messages
listlengths 3
3
|
---|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Build a molecule that meets the requirement: The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, cholesterol translocation that impacts barth syndrome and tangier disease. The molecule is a stabilizing cytochrome oxidase and a apoptosis that impacts aging, diabetic heart disease, and non-alcoholic fatty liver disease.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCC(C)C",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Can you create a molecule that matches the given characteristics? The molecule is a apoptosis and a cholesterol translocation that impacts diabetic heart disease, barth syndrome, and aging. The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation that impacts tangier disease and non-alcoholic fatty liver disease.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCCC",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Come up with a molecule based on the description: The molecule is a stabilizing mitochondrial structure and a apoptosis that impacts diabetic heart disease, tangier disease, and barth syndrome. The molecule is a cholesterol translocation, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts aging and non-alcoholic fatty liver disease.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCC(C)C",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Can you create a molecule that matches the given characteristics? The molecule is a plasma kallikrein inhibitor.",
"role": "user"
},
{
"content": "CC(CNC(=O)c1cn(Cc2ccc(Cn3ccccc3=O)cc2)nc1N)Oc1cccc(Cl)c1",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I need a molecule that meets the following conditions: The molecule is a stabilizing mitochondrial structure that impacts aging, diabetic heart disease, tangier disease, and non-alcoholic fatty liver disease. The molecule is a cholesterol translocation, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, apoptosis that impacts barth syndrome. Please represent the molecule in SMILES.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCC",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a energy storage, nutrient, membrane stabilizer that impacts cardiovascular disease, metabolic syndrome, and pancreatitis. The molecule is a member of the thyroxine treatment class and affects both atherosclerosis and cancer. The molecule is a fat storage, a energy source, and a inflammatory, and it impacts obesity.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCC(C)C",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule based on this description: It belongs to the tgr5 agonist class of molecules.",
"role": "user"
},
{
"content": "N#Cc1ccc(CCNC(=O)C2CCN2c2cc(N3CCC(CCCC(=O)NC(CCCN=C(N)N)C(=O)O)CC3)nc(C(F)(F)F)n2)cc1",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Give me a molecule that satisfies the conditions outlined in the description: The molecule is a nutrient and thyroxine treatment, and it impacts cardiovascular disease. The molecule is a fat storage that impacts atherosclerosis, pancreatitis, and metabolic syndrome.",
"role": "user"
},
{
"content": "CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COC(=O)CCCCCCC=CCC=CCC=CCCCCC)OC(=O)CCCCC=CCC=CCC=CCCCCC",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule based on this description: The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, apoptosis that impacts barth syndrome and aging. The molecule is a cholesterol translocation and a stabilizing mitochondrial structure that impacts diabetic heart disease, non-alcoholic fatty liver disease, and tangier disease.",
"role": "user"
},
{
"content": "CCC(C)CCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC(C)CC",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "The molecule is a pain treatment that impacts inflammatory disease treatment. Use the above information to create a molecule.",
"role": "user"
},
{
"content": "Cc1c(Cl)cccc1-n1ccn2c(SCC(=O)c3ccccc3C(F)(F)F)nnc2c1=O",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Conceptualize a molecule that meets the specified attribute(s): The molecule is a energy storage, inflammatory, membrane stabilizer that impacts cancer, atherosclerosis, and obesity. The molecule is a fat storage and a energy source, belonging to the thyroxine treatment class of molecules. The molecule is a nutrient that impacts pancreatitis, cardiovascular disease, and metabolic syndrome.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC(C)C",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "The molecule is a cholesterol translocation, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure that impacts barth syndrome and tangier disease. The molecule is a stabilizing cytochrome oxidase and a apoptosis that impacts diabetic heart disease, aging, and non-alcoholic fatty liver disease. Use the above information to create a molecule.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCC",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a energy storage, energy source, membrane stabilizer, nutrient that impacts cancer and obesity. The molecule is a inflammatory that impacts both cardiovascular disease and pancreatitis. The molecule is a fat storage that impacts metabolic syndrome, atherosclerosis, and thyroxine treatment.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COC(=O)CCCCCCCCCCCCCCCCCC(C)C",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Build a molecule that meets the requirement: The molecule is a liquid crystal display and belongs to the liquid crystal class of molecules.",
"role": "user"
},
{
"content": "CC1CCC(C(C)C)C(Oc2ccc(CC(=O)O)cc2)C1",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule that fulfills the requirement: The molecule is a cholesterol translocation and a stabilizing cytochrome oxidase that impacts tangier disease, diabetic heart disease, and aging. The molecule is a proton trap for oxidative phosphorylation, stabilizing mitochondrial structure, apoptosis that impacts non-alcoholic fatty liver disease and barth syndrome.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Build a molecule that meets the requirement: The molecule is a 11βhsd1 inhibitor that impacts diabetes treatment.",
"role": "user"
},
{
"content": "CC(C)n1c(-c2ccc3c(c2)CNC3=O)nnc1C(C)(C)Oc1c(F)cc(Cl)cc1F",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "The molecule is a energy source, stabilizing cytochrome oxidase, stabilizing mitochondrial structure, cholesterol translocation. The molecule is a emulsifier, energy storage, nutritional supplement that impacts diabetic heart disease and tangier disease. The molecule is a membrane stabilizer and a food additive, impacting both barth syndrome and non-alcoholic fatty liver disease. The molecule is a surfactant, a apoptosis, and a proton trap for oxidative phosphorylation, it impacts aging and is smooth. Use the above information to create a molecule.",
"role": "user"
},
{
"content": "CCCCCC=CCC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCCCCCC",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Conceptualize a molecule that meets the specified attribute(s): The molecule is a proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase, apoptosis that impacts tangier disease and aging. The molecule is a cholesterol translocation and a stabilizing mitochondrial structure that impacts barth syndrome, diabetic heart disease, and non-alcoholic fatty liver disease.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule that fulfills the requirement: The molecule is a stabilizing mitochondrial structure and a proton trap for oxidative phosphorylation that impacts aging, diabetic heart disease, and barth syndrome. The molecule is a stabilizing cytochrome oxidase, apoptosis, cholesterol translocation that impacts tangier disease and non-alcoholic fatty liver disease.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Build a molecule that meets the requirement: The molecule is a nutrient.",
"role": "user"
},
{
"content": "COc1cc(CC(O)COC2OC(CO)C(O)C(O)C2O)cc(O)c1OC",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Suppose there is a molecule that meets the following description: The molecule is a stabilizing cytochrome oxidase and a stabilizing mitochondrial structure that impacts diabetic heart disease, aging, and barth syndrome. The molecule is a cholesterol translocation, apoptosis, proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease and tangier disease. Please write the SMILES representation of it.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCC(C)C",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Come up with a molecule based on the description: The molecule is a anti bacterial.",
"role": "user"
},
{
"content": "CC(C)(C)OC(=O)NC12CCC(CCN3C(=O)COc4ccc(Br)cc43)(CC1)OC2",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Give me a molecule that satisfies the conditions outlined in the description: The molecule is a apoptosis and a proton trap for oxidative phosphorylation that impacts aging, tangier disease, and barth syndrome. The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, cholesterol translocation that impacts diabetic heart disease and non-alcoholic fatty liver disease.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Build a molecule that meets the requirement: The molecule is a surfactant, emulsifier, energy source, nutritional supplement. The molecule is a proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase, food additive that impacts tangier disease and barth syndrome. The molecule is a apoptosis and a stabilizing mitochondrial structure, it impacts aging, and is smooth. The molecule is a cholesterol translocation, energy storage, membrane stabilizer that impacts non-alcoholic fatty liver disease and diabetic heart disease.",
"role": "user"
},
{
"content": "CCC(C)CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCC(C)C",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Give me a molecule that satisfies the conditions outlined in the description: The molecule is a protein kinase inhibitor and pdk1 inhibitor, and it impacts cancer treatment.",
"role": "user"
},
{
"content": "Cc1[nH]c(C=C2C(=O)Nc3cc(C=CCNc4ncccc4C(=O)NCc4ccc(F)c(F)c4)ccc32)c(C)c1C(=O)O",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Can you create a molecule that matches the given characteristics? When heated to decomposition it emits acrid smoke and irritating fumes. The molecule has both a Bitter and unpleasant taste and a Pleasant odor.",
"role": "user"
},
{
"content": "COc1ccc(C(C)=O)cc1",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Give me a molecule that satisfies the conditions outlined in the description: The molecule is a nutrient that impacts parkinson's disease, alzheimer's disease, non-alcoholic fatty liver disease, and diabetes mellitus type 2.",
"role": "user"
},
{
"content": "CCCc1oc(CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCCN)OC(=O)CCCC=CCC=CCC=CCC=CCCCC(C)O)c(C)c1C",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule based on this description: The molecule is a anti viral member of the anti viral compound class.",
"role": "user"
},
{
"content": "O=C(NC1CCCC(Nc2nc(-c3[nH]nc4ncc(Cl)cc34)ncc2F)C1)N1CCCC1CO",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Suppose there is a molecule that meets the following description: The molecule is a kinase inhibitor. Please write the SMILES representation of it.",
"role": "user"
},
{
"content": "CC(C)Cc1ncc(-c2cc(-c3ccccc3CNC(=O)OC(C)(C)C)nc(NCCN(C)C)n2)s1",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Build a molecule that meets the requirement: The molecule is a apoptosis, stabilizing cytochrome oxidase, cholesterol translocation that impacts diabetic heart disease and tangier disease. The molecule is a stabilizing mitochondrial structure and a proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease, barth syndrome, and aging.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCCCCCCCC(C)C",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Give me a molecule that satisfies the conditions outlined in the description: The molecule is a surfactant, energy storage, energy source, emulsifier, membrane stabilizer, nutrient.",
"role": "user"
},
{
"content": "CSC=CC(=O)OC1CC(C)C2(C)CC(=C(C)C)C(=O)CC2C1",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Could you please return a molecule that adheres to this description? The molecule is a orexin receptor antagonist.",
"role": "user"
},
{
"content": "Cc1nc2sccn2c1C(=O)NCC1CCCCN1C(=O)c1nc(C2CC2)sc1-c1cccc(C(F)(F)F)c1",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Based on the given information, generate a molecule that meets the desired specifications: The molecule is a nutrient.",
"role": "user"
},
{
"content": "CC1(C)CCC2(C(=O)OC3OCC(O)C(OC4OC(CO)C(O)C(O)C4O)C3O)CCC3(C)C(=CCC4C5(C)CCC(OC6OC(CO)C(O)C(O)C6O)C(C)(COC6OC(CO)C(O)C(O)C6O)C5CCC43C)C2C1",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Based on the given information, generate a molecule that meets the desired specifications: The molecule is a energy storage, nutrient, emulsifier, surfactant, energy source, membrane stabilizer.",
"role": "user"
},
{
"content": "CC=C(C)C(=O)OC1CC(C)(C)CC2C3=CCC4C5(C)CCC(OC6OC(C(=O)O)C(O)C(OC7OCC(O)C(O)C7OC7OC(CO)C(O)C(O)C7O)C6OC6OC(CO)C(O)C(O)C6O)C(C)(CO)C5CCC4(C)C3(C)CC(O)C12CO",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Give me a molecule that satisfies the conditions outlined in the description: The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease and tangier disease. The molecule is a apoptosis and a cholesterol translocation that impacts diabetic heart disease, aging, and barth syndrome.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a stabilizing mitochondrial structure, cholesterol translocation, apoptosis that impacts aging and non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation and a stabilizing cytochrome oxidase that impacts diabetic heart disease, tangier disease, and barth syndrome.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Conceptualize a molecule that meets the specified attribute(s): The molecule is a apoptosis and a stabilizing mitochondrial structure that impacts tangier disease, aging, and non-alcoholic fatty liver disease. The molecule is a cholesterol translocation, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts diabetic heart disease and barth syndrome.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCC(C)C",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Build a molecule that meets the requirement: The molecule is a proton trap for oxidative phosphorylation, a membrane stabilizer, and a surfactant, and it impacts non-alcoholic fatty liver disease. The molecule is a cholesterol translocation and a apoptosis, which impacts both diabetic heart disease and barth syndrome, and is characterized as smooth. The molecule is a food additive, a energy storage, and a emulsifier, and it impacts tangier disease. The molecule is a energy source, nutritional supplement, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts aging.",
"role": "user"
},
{
"content": "CC(C)CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC(C)C",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Can you create a molecule that matches the given characteristics? The molecule is a apoptosis and a cholesterol translocation that impacts barth syndrome, diabetic heart disease, and aging. The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease and tangier disease.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC(C)C",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Build a molecule that meets the requirement: It belongs to the diabetes treatment class of molecules.",
"role": "user"
},
{
"content": "O=P(O)(O)CN(c1ccc2c(ccn2-c2ccc(N3CCCNCC3)nn2)c1)S(=O)(=O)C1C=C(Cl)C=C(Cl)C1",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Based on the given information, generate a molecule that meets the desired specifications: The molecule is a flavoring agent, savory, meaty, and sulfur.",
"role": "user"
},
{
"content": "COc1cc(C(=O)CO)cc(OC)c1O",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule based on this description: The molecule is a faah inhibitor.",
"role": "user"
},
{
"content": "CC1(C)COCN1C(=O)n1nnc2ncccc21",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule based on this description: The molecule is a stabilizing cytochrome oxidase and a apoptosis that impacts barth syndrome, tangier disease, and non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation, cholesterol translocation, stabilizing mitochondrial structure that impacts diabetic heart disease and aging.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCCCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a nutrient that impacts both pancreatitis and atherosclerosis. The molecule is a fat storage that impacts cardiovascular disease, thyroxine treatment, and metabolic syndrome.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCC=CCC=CCC=CCC=CCCCCC)COC(=O)CCCCCCCCCCCCCC=CCCCCCCCC",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule based on this description: The molecule is anti cancer.",
"role": "user"
},
{
"content": "CC(C)=CCCC(C)=CCn1cc(CN2CCCC2)c2cc(F)ccc21",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule that fulfills the requirement: The molecule is a apoptosis, cholesterol translocation, proton trap for oxidative phosphorylation that impacts barth syndrome and diabetic heart disease. The molecule is a stabilizing cytochrome oxidase and a stabilizing mitochondrial structure that impacts tangier disease, non-alcoholic fatty liver disease, and aging.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Conceptualize a molecule that meets the specified attribute(s): The molecule is cancer treatment.",
"role": "user"
},
{
"content": "CC(=CC=CN)Cc1ccccn1",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Based on the given information, generate a molecule that meets the desired specifications: The molecule is both a hcv inhibitor and a anti viral.",
"role": "user"
},
{
"content": "COc1ccc2c(c1)c(C#N)c(-c1ccc(NS(=O)(=O)C3CC3)cc1)n2C1CCC1",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Suppose there is a molecule that meets the following description: Hazardous decomposition products formed under fire conditions: carbon oxides, silicon oxides. Please write the SMILES representation of it.",
"role": "user"
},
{
"content": "C[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Build a molecule that meets the requirement: The molecule is anti fungal and it impacts hypercholesterolemia treatment.",
"role": "user"
},
{
"content": "CC(C)(C)CN1C(=O)C(CCC#N)OC(c2ccccc2Cl)c2cc(Cl)ccc21",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Conceptualize a molecule that meets the specified attribute(s): The molecule is a cholesterol translocation and a stabilizing mitochondrial structure that impacts diabetic heart disease, non-alcoholic fatty liver disease, and aging. The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, apoptosis that impacts barth syndrome and tangier disease.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Could you please return a molecule that adheres to this description? The molecule is a anti allergic and is anti allergic agent.",
"role": "user"
},
{
"content": "COc1c(OC(=O)c2ccccc2)c2cccc(OC(C)(C)C)c2oc1=O",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Give me a molecule that satisfies the conditions outlined in the description: It impacts thyroxine treatment, metabolic syndrome, and pancreatitis. The molecule is a fat storage and a nutrient, impacting both cardiovascular disease and atherosclerosis.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCC=CCC=CCCCCC)COC(=O)CCCCCCCCCCCC=CCCCCCCCC",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Give me a molecule that satisfies the conditions outlined in the description: The molecule is anti bacterial.",
"role": "user"
},
{
"content": "CC(=O)Nc1ccc([N+](=O)[O-])c(-c2ccncc2)n1",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Give me a molecule that satisfies the conditions outlined in the description: The molecule is a apoptosis, proton trap for oxidative phosphorylation, cholesterol translocation that impacts barth syndrome and aging. The molecule is a stabilizing mitochondrial structure and a stabilizing cytochrome oxidase that impacts diabetic heart disease, non-alcoholic fatty liver disease, and tangier disease.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Give me a molecule that satisfies the conditions outlined in the description: It impacts atherosclerosis, metabolic syndrome, and pancreatitis. The molecule is a nutrient and a fat storage, it impacts cardiovascular disease, and is thyroxine treatment.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCCCC=CCCCCCCCC",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule based on this description: The molecule is a fat storage, energy source, and membrane stabilizer that has an effect on cancer and impacts both pancreatitis and atherosclerosis. The molecule is a inflammatory and energy storage, and it impacts cardiovascular disease. The molecule is a nutrient and belongs to the thyroxine treatment class of molecules, impacting both obesity and metabolic syndrome.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)C",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Can you create a molecule that matches the given characteristics? The molecule is a stabilizing mitochondrial structure and a cholesterol translocation that impacts barth syndrome, tangier disease, and diabetic heart disease. The molecule is a apoptosis, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts aging and non-alcoholic fatty liver disease.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a nutrient that affects breast cancer by impacting cervical cancer, atherosclerosis, and ulcerative colitis.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCCC(O)CC)COP(=O)([O-])OCC[N+](C)(C)C",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule based on this description: The molecule is a apoptosis and a membrane stabilizer, impacting both diabetic heart disease and tangier disease. The molecule is a emulsifier, a food additive, and a stabilizing mitochondrial structure, it impacts barth syndrome and is smooth. The molecule is a nutritional supplement, a cholesterol translocation, and a proton trap for oxidative phosphorylation, and it impacts non-alcoholic fatty liver disease. The molecule is a energy source, energy storage, stabilizing cytochrome oxidase, surfactant that impacts aging.",
"role": "user"
},
{
"content": "CCC(C)CCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC(C)C",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Come up with a molecule based on the description: The molecule is a hmgcoa reductase inhibitor.",
"role": "user"
},
{
"content": "CC(C)Cc1nc(N(C)S(C)(=O)=O)nc(-c2ccc(F)cc2)c1CO",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Could you please return a molecule that adheres to this description? The molecule is a stabilizing mitochondrial structure, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation that impacts tangier disease and non-alcoholic fatty liver disease. The molecule is a cholesterol translocation and a apoptosis that impacts aging, barth syndrome, and diabetic heart disease.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCC",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule based on this description: The molecule is light-emitting.",
"role": "user"
},
{
"content": "Cc1ccccc1N(c1cccc(-c2cccc3c2oc2ccccc23)c1)c1ccc2ccc3c(N(c4cccc(-c5cccc6c5oc5ccccc56)c4)c4ccccc4C)ccc4ccc1c2c43",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: It impacts diabetes mellitus type 1, cardiovascular disease, and diabetes mellitus type 2. The molecule is a nutrient that impacts insulin resistance, atherosclerosis, and pick's disease.",
"role": "user"
},
{
"content": "CCC=CCC=CCC(O)C=CC=CCC=CCCCC(=O)NC(COP(=O)([O-])OCC[N+](C)(C)C)C(O)CCCCCCCCCCCCCCC",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Build a molecule that meets the requirement: The molecule is a phosphorescent emitter and is both phosphorescent and belongs to the electroluminescent and organic electroluminescent material classes of molecules.",
"role": "user"
},
{
"content": "O=P1(c2ccccc2)c2ccccc2-c2ccc3c4ccccc4n(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3c2N1c1ccccc1",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Could you please return a molecule that adheres to this description? The molecule is thyroxine treatment and it impacts both atherosclerosis and metabolic syndrome. The molecule is a fat storage and a nutrient, impacting both cardiovascular disease and pancreatitis.",
"role": "user"
},
{
"content": "CCCCCCC=CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COC(=O)CCCCCCCCCCCCCCCCCCCCCCC",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "The molecule is anti oxidant. Use the above information to create a molecule.",
"role": "user"
},
{
"content": "C=C(C(=CC1C(O)=CC(O)=CC1C)CC1CC(O)C(O)C(O)C1O)c1ccc(O)c(O)c1",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule that fulfills the requirement: The molecule is a ccr2 antagonist.",
"role": "user"
},
{
"content": "Cc1c(Nc2ccc(Cl)c(Cl)c2)nc(C2CC2)nc1C(=O)N1CCC(NC2CCOCC2F)CC1",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Based on the given information, generate a molecule that meets the desired specifications: The molecule is a stabilizing cytochrome oxidase and a stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease, tangier disease, and diabetic heart disease. The molecule is a proton trap for oxidative phosphorylation, cholesterol translocation, apoptosis that impacts aging and barth syndrome.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule that fulfills the requirement: The molecule is a energy source that impacts inflammatory bowel disease, cardiovascular disease, and renal cell carcinoma. It impacts celiac disease, breast cancer, diabetes mellitus type 2, and heart failure.",
"role": "user"
},
{
"content": "CCCCCC=CCCCCCC(=O)OC(CC(=O)[O-])C[N+](C)(C)C",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a stabilizing mitochondrial structure and a stabilizing cytochrome oxidase that impacts barth syndrome, non-alcoholic fatty liver disease, and aging. The molecule is a proton trap for oxidative phosphorylation, cholesterol translocation, apoptosis that impacts diabetic heart disease and tangier disease.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCC",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I need a molecule that meets the following conditions: The molecule is a apoptosis, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease and diabetic heart disease. The molecule is a stabilizing cytochrome oxidase and a cholesterol translocation that impacts barth syndrome, tangier disease, and aging. Please represent the molecule in SMILES.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Build a molecule that meets the requirement: The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, cholesterol translocation, apoptosis that impacts aging. The molecule is a stabilizing cytochrome oxidase that impacts tangier disease, diabetic heart disease, non-alcoholic fatty liver disease, and barth syndrome.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Can you create a molecule that matches the given characteristics? The molecule is a stabilizing mitochondrial structure, apoptosis, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts tangier disease. The molecule is a cholesterol translocation that impacts barth syndrome, diabetic heart disease, aging, and non-alcoholic fatty liver disease.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCCCC(C)C",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Can you create a molecule that matches the given characteristics? The molecule is anti bacterial.",
"role": "user"
},
{
"content": "CCSc1c(C)[nH]c2c(Br)cc(F)c(F)c12",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule based on this description: The molecule is a nutrient that affects breast cancer by impacting atherosclerosis, cervical cancer, and ulcerative colitis.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCC=CCC=CCC=CC=CC(O)CCCCC",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I need a molecule that meets the following conditions: The molecule is a apoptosis and a cholesterol translocation that impacts diabetic heart disease, non-alcoholic fatty liver disease, and aging. The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure that impacts tangier disease and barth syndrome. Please represent the molecule in SMILES.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCC",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Give me a molecule that satisfies the conditions outlined in the description: The molecule is a energy source, nutrient, energy storage, membrane stabilizer.",
"role": "user"
},
{
"content": "CCC(CCCC(=O)O)C(=O)O",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Come up with a molecule based on the description: The molecule is a member of the thyroxine treatment class and affects both metabolic syndrome and cardiovascular disease. The molecule is a fat storage and a nutrient, impacting both pancreatitis and atherosclerosis.",
"role": "user"
},
{
"content": "CCCCC=CCCCCCCCC(=O)OCC(COCCCCCCCCCCCCCCCCCC)OC(=O)CCCC=CCC=CCC=CCCCCCCCC",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule based on this description: The molecule is a thrombin inhibitor and belongs to the thrombosis treatment class of molecules.",
"role": "user"
},
{
"content": "COC(=O)Cc1cn(-c2cc(C)ccn2)cn1",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Give me a molecule that satisfies the conditions outlined in the description: The molecule is a apoptosis that impacts tangier disease, barth syndrome, non-alcoholic fatty liver disease, and aging. The molecule is a cholesterol translocation, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts diabetic heart disease.",
"role": "user"
},
{
"content": "CCCCCC=CCC=CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCC=CCCCCCC",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I need a molecule that meets the following conditions: The molecule is a anti viral. Please represent the molecule in SMILES.",
"role": "user"
},
{
"content": "CCC(C)(C)C1CC(F)(F)CC1C(N)=O",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Suppose there is a molecule that meets the following description: The molecule is a nutrient. Please write the SMILES representation of it.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(N)C(=O)O)OC(=O)CCCCCCCC=CC=CC(=O)CCCCC",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule that fulfills the requirement: It impacts cardiovascular disease, stomach cancer, parkinson's disease, and colorectal cancer. It has an effect on breast cancer, and impacts alzheimer's disease, diabetes mellitus, and seizure.",
"role": "user"
},
{
"content": "CCCCCCCCC=CCCCCCCCC(=O)OC1COC(=O)CCCC=CCC2C=CC(=O)C(C=CC(O)CCCCC)C(O)C(O)C(OP(=O)(O)OC1)C(O)C(O)C2O",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Based on the given information, generate a molecule that meets the desired specifications: The molecule is a anti viral.",
"role": "user"
},
{
"content": "COC(=O)CC1c2cccc(F)c2N=C(N2CCN(c3cccc(C)c3)CC2)N1c1cc(C(F)(F)F)ccc1SC",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is thyroxine treatment and it impacts both metabolic syndrome and pancreatitis. The molecule is a fat storage and a nutrient, impacting both cardiovascular disease and atherosclerosis.",
"role": "user"
},
{
"content": "CCCCCCCCC=CCCCCCCCCCC(=O)OCC(COCCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCC",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Can you create a molecule that matches the given characteristics? It has an effect on stomach cancer, and impacts seizure, parkinson's disease, and breast cancer. It has an effect on colorectal cancer, and impacts alzheimer's disease, diabetes mellitus, and cardiovascular disease.",
"role": "user"
},
{
"content": "CCCCCC=CCC=CCCCCCCCCCC(=O)OCC1COP(=O)(O)OC2C(O)C(O)C(O)C(CCCCCCC(=O)O1)C(=O)CC(O)C(C=CC(O)CCCCC)C(O)C2O",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I need a molecule that meets the following conditions: The molecule is a apoptosis and a proton trap for oxidative phosphorylation that impacts diabetic heart disease, barth syndrome, and non-alcoholic fatty liver disease. The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, cholesterol translocation that impacts aging and tangier disease. Please represent the molecule in SMILES.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Build a molecule that meets the requirement: The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, cholesterol translocation that impacts barth syndrome and diabetic heart disease. The molecule is a apoptosis and a stabilizing mitochondrial structure that impacts tangier disease, non-alcoholic fatty liver disease, and aging.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCC=CCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCCCCC",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule that fulfills the requirement: The molecule is a energy source, inflammatory, energy storage, nutrient that belongs to the thyroxine treatment class of molecules and impacts atherosclerosis. The molecule is a membrane stabilizer that affects cancer by impacting pancreatitis. The molecule is a fat storage that impacts metabolic syndrome, cardiovascular disease, and obesity.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCC(C)CC",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Give me a molecule that satisfies the conditions outlined in the description: The molecule is a stabilizing cytochrome oxidase and a apoptosis that impacts barth syndrome, diabetic heart disease, and aging. The molecule is a stabilizing mitochondrial structure, cholesterol translocation, proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease and tangier disease.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCC",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Give me a molecule that satisfies the conditions outlined in the description: The molecule is a apoptosis and a stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease, diabetic heart disease, and barth syndrome. The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, cholesterol translocation that impacts tangier disease and aging.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC(C)C",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Suppose there is a molecule that meets the following description: The molecule is a stabilizing mitochondrial structure and a proton trap for oxidative phosphorylation that impacts diabetic heart disease, tangier disease, and barth syndrome. The molecule is a stabilizing cytochrome oxidase, apoptosis, cholesterol translocation that impacts non-alcoholic fatty liver disease and aging. Please write the SMILES representation of it.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCC=CCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I need a molecule that meets the following conditions: The molecule is a serotonin antagonist. Please represent the molecule in SMILES.",
"role": "user"
},
{
"content": "CCN1CCN(c2nc(-c3ccc(OCCO)cc3)cc3cc(F)ccc23)CC1.Cl.Cl",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Can you create a molecule that matches the given characteristics? The molecule is a cholesterol translocation, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease and tangier disease. The molecule is a proton trap for oxidative phosphorylation and a apoptosis that impacts aging, barth syndrome, and diabetic heart disease.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule that fulfills the requirement: The molecule is a stabilizing cytochrome oxidase, cholesterol translocation, proton trap for oxidative phosphorylation that impacts tangier disease and non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure and a apoptosis that impacts diabetic heart disease, barth syndrome, and aging.",
"role": "user"
},
{
"content": "CCCCCCC=CC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCC(C)C",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation that impacts aging, non-alcoholic fatty liver disease, and barth syndrome. The molecule is a stabilizing cytochrome oxidase, apoptosis, stabilizing mitochondrial structure that impacts tangier disease and diabetic heart disease.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCC(C)CC",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Based on the given information, generate a molecule that meets the desired specifications: The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts diabetic heart disease and tangier disease. The molecule is a cholesterol translocation and a apoptosis that impacts barth syndrome, aging, and non-alcoholic fatty liver disease.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCC)OC(=O)CCCCCCCCCCC(C)C",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Build a molecule that meets the requirement: The molecule is a anti bacterial.",
"role": "user"
},
{
"content": "Cc1ncc(SCC2=C(C(=O)O)N3C(=O)C(O)C3SC2)s1",
"role": "assistant"
}
]
|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Could you please return a molecule that adheres to this description? The molecule is a cholesterol translocation and a stabilizing cytochrome oxidase that impacts tangier disease, aging, and barth syndrome. The molecule is a apoptosis, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure that impacts diabetic heart disease and non-alcoholic fatty liver disease.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCCCC",
"role": "assistant"
}
]
|
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.