Dataset Viewer
messages
listlengths 2
2
| images
images listlengths 1
1
|
---|---|
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Please suggest possible reactants for the given product."
},
{
"role": "assistant",
"content": "[C][O][C][=Branch1][C][=O][C][Br].[O][=C][Branch2][Ring2][=C][C][C][C][C][C][Branch1][=N][C][=C][C][Branch1][C][F][=C][C][=C][Ring1][#Branch1][F][Branch2][Ring1][Ring1][S][=Branch1][C][=O][=Branch1][C][=O][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][C][C][Ring2][Ring1][Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][O]"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> What is the SMILES formula of this molecule?"
},
{
"role": "assistant",
"content": "The SMILES formula of this molecule is: CC(C)C1=CC2=CC(=CC3=C2C(=C1CO)C(=O)N3CCO)OC"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that understands molecular structures, properties, and applications. Analyze the provided to describe this molecule concisely, including its key structural features, physical/chemical traits, uses, and safety considerations. <image> Describe this molecule."
},
{
"role": "assistant",
"content": "The molecule is a natural product found in Allium ampeloprasum with data available."
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> What is the SMILES formula of this molecule?"
},
{
"role": "assistant",
"content": "The SMILES formula of this molecule is: CC=CC(=O)OCC=C(C)CCC=C(C)C"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Please suggest possible reactants for the given product."
},
{
"role": "assistant",
"content": "[C][S][=Branch1][C][=O][=Branch1][C][=O][Cl].[O][C][C][C][O][C][=C][C][=N][C][=C][C][=C][C][=C][Ring1][#Branch2][Ring1][=Branch1]"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Please suggest possible reactants for the given product."
},
{
"role": "assistant",
"content": "[C][O][C][=Branch1][C][=O][/C][=C][/C][C][=C][Branch2][Ring1][Branch1][C][=C][C][=C][Branch1][O][O][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][Ring1][=C][N][Branch1][=Branch2][C][C][C][C][C][C][Ring1][=Branch1][N][=Ring2][Ring1][=Branch2]"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that analyzes molecular structures and provides precise calculations for HOMO-LUMO gap energy. <image> I need to know the HOMO-LUMO gap energy of this molecule, could you please provide it?"
},
{
"role": "assistant",
"content": "0.3157"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[C][C][C][O][C][Ring1][Branch1].[C][N][Branch1][C][C][C][=O].[Cl][C][Cl].[O].[O][=C][Branch1][C][Cl][C][=Branch1][C][=O][Cl].[O][=C][Branch1][C][O-1][O].[Na+1]"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> What is the SMILES formula of this molecule?"
},
{
"role": "assistant",
"content": "The SMILES formula of this molecule is: CCCC[Sn]CCCC.CCCC[Sn]CCCC.C1CC(=O)N[C@@H]1C(=O)O.C1CC(=O)N[C@@H]1C(=O)O.O"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> What is the SMILES formula of this molecule?"
},
{
"role": "assistant",
"content": "The SMILES formula of this molecule is: C=CCNC(=S)C1=NC=NN1"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[C][C][C][C][N][C][=Branch1][C][=O][N][C][C][Branch2][Ring1][Ring2][O][C][=C][C][=C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][C][=C][Ring1][#Branch2][C][Ring1][#C]"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[C][C][C][O][C][Ring1][Branch1].[C][C][C][C][C][C].[O].[H-1].[Na+1]"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that understands molecular structures, properties, and applications. Analyze the provided to describe this molecule concisely, including its key structural features, physical/chemical traits, uses, and safety considerations. <image> Describe this molecule."
},
{
"role": "assistant",
"content": "The molecule is a natural product found in Homo sapiens with data available."
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> What is the SMILES formula of this molecule?"
},
{
"role": "assistant",
"content": "The SMILES formula of this molecule is: CC1C2C(CC3C4(CCN3C2=O)C5=CC=CC=C5NC4=O)C(=CO1)C(=O)OC"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> What is the SMILES formula of this molecule?"
},
{
"role": "assistant",
"content": "The SMILES formula of this molecule is: CC1=CC=C(C=C1)[SnH](C2=CC=C(C=C2)C)C3=CC=C(C=C3)C"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[O][=C][Branch1][C][O][C][C][C][N][Branch1][N][C][=C][C][=C][Branch1][C][F][C][=N][Ring1][#Branch1][C][C][Ring1][=N]"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that analyzes molecular structures and provides precise calculations for HOMO-LUMO gap energy. <image> I need to know the HOMO-LUMO gap energy of this molecule, could you please provide it?"
},
{
"role": "assistant",
"content": "0.0295"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[O][=C][Branch2][Ring1][S][C][C][=Branch1][C][=O][N][C][C][N][Branch1][P][S][=Branch1][C][=O][=Branch1][C][=O][C][=C][C][=C][C][=C][Ring1][=Branch1][Cl][C][C][Ring1][S][N][C][=C][C][=C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][Ring1][N]"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that understands molecular structures, properties, and applications. Analyze the provided to describe this molecule concisely, including its key structural features, physical/chemical traits, uses, and safety considerations. <image> Describe this molecule."
},
{
"role": "assistant",
"content": "The molecule is a natural product found in Apis cerana with data available."
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that analyzes molecular structures and provides precise calculations for HOMO-LUMO gap energy. <image> I need to know the HOMO-LUMO gap energy of this molecule, could you please provide it?"
},
{
"role": "assistant",
"content": "-0.1717"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[C][C][C][O][C][Ring1][Branch1].[C][C][O][C][=Branch1][C][=O][N][=N][C][=Branch1][C][=O][O][C][C].[C][C][O][C][Branch1][C][C][=O].[C][=C][C][=C][Branch2][Ring1][Ring2][P][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][Ring2][Ring1][Ring1]"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Please suggest possible reactants for the given product."
},
{
"role": "assistant",
"content": "[C][C@@H1][C][C][N][C][C@@H1][Ring1][=Branch1][C][=N][C][=C][C][=N][C][NH1][C][=C][C][=Ring1][Branch1][N][Ring1][N][Ring1][=Branch2].[O][=C][Branch1][C][Cl][N][C][C][C][C][C][Ring1][=Branch1]"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Please suggest possible reactants for the given product."
},
{
"role": "assistant",
"content": "[C][C][C][C][=Branch1][C][=O][Cl].[O][=C][Branch1][C][O][C][C][C][C][C][C][C][C][C][C][C][O]"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> What is the SMILES formula of this molecule?"
},
{
"role": "assistant",
"content": "The SMILES formula of this molecule is: CC(C(=O)O)OC1=CC2=C(C=C1)OC3=CC=CC=C3C2=O"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[C][C][N][Branch1][=Branch1][C][Branch1][C][C][C][C][Branch1][C][C][C].[C][C][O][P][=Branch1][C][=O][Branch1][Ring1][C][#N][O][C][C].[C][N][Branch1][C][C][C][=O].[O][=C][Branch1][C][O-1][O].[Na+1]"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that understands molecular structures, properties, and applications. Analyze the provided to describe this molecule concisely, including its key structural features, physical/chemical traits, uses, and safety considerations. <image> Describe this molecule."
},
{
"role": "assistant",
"content": "The molecule is a natural product found in Streptomyces hiroshimensis and Streptomyces roseoverticillatus with data available."
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Please suggest possible reactants for the given product."
},
{
"role": "assistant",
"content": "[C][C][Branch1][C][C][C][=N][C][=C][Branch2][Ring2][Ring1][C][Branch1][N][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1][=C][Ring1][=N][C][Branch1][#Branch2][O][C][Branch1][C][C][Branch1][C][C][C][C][=Branch1][C][=O][O][C][N][C][C][Ring2][Ring1][Branch2][Branch1][C][C][C].[O][=C][Branch1][C][Cl][C][=C][C][=C][C][=C][Ring1][=Branch1]"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Please suggest possible reactants for the given product."
},
{
"role": "assistant",
"content": "[C][O][C][=C][C][=C][Branch1][Branch2][C][=C][C][=Branch1][C][=O][Cl][C][=C][Ring1][O][O][C].[C][C][=C][C][=C][Branch1][C][N][C][Branch1][=Branch1][C][=Branch1][C][=O][O][=C][Ring1][#Branch2]"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that understands molecular structures, properties, and applications. Analyze the provided to describe this molecule concisely, including its key structural features, physical/chemical traits, uses, and safety considerations. <image> Describe this molecule."
},
{
"role": "assistant",
"content": "The molecule is a natural product found in Garcinia scortechinii and Garcinia acuminata with data available."
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[C][O].[Cl].[Na+1].[OH1-1]"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that understands molecular structures, properties, and applications. Analyze the provided to describe this molecule concisely, including its key structural features, physical/chemical traits, uses, and safety considerations. <image> Describe this molecule."
},
{
"role": "assistant",
"content": "The molecule is a natural product found in Tripterygium wilfordii with data available."
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that understands molecular structures, properties, and applications. Analyze the provided to describe this molecule concisely, including its key structural features, physical/chemical traits, uses, and safety considerations. <image> Describe this molecule."
},
{
"role": "assistant",
"content": "The molecule is a pyrrolidinedicarboxylic acid."
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[N][C][C][C][O][C][=C][C][=C][NH1][N][=C][Branch2][Ring1][=Branch1][S][=Branch1][C][=O][=Branch1][C][=O][C][=C][C][=C][C][=C][C][=C][C][=C][Ring1][#Branch2][Ring1][=Branch1][C][Ring2][Ring1][C][=C][Ring2][Ring1][=Branch1]"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Please suggest possible reactants for the given product."
},
{
"role": "assistant",
"content": "[N][#C][C][=C][Branch1][C][F][C][=C][C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][=C][Ring1][#Branch2][N][C][=C][C][=C][C][=N][Ring1][=Branch1]"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that understands molecular structures, properties, and applications. Analyze the provided to describe this molecule concisely, including its key structural features, physical/chemical traits, uses, and safety considerations. <image> Describe this molecule."
},
{
"role": "assistant",
"content": "The molecule is a carbon atom."
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][=C][C][=C][Branch1][C][O][C][=C][Ring1][#Branch1]"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[C][C][C][C][C][C].[C][C][O][C][Branch1][C][C][=O]"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[C][O].[Pd]"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> What is the SMILES formula of this molecule?"
},
{
"role": "assistant",
"content": "The SMILES formula of this molecule is: CC1=CC=C(C=C1)S(=O)(=O)NC2=CC=CC=N2"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> What is the SMILES formula of this molecule?"
},
{
"role": "assistant",
"content": "The SMILES formula of this molecule is: CNC(=O)OC1CCCC(C1)N(CC2=CC=CC=C2)CC3=CC=CC=C3"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that analyzes molecular structures and provides precise calculations for HOMO-LUMO gap energy. <image> I need to know the HOMO-LUMO gap energy of this molecule, could you please provide it?"
},
{
"role": "assistant",
"content": "-0.2164"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Please suggest possible reactants for the given product."
},
{
"role": "assistant",
"content": "[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][N][C][C][Ring1][=Branch1].[C][C][=C][C][Branch1][Ring1][C][#N][=C][C][=C][Ring1][Branch2][Br]"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[C][S][Branch1][C][C][=O].[O][=C][Branch1][C][O-1][O-1].[K+1].[K+1]"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[C][C][O][C][=C][C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][=C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][C][=C][Ring1][N][C][=Branch1][C][=O][O]"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> What is the SMILES formula of this molecule?"
},
{
"role": "assistant",
"content": "The SMILES formula of this molecule is: COC(=O)C1=CC2=C(C=CC3=CC=CC=C32)C=C1"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that understands molecular structures, properties, and applications. Analyze the provided to describe this molecule concisely, including its key structural features, physical/chemical traits, uses, and safety considerations. <image> Describe this molecule."
},
{
"role": "assistant",
"content": "The molecule is a carbohydrate acid derivative."
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Please suggest possible reactants for the given product."
},
{
"role": "assistant",
"content": "[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][C][Branch1][C][O][C][C][Ring1][#Branch1].[Cl][C][=C][N][=C][C][Branch1][C][Cl][=N][Ring1][#Branch1]"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[C][C][C][C][C][C][C][=C][C][=C][N][=C][Branch1][N][C][=C][C][=C][Branch1][C][O][C][=C][Ring1][#Branch1][S][C][Ring1][N][=C][Ring1][S]"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[C][C][Branch1][C][C][Branch1][C][C][C][C][=C][Branch2][Ring1][C][N][C][=Branch1][C][=O][N][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1][N][Branch2][Ring1][C][C][=C][C][=C][C][Branch1][Branch2][C][C][C][=Branch1][C][=O][O][=C][Ring1][O][N][=Ring2][Ring1][O]"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that analyzes molecular structures and provides precise calculations for HOMO-LUMO gap energy. <image> I need to know the HOMO-LUMO gap energy of this molecule, could you please provide it?"
},
{
"role": "assistant",
"content": "-0.031"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][N][Branch1][P][C][C][C][O][C][=C][C][=C][Branch1][Ring1][C][=O][C][=C][Ring1][Branch2][C][C][Ring2][Ring1][C]"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that analyzes molecular structures and provides precise calculations for HOMO-LUMO gap energy. <image> I need to know the HOMO-LUMO gap energy of this molecule, could you please provide it?"
},
{
"role": "assistant",
"content": "0.034"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[C][C][O][C][Branch1][C][C][=O].[C][N][Branch1][C][C][C][=O]"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Please suggest possible reactants for the given product."
},
{
"role": "assistant",
"content": "[C][C][Branch1][C][C][Branch1][C][C][Si][Branch1][C][C][Branch1][C][C][O][C][C@@H1][C][C@@H1][Branch1][C][O][C][C@@H1][Ring1][=Branch1][O][Si][Branch1][C][C][Branch1][C][C][C][Branch1][C][C][Branch1][C][C][C].[N][C][=N][C][=C][C][Branch1][C][Cl][=C][Ring1][#Branch1][N+1][=Branch1][C][=O][O-1]"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Please suggest possible reactants for the given product."
},
{
"role": "assistant",
"content": "[N][C][=C][Branch1][C][F][C][=C][C][=C][Ring1][#Branch1][O][C][C][C][Ring1][=Branch1].[O][=C][C][C][C][=Branch1][C][=O][N][Ring1][=Branch1][Cl]"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[C][C][=Branch1][C][=O][O][BH1-1][Branch1][#Branch1][O][C][Branch1][C][C][=O][O][C][Branch1][C][C][=O].[Cl][C][Cl].[Na+1]"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> What is the SMILES formula of this molecule?"
},
{
"role": "assistant",
"content": "The SMILES formula of this molecule is: CC1=CC=C(O1)SC"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that analyzes molecular structures and provides precise calculations for HOMO-LUMO gap energy. <image> I need to know the HOMO-LUMO gap energy of this molecule, could you please provide it?"
},
{
"role": "assistant",
"content": "0.0184"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that understands molecular structures, properties, and applications. Analyze the provided to describe this molecule concisely, including its key structural features, physical/chemical traits, uses, and safety considerations. <image> Describe this molecule."
},
{
"role": "assistant",
"content": "The molecule is a cyclopropanecarboxylate ester. It is an enantiomer of a (1S)-cis-(alphaR)-cyfluthrin."
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[C][C][O].[Na+1].[OH1-1]"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Please suggest possible reactants for the given product."
},
{
"role": "assistant",
"content": "[C][C][O][C][=Branch1][C][=O][C][Branch2][Ring1][Ring2][N][C][=Branch1][C][=O][C][=C][C][=C][C][=C][Ring1][=Branch1][C][C][C][C][Ring1][=Branch1][C][C][=C][N][=C][Branch1][C][C][C][=C][Ring1][#Branch1][C][Ring2][Ring1][#Branch1]"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that analyzes molecular structures and provides precise calculations for HOMO-LUMO gap energy. <image> I need to know the HOMO-LUMO gap energy of this molecule, could you please provide it?"
},
{
"role": "assistant",
"content": "0.1673"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[O][=C][Branch1][C][O][C][=C][C][=C][Branch2][Ring1][Ring1][N][C][=C][C][=N][C][=C][C][Branch1][C][Cl][=C][C][=C][Ring1][O][Ring1][#Branch1][C][=C][Ring2][Ring1][C]"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[C][S][Branch1][C][C][=O]"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> What is the SMILES formula of this molecule?"
},
{
"role": "assistant",
"content": "The SMILES formula of this molecule is: COC1=C(C(=CC=C1)OC)[N+](=O)[O-]"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Please suggest possible reactants for the given product."
},
{
"role": "assistant",
"content": "[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][O][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C].[C][C][Branch1][C][C][Branch1][C][N][C][=C][C][=C][Branch1][C][Br][C][=N][Ring1][#Branch1]"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Please suggest possible reactants for the given product."
},
{
"role": "assistant",
"content": "[C][N][Branch1][C][C][C][=Branch1][C][=O][C][Cl].[C][C@H1][Branch1][#C][N][C][=N][C][=N][C][NH1][C][=N][C][Ring1][=Branch2][=Ring1][Branch1][C][=N][C][=C][C][=C][C][=C][Ring1][=Branch1][N][Ring1][=Branch2][C@@H1][C][C][C][N][C][Ring1][=Branch1]"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that analyzes molecular structures and provides precise calculations for HOMO-LUMO gap energy. <image> I need to know the HOMO-LUMO gap energy of this molecule, could you please provide it?"
},
{
"role": "assistant",
"content": "0.298"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that understands molecular structures, properties, and applications. Analyze the provided to describe this molecule concisely, including its key structural features, physical/chemical traits, uses, and safety considerations. <image> Describe this molecule."
},
{
"role": "assistant",
"content": "The molecule is a phosphide of indium. It is a semiconductor used in high-power and high-frequency electronics because of its superior electron velocity with respect to the more common semiconductors silicon and gallium arsenide. It also has a direct bandgap, making it useful for optoelectronics devices like laser diodes. Metal phosphides are hydrolysed to phosphine upon contact with water or stomach acid. Phosphine is a colorless, flammable, explosive, and toxic gas. (L980, L986)"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that analyzes molecular structures and provides precise calculations for HOMO-LUMO gap energy. <image> I need to know the HOMO-LUMO gap energy of this molecule, could you please provide it?"
},
{
"role": "assistant",
"content": "-0.0152"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Please suggest possible reactants for the given product."
},
{
"role": "assistant",
"content": "[C][C][C][N][C][Ring1][Branch1].[F][C][=C][C][=C][C][Branch2][Ring1][C][N][C][=C][C][Branch1][C][Cl][=N][N][C][=C][N][=C][Ring1][#Branch2][Ring1][Branch1][=N][Ring1][P]"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Please suggest possible reactants for the given product."
},
{
"role": "assistant",
"content": "[C][C][C][C][O][C][=Branch1][C][=O][C][N][=C][Branch2][Ring1][C][N][C][C][C@H1][Branch1][C][N][C@H1][Branch1][Branch1][O][C][C][C][C][Ring1][O][O][C][=Ring1][S][C].[C][C][C][NH1][C][Branch1][=Branch1][C][=Branch1][C][=O][O][=N][C][=Ring1][Branch2][Cl]"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[C][O][C][=C][C][=C][Branch1][=C][O][C][=C][C][=C][Branch1][C][Br][C][=C][Ring1][#Branch1][F][N][=C][N][=C][Ring1][#C][C][=C][Ring2][Ring1][Ring1][O][C][C][C][N]"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that understands molecular structures, properties, and applications. Analyze the provided to describe this molecule concisely, including its key structural features, physical/chemical traits, uses, and safety considerations. <image> Describe this molecule."
},
{
"role": "assistant",
"content": "The molecule is a natural product found in Piper nigrum with data available."
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Please suggest possible reactants for the given product."
},
{
"role": "assistant",
"content": "[N][#C][C][=C][C][=N][C][Branch2][Ring1][Ring1][C][=C][C][=C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][C][=C][Ring1][#Branch2][=C][Ring1][S]"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[C][C][O].[O].[Na+1].[OH1-1]"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> What is the SMILES formula of this molecule?"
},
{
"role": "assistant",
"content": "The SMILES formula of this molecule is: CCCCCCCCCCCCCCCCCC(=O)NCCNCCNCCNCCN.CC(=O)O"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Please suggest possible reactants for the given product."
},
{
"role": "assistant",
"content": "[C][C][C][C][C][O][C][=N][C][Branch1][C][N][=C][N][=C][N][Branch1][=Branch2][C][C][=C][C][C][C][Ring1][=Branch1][C][Ring1][O][=N][Ring1][S]"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that understands molecular structures, properties, and applications. Analyze the provided to describe this molecule concisely, including its key structural features, physical/chemical traits, uses, and safety considerations. <image> Describe this molecule."
},
{
"role": "assistant",
"content": "The molecule is a natural product found in Laurencia with data available."
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that understands molecular structures, properties, and applications. Analyze the provided to describe this molecule concisely, including its key structural features, physical/chemical traits, uses, and safety considerations. <image> Describe this molecule."
},
{
"role": "assistant",
"content": "The molecule is a natural product found in Withania somnifera with data available."
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Please suggest possible reactants for the given product."
},
{
"role": "assistant",
"content": "[C][O][C][=Branch1][C][=O][C][N][C][=Branch1][C][=O][C][=C][C][=C][C][=Branch1][Ring2][=C][Ring1][=Branch1][C][=C][Branch2][Ring2][Branch2][C][Branch2][Ring1][#Branch1][C][=Branch1][C][=O][C][Branch1][Ring1][C][#N][C][=Branch1][C][=O][N][C][=C][C][=C][C][=C][Ring1][=Branch1][=N][N][Ring2][Ring1][Ring1][C][=C][C][=C][C][=C][Ring1][=Branch1][C][Ring2][Ring1][=N]"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Please suggest possible reactants for the given product."
},
{
"role": "assistant",
"content": "[C][O][C][=C][C][=C][C][=N][C][=C][Branch1][C][C][C][=C][Ring1][O][Ring1][#Branch1]"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[I][C][C][C][C][C][Branch1][#Branch2][O][C][C][C][C][C][O][Ring1][=Branch1][C][Ring1][N]"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that analyzes molecular structures and provides precise calculations for HOMO-LUMO gap energy. <image> I need to know the HOMO-LUMO gap energy of this molecule, could you please provide it?"
},
{
"role": "assistant",
"content": "-0.2434"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that analyzes molecular structures and provides precise calculations for HOMO-LUMO gap energy. <image> I need to know the HOMO-LUMO gap energy of this molecule, could you please provide it?"
},
{
"role": "assistant",
"content": "-0.0107"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> What is the SMILES formula of this molecule?"
},
{
"role": "assistant",
"content": "The SMILES formula of this molecule is: CC(=O)C1=C2N(CCN2C(=O)C=C1C(=O)OC)C"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[C][O].[Na+1].[OH1-1]"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> What is the SMILES formula of this molecule?"
},
{
"role": "assistant",
"content": "The SMILES formula of this molecule is: CC(C)NCC(COC1=CC=CC2=NC(=O)N=C21)O"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that understands molecular structures, properties, and applications. Analyze the provided to describe this molecule concisely, including its key structural features, physical/chemical traits, uses, and safety considerations. <image> Describe this molecule."
},
{
"role": "assistant",
"content": "The molecule is a terpene lactone."
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that analyzes molecular structures and provides precise calculations for HOMO-LUMO gap energy. <image> I need to know the HOMO-LUMO gap energy of this molecule, could you please provide it?"
},
{
"role": "assistant",
"content": "-0.2804"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[C][C][C][N][Branch1][Ring2][C][C][C][C][C][O][C][C][N]"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that analyzes molecular structures and provides precise calculations for HOMO-LUMO gap energy. <image> I need to know the HOMO-LUMO gap energy of this molecule, could you please provide it?"
},
{
"role": "assistant",
"content": "-0.2258"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[C][C][Branch1][C][C][O][C][=Branch1][C][=O][C][O][C][C][N][=C][C][=C][C][=C][N][Ring1][=Branch1][C][=Ring1][=Branch2][C][#C][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1]"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that analyzes molecular structures and provides precise calculations for HOMO-LUMO gap energy. <image> I need to know the HOMO-LUMO gap energy of this molecule, could you please provide it?"
},
{
"role": "assistant",
"content": "-0.2545"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> What is the SMILES formula of this molecule?"
},
{
"role": "assistant",
"content": "The SMILES formula of this molecule is: C1=CC=C(C=C1)C2(C3=CC=CC=C3C(=O)N2C4=CC=NC=C4)O"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that analyzes molecular structures and provides precise calculations for HOMO-LUMO gap energy. <image> I need to know the HOMO-LUMO gap energy of this molecule, could you please provide it?"
},
{
"role": "assistant",
"content": "-0.2342"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Please suggest possible reactants for the given product."
},
{
"role": "assistant",
"content": "[Br][C][C][C][C][Ring1][Ring1].[O][C][=C][C][=C][Branch1][C][Br][C][=C][Ring1][#Branch1][I]"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that understands molecular structures, properties, and applications. Analyze the provided to describe this molecule concisely, including its key structural features, physical/chemical traits, uses, and safety considerations. <image> Describe this molecule."
},
{
"role": "assistant",
"content": "The molecule is a guanidine derivative consisting of butane having guanidino groups at the 1- and 4-positions. It is a conjugate base of a 1,4-diguanidiniumylbutane. It derives from a hydride of a butane."
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that understands synthesis pathways. Analyze the input to suggest reactants for this product, including reaction types, reagents, conditions, and feasibility. <image> Please suggest possible reactants for the given product."
},
{
"role": "assistant",
"content": "[Cl][C][=N][C][=C][C][=C][C][=C][Ring1][=Branch1][N][=C][Ring1][#Branch2][N][C][C][N][C][C][Ring1][=Branch1].[O][C][C][C][C][C][=C][C][=C][C][=C][Ring1][=Branch1][O][Ring1][#Branch2]"
}
] | |
[
{
"role": "user",
"content": "You are a chemical assistant that outputs SMILES notation for molecular graphs. When shown a molecular graph image, respond ONLY with the correct SMILES formula string - no explanations or additional text. <image> Given the reactants and reagents provided, what is a possible product that can be formed?"
},
{
"role": "assistant",
"content": "[C][O][C][=Branch1][C][=O][C@H1][Branch1][Branch1][C][C][S][C][N][C][=Branch1][C][=O][C][=C][C][Branch2][Ring1][#Branch1][O][C][Branch1][N][C][N][C][=N][C][Branch1][C][C][=C][Ring1][=Branch1][C][=N][C][=C][S][Ring1][Branch1][=C][C][=C][Ring2][Ring1][Ring2][C][C][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1]"
}
] |
End of preview. Expand
in Data Studio
README.md exists but content is empty.
- Downloads last month
- 141