instruction
stringlengths 51
2.18k
| output
stringlengths 1
833
| input
stringclasses 1
value |
---|---|---|
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a hsp90 inhibitor and belongs to the cancer treatment class of molecules. | CCNC(=O)c1nnc(-c2cc(C(C)C)c(O)cc2O)n1-c1ccc(S(=O)(=O)N2CCC(C(=O)N3CCC(CN(C)C(=O)Oc4ccc5nc6c(c(CC)c5c4)Cn4c-6cc5c(c4=O)COC(=O)C5(O)CC)CC3)CC2)cc1 | |
Generate a molecule based on this description: The molecule is a hsp90 inhibitor and is cancer treatment. | CCNC(=O)c1nnc(-c2cc(C(C)C)c(O)cc2O)n1-c1ccc(S(=O)(=O)N2CCC(C(=O)N3CCC(CN(C)C(=O)Oc4ccc5nc6c(c(CC)c5c4)Cn4c-6cc5c(c4=O)COC(=O)C5(O)CC)CC3)CC2)cc1 | |
Generate a molecule based on this description: The molecule is a hsp90 inhibitor that impacts cancer treatment. | CCNC(=O)c1nnc(-c2cc(C(C)C)c(O)cc2O)n1-c1ccc(S(=O)(=O)N2CCC(C(=O)N3CCC(CN(C)C(=O)Oc4ccc5nc6c(c(CC)c5c4)Cn4c-6cc5c(c4=O)COC(=O)C5(O)CC)CC3)CC2)cc1 | |
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is both a hsp90 inhibitor and a cancer treatment. | CCNC(=O)c1nnc(-c2cc(C(C)C)c(O)cc2O)n1-c1ccc(S(=O)(=O)N2CCC(C(=O)N3CCC(CN(C)C(=O)Oc4ccc5nc6c(c(CC)c5c4)Cn4c-6cc5c(c4=O)COC(=O)C5(O)CC)CC3)CC2)cc1 | |
Could you please return a molecule that adheres to this description? The molecule is a hsp90 inhibitor and is cancer treatment. | CCNC(=O)c1nnc(-c2cc(C(C)C)c(O)cc2O)n1-c1ccc(S(=O)(=O)N2CCC(C(=O)N3CCC(CN(C)C(=O)Oc4ccc5nc6c(c(CC)c5c4)Cn4c-6cc5c(c4=O)COC(=O)C5(O)CC)CC3)CC2)cc1 | |
Build a molecule that meets the requirement: The molecule is both a anti inflammatory and a mmp inhibitor. | Cc1ccccc1S(=O)(=O)OCC1(CC(=O)O)COCCO1 | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a mmp inhibitor and belongs to the anti inflammatory class of molecules. | Cc1ccccc1S(=O)(=O)OCC1(CC(=O)O)COCCO1 | |
The molecule is a mmp inhibitor and belongs to the anti inflammatory class of molecules. Use the above information to create a molecule. | Cc1ccccc1S(=O)(=O)OCC1(CC(=O)O)COCCO1 | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a mmp inhibitor and is anti inflammatory. | Cc1ccccc1S(=O)(=O)OCC1(CC(=O)O)COCCO1 | |
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a mmp inhibitor and is anti inflammatory. | Cc1ccccc1S(=O)(=O)OCC1(CC(=O)O)COCCO1 | |
Generate a molecule that fulfills the requirement: The molecule is a stabilizing cytochrome oxidase and a apoptosis, impacting both aging and barth syndrome. The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, cholesterol translocation that impacts diabetic heart disease, tangier disease, and non-alcoholic fatty liver disease. | CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a cholesterol translocation and a stabilizing mitochondrial structure that impacts barth syndrome, aging, and diabetic heart disease. The molecule is a stabilizing cytochrome oxidase, apoptosis, proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease and tangier disease. | CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC | |
Build a molecule that meets the requirement: The molecule is a stabilizing cytochrome oxidase, cholesterol translocation, apoptosis that impacts tangier disease and diabetic heart disease. The molecule is a proton trap for oxidative phosphorylation and a stabilizing mitochondrial structure that impacts barth syndrome, aging, and non-alcoholic fatty liver disease. | CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a cholesterol translocation that impacts both barth syndrome and diabetic heart disease. The molecule is a stabilizing mitochondrial structure and proton trap for oxidative phosphorylation, and it impacts aging. The molecule is a apoptosis and a stabilizing cytochrome oxidase, impacting both non-alcoholic fatty liver disease and tangier disease. | CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC | |
I need a molecule that meets the following conditions: The molecule is a cholesterol translocation and a stabilizing mitochondrial structure that impacts tangier disease, barth syndrome, and aging. The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, apoptosis that impacts diabetic heart disease and non-alcoholic fatty liver disease. Please represent the molecule in SMILES. | CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC | |
Generate a molecule based on this description: The molecule is a cholesterol translocation, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts diabetic heart disease, non-alcoholic fatty liver disease, and barth syndrome. The molecule is a apoptosis and a stabilizing mitochondrial structure, impacting both aging and tangier disease. | CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC(C)C | |
Come up with a molecule based on the description: The molecule is a proton trap for oxidative phosphorylation and a cholesterol translocation that impacts diabetic heart disease, aging, barth syndrome, and non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure, a stabilizing cytochrome oxidase, and a apoptosis, and it impacts tangier disease. | CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC(C)C | |
The molecule is a stabilizing mitochondrial structure and a apoptosis that impacts barth syndrome, aging, and tangier disease. The molecule is a cholesterol translocation, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease and diabetic heart disease. Use the above information to create a molecule. | CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC(C)C | |
The molecule is a stabilizing mitochondrial structure, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease and aging. The molecule is a cholesterol translocation and a apoptosis that impacts diabetic heart disease, barth syndrome, and tangier disease. Use the above information to create a molecule. | CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC(C)C | |
I need a molecule that meets the following conditions: The molecule is a stabilizing cytochrome oxidase and cholesterol translocation, and it impacts barth syndrome. The molecule is a apoptosis and stabilizing mitochondrial structure, and it impacts tangier disease. The molecule is a proton trap for oxidative phosphorylation that impacts aging, non-alcoholic fatty liver disease, and diabetic heart disease. Please represent the molecule in SMILES. | CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC(C)C | |
Generate a molecule based on this description: It impacts cancer treatment. | CN(C(=O)NCc1ccccc1)N1CC(=O)N2C(Cc3ccccc3)C(=O)N(Cc3cccc(F)c3)CC21 | |
Build a molecule that meets the requirement: The molecule is cancer treatment. | CN(C(=O)NCc1ccccc1)N1CC(=O)N2C(Cc3ccccc3)C(=O)N(Cc3cccc(F)c3)CC21 | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is cancer treatment. | CN(C(=O)NCc1ccccc1)N1CC(=O)N2C(Cc3ccccc3)C(=O)N(Cc3cccc(F)c3)CC21 | |
Based on the given information, generate a molecule that meets the desired specifications: It belongs to the cancer treatment class of molecules. | CN(C(=O)NCc1ccccc1)N1CC(=O)N2C(Cc3ccccc3)C(=O)N(Cc3cccc(F)c3)CC21 | |
Conceptualize a molecule that meets the specified attribute(s): It impacts cancer treatment. | CN(C(=O)NCc1ccccc1)N1CC(=O)N2C(Cc3ccccc3)C(=O)N(Cc3cccc(F)c3)CC21 | |
Come up with a molecule based on the description: This molecule is a member of the electroluminescent class and influences electroluminescent device. | c1cnc(-c2cccc3c2oc2ccccc23)c(-c2cccnc2-n2c3ccccc3n3c4ccccc4nc23)c1 | |
Generate a molecule that fulfills the requirement: It belongs to both the electroluminescent device and electroluminescent classes of molecules. | c1cnc(-c2cccc3c2oc2ccccc23)c(-c2cccnc2-n2c3ccccc3n3c4ccccc4nc23)c1 | |
Generate a molecule based on this description: The molecule is a electroluminescent member of the electroluminescent device class. | c1cnc(-c2cccc3c2oc2ccccc23)c(-c2cccnc2-n2c3ccccc3n3c4ccccc4nc23)c1 | |
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a electroluminescent member of the electroluminescent device class. | c1cnc(-c2cccc3c2oc2ccccc23)c(-c2cccnc2-n2c3ccccc3n3c4ccccc4nc23)c1 | |
Conceptualize a molecule that meets the specified attribute(s): The molecule is a electroluminescent member of the electroluminescent device class. | c1cnc(-c2cccc3c2oc2ccccc23)c(-c2cccnc2-n2c3ccccc3n3c4ccccc4nc23)c1 | |
Conceptualize a molecule that meets the specified attribute(s): The molecule is a proton trap for oxidative phosphorylation and a stabilizing cytochrome oxidase, impacting both non-alcoholic fatty liver disease and aging. The molecule is a apoptosis, stabilizing mitochondrial structure, cholesterol translocation that impacts tangier disease, barth syndrome, and diabetic heart disease. | CCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCCCCCC | |
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a stabilizing mitochondrial structure. The molecule is a cholesterol translocation, a proton trap for oxidative phosphorylation, and a stabilizing cytochrome oxidase, and it impacts aging. The molecule is a apoptosis that impacts tangier disease, barth syndrome, non-alcoholic fatty liver disease, and diabetic heart disease. | CCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCCCCCC | |
Conceptualize a molecule that meets the specified attribute(s): The molecule is a stabilizing mitochondrial structure and a cholesterol translocation, impacting both diabetic heart disease and non-alcoholic fatty liver disease. The molecule is a apoptosis and a proton trap for oxidative phosphorylation, impacting both tangier disease and barth syndrome. The molecule is a stabilizing cytochrome oxidase that impacts aging. | CCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCCCCCC | |
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a proton trap for oxidative phosphorylation and a stabilizing mitochondrial structure that impacts barth syndrome, non-alcoholic fatty liver disease, and tangier disease. The molecule is a cholesterol translocation, stabilizing cytochrome oxidase, apoptosis that impacts aging and diabetic heart disease. | CCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCCCCCC | |
Come up with a molecule based on the description: The molecule is a apoptosis that impacts both diabetic heart disease and aging. The molecule is a cholesterol translocation and stabilizing cytochrome oxidase, and it impacts non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation and a stabilizing mitochondrial structure, impacting both tangier disease and barth syndrome. | CCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCCCCCC | |
The molecule is a nutrient and fat storage, and it impacts pancreatitis. It impacts metabolic syndrome, cardiovascular disease, thyroxine treatment, and atherosclerosis. Use the above information to create a molecule. | CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCCCCCCC | |
Could you please return a molecule that adheres to this description? The molecule is a thyroxine treatment and a nutrient that impacts atherosclerosis, metabolic syndrome, cardiovascular disease, and pancreatitis. The molecule is a fat storage. | CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCCCCCCC | |
I need a molecule that meets the following conditions: The molecule is a fat storage that impacts both metabolic syndrome and pancreatitis. The molecule is a thyroxine treatment and a nutrient, impacting both atherosclerosis and cardiovascular disease. Please represent the molecule in SMILES. | CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCCCCCCC | |
I need a molecule that meets the following conditions: It impacts atherosclerosis. The molecule is a thyroxine treatment, fat storage, nutrient that impacts metabolic syndrome, pancreatitis, and cardiovascular disease. Please represent the molecule in SMILES. | CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCCCCCCC | |
Come up with a molecule based on the description: The molecule is a fat storage. The molecule is a nutrient and a thyroxine treatment that impacts metabolic syndrome, atherosclerosis, pancreatitis, and cardiovascular disease. | CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCCCCCCC | |
I need a molecule that meets the following conditions: The molecule is a stabilizing cytochrome oxidase that impacts both non-alcoholic fatty liver disease and tangier disease. The molecule is a proton trap for oxidative phosphorylation and stabilizing mitochondrial structure, and it impacts barth syndrome. The molecule is a cholesterol translocation and a apoptosis, impacting both diabetic heart disease and aging. Please represent the molecule in SMILES. | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCCCC | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a apoptosis that impacts non-alcoholic fatty liver disease, aging, diabetic heart disease, barth syndrome, and tangier disease. The molecule is a proton trap for oxidative phosphorylation, cholesterol translocation, stabilizing mitochondrial structure, stabilizing cytochrome oxidase. | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCCCC | |
Come up with a molecule based on the description: The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, cholesterol translocation that impacts barth syndrome and non-alcoholic fatty liver disease. The molecule is a apoptosis that impacts aging, tangier disease, and diabetic heart disease. | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCCCC | |
Suppose there is a molecule that meets the following description: The molecule is a cholesterol translocation and a stabilizing mitochondrial structure that impacts aging, tangier disease, and non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation, apoptosis, stabilizing cytochrome oxidase that impacts barth syndrome and diabetic heart disease. Please write the SMILES representation of it. | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCCCC | |
Conceptualize a molecule that meets the specified attribute(s): The molecule is a apoptosis, a cholesterol translocation, and a stabilizing mitochondrial structure, and it impacts barth syndrome. The molecule is a proton trap for oxidative phosphorylation and a stabilizing cytochrome oxidase that impacts aging, non-alcoholic fatty liver disease, and tangier disease. It impacts diabetic heart disease. | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCCCC | |
Conceptualize a molecule that meets the specified attribute(s): The molecule is a membrane stabilizer that impacts both diabetic heart disease and aging. The molecule is a food additive, cholesterol translocation, apoptosis, proton trap for oxidative phosphorylation. The molecule is a nutritional supplement, a energy storage, and a emulsifier. The molecule is a surfactant and a stabilizing cytochrome oxidase, impacting both non-alcoholic fatty liver disease and barth syndrome. The molecule is a energy source and a stabilizing mitochondrial structure, it impacts tangier disease, and is smooth. | CC(C)CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC(C)C | |
Generate a molecule based on this description: The molecule is a emulsifier, a stabilizing cytochrome oxidase, and a membrane stabilizer. The molecule is a proton trap for oxidative phosphorylation and a nutritional supplement, it impacts tangier disease, and is smooth. The molecule is a energy storage and energy source, and it impacts barth syndrome. The molecule is a cholesterol translocation and a food additive, impacting both non-alcoholic fatty liver disease and aging. The molecule is a stabilizing mitochondrial structure, a surfactant, and a apoptosis, and it impacts diabetic heart disease. | CC(C)CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC(C)C | |
Generate a molecule that fulfills the requirement: The molecule is a energy storage, a stabilizing mitochondrial structure, and smooth. The molecule is a emulsifier, energy source, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase. The molecule is a nutritional supplement and a membrane stabilizer, impacting both tangier disease and aging. The molecule is a apoptosis, food additive, cholesterol translocation, surfactant. It impacts non-alcoholic fatty liver disease, barth syndrome, and diabetic heart disease. | CC(C)CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC(C)C | |
Conceptualize a molecule that meets the specified attribute(s): The molecule is a surfactant, a stabilizing cytochrome oxidase, and smooth. The molecule is a proton trap for oxidative phosphorylation and a food additive, impacting both aging and barth syndrome. The molecule is a membrane stabilizer, energy storage, energy source, emulsifier that impacts non-alcoholic fatty liver disease. The molecule is a nutritional supplement, stabilizing mitochondrial structure, apoptosis, cholesterol translocation that impacts tangier disease and diabetic heart disease. | CC(C)CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC(C)C | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a stabilizing cytochrome oxidase and smooth, and it impacts diabetic heart disease. The molecule is a cholesterol translocation and a energy storage, impacting both non-alcoholic fatty liver disease and tangier disease. The molecule is a nutritional supplement and emulsifier, and it impacts aging. The molecule is a apoptosis, a stabilizing mitochondrial structure, and a energy source, and it impacts barth syndrome. The molecule is a food additive, membrane stabilizer, proton trap for oxidative phosphorylation, surfactant. | CC(C)CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC(C)C | |
Could you please return a molecule that adheres to this description? The molecule is a stabilizing mitochondrial structure and a energy storage, impacting both aging and tangier disease. The molecule is a proton trap for oxidative phosphorylation, a stabilizing cytochrome oxidase, a energy source, and smooth. The molecule is a membrane stabilizer, surfactant, apoptosis, nutritional supplement. The molecule is a cholesterol translocation and a food additive that impacts diabetic heart disease, barth syndrome, and non-alcoholic fatty liver disease. The molecule is a emulsifier. | CCC(C)CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCC(C)C | |
Can you create a molecule that matches the given characteristics? The molecule is a membrane stabilizer, nutritional supplement, food additive, stabilizing mitochondrial structure, stabilizing cytochrome oxidase, and smooth. The molecule is a emulsifier, surfactant, proton trap for oxidative phosphorylation that impacts barth syndrome, aging, and tangier disease. The molecule is a cholesterol translocation, energy storage, energy source, apoptosis that impacts diabetic heart disease and non-alcoholic fatty liver disease. | CCC(C)CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCC(C)C | |
Come up with a molecule based on the description: The molecule is a nutritional supplement, a energy source, and a food additive that impacts both non-alcoholic fatty liver disease and aging, and is smooth. The molecule is a emulsifier and membrane stabilizer, and it impacts diabetic heart disease. The molecule is a apoptosis, a energy storage, and a stabilizing mitochondrial structure, and it impacts tangier disease. The molecule is a proton trap for oxidative phosphorylation, cholesterol translocation, surfactant, stabilizing cytochrome oxidase that impacts barth syndrome. | CCC(C)CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCC(C)C | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a energy source, a stabilizing cytochrome oxidase, and a nutritional supplement, and it impacts non-alcoholic fatty liver disease. The molecule is a apoptosis, emulsifier, proton trap for oxidative phosphorylation, energy storage. The molecule is a food additive that impacts aging, tangier disease, and diabetic heart disease. The molecule is a cholesterol translocation and a membrane stabilizer, it impacts barth syndrome, and is smooth. The molecule is both a stabilizing mitochondrial structure and a surfactant. | CCC(C)CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCC(C)C | |
Come up with a molecule based on the description: The molecule is a nutritional supplement and a membrane stabilizer, impacting both barth syndrome and tangier disease. The molecule is a stabilizing mitochondrial structure, energy storage, surfactant, energy source, and smooth. The molecule is a food additive, a emulsifier, and a apoptosis, and it impacts diabetic heart disease. The molecule is a stabilizing cytochrome oxidase, cholesterol translocation, proton trap for oxidative phosphorylation that impacts aging and non-alcoholic fatty liver disease. | CCC(C)CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCC(C)C | |
I need a molecule that meets the following conditions: It impacts barth syndrome. The molecule is a apoptosis, a stabilizing mitochondrial structure, and a proton trap for oxidative phosphorylation, and it impacts non-alcoholic fatty liver disease. The molecule is a stabilizing cytochrome oxidase and a cholesterol translocation that impacts tangier disease, diabetic heart disease, and aging. Please represent the molecule in SMILES. | CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCC(C)C | |
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: It impacts diabetic heart disease, barth syndrome, and non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation, a stabilizing cytochrome oxidase, and a stabilizing mitochondrial structure, and it impacts aging. The molecule is a apoptosis and cholesterol translocation, and it impacts tangier disease. | CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCC(C)C | |
Can you create a molecule that matches the given characteristics? The molecule is a stabilizing cytochrome oxidase that impacts both aging and tangier disease. The molecule is a apoptosis and proton trap for oxidative phosphorylation, and it impacts non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure and a cholesterol translocation, impacting both barth syndrome and diabetic heart disease. | CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCC(C)C | |
Could you please return a molecule that adheres to this description? The molecule is a stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease. The molecule is a apoptosis, a stabilizing mitochondrial structure, and a cholesterol translocation, and it impacts diabetic heart disease. The molecule is a proton trap for oxidative phosphorylation that impacts aging, barth syndrome, and tangier disease. | CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCC(C)C | |
Conceptualize a molecule that meets the specified attribute(s): The molecule is a stabilizing mitochondrial structure and a proton trap for oxidative phosphorylation, impacting both barth syndrome and tangier disease. The molecule is a cholesterol translocation and a apoptosis that impacts aging, non-alcoholic fatty liver disease, and diabetic heart disease. The molecule is a stabilizing cytochrome oxidase. | CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCC(C)C | |
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a cholesterol translocation. The molecule is a stabilizing mitochondrial structure, a stabilizing cytochrome oxidase, and a apoptosis, and it impacts diabetic heart disease. The molecule is a proton trap for oxidative phosphorylation that impacts barth syndrome, aging, non-alcoholic fatty liver disease, and tangier disease. | CCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCC(C)CC | |
The molecule is a cholesterol translocation that impacts both tangier disease and aging. The molecule is a apoptosis and stabilizing mitochondrial structure, and it impacts barth syndrome. The molecule is a proton trap for oxidative phosphorylation and a stabilizing cytochrome oxidase, impacting both diabetic heart disease and non-alcoholic fatty liver disease. Use the above information to create a molecule. | CCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCC(C)CC | |
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease. The molecule is a cholesterol translocation and a stabilizing mitochondrial structure, impacting both diabetic heart disease and tangier disease. The molecule is a stabilizing cytochrome oxidase and a apoptosis, impacting both barth syndrome and aging. | CCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCC(C)CC | |
Generate a molecule that fulfills the requirement: It impacts non-alcoholic fatty liver disease. The molecule is a stabilizing cytochrome oxidase, a proton trap for oxidative phosphorylation, and a cholesterol translocation, and it impacts barth syndrome. The molecule is a stabilizing mitochondrial structure and a apoptosis that impacts diabetic heart disease, tangier disease, and aging. | CCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCC(C)CC | |
Can you create a molecule that matches the given characteristics? The molecule is a proton trap for oxidative phosphorylation, cholesterol translocation, stabilizing cytochrome oxidase that impacts barth syndrome and aging. The molecule is a apoptosis and a stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease, tangier disease, and diabetic heart disease. | CCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCC(C)CC | |
Can you create a molecule that matches the given characteristics? The molecule is a member of the thyroxine treatment class and affects cardiovascular disease. The molecule is a nutrient and a fat storage that impacts metabolic syndrome, pancreatitis, and atherosclerosis. | CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCC | |
Come up with a molecule based on the description: The molecule is a thyroxine treatment that impacts metabolic syndrome, atherosclerosis, and pancreatitis. The molecule is a nutrient and fat storage, and it impacts cardiovascular disease. | CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCC | |
I need a molecule that meets the following conditions: The molecule is a nutrient and a fat storage, impacting both metabolic syndrome and cardiovascular disease. The molecule is a member of the thyroxine treatment class and affects both pancreatitis and atherosclerosis. Please represent the molecule in SMILES. | CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCC | |
Build a molecule that meets the requirement: The molecule is a fat storage that belongs to the thyroxine treatment class of molecules, impacting pancreatitis, metabolic syndrome, and atherosclerosis. The molecule is a nutrient that impacts cardiovascular disease. | CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCC | |
Can you create a molecule that matches the given characteristics? The molecule is a fat storage and a nutrient that impacts atherosclerosis, pancreatitis, and cardiovascular disease. The molecule is thyroxine treatment and it impacts metabolic syndrome. | CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCC | |
Build a molecule that meets the requirement: The molecule is a inflammatory that impacts pancreatitis, atherosclerosis, and obesity. The molecule is a membrane stabilizer and a fat storage, with effects on cancer and impacts on metabolic syndrome. The molecule is a energy source, a energy storage, and a nutrient, it impacts cardiovascular disease and is thyroxine treatment. | CCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCC(C)C | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a inflammatory, a energy source, and a energy storage, and it impacts cardiovascular disease. The molecule is a fat storage and a nutrient, has an effect on cancer, impacts obesity, and is thyroxine treatment. The molecule is a membrane stabilizer that impacts metabolic syndrome, atherosclerosis, and pancreatitis. | CCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCC(C)C | |
Suppose there is a molecule that meets the following description: The molecule is a energy storage, a membrane stabilizer, and a energy source, and it impacts pancreatitis. The molecule is a inflammatory and belongs to the thyroxine treatment class of molecules, impacting both atherosclerosis and cancer. The molecule is a nutrient and a fat storage that impacts cardiovascular disease, obesity, and metabolic syndrome. Please write the SMILES representation of it. | CCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCC(C)C | |
Conceptualize a molecule that meets the specified attribute(s): The molecule is a energy storage and a membrane stabilizer that impacts cardiovascular disease, pancreatitis, and obesity. The molecule is a inflammatory, nutrient, and fat storage that has an effect on cancer and impacts both thyroxine treatment and atherosclerosis. The molecule is a energy source that impacts metabolic syndrome. | CCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCC(C)C | |
Build a molecule that meets the requirement: The molecule is a energy storage, nutrient, membrane stabilizer that has an effect on cancer and impacts atherosclerosis. The molecule is a inflammatory and fat storage, belonging to the thyroxine treatment class of molecules, and impacts pancreatitis. The molecule is a energy source that impacts obesity, metabolic syndrome, and cardiovascular disease. | CCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCC(C)C | |
Could you please return a molecule that adheres to this description? The molecule is a apoptosis that impacts aging, non-alcoholic fatty liver disease, and diabetic heart disease. The molecule is a stabilizing mitochondrial structure, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, cholesterol translocation that impacts tangier disease. It impacts barth syndrome. | CCC=CCC=CCC=CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC | |
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a stabilizing cytochrome oxidase and cholesterol translocation, and it impacts barth syndrome. The molecule is a apoptosis that impacts non-alcoholic fatty liver disease, diabetic heart disease, and aging. The molecule is a stabilizing mitochondrial structure and proton trap for oxidative phosphorylation, and it impacts tangier disease. | CCC=CCC=CCC=CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC | |
Conceptualize a molecule that meets the specified attribute(s): The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, apoptosis that impacts tangier disease and aging. The molecule is a stabilizing mitochondrial structure and a cholesterol translocation that impacts diabetic heart disease, non-alcoholic fatty liver disease, and barth syndrome. | CCC=CCC=CCC=CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC | |
I need a molecule that meets the following conditions: It impacts both barth syndrome and aging. The molecule is a stabilizing cytochrome oxidase and a cholesterol translocation, impacting both tangier disease and diabetic heart disease. The molecule is a apoptosis, a proton trap for oxidative phosphorylation, and a stabilizing mitochondrial structure, and it impacts non-alcoholic fatty liver disease. Please represent the molecule in SMILES. | CCC=CCC=CCC=CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC | |
Generate a molecule that fulfills the requirement: The molecule is a apoptosis and a proton trap for oxidative phosphorylation, impacting both non-alcoholic fatty liver disease and barth syndrome. The molecule is a cholesterol translocation, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts diabetic heart disease, aging, and tangier disease. | CCC=CCC=CCC=CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC | |
Could you please return a molecule that adheres to this description? The molecule is a proton trap for oxidative phosphorylation and a stabilizing cytochrome oxidase that impacts diabetic heart disease, barth syndrome, and aging. The molecule is a stabilizing mitochondrial structure, cholesterol translocation, apoptosis that impacts non-alcoholic fatty liver disease and tangier disease. | CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC(C)C | |
Generate a molecule that fulfills the requirement: The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, cholesterol translocation that impacts non-alcoholic fatty liver disease, diabetic heart disease, and tangier disease. The molecule is a apoptosis and a proton trap for oxidative phosphorylation, impacting both aging and barth syndrome. | CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC(C)C | |
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a cholesterol translocation, stabilizing cytochrome oxidase, apoptosis that impacts tangier disease, non-alcoholic fatty liver disease, and diabetic heart disease. The molecule is a stabilizing mitochondrial structure and a proton trap for oxidative phosphorylation, impacting both aging and barth syndrome. | CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC(C)C | |
Give me a molecule that satisfies the conditions outlined in the description: It impacts both diabetic heart disease and tangier disease. The molecule is a apoptosis, a stabilizing mitochondrial structure, and a stabilizing cytochrome oxidase, and it impacts non-alcoholic fatty liver disease. The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation, impacting both barth syndrome and aging. | CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC(C)C | |
I need a molecule that meets the following conditions: The molecule is a stabilizing mitochondrial structure, a proton trap for oxidative phosphorylation, and a cholesterol translocation, and it impacts tangier disease. The molecule is a stabilizing cytochrome oxidase that impacts barth syndrome, non-alcoholic fatty liver disease, and aging. The molecule is a apoptosis that impacts diabetic heart disease. Please represent the molecule in SMILES. | CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC(C)C | |
Conceptualize a molecule that meets the specified attribute(s): It has an effect on breast cancer. The molecule is a nutrient that affects cervical cancer by impacting both ulcerative colitis and atherosclerosis. | CCC=CCC=CCC=CCC=CCC=CC=CC(O)CCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC | |
Build a molecule that meets the requirement: It impacts ulcerative colitis, cervical cancer, and breast cancer. The molecule is a nutrient that impacts atherosclerosis. | CCC=CCC=CCC=CCC=CCC=CC=CC(O)CCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC | |
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a nutrient that affects cervical cancer by impacting breast cancer, atherosclerosis, and ulcerative colitis. | CCC=CCC=CCC=CCC=CCC=CC=CC(O)CCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC | |
Build a molecule that meets the requirement: The molecule is a nutrient that affects both cervical cancer and breast cancer, and also impacts atherosclerosis and ulcerative colitis. | CCC=CCC=CCC=CCC=CCC=CC=CC(O)CCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC | |
Generate a molecule that fulfills the requirement: It impacts cervical cancer. The molecule is a nutrient that impacts ulcerative colitis, atherosclerosis, and breast cancer. | CCC=CCC=CCC=CCC=CCC=CC=CC(O)CCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC | |
Conceptualize a molecule that meets the specified attribute(s): The molecule is a factor xa inhibitor and belongs to the anti thrombotic class of molecules. | NCC(C(=O)Nc1ccc(N2CCOCC2=O)cc1OC(F)F)N(CC(F)F)CC1CC1 | |
The molecule is a factor xa inhibitor and is anti thrombotic. Use the above information to create a molecule. | NCC(C(=O)Nc1ccc(N2CCOCC2=O)cc1OC(F)F)N(CC(F)F)CC1CC1 | |
Build a molecule that meets the requirement: The molecule is a factor xa inhibitor and is anti thrombotic. | NCC(C(=O)Nc1ccc(N2CCOCC2=O)cc1OC(F)F)N(CC(F)F)CC1CC1 | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is both a factor xa inhibitor and a anti thrombotic. | NCC(C(=O)Nc1ccc(N2CCOCC2=O)cc1OC(F)F)N(CC(F)F)CC1CC1 | |
Can you create a molecule that matches the given characteristics? The molecule is both a anti thrombotic and a factor xa inhibitor. | NCC(C(=O)Nc1ccc(N2CCOCC2=O)cc1OC(F)F)N(CC(F)F)CC1CC1 | |
Generate a molecule based on this description: It impacts both tangier disease and aging. The molecule is a apoptosis, a stabilizing mitochondrial structure, and a proton trap for oxidative phosphorylation, and it impacts diabetic heart disease. The molecule is a cholesterol translocation and a stabilizing cytochrome oxidase, impacting both non-alcoholic fatty liver disease and barth syndrome. | CCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC(C)C | |
Come up with a molecule based on the description: The molecule is a apoptosis, proton trap for oxidative phosphorylation, cholesterol translocation that impacts diabetic heart disease and aging. The molecule is a stabilizing mitochondrial structure and a stabilizing cytochrome oxidase that impacts tangier disease, non-alcoholic fatty liver disease, and barth syndrome. | CCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC(C)C | |
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a stabilizing mitochondrial structure and cholesterol translocation, and it impacts diabetic heart disease. The molecule is a apoptosis that impacts both non-alcoholic fatty liver disease and tangier disease. The molecule is a proton trap for oxidative phosphorylation and a stabilizing cytochrome oxidase, impacting both barth syndrome and aging. | CCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC(C)C | |
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a proton trap for oxidative phosphorylation and a stabilizing cytochrome oxidase, impacting both barth syndrome and aging. The molecule is a stabilizing mitochondrial structure and a apoptosis, impacting both non-alcoholic fatty liver disease and diabetic heart disease. The molecule is a cholesterol translocation that impacts tangier disease. | CCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC(C)C | |
Conceptualize a molecule that meets the specified attribute(s): The molecule is a proton trap for oxidative phosphorylation and a apoptosis, impacting both tangier disease and aging. The molecule is a stabilizing cytochrome oxidase, a cholesterol translocation, and a stabilizing mitochondrial structure, and it impacts non-alcoholic fatty liver disease. It impacts both diabetic heart disease and barth syndrome. | CCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC(C)C |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.