messages
listlengths
3
3
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Conceptualize a molecule that meets the specified attribute(s): The molecule is a nutritional supplement, a emulsifier, and a membrane stabilizer, and it impacts aging. The molecule is a surfactant and a cholesterol translocation that impacts diabetic heart disease, barth syndrome, and tangier disease. The molecule is a stabilizing cytochrome oxidase and a food additive, it impacts non-alcoholic fatty liver disease, and is smooth. The molecule is a proton trap for oxidative phosphorylation, energy storage, stabilizing mitochondrial structure, energy source, apoptosis.", "role": "user" }, { "content": "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCC=CCC=CCC=CCC=CCC=CCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Generate a molecule based on this description: The molecule is a stabilizing mitochondrial structure that impacts aging, non-alcoholic fatty liver disease, tangier disease, and barth syndrome. The molecule is a cholesterol translocation, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, apoptosis that impacts diabetic heart disease.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Build a molecule that meets the requirement: The molecule is both a protein kinase inhibitor and a kinase inhibitor.", "role": "user" }, { "content": "CC(C)(O)CNC1CN(c2cc(C#N)cc(Nc3nc(NC4CC4)c4ncc(C#N)n4n3)c2Cl)CCC1NC(=O)O", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Suppose there is a molecule that meets the following description: The molecule is a fxr agonist. Please write the SMILES representation of it.", "role": "user" }, { "content": "COc1cc(C)cc2ncc(C(C)C)nc12", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a neurological treatment.", "role": "user" }, { "content": "Cc1cc(-c2cc(CO)ccn2)ccc1C(N)=O", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Can you create a molecule that matches the given characteristics? The molecule is a proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts aging and tangier disease. The molecule is a apoptosis and a cholesterol translocation that impacts diabetic heart disease, non-alcoholic fatty liver disease, and barth syndrome.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Generate a molecule that fulfills the requirement: The molecule is a stabilizing cytochrome oxidase and a apoptosis that impacts diabetic heart disease, non-alcoholic fatty liver disease, and aging. The molecule is a proton trap for oxidative phosphorylation, cholesterol translocation, stabilizing mitochondrial structure that impacts tangier disease and barth syndrome.", "role": "user" }, { "content": "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCC=CCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Could you please return a molecule that adheres to this description? The molecule is a fat storage and belongs to the thyroxine treatment class of molecules, impacting cardiovascular disease. The molecule is a nutrient that impacts pancreatitis, metabolic syndrome, and atherosclerosis.", "role": "user" }, { "content": "CCCCCC=CCC=CCC=CCC=CCCCC(=O)OCC(COC(=O)CCCCCCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Suppose there is a molecule that meets the following description: The molecule is a cholesterol translocation that impacts barth syndrome, aging, tangier disease, and diabetic heart disease. The molecule is a apoptosis, stabilizing cytochrome oxidase, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease. Please write the SMILES representation of it.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Come up with a molecule based on the description: The molecule is a nutrient.", "role": "user" }, { "content": "COc1cc2c(=O)oc3c(O)c(O)cc4c(=O)oc(c1OC)c2c34", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "I need a molecule that meets the following conditions: The molecule is a stabilizing cytochrome oxidase, apoptosis, stabilizing mitochondrial structure that impacts barth syndrome and non-alcoholic fatty liver disease. The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation that impacts tangier disease, diabetic heart disease, and aging. Please represent the molecule in SMILES.", "role": "user" }, { "content": "CCC=CCC=CCC=CCC=CCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "I need a molecule that meets the following conditions: It influences both colorectal cancer and stomach cancer, as well as affecting parkinson's disease and alzheimer's disease. It has an effect on breast cancer, and impacts seizure, diabetes mellitus, and cardiovascular disease. Please represent the molecule in SMILES.", "role": "user" }, { "content": "CCC=CCC=CCC=CCC=CCCCCCCC(=O)OCC(COP(=O)(O)OC1C(O)C(O)C(O)C(O)C1O)OC(=O)CCCC(O)C=CC=CCC=CC=CC(O)CCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Build a molecule that meets the requirement: The molecule is a stabilizing cytochrome oxidase and a apoptosis that impacts barth syndrome, aging, and non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure, cholesterol translocation, proton trap for oxidative phosphorylation that impacts tangier disease and diabetic heart disease.", "role": "user" }, { "content": "CCCCCCC=CC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Generate a molecule that fulfills the requirement: The molecule is alzheimer's treatment and it impacts epilepsy treatment.", "role": "user" }, { "content": "FC(F)(F)C1CCOC2(CNC2)C1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Can you create a molecule that matches the given characteristics? The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation that impacts aging, barth syndrome, and tangier disease. The molecule is a apoptosis, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts diabetic heart disease and non-alcoholic fatty liver disease.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)CC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Could you please return a molecule that adheres to this description? The molecule is a proton trap for oxidative phosphorylation and a cholesterol translocation that impacts non-alcoholic fatty liver disease, tangier disease, and aging. The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, apoptosis that impacts barth syndrome and diabetic heart disease.", "role": "user" }, { "content": "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Based on the given information, generate a molecule that meets the desired specifications: The molecule is a stabilizing mitochondrial structure, a surfactant, and a membrane stabilizer, and it impacts non-alcoholic fatty liver disease. The molecule is a stabilizing cytochrome oxidase and a cholesterol translocation that impacts diabetic heart disease, barth syndrome, and aging. The molecule is a apoptosis and a emulsifier, it impacts tangier disease, and is smooth. The molecule is a energy source, food additive, proton trap for oxidative phosphorylation, energy storage, nutritional supplement.", "role": "user" }, { "content": "CCC(C)CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "I need a molecule that meets the following conditions: The molecule is a aldose reductase inhibitor. Please represent the molecule in SMILES.", "role": "user" }, { "content": "CC1C(=O)c2ccccc2C(CCNOCc2ccccc2)C1=C=O", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a proton trap for oxidative phosphorylation and a stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease, diabetic heart disease, and aging. The molecule is a stabilizing mitochondrial structure, cholesterol translocation, apoptosis that impacts barth syndrome and tangier disease.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCC(C)CC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Come up with a molecule based on the description: The molecule is a fat storage and a nutrient that impacts cancer, atherosclerosis, metabolic syndrome, and cardiovascular disease. The molecule is a inflammatory that impacts both obesity and pancreatitis. The molecule is a energy storage, a membrane stabilizer, and a energy source, and it impacts thyroxine treatment.", "role": "user" }, { "content": "CCC(C)CCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC(C)C", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, apoptosis, cholesterol translocation. It impacts tangier disease, aging, non-alcoholic fatty liver disease, diabetic heart disease, and barth syndrome. Use the above information to create a molecule.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Come up with a molecule based on the description: The molecule is a proton trap for oxidative phosphorylation and a stabilizing mitochondrial structure that impacts tangier disease, barth syndrome, and non-alcoholic fatty liver disease. The molecule is a stabilizing cytochrome oxidase, apoptosis, cholesterol translocation that impacts diabetic heart disease and aging.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCC(C)C", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Generate a molecule based on this description: The molecule is a fat storage that impacts both cardiovascular disease and thyroxine treatment. The molecule is a nutrient that impacts atherosclerosis, pancreatitis, and metabolic syndrome.", "role": "user" }, { "content": "CCCCC=CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCC=CCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Come up with a molecule based on the description: The molecule is a anti protozoal and belongs to the anti bacterial class of molecules.", "role": "user" }, { "content": "CC(C)(C)C(N)c1nc2ccccc2[nH]1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Generate a molecule that fulfills the requirement: The molecule is a 5ht2c receptor agonist.", "role": "user" }, { "content": "O=C(Nc1cccnc1)c1ccc2c3c1CCN3CCNC2", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Build a molecule that meets the requirement: The molecule is a stabilizing cytochrome oxidase that impacts barth syndrome, aging, tangier disease, and diabetic heart disease. The molecule is a apoptosis, cholesterol translocation, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease.", "role": "user" }, { "content": "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Based on the given information, generate a molecule that meets the desired specifications: The molecule is a hiv inhibitor and belongs to the anti viral class of molecules.", "role": "user" }, { "content": "CCOC(=O)C(OC(C)(C)C)c1c(C)c2c(c(C)c1-c1cc(F)c3c(c1C)CCCO3)CCN(S(=O)(=O)c1ccccc1[N+](=O)[O-])CC2", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "The molecule is anti inflammatory. Use the above information to create a molecule.", "role": "user" }, { "content": "COc1ccc2c(c1)Sc1cccc(C(=O)O)c1N2", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Build a molecule that meets the requirement: The molecule is a hcv inhibitor, a anti viral, a ns5a inhibitor, and anti viral compound.", "role": "user" }, { "content": "CCCNCc1nc2ccc(C#Cc3ccc(-c4cnc(CN(CCC)C(=O)OC(C)(C)C)[nH]4)cc3)cc2[nH]1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Give me a molecule that satisfies the conditions outlined in the description: The light-emitting molecule has an effect on light-emitting device.", "role": "user" }, { "content": "CC(C)(C)c1ccc(-c2cc(-c3ccc(C(C)(C)C)cc3)cc(-c3cc(-c4cc(-c5ccc(C(C)(C)C)cc5)cc(-c5ccc(C(C)(C)C)cc5)c4)cc(N4c5ccc(Cl)cc5Oc5cc(Cl)ccc54)c3)c2)cc1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Based on the given information, generate a molecule that meets the desired specifications: The molecule is a apoptosis, cholesterol translocation, stabilizing cytochrome oxidase that impacts aging and diabetic heart disease. The molecule is a stabilizing mitochondrial structure and a proton trap for oxidative phosphorylation that impacts tangier disease, barth syndrome, and non-alcoholic fatty liver disease.", "role": "user" }, { "content": "CCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCC(C)CC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Based on the given information, generate a molecule that meets the desired specifications: The molecule is a proton trap for oxidative phosphorylation and a cholesterol translocation that impacts tangier disease, diabetic heart disease, and barth syndrome. The molecule is a stabilizing cytochrome oxidase, apoptosis, stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease and aging.", "role": "user" }, { "content": "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "I need a molecule that meets the following conditions: The molecule is a apoptosis that impacts barth syndrome, aging, diabetic heart disease, and tangier disease. The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, cholesterol translocation, stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease. Please represent the molecule in SMILES.", "role": "user" }, { "content": "CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Give me a molecule that satisfies the conditions outlined in the description: It impacts metabolic syndrome, atherosclerosis, and cardiovascular disease. The molecule is a nutrient, a fat storage, and a thyroxine treatment, and it impacts pancreatitis.", "role": "user" }, { "content": "CCCCCCC=CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCC=CCCCCCCCC)COC(=O)CCCCCCCCCCCCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Conceptualize a molecule that meets the specified attribute(s): The molecule is a proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease, barth syndrome, diabetic heart disease, and aging. The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, cholesterol translocation, apoptosis that impacts tangier disease.", "role": "user" }, { "content": "CCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Conceptualize a molecule that meets the specified attribute(s): The molecule is a nutrient that impacts alzheimer's disease, diabetes mellitus type 2, parkinson's disease, and non-alcoholic fatty liver disease.", "role": "user" }, { "content": "CCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CC=CC(O)CCCCC)COP(=O)(O)OCCN", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Could you please return a molecule that adheres to this description? The molecule is a cholesterol translocation and a stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease, tangier disease, and diabetic heart disease. The molecule is a apoptosis, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts aging and barth syndrome.", "role": "user" }, { "content": "CCCCCC=CCC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Generate a molecule based on this description: The molecule is a nutrient that impacts non-alcoholic fatty liver disease, diabetes mellitus type 2, alzheimer's disease, and parkinson's disease.", "role": "user" }, { "content": "CCCCCC=CCC=CCC=CCC1OC1CCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCCN", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "I need a molecule that meets the following conditions: The molecule is a stabilizing mitochondrial structure that impacts tangier disease, aging, non-alcoholic fatty liver disease, and barth syndrome. The molecule is a stabilizing cytochrome oxidase, cholesterol translocation, apoptosis, proton trap for oxidative phosphorylation that impacts diabetic heart disease. Please represent the molecule in SMILES.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCCC(C)CC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Can you create a molecule that matches the given characteristics? The molecule is a liquid crystal and belongs to the optoelectronic class of molecules.", "role": "user" }, { "content": "CCCCCc1ccc2cc(-c3ccc(-c4cc(F)c(OC)c(F)c4)c(F)c3)ccc2c1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Based on the given information, generate a molecule that meets the desired specifications: The molecule is a hsp90 inhibitor and belongs to the cancer treatment class of molecules.", "role": "user" }, { "content": "CCNC(=O)c1nnc(-c2cc(C(C)C)c(O)cc2O)n1-c1ccc(S(=O)(=O)N2CCC(C(=O)N3CCC(CN(C)C(=O)Oc4ccc5nc6c(c(CC)c5c4)Cn4c-6cc5c(c4=O)COC(=O)C5(O)CC)CC3)CC2)cc1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Suppose there is a molecule that meets the following description: The molecule is a mmp inhibitor and belongs to the anti inflammatory class of molecules. Please write the SMILES representation of it.", "role": "user" }, { "content": "Cc1ccccc1S(=O)(=O)OCC1(CC(=O)O)COCCO1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Suppose there is a molecule that meets the following description: The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts barth syndrome and diabetic heart disease. The molecule is a cholesterol translocation and a apoptosis that impacts tangier disease, aging, and non-alcoholic fatty liver disease. Please write the SMILES representation of it.", "role": "user" }, { "content": "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a apoptosis, cholesterol translocation, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure that impacts tangier disease, diabetic heart disease, aging, and barth syndrome.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC(C)C", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is cancer treatment.", "role": "user" }, { "content": "CN(C(=O)NCc1ccccc1)N1CC(=O)N2C(Cc3ccccc3)C(=O)N(Cc3cccc(F)c3)CC21", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Could you please return a molecule that adheres to this description? The electroluminescent molecule has an effect on electroluminescent device.", "role": "user" }, { "content": "c1cnc(-c2cccc3c2oc2ccccc23)c(-c2cccnc2-n2c3ccccc3n3c4ccccc4nc23)c1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Give me a molecule that satisfies the conditions outlined in the description: The molecule is a apoptosis, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation that impacts aging and tangier disease. The molecule is a cholesterol translocation and a stabilizing mitochondrial structure that impacts diabetic heart disease, non-alcoholic fatty liver disease, and barth syndrome.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Based on the given information, generate a molecule that meets the desired specifications: The molecule is a fat storage and thyroxine treatment, and it impacts metabolic syndrome. The molecule is a nutrient that impacts cardiovascular disease, atherosclerosis, and pancreatitis.", "role": "user" }, { "content": "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Give me a molecule that satisfies the conditions outlined in the description: The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure that impacts barth syndrome and diabetic heart disease. The molecule is a cholesterol translocation and a apoptosis that impacts tangier disease, non-alcoholic fatty liver disease, and aging.", "role": "user" }, { "content": "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Build a molecule that meets the requirement: The molecule is a food additive, a stabilizing mitochondrial structure, a energy source, and smooth. The molecule is a energy storage, nutritional supplement, stabilizing cytochrome oxidase, emulsifier that impacts barth syndrome. The molecule is a proton trap for oxidative phosphorylation, a membrane stabilizer, and a surfactant, and it impacts diabetic heart disease. The molecule is a apoptosis and a cholesterol translocation that impacts tangier disease, non-alcoholic fatty liver disease, and aging.", "role": "user" }, { "content": "CC(C)CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC(C)C", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Generate a molecule that fulfills the requirement: The molecule is a nutritional supplement and a energy source, impacting both diabetic heart disease and non-alcoholic fatty liver disease. The molecule is a emulsifier, food additive, cholesterol translocation, surfactant that impacts tangier disease. The molecule is a stabilizing cytochrome oxidase, a energy storage, and a apoptosis, and it impacts barth syndrome. The molecule is a membrane stabilizer, a stabilizing mitochondrial structure, and a proton trap for oxidative phosphorylation, it impacts aging and is smooth.", "role": "user" }, { "content": "CCC(C)CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCC(C)C", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Give me a molecule that satisfies the conditions outlined in the description: The molecule is a stabilizing cytochrome oxidase, cholesterol translocation, proton trap for oxidative phosphorylation that impacts tangier disease and diabetic heart disease. The molecule is a apoptosis and a stabilizing mitochondrial structure that impacts barth syndrome, aging, and non-alcoholic fatty liver disease.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCC(C)C", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Could you please return a molecule that adheres to this description? The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation that impacts diabetic heart disease, aging, and barth syndrome. The molecule is a apoptosis, stabilizing mitochondrial structure, stabilizing cytochrome oxidase that impacts tangier disease and non-alcoholic fatty liver disease.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCC(C)CC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Generate a molecule that fulfills the requirement: The molecule is a thyroxine treatment and nutrient, and it impacts metabolic syndrome. The molecule is a fat storage that impacts cardiovascular disease, pancreatitis, and atherosclerosis.", "role": "user" }, { "content": "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Generate a molecule based on this description: The molecule is a inflammatory, energy source, energy storage that impacts cancer, cardiovascular disease, and atherosclerosis. The molecule is a membrane stabilizer and fat storage, and it impacts obesity. The molecule is a nutrient that impacts metabolic syndrome, pancreatitis, and thyroxine treatment.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCC(C)C", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Generate a molecule based on this description: The molecule is a proton trap for oxidative phosphorylation, stabilizing mitochondrial structure, stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease and barth syndrome. The molecule is a cholesterol translocation and a apoptosis that impacts diabetic heart disease, tangier disease, and aging.", "role": "user" }, { "content": "CCC=CCC=CCC=CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "I need a molecule that meets the following conditions: The molecule is a proton trap for oxidative phosphorylation and a stabilizing cytochrome oxidase that impacts tangier disease, diabetic heart disease, and non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure, cholesterol translocation, apoptosis that impacts aging and barth syndrome. Please represent the molecule in SMILES.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC(C)C", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Can you create a molecule that matches the given characteristics? The molecule is a nutrient that affects breast cancer by impacting cervical cancer, ulcerative colitis, and atherosclerosis.", "role": "user" }, { "content": "CCC=CCC=CCC=CCC=CCC=CC=CC(O)CCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Generate a molecule that fulfills the requirement: The molecule is a factor xa inhibitor and belongs to the anti thrombotic class of molecules.", "role": "user" }, { "content": "NCC(C(=O)Nc1ccc(N2CCOCC2=O)cc1OC(F)F)N(CC(F)F)CC1CC1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a apoptosis and a cholesterol translocation that impacts tangier disease, barth syndrome, and non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation, stabilizing mitochondrial structure, stabilizing cytochrome oxidase that impacts aging and diabetic heart disease.", "role": "user" }, { "content": "CCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC(C)C", "role": "assistant" } ]