Overcome D from B without needing to set D\u0027s province first.\n\nWait, Overcome D from B requires Province of the other (B\u0027s province must be true). B\u0027s province is true after step 6.\n\nAnd Pain of D must be true.\n\nTo get Pain D, we can attack D, but need Province D.\n\nAlternatively, maybe we can do Overcome D from B even if D is not in province, but the Overcome action doesn\u0027t require D\u0027s province, only the other\u0027s (B\u0027s).\n\nWait, the Overcome action\u0027s preconditions are:\n\n- Province of the other (B\u0027s province must be true).\n\n- Pain of the object (D must have Pain).\n\nSo D\u0027s province doesn\u0027t matter. So if we can get Pain D without having D in province, then we can do Overcome D from B.\n\nBut how to get Pain D without Province D?\n\nHmm, the only way to get Pain D is via Attack D, which requires Province D.\n\nSo that\u0027s a dead end.\n\nHmm.\n\nAlternatively, maybe we can get Pain D via Feast.\n\nWait, Feast on D from another object would give Pain D.\n\nWait, the Feast action\u0027s effects include Pain object (the object is D in this case).\n\nSo if we do Feast D from X, then Pain D would be true.\n\nTo do Feast D from X:\n\n- D must crave X.\n\n- Province D must be true.\n\n- Harmony must be true.\n\nSo if we can get D to crave something and get D into province, then we can do Feast D from X to get Pain D.\n\nBut this requires getting D into province first.\n\nHmm.\n\nAlternatively, maybe we can do the following:\n\nAfter step 6 (Overcome B from C):\n\n- Do Feast on D from A (but D doesn\u0027t crave A).\n\nNo.\n\nAlternatively, perhaps we can do Overcome D from A to make D crave A, then Feast.\n\nBut to do Overcome D from A:\n\n- Province of A (yes).\n\n- Pain D (need Pain D).\n\nSo again, stuck.\n\nHmm.\n\nGiven the time I\u0027ve spent and the complexity, I think the initial path I outlined, even though it\u0027s long, is the way to go. Let me write that plan step by step.\n\nThe plan would be:\n\n1. Attack Block A\n\n2. Overcome Block A from Block D\n\n3. Feast Block C from Block B\n\n4. Succumb Block C\n\n5. Attack Block B\n\n6. Overcome Block B from Block C\n\n7. Feast Block A from Block D\n\n8. Succumb Block A\n\n9. Attack Block D\n\n10. Overcome Block D from Block B\n\n11. Attack Block A\n\n12. Overcome Block A from Block D\n\nBut let me check if step 12\u0027s Overcome A from D can be done after step 10\u0027s Overcome D from B.\n\nAfter step 10:\n\n- Province D is true (from Overcome D from B\u0027s effect).\n\n- Pain A is false (since last Pain A was from step 7\u0027s Feast, then step 8\u0027s Succumb removed it, then step 11\u0027s Attack gives Pain A again, but step 12\u0027s Overcome requires Pain A.\n\nWait, step 11 is Attack A, which gives Pain A true.\n\nThen step 12 is Overcome A from D, which requires Pain A (yes), and Province D (yes).\n\nSo that works.\n\nYes, this plan should work.\n\nAlternatively, maybe there\u0027s a shorter path, but given the time constraints, I\u0027ll proceed with this plan.\n\u003c/think\u003e\n\n[PLAN]\nattack Block A\novercome Block A from Block D\nfeast Block C from Block B\nsuccumb Block C\nattack Block B\novercome Block B from Block C\nfeast Block A from Block D\nsuccumb Block A\nattack Block D\novercome Block D from Block B\nattack Block A\novercome Block A from Block D\n[PLAN END]",
"instance_id": "4_1",
"model_name": "Qwen/QwQ-32B",
"query": "I am playing with a set of objects. Here are the actions I can do\n\n Attack object\n Feast object from another object\n Succumb object\n Overcome object from another object\n\nI have the following restrictions on my actions:\n To perform Attack action, the following facts need to be true: Province object, Planet object, Harmony.\n Once Attack action is performed the following facts will be true: Pain object.\n Once Attack action is performed the following facts will be false: Province object, Planet object, Harmony.\n To perform Succumb action, the following facts need to be true: Pain object.\n Once Succumb action is performed the following facts will be true: Province object, Planet object, Harmony. \n Once Succumb action is performed the following facts will be false: Pain object.\n To perform Overcome action, the following needs to be true: Province other object, Pain object.\n Once Overcome action is performed the following will be true: Harmony, Province object, Object Craves other object.\n Once Overcome action is performed the following will be false: Province other object, Pain object.\n To perform Feast action, the following needs to be true: Object Craves other object, Province object, Harmony.\n Once Feast action is performed the following will be true: Pain object, Province other object.\n Once Feast action is performed the following will be false:, Object Craves other object, Province object, Harmony.\n\nHere is an example problem:\n\n[STATEMENT]\nAs initial conditions I have that, province Block B, province Block C, harmony, Block C craves Block A, planet Block A, planet Block B.\nMy goal is to have that Block A craves Block C and Block B craves Block A.\n\nMy plan is as follows:\n\n[PLAN]\nfeast Block C from Block A\nsuccumb Block C\nattack Block A\novercome Block A from Block C\nattack Block B\novercome Block B from Block A\n[PLAN END]\n\nHere is another example:\n\n[STATEMENT]\nAs initial conditions I have that, province Block B, harmony, Block A craves Block D, Block B craves Block C, Block C craves Block A, planet Block D.\nMy goal is to have that Block C craves Block D, Block A craves Block C and Block B craves Block A.\n\nMy plan is as follows:\n\n[PLAN]\nfeast Block B from Block C\nsuccumb Block B\nfeast Block C from Block A\nsuccumb Block C\nfeast Block A from Block D\nsuccumb Block A\nattack Block C\novercome Block C from Block D\nattack Block A\novercome Block A from Block C\nattack Block B\novercome Block B from Block A\n[PLAN END]\nHere is the problem to solve:\n\n[STATEMENT]\nAs initial conditions I have that: Block C craves Block B, harmony, planet Block A, planet Block B, planet Block D, province Block A, province Block C and province Block D.\nMy goal is for the following to be true: Block A craves Block D, Block B craves Block C and Block D craves Block B.\n\nMy plan is as follows:"
}
```
This subset can be loaded as:
```python
from datasets import load_dataset
ds = load_dataset("dmitriihook/qwq-32b-planning-mystery-1-24k-greedy", "default")
```
Or simply as it follows, since there's only one configuration and is named `default`:
```python
from datasets import load_dataset
ds = load_dataset("dmitriihook/qwq-32b-planning-mystery-1-24k-greedy")
```
</details>
|
ferrazzipietro/unLS_Llama-3.1-8B_e3c-sentences_NoQuant_32_32_0.05_64_BestF1 | ferrazzipietro | 2024-12-03T09:10:24Z | 9 | 0 | [
"size_categories:n<1K",
"format:parquet",
"modality:text",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"region:us"
] | [] | 2024-12-03T09:10:21Z | 0 | ---
dataset_info:
features:
- name: sentence
dtype: string
- name: entities
list:
- name: id
dtype: string
- name: offsets
sequence: int64
- name: role
dtype: string
- name: semantic_type_id
dtype: string
- name: text
dtype: string
- name: type
dtype: string
- name: original_text
dtype: string
- name: original_id
dtype: string
- name: tokens
sequence: string
- name: ner_tags
sequence: int64
- name: ground_truth_word_level
sequence: string
- name: input_ids
sequence: int32
- name: attention_mask
sequence: int8
- name: labels
sequence: int64
- name: predictions
sequence: string
- name: ground_truth_labels
sequence: string
splits:
- name: all_validation
num_bytes: 418249
num_examples: 106
- name: test
num_bytes: 2472788
num_examples: 666
download_size: 292607
dataset_size: 2891037
configs:
- config_name: default
data_files:
- split: all_validation
path: data/all_validation-*
- split: test
path: data/test-*
---
|
KSOPKOVIC/my_voxpopuli_custom_mako | KSOPKOVIC | 2025-04-29T22:02:35Z | 19 | 0 | [
"size_categories:1K<n<10K",
"format:parquet",
"modality:audio",
"modality:text",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"region:us"
] | [] | 2025-04-29T22:02:23Z | 0 | ---
dataset_info:
features:
- name: audio_id
dtype: string
- name: language
dtype: int64
- name: audio
dtype: audio
- name: raw_text
dtype: string
- name: normalized_text
dtype: string
- name: gender
dtype: string
- name: speaker_id
dtype: string
- name: is_gold_transcript
dtype: bool
- name: accent
dtype: string
splits:
- name: train
num_bytes: 366324952.875
num_examples: 1281
download_size: 255933087
dataset_size: 366324952.875
configs:
- config_name: default
data_files:
- split: train
path: data/train-*
---
|
Alannikos768/ComplimentCorpus | Alannikos768 | 2025-05-30T03:37:18Z | 69 | 1 | [
"task_categories:question-answering",
"language:zh",
"license:mit",
"size_categories:10K<n<100K",
"format:json",
"modality:text",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"region:us"
] | [
"question-answering"
] | 2025-05-30T02:22:32Z | 0 | ---
license: mit
task_categories:
- question-answering
language:
- zh
---
<div align="center">
<img src="Assets/svg/FunGPT-logo.svg" width="100"/>
[📘Documentation](https://github.com/Alannikos/FunGPT) |
[🤔Reporting Issues](https://huggingface.co/datasets/Alannikos768/ComplimentCorpus/discussions)
[English](README.md) | [简体中文](README_zh.md)
</div>
<div align="center">
[](https://github.com/Alannikos/FunGPT)
[](LICENSE)
[](https://huggingface.co/datasets/Alannikos/ComplimentCorpus)
</div>
______________________________________________________________________
# 📊 Dataset Card for ComplimentCorpus
## Dataset Description
- **Repository:** [FunGPT](https://github.com/Alannikos/FunGPT)
- **Author:** [Alannikos](https://github.com/Alannikos)
### Dataset Summary
ComplimentCorpus is a high-quality Chinese multi-turn dialogue dataset specifically curated for fine-tuning the BoostBot model in the FunGPT project. It contains 17,972 carefully crafted dialogue instances focused on generating creative compliments and uplifting interactions.
### Supported Tasks
The dataset supports:
- `conversational-response-generation`
- `contextual-compliment-generation`
- `emotional-intelligence-modeling`
### Languages
Chinese (zh)
## Dataset Structure
### Data Instances
```json
{
"conversation": [
{
"input": "哇，我真的没想到我能坚持下来，你看我手上的作品，怎么样？",
"output": "👏👏 你手上的作品简直就像是一幅细致入微的画作，每一针每一线都透露出你的耐心和细致。这份坚持，真是让人佩服！"
},
{
"input": "哈哈，老师都说我做得不错，你说我是不是天才啊？",
"output": "😄 天才倒不至于，但你确实拥有一颗愿意不断探索和挑战的心。..."
},
...
]
}
```
### Data Fields
- conversation: List of dialogue turns
- input: User's natural language input
- output: Assistant's generated response
## Contact Me
Thank you for using **this dataset**! Your support and feedback are invaluable in making this project better.
If you encounter any issues, have suggestions, or simply want to share your thoughts, feel free to:
- Submit an Issue: Visit the [Issues Page](https://huggingface.co/datasets/Alannikos768/ComplimentCorpus/discussions) and describe the problem or suggestion.
- Email Me: You can also reach out directly via email at [email protected]. I'll do my best to respond promptly.
Your contributions and feedback are greatly appreciated. Thank you for helping improve this tool!
|
Shivu185/json4-file | Shivu185 | 2025-02-21T07:29:29Z | 14 | 0 | [
"size_categories:n<1K",
"format:parquet",
"modality:tabular",
"modality:text",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"region:us"
] | [] | 2025-02-21T07:29:26Z | 0 | ---
dataset_info:
features:
- name: user_id
dtype: int64
- name: name
dtype: string
- name: age
dtype: int64
- name: occupation
dtype: string
- name: skills
sequence: string
splits:
- name: train
num_bytes: 263
num_examples: 3
download_size: 2612
dataset_size: 263
configs:
- config_name: default
data_files:
- split: train
path: data/train-*
---
|
MBZUAI-Paris/Egyptian-SFT-Mixture | MBZUAI-Paris | 2025-06-17T16:30:39Z | 719 | 3 | [
"language:arz",
"size_categories:1M<n<10M",
"format:parquet",
"modality:text",
"library:datasets",
"library:dask",
"library:mlcroissant",
"library:polars",
"region:us"
] | [] | 2025-05-13T11:05:36Z | 0 | ---
dataset_info:
features:
- name: messages
list:
- name: content
dtype: string
- name: role
dtype: string
- name: dataset
dtype: string
- name: id
dtype: string
- name: length_tokens
dtype: int64
splits:
- name: test
num_bytes: 37235209
num_examples: 35838
- name: train
num_bytes: 4805687132.950705
num_examples: 1817288
download_size: 1911674395
dataset_size: 4842922341.950705
configs:
- config_name: default
data_files:
- split: train
path: data/train-*
- split: test
path: data/test-*
language:
- arz
---
# 📚 Egyptian SFT Mixture
## Dataset Overview
This dataset contains the Supervised Fine-Tuning samples for Nile-Chat in both Arabic and Latin scripts. Each sample follows the following format:
```
[{"role": "user", "content": user_prompt}, {"role": "assistant", "content": assistant_answer}]
```
## Dataset Categories
This dataset can be mainly divided into two main categories, Native and Synthetic Egyptian Instruction Datasets. The Native datasets have been collected and filtered among existing public resources, whereas the Synthetic datasets are the result of prompt-guided translations of english-based content by Claude 3.7 v2.
The results have been structured according to the above format.
### Native Egyptian Instruction Datasets
1. Machine Translation - Short Sentences: We have collected translation samples between Egyptian Arabic, Modern Standard Arabic (MSA) and/or English. We have a total of 204k samples.
2. Machine Translation - Long Documents: We retain documents with a word count between 90 and 1500 words from the Egyptian Wikipedia dump. We have a total of 46k samples.
3. Transliteration: The samples have been gathered from Egyptian Forums with a word length from 50 to 70 words. These samples have been transliterated to ensure high-quality content. The number of samples is at 42k.
### Syntehtic Egyptian Instruction Datasets
1. Aya Collection - A substantial multilingual dataset comprising a total of 513 million prompt-completion pairs, covering a broad spectrum of tasks. We have filetered a collection of 223k samples to seperate it from Modern Standard Arabic (MSA).
2. Tülu-v2&3-mix - A popular Englihs-based dataset used for fine-tuning cutting-edge models that has been translated and transliterated with the best existing model.
- Arabic: 763k samples.
- Latin: 147k samples.
3. UltraChat - We extracted the multi-turn conversations having between 7 and 8 pairs. We have a total of 102k samples.
4. WildChat (Latin) - A collection of 1 million conversations between human users and chatGPT per script, language, and country. We have transliterated a total of 256k samples.
5. Benchmarks - A subsample of the training sets of the popular benchmarks (MMLU, HellaSwag, BeleBele) have been added to further tune the model:
- Arabic: 75k samples.
- Latin: 44k samples.
## Self-Identification Datasets
To train the model to self-identify in both Arabic and Latin scripts, we have prepared a total of 21 hardcoded questions repeated 50 times.
## 📌 Citation
If you use this dataset, please cite. |
jacobmorrison/math_personas_perturbed_1000 | jacobmorrison | 2025-06-20T23:05:13Z | 32 | 0 | [
"size_categories:100K<n<1M",
"format:parquet",
"modality:text",
"library:datasets",
"library:dask",
"library:mlcroissant",
"library:polars",
"region:us"
] | [] | 2025-06-19T04:37:35Z | 0 | ---
dataset_info:
features:
- name: id
dtype: string
- name: prompt
dtype: string
- name: messages
list:
- name: content
dtype: string
- name: role
dtype: string
splits:
- name: train
num_bytes: 676896047
num_examples: 149627
download_size: 367335674
dataset_size: 676896047
configs:
- config_name: default
data_files:
- split: train
path: data/train-*
---
|
LanguageBind/Open-Sora-Plan-v1.3.0 | LanguageBind | 2024-10-22T11:47:48Z | 22 | 2 | [
"license:mit",
"size_categories:10K<n<100K",
"format:json",
"modality:text",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"region:us"
] | [] | 2024-10-22T11:03:02Z | 0 | ---
license: mit
---
We have open-sourced our dataset of 32,555 pairs, which includes Chinese data. The dataset is available [here](https://huggingface.co/datasets/LanguageBind/Open-Sora-Plan-v1.3.0/tree/main/prompt_refiner). The details can be found [here](https://github.com/PKU-YuanGroup/Open-Sora-Plan/blob/main/docs/Report-v1.3.0.md#prompt-refiner).
In fact, it is a JSON file with the following structure. More details can be found [here](https://github.com/PKU-YuanGroup/Open-Sora-Plan/blob/main/docs/Report-v1.3.0.md#prompt-refiner).
```
[
{
"instruction": "Refine the sentence: \"A newly married couple sharing a piece of there wedding cake.\" to contain subject description, action, scene description. (Optional: camera language, light and shadow, atmosphere) and conceive some additional actions to make the sentence more dynamic. Make sure it is a fluent sentence, not nonsense.",
"input": "",
"output": "The newlywed couple, dressed in elegant attire..."
},
...
]
```
|
afeng/MTBench_finance_aligned_pairs_long_crossiant | afeng | 2025-05-15T14:56:22Z | 0 | 0 | [
"size_categories:n<1K",
"format:parquet",
"modality:text",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"region:us"
] | [] | 2025-05-15T14:56:12Z | 0 | ---
dataset_info:
features:
- name: input_timestamps
sequence: float64
- name: input_window
sequence: float64
- name: output_timestamps
sequence: float64
- name: output_window
sequence: float64
- name: text
dtype: string
- name: trend
dtype: string
- name: technical
dtype: string
- name: alignment
dtype: string
splits:
- name: train
num_bytes: 40760650
num_examples: 525
download_size: 22910094
dataset_size: 40760650
configs:
- config_name: default
data_files:
- split: train
path: data/train-*
---
|
ostapeno/med_instr_v2_642k | ostapeno | 2025-03-03T14:13:28Z | 35 | 0 | [
"size_categories:100K<n<1M",
"format:parquet",
"modality:text",
"library:datasets",
"library:dask",
"library:mlcroissant",
"library:polars",
"region:us"
] | [] | 2025-03-03T14:08:49Z | 0 | ---
dataset_info:
features:
- name: text
dtype: string
- name: ids
dtype: string
splits:
- name: train
num_bytes: 9786409513
num_examples: 642466
download_size: 4853362162
dataset_size: 9786409513
configs:
- config_name: default
data_files:
- split: train
path: data/train-*
---
|
mlfoundations-dev/pos_neg_ablation_instruction_filtering_seed_code_worst_mix_3_1 | mlfoundations-dev | 2025-03-12T21:56:04Z | 65 | 0 | [
"size_categories:10K<n<100K",
"format:parquet",
"modality:text",
"library:datasets",
"library:dask",
"library:mlcroissant",
"library:polars",
"region:us"
] | [] | 2025-03-12T21:55:10Z | 0 | ---
dataset_info:
features:
- name: instruction_seed
dtype: string
- name: source
dtype: string
- name: reasoning
dtype: string
- name: deepseek_solution
dtype: string
- name: __original_row_idx
dtype: int64
- name: final_reasoning_trace
dtype: string
- name: conversations
list:
- name: from
dtype: string
- name: value
dtype: string
splits:
- name: train
num_bytes: 657661515
num_examples: 10000
download_size: 273161592
dataset_size: 657661515
configs:
- config_name: default
data_files:
- split: train
path: data/train-*
---
|
OlegToshchev/mydataset9 | OlegToshchev | 2025-03-07T09:49:38Z | 8 | 0 | [
"size_categories:n<1K",
"format:parquet",
"modality:text",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"library:distilabel",
"region:us",
"synthetic",
"distilabel",
"rlaif"
] | [] | 2025-03-07T09:21:57Z | 0 | ---
size_categories: n<1K
dataset_info:
features:
- name: instruction
dtype: string
- name: generation
dtype: 'null'
- name: distilabel_metadata
struct:
- name: raw_input_text_generation_0
list:
- name: content
dtype: string
- name: role
dtype: string
- name: raw_output_text_generation_0
dtype: 'null'
- name: model_name
dtype: string
splits:
- name: train
num_bytes: 8124
num_examples: 10
download_size: 9365
dataset_size: 8124
configs:
- config_name: default
data_files:
- split: train
path: data/train-*
tags:
- synthetic
- distilabel
- rlaif
---
<p align="left">
<a href="https://github.com/argilla-io/distilabel">
<img src="https://raw.githubusercontent.com/argilla-io/distilabel/main/docs/assets/distilabel-badge-light.png" alt="Built with Distilabel" width="200" height="32"/>
</a>
</p>
# Dataset Card for mydataset9
This dataset has been created with [distilabel](https://distilabel.argilla.io/).
## Dataset Summary
This dataset contains a `pipeline.yaml` which can be used to reproduce the pipeline that generated it in distilabel using the `distilabel` CLI:
```console
distilabel pipeline run --config "https://huggingface.co/datasets/OlegToshchev/mydataset9/raw/main/pipeline.yaml"
```
or explore the configuration:
```console
distilabel pipeline info --config "https://huggingface.co/datasets/OlegToshchev/mydataset9/raw/main/pipeline.yaml"
```
## Dataset structure
The examples have the following structure per configuration:
<details><summary> Configuration: default </summary><hr>
```json
{
"distilabel_metadata": {
"raw_input_text_generation_0": [
{
"content": "Arianna has 12 chocolates more than Danny. Danny has 6 chocolates more than Robbie. Arianna has twice as many chocolates as Robbie has. How many chocolates does Danny have?",
"role": "user"
}
],
"raw_output_text_generation_0": null
},
"generation": null,
"instruction": "Arianna has 12 chocolates more than Danny. Danny has 6 chocolates more than Robbie. Arianna has twice as many chocolates as Robbie has. How many chocolates does Danny have?",
"model_name": "http://localhost:8000/"
}
```
This subset can be loaded as:
```python
from datasets import load_dataset
ds = load_dataset("OlegToshchev/mydataset9", "default")
```
Or simply as it follows, since there's only one configuration and is named `default`:
```python
from datasets import load_dataset
ds = load_dataset("OlegToshchev/mydataset9")
```
</details>
|
coolroman/15_OID_0 | coolroman | 2025-06-04T10:10:54Z | 0 | 0 | [
"license:apache-2.0",
"size_categories:n<1K",
"format:json",
"modality:text",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"region:us"
] | [] | 2025-06-04T08:50:23Z | 0 | ---
license: apache-2.0
---
|
c-bone/alldb_clean | c-bone | 2025-02-18T12:13:49Z | 57 | 0 | [
"size_categories:1M<n<10M",
"format:parquet",
"modality:text",
"library:datasets",
"library:dask",
"library:mlcroissant",
"library:polars",
"region:us"
] | [] | 2025-02-18T12:11:49Z | 0 | ---
dataset_info:
features:
- name: Database
dtype: string
- name: Material ID
dtype: string
- name: Reduced Formula
dtype: string
- name: CIF
dtype: string
splits:
- name: train
num_bytes: 4188382192.5095787
num_examples: 4067425
- name: validation
num_bytes: 465376714.49042124
num_examples: 451937
download_size: 1183112860
dataset_size: 4653758907.0
configs:
- config_name: default
data_files:
- split: train
path: data/train-*
- split: validation
path: data/validation-*
---
|
divergente/noticias-govbr-ptbr-1 | divergente | 2023-06-16T13:49:11Z | 30 | 2 | [
"task_categories:text-generation",
"task_categories:fill-mask",
"task_ids:language-modeling",
"task_ids:masked-language-modeling",
"annotations_creators:no-annotation",
"language_creators:crowdsourced",
"multilinguality:monolingual",
"language:pt",
"license:cc-by-sa-3.0",
"license:gfdl",
"size_categories:10K<n<100K",
"format:json",
"modality:text",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"region:us"
] | [
"text-generation",
"fill-mask"
] | 2023-06-16T11:58:05Z | 1 | ---
annotations_creators:
- no-annotation
language_creators:
- crowdsourced
language:
- pt
license:
- cc-by-sa-3.0
- gfdl
multilinguality:
- monolingual
pretty_name: NoticiasGovBr
task_categories:
- text-generation
- fill-mask
task_ids:
- language-modeling
- masked-language-modeling
dataset_info:
- config_name: noticias-govbr-1
features:
- name: date
dtype: string
- name: title
dtype: string
- name: text
dtype: string
--- |
dgambettavuw/D_gen9_run1_llama2-7b_wiki_doc1000_real64_synt64_vuw | dgambettavuw | 2024-12-20T08:06:57Z | 17 | 0 | [
"size_categories:1K<n<10K",
"format:parquet",
"modality:text",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"region:us"
] | [] | 2024-12-20T08:06:54Z | 0 | ---
dataset_info:
features:
- name: id
dtype: int64
- name: doc
dtype: string
splits:
- name: train
num_bytes: 561433
num_examples: 1000
download_size: 299228
dataset_size: 561433
configs:
- config_name: default
data_files:
- split: train
path: data/train-*
---
|
nhagar/CC-MAIN-2015-35_urls | nhagar | 2025-05-15T04:30:24Z | 33 | 0 | [
"size_categories:10M<n<100M",
"format:parquet",
"modality:text",
"library:datasets",
"library:dask",
"library:mlcroissant",
"library:polars",
"doi:10.57967/hf/4121",
"region:us"
] | [] | 2025-01-08T23:24:05Z | 0 | ---
dataset_info:
features:
- name: crawl
dtype: string
- name: url_host_name
dtype: string
- name: url_count
dtype: int64
splits:
- name: train
num_bytes: 1341924449
num_examples: 25478442
download_size: 444226258
dataset_size: 1341924449
configs:
- config_name: default
data_files:
- split: train
path: data/train-*
---
This dataset contains domain names and counts of (non-deduplicated) URLs for every record in the CC-MAIN-2015-35 snapshot of the Common Crawl. It was collected from the [AWS S3 version](https://aws.amazon.com/marketplace/pp/prodview-zxtb4t54iqjmy?sr=0-1&ref_=beagle&applicationId=AWSMPContessa) of Common Crawl via Amazon Athena.
This dataset is derived from Common Crawl data and is subject to Common Crawl's Terms of Use: [https://commoncrawl.org/terms-of-use](https://commoncrawl.org/terms-of-use). |
ostapeno/tinygsm-mind | ostapeno | 2025-03-07T20:45:38Z | 65 | 0 | [
"size_categories:10M<n<100M",
"format:parquet",
"modality:text",
"library:datasets",
"library:dask",
"library:mlcroissant",
"library:polars",
"region:us"
] | [] | 2025-03-07T20:38:15Z | 0 | ---
dataset_info:
features:
- name: id
dtype: string
- name: text
dtype: string
splits:
- name: train
num_bytes: 24845292062
num_examples: 17181912
download_size: 9822225540
dataset_size: 24845292062
configs:
- config_name: default
data_files:
- split: train
path: data/train-*
---
|
prithivMLmods/Deepfake-vs-Real-v2 | prithivMLmods | 2025-04-04T19:29:20Z | 63 | 0 | [
"task_categories:image-classification",
"language:en",
"license:apache-2.0",
"size_categories:10K<n<100K",
"format:imagefolder",
"modality:image",
"library:datasets",
"library:mlcroissant",
"doi:10.57967/hf/5418",
"region:us",
"Deepfake",
"Real",
"Classification",
"Net"
] | [
"image-classification"
] | 2025-04-04T05:27:15Z | 0 | ---
license: apache-2.0
task_categories:
- image-classification
language:
- en
tags:
- Deepfake
- Real
- Classification
- Net
size_categories:
- 10K<n<100K
---
## **Deepfake-vs-Real-v2**
**Deepfake-vs-Real-v2** is a dataset designed for image classification, distinguishing between deepfake and real images. This dataset includes a diverse collection of high-quality deepfake images to enhance classification accuracy and improve the model’s overall efficiency. By providing a well-balanced dataset, it aims to support the development of more robust deepfake detection models.
### **Label Mappings**
- Mapping of IDs to Labels: `{0: 'Deepfake', 1: 'Real'}`
- Mapping of Labels to IDs: `{'Deepfake': 0, 'Real': 1}`
This dataset serves as a valuable resource for training, evaluating, and benchmarking AI models in the field of deepfake detection.
### **Dataset Composition**
The **Deepfake-vs-Real-v2** dataset is composed of modular subsets derived from the following datasets:
- **Deepfakes-QA-Patch1**
- **Deepfakes-QA-Patch2**
These subsets contribute to a diverse and high-quality dataset, enhancing the classification performance of deepfake detection models. By integrating multiple sources, this dataset ensures better generalization and improved robustness in distinguishing between deepfake and real images. |
gubeleigoli/excel-codifier-data | gubeleigoli | 2025-06-02T18:29:16Z | 0 | 0 | [
"license:apache-2.0",
"format:json",
"library:datasets",
"library:pandas",
"library:mlcroissant",
"library:polars",
"region:us"
] | [] | 2025-06-02T18:25:37Z | 0 | ---
license: apache-2.0
---
|
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.