instruction
stringlengths 84
477
| input
stringclasses 1
value | output
stringlengths 11
209
|
---|---|---|
CC(C)(C)OC(=O)N1CCNCC1.Cn1c(=O)[nH]c(=O)c2c1nc(Cl)n2-c1ccccc1Cl.CCOC(C)=O Based on the reactants and reagents given above, suggest a possible product. | A possible product can be Cn1c(=O)[nH]c(=O)c2c1nc(N1CCN(C(=O)OC(C)(C)C)CC1)n2-c1ccccc1Cl . |
|
Cc1cccc2scc(Cn3c(=O)n(C(C)C(=O)OC(C)(C)C)c4ccccc43)c12.ClCCl.O=C(O)C(F)(F)F Based on the reactants and reagents given above, suggest a possible product. | A possible product can be Cc1cccc2scc(Cn3c(=O)n(C(C)C(=O)O)c4ccccc43)c12 . |
|
Predict the product of a chemical reaction with CO.Cc1ccc(-c2nc3ccc(C)cn3c2CC(=O)O)cc1.O=S(Cl)Cl as the reactants and reagents. | COC(=O)Cc1c(-c2ccc(C)cc2)nc2ccc(C)cn12 . |
|
Can you tell me the potential product of a chemical reaction that uses CC(=O)c1ccc2cc(N3CCNCC3)ccc2c1.CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.CCCC[N+](CCCC)(CCCC)CCCC.CO.Cc1ccccc1.ClCCl.O.O=C([O-])OC(=O)[O-].O=S(=O)([O-])O.[Na+].[OH-] as the reactants and reagents? | Sure. A potential product: CC(=O)c1ccc2cc(N3CCN(C(=O)OC(C)(C)C)CC3)ccc2c1 . |
|
CC(C)(C)OC(=O)N1CCc2cccc(Oc3ccc(C(N)=O)cn3)c2C1.ClCCl.O=C(O)C(F)(F)F Given the above reactants and reagents, what could be a probable product of their reaction? | A probable product could be NC(=O)c1ccc(Oc2cccc3c2CNCC3)nc1 . |
|
Predict a possible product from the listed reactants and reagents. CC(C)(C)OC(=O)NCCC=O.CCC(N)c1nc2onc(C(F)(F)F)c2c(=O)n1Cc1ccccc1.CC(=O)O[BH-](OC(C)=O)OC(C)=O.CO.O.[Na+] | CCC(NCCCNC(=O)OC(C)(C)C)c1nc2onc(C(F)(F)F)c2c(=O)n1Cc1ccccc1 . |
|
Consider that for a chemical reaction, if COC(=O)C(Cc1ccc2nc(-c3c(Cl)cccc3Cl)ccc2c1)NC(=O)c1c(Cl)cncc1Cl.C1CCOC1.[Na+].[OH-] is/are the reactants and reagents, what can be the product? | O=C(NC(Cc1ccc2nc(-c3c(Cl)cccc3Cl)ccc2c1)C(=O)O)c1c(Cl)cncc1Cl . |
|
Can you tell me the potential product of a chemical reaction that uses CCCc1c(O)ccc(C(C)=O)c1O.OCCCBr.CN(C)C=O.O=C([O-])[O-].[K+].[K+] as the reactants and reagents? | Sure. A potential product: CCCc1c(OCCCO)ccc(C(C)=O)c1O . |
|
O=[N+]([O-])c1ccc(F)cc1OCc1ccccc1.CC(=O)O.CCOC(C)=O.[Fe] Given the above reactants and reagents, what could be a probable product of their reaction? | A probable product could be Nc1ccc(F)cc1OCc1ccccc1 . |
|
Based on the given reactants and reagents: C1=COCCC1.OCCSc1ccccc1-c1nnc2ccc(F)cn12.Cc1ccc(S(=O)(=O)O)cc1.ClCCl, what product could potentially be produced? | The product can be Fc1ccc2nnc(-c3ccccc3SCCOC3CCCCO3)n2c1 . |
|
Predict the product of a chemical reaction with CC(C)(C)OC(=O)Nc1cccc(-c2cc(=O)cc(N3CCOCC3)o2)c1.ClCCl.O=C(O)C(F)(F)F as the reactants and reagents. | Nc1cccc(-c2cc(=O)cc(N3CCOCC3)o2)c1 . |
|
Consider that for a chemical reaction, if OCCN1CCN(CC2CN(Cc3ccccc3)CCO2)CC1.CCO.[OH-].[OH-].[Pd+2] is/are the reactants and reagents, what can be the product? | OCCN1CCN(CC2CNCCO2)CC1 . |
|
Using CCc1sc(C(=O)OC)cc1-c1c(C)cnn1C.C1CCOC1.[Na+].[OH-] as the reactants and reagents, tell me the potential product. | CCc1sc(C(=O)O)cc1-c1c(C)cnn1C . |
|
Based on the given reactants and reagents: OC(c1ccc(F)cc1)c1ccc(F)cc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C([O-])[O-].[K+].[K+].[Pd], what product could potentially be produced? | The product can be O=C(c1ccc(F)cc1)c1ccc(F)cc1 . |
|
Using COCC#Cc1cc(Cl)c(N)c2c1OCO2.COc1cc2c(Cl)ncnc2cc1OCCCN1CCN(C)CC1.C1CCOC1.CN(C)C=O.C[Si](C)(C)[N-][Si](C)(C)C.[Cl-].[NH4+].[Na+] as the reactants and reagents, tell me the potential product. | COCC#Cc1cc(Cl)c(Nc2ncnc3cc(OCCCN4CCN(C)CC4)c(OC)cc23)c2c1OCO2 . |
|
COc1cc2ncnc(Oc3ccc(N)c([N+](=O)[O-])c3)c2cc1OC.NC1CCN(Cc2ccccc2)CC1.O=C(OC(Cl)(Cl)Cl)OC(Cl)(Cl)Cl.CCN(CC)CC.ClC(Cl)Cl.O Based on the reactants and reagents given above, suggest a possible product. | A possible product can be COc1cc2ncnc(Oc3ccc(NC(=O)NC4CCN(Cc5ccccc5)CC4)c([N+](=O)[O-])c3)c2cc1OC . |
|
CC(=O)c1ccc(O)c(C)c1O.N#Cc1cncc(Sc2cccc(CO)c2)c1.C1CCOC1.CC(C)OC(=O)N=NC(=O)OC(C)C.c1ccc(P(c2ccccc2)c2ccccc2)cc1 Based on the reactants and reagents given above, suggest a possible product. | A possible product can be CC(=O)c1ccc(OCc2cccc(Sc3cncc(C#N)c3)c2)c(C)c1O . |
|
Propose a potential product given these reactants and reagents. COc1cc2nccc(Cl)c2cc1OC.Oc1cccc(O)c1.[K+].[OH-] | COc1cc2nccc(Oc3cccc(O)c3)c2cc1OC . |
|
Predict the product of a chemical reaction with COc1ccc(-c2nn(C(C)C)c3c(C)cccc23)cc1.BrB(Br)Br.C1=CCCCC1 as the reactants and reagents. | Cc1cccc2c(-c3ccc(O)cc3)nn(C(C)C)c12 . |
|
Consider that for a chemical reaction, if CCOC(=O)N1CCN(c2nn(-c3ccc(F)cc3)c3ccccc23)CC1.COC(C)O.O.[K+].[OH-] is/are the reactants and reagents, what can be the product? | Fc1ccc(-n2nc(N3CCNCC3)c3ccccc32)cc1 . |
|
COC(=O)C=Cc1ccc(O)c(OC)c1.OCCCCCCCCCl.C1CCOC1.CCOC(=O)N=NC(=O)OCC.Cc1ccccc1.c1ccc(P(c2ccccc2)c2ccccc2)cc1 Considering the given starting materials, what might be the resulting product in a chemical reaction? | COC(=O)C=Cc1ccc(OCCCCCCCCCl)c(OC)c1 . |
|
Based on the given reactants and reagents: COn1c(=O)c(-c2ccc([N+](=O)[O-])cc2Cl)cc2cnc(NCCN(C)C)nc21.CCO.Cl.[Fe], what product could potentially be produced? | The product can be COn1c(=O)c(-c2ccc(N)cc2Cl)cc2cnc(NCCN(C)C)nc21 . |
|
CCCn1nc2ccc(Br)cc2c1C.O=c1cc(OCc2ccc(Cl)cc2)cc[nH]1.C1COCCO1.CNC1CCCCC1NC.O=C([O-])[O-].[Cu]I.[K+].[K+] Considering the given starting materials, what might be the resulting product in a chemical reaction? | CCCn1nc2ccc(-n3ccc(OCc4ccc(Cl)cc4)cc3=O)cc2c1C . |
|
Please provide a feasible product that could be formed using these reactants and reagents: COc1ccc(C)c(F)c1.BrB(Br)Br.ClCCl . | Cc1ccc(O)cc1F . |
|
Given the following reactants and reagents, please provide a possible product. CCOC(=O)CC(CCCO[Si](C)(C)C(C)(C)C)C(C)=CCc1c(OC)c(C)c2c(c1O[Si](C)(C)C(C)(C)C)C(=O)OC2.CC#N | CCOC(=O)CC(CCCO)C(C)=CCc1c(OC)c(C)c2c(c1O[Si](C)(C)C(C)(C)C)C(=O)OC2 . |
|
Can you tell me the potential product of a chemical reaction that uses Cn1nc(-c2cnc3c(n2)c(C(=O)NC(C(=O)N2CCC(C#N)CC2)C2CC2)cn3COCC[Si](C)(C)C)c2cc(Cl)c(Cl)cc21.ClCCl.NCCN.O=C(O)C(F)(F)F as the reactants and reagents? | Sure. A potential product: Cn1nc(-c2cnc3[nH]cc(C(=O)NC(C(=O)N4CCC(C#N)CC4)C4CC4)c3n2)c2cc(Cl)c(Cl)cc21 . |
|
Given the following reactants and reagents, please provide a possible product. CCOC(=O)C1=Cc2ccc(F)c(C)c2OC1C(F)(F)F.Oc1ccccc1.CN(C)C=O.O=C([O-])[O-].[K+].[K+] | CCOC(=O)C1=Cc2ccc(Oc3ccccc3)c(C)c2OC1C(F)(F)F . |
|
Given the following reactants and reagents, please provide a possible product. CC(C)(C)[Si](C)(C)OS(=O)(=O)C(F)(F)F.[N-]=[N+]=NC1CCc2cc(-c3noc(-c4onc(-c5ccccc5)c4C(F)(F)F)n3)ccc2C1O.Cc1cccc(C)n1.ClCCl | CC(C)(C)[Si](C)(C)OC1c2ccc(-c3noc(-c4onc(-c5ccccc5)c4C(F)(F)F)n3)cc2CCC1N=[N+]=[N-] . |
|
Using CC(C)(C)OC(=O)NCc1cccc(Oc2cc(Cl)ccc2N(Cc2ccc(O)cc2)C(=O)CCC(=O)O)c1.NCc1ccccc1F.CCN(CC)CC.CCOP(=O)(C#N)OCC.CN(C)C=O.O as the reactants and reagents, tell me the potential product. | CC(C)(C)OC(=O)NCc1cccc(Oc2cc(Cl)ccc2N(Cc2ccc(O)cc2)C(=O)CCC(=O)NCc2ccccc2F)c1 . |
|
CN.Clc1ncc(Cl)c(Cl)n1.CO Given the above reactants and reagents, what could be a probable product of their reaction? | A probable product could be CNc1nc(Cl)ncc1Cl . |
|
COc1cc2c(nc1OC)c(-c1cc3c(CNCc4ccc(N5CCOCC5)cc4)ccnc3n1S(=O)(=O)c1ccc(C)cc1)cn2C.[K+].[OH-] Given the above reactants and reagents, what could be a probable product of their reaction? | A probable product could be COc1cc2c(nc1OC)c(-c1cc3c(CNCc4ccc(N5CCOCC5)cc4)ccnc3[nH]1)cn2C . |
|
Using CCOc1c(F)cc(-c2nc3ccc(OCC(C)NC(C)=O)cc3o2)cc1C(C)=O.C1CCOC1.CCOC(C)=O.CO.[BH4-].[Cl-].[NH4+].[Na+] as the reactants and reagents, tell me the potential product. | CCOc1c(F)cc(-c2nc3ccc(OCC(C)NC(C)=O)cc3o2)cc1C(C)O . |
|
Predict a possible product from the listed reactants and reagents. O=[N+]([O-])CC12CCCN1CCC2.CCO.Cl.[Fe] | NCC12CCCN1CCC2 . |
|
Using COc1ccc(CN2CCc3c(Cl)nc(Cl)nc32)cc1.Nc1ccc(N2CCOCC2)c2c1OCCO2.CC(C)(C)[O-].O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Na+].[Pd].[Pd] as the reactants and reagents, tell me the potential product. | COc1ccc(CN2CCc3c(Cl)nc(Nc4ccc(N5CCOCC5)c5c4OCCO5)nc32)cc1 . |
|
Predict the product of a chemical reaction with CI.O=c1cc(I)cc[nH]1.CCOC(C)=O.CN(C)C=O.O.O=C([O-])[O-].[K+].[K+] as the reactants and reagents. | Cn1ccc(I)cc1=O . |
|
Given the following reactants and reagents, please provide a possible product. CC(=O)NCCCC(O)c1ccccc1.ClCCl.O=[Cr](=O)([O-])Cl.c1cc[nH+]cc1 | CC(=O)NCCCC(=O)c1ccccc1 . |
|
CCN(CC)c1ccc(C(O)C#Cc2ccc(C(=O)OC)c(O)c2)cc1C(C)(C)C.C1CCOC1.CO.Cl.[Cl-].[NH4+] Considering the given starting materials, what might be the resulting product in a chemical reaction? | CCN(CC)c1ccc(C(O)C#Cc2ccc(C(=O)O)c(O)c2)cc1C(C)(C)C . |
|
Consider that for a chemical reaction, if NCC1CN(c2ccc(N3CCOCC3=O)cc2)C(=O)O1.O=C(O)c1ccc(Cl)s1.CS(=O)(=O)Cl.ClCCl.Cn1ccnc1.O is/are the reactants and reagents, what can be the product? | O=C(NCC1CN(c2ccc(N3CCOCC3=O)cc2)C(=O)O1)c1ccc(Cl)s1 . |
|
A chemical reaction has started with the substance(s) CC(c1c(O)ccc2c1OC(=Cc1n[nH]c3ccccc13)C2=O)N1CCN(C(=O)OC(C)(C)C)CC1.C1COCCO1.Cl.ClCCl as the reactants and reagents, what could be a probable product? | A probable product: CC(c1c(O)ccc2c1OC(=Cc1n[nH]c3ccccc13)C2=O)N1CCNCC1 . |
|
Predict a possible product from the listed reactants and reagents. COC(=O)c1c(C)nc2[nH]ccc2c1-c1ccc(C)cc1.Fc1cc(Cl)ccc1CBr.CCOC(C)=O.CN(C)C=O.O=C([O-])[O-].[Cl-].[Cs+].[Cs+].[NH4+] | COC(=O)c1c(C)nc2c(ccn2Cc2ccc(Cl)cc2F)c1-c1ccc(C)cc1 . |
|
Predict the product of a chemical reaction with C=CCBr.Oc1ccc2c(c1)CC(CCc1ccccc1)O2.CC(C)=O.CCCCCC.O=C([O-])[O-].[K+].[K+] as the reactants and reagents. | C=CCOc1ccc2c(c1)CC(CCc1ccccc1)O2 . |
|
COc1ccc(CSc2nc(C)cc(O)n2)c(Cl)c1.BrB(Br)Br.ClCCl.O Based on the reactants and reagents given above, suggest a possible product. | A possible product can be Cc1cc(O)nc(SCc2ccc(O)cc2Cl)n1 . |
|
CCN(CC)C(=O)COc1cccc2c(CC(C)N3C(=O)c4ccccc4C3=O)c[nH]c12.CCO.NN.O Considering the given starting materials, what might be the resulting product in a chemical reaction? | CCN(CC)C(=O)COc1cccc2c(CC(C)N)c[nH]c12 . |
|
CNC.N#Cc1ccccc1S(=O)(=O)Cl.CCN(CC)CC.CCOC(C)=O Given the above reactants and reagents, what could be a probable product of their reaction? | A probable product could be CN(C)S(=O)(=O)c1ccccc1C#N . |
|
C#Cc1ccc(N)nc1N.ON=C(Cl)Cc1ccc(OCc2ccccc2)nc1.C1CCOC1.CCN(CC)CC Based on the reactants and reagents given above, suggest a possible product. | A possible product can be Nc1ccc(-c2cc(Cc3ccc(OCc4ccccc4)nc3)no2)c(N)n1 . |
|
Consider that for a chemical reaction, if O=C1Nc2ccc(Br)c3c2C1(CCCCBr)CCC3.c1ccc2c3c([nH]c2c1)CNCC3.CN(C)C=O.O=C([O-])[O-].[K+].[K+] is/are the reactants and reagents, what can be the product? | O=C1Nc2ccc(Br)c3c2C1(CCCCN1CCc2c([nH]c4ccccc24)C1)CCC3 . |
|
CN(C)CCCl.O=C(c1ccccc1O)C(F)(F)F.CCOCC.Cc1ccccc1.Cl.O Given the above reactants and reagents, what could be a probable product of their reaction? | A probable product could be CN(C)CCOc1ccccc1C(=O)C(F)(F)F . |
|
Based on the given reactants and reagents: CCOC(=O)CBr.Oc1cccc2c1CCCC(N(Cc1ccccc1)CC(O)COc1ccccc1)C2.CN(C)C=O.O.[H-].[Na+], what product could potentially be produced? | The product can be CCOC(=O)COc1cccc2c1CCCC(N(Cc1ccccc1)CC(O)COc1ccccc1)C2 . |
|
Predict the product of a chemical reaction with O=C(O)c1ccc(I)cc1.OB(O)c1ccc(Cl)cc1.CCCCO.Cc1ccccc1.O.O=C([O-])[O-].[Cs+].[Cs+] as the reactants and reagents. | O=C(O)c1ccc(-c2ccc(Cl)cc2)cc1 . |
|
O=C(O)c1c(F)ccc([N+](=O)[O-])c1F.C.CO.[H][H].[Pd] Given the above reactants and reagents, what could be a probable product of their reaction? | A probable product could be Nc1ccc(F)c(C(=O)O)c1F . |
|
Predict the product of a chemical reaction with CCCN(CCC)C(=O)c1cccc(C(=O)NC(Cc2ccccc2)C(O)([PH2]=O)C(CC(=O)OC)C(=O)Nc2ccccc2)c1.CO.[Na+].[OH-] as the reactants and reagents. | CCCN(CCC)C(=O)c1cccc(C(=O)NC(Cc2ccccc2)C(O)([PH2]=O)C(CC(=O)O)C(=O)Nc2ccccc2)c1 . |
|
Consider that for a chemical reaction, if COc1ccc(CCl)cc1.Oc1cc(I)ccc1Cl.CCCCC.CCOCC.CN(C)C=O.O.O=C([O-])[O-].[K+].[K+] is/are the reactants and reagents, what can be the product? | COc1ccc(COc2cc(I)ccc2Cl)cc1 . |
|
Predict a possible product from the listed reactants and reagents. COC(=O)c1ccc(C(=O)C(CC(=O)c2ccc(C(C)(C)C)cc2)c2ccc(OC(F)(F)F)cc2)cc1.CCO.[Na+].[OH-] | CC(C)(C)c1ccc(C(=O)CC(C(=O)c2ccc(C(=O)O)cc2)c2ccc(OC(F)(F)F)cc2)cc1 . |
|
CCOC(=O)c1cc2c(C(=O)Nc3c(Cl)cncc3Cl)ccc(OC)c2o1.CO.Cl.[Na+].[OH-] Given the above reactants and reagents, what could be a probable product of their reaction? | A probable product could be COc1ccc(C(=O)Nc2c(Cl)cncc2Cl)c2cc(C(=O)O)oc12 . |
|
Can you tell me the potential product of a chemical reaction that uses C[Si](C)(C)C#Cc1ccc2cnccc2c1.CCOC(C)=O.CO.O.O=C([O-])[O-].[K+].[K+] as the reactants and reagents? | Sure. A potential product: C#Cc1ccc2cnccc2c1 . |
|
Given the following reactants and reagents, please provide a possible product. CC1COC2Cn3cc(C(=O)NCc4ccc(F)cc4F)c(=O)c(OCc4ccccc4)c3C(=O)N12.CO.[Pd] | CC1COC2Cn3cc(C(=O)NCc4ccc(F)cc4F)c(=O)c(O)c3C(=O)N12 . |
|
Can you tell me the potential product of a chemical reaction that uses C#Cc1cccnc1N.CCCCOc1ccc(CC(Cl)=NO)cc1.C1CCOC1.CCN(CC)CC.O as the reactants and reagents? | Sure. A potential product: CCCCOc1ccc(Cc2cc(-c3cccnc3N)on2)cc1 . |
|
Based on the given reactants and reagents: CN(C)CCNc1cc2[nH]c(-c3nn(C4CCCCO4)cc3[N+](=O)[O-])nc2cc1F.CO.[H][H].[Pd], what product could potentially be produced? | The product can be CN(C)CCNc1cc2[nH]c(-c3nn(C4CCCCO4)cc3N)nc2cc1F . |
|
Using COc1cc(CN(Cc2ccccc2)C(=O)OC(C)(C)C)ccc1[N+](=O)[O-].CO.[Cl-].[NH4+].[Zn] as the reactants and reagents, tell me the potential product. | COc1cc(CN(Cc2ccccc2)C(=O)OC(C)(C)C)ccc1N . |
|
Can you tell me the potential product of a chemical reaction that uses CC(COC(F)F)NC(=O)c1cn(COCC[Si](C)(C)C)c2ncc(-c3nn(C)c4cc(F)ccc34)nc12.ClCCl.NCCN.O=C(O)C(F)(F)F as the reactants and reagents? | Sure. A potential product: CC(COC(F)F)NC(=O)c1c[nH]c2ncc(-c3nn(C)c4cc(F)ccc34)nc12 . |
|
A chemical reaction has started with the substance(s) CC(=O)c1cccc(B(O)O)c1.Oc1ccc(I)cc1.CC(=O)[O-].CC(=O)[O-].CN(C)C=O.ClCCl.O=C([O-])[O-].[Na+].[Na+].[Pd+2] as the reactants and reagents, what could be a probable product? | A probable product: CC(=O)c1cccc(-c2ccc(O)cc2)c1 . |
|
Predict a possible product from the listed reactants and reagents. COC(=O)C=Cc1cc(C(=O)OC)ccc1NC(=O)NC(=O)c1cc(F)c(F)cc1Cl.C1CCOC1.Cl.O.[Li+].[OH-] | COC(=O)C=Cc1cc(C(=O)O)ccc1NC(=O)NC(=O)c1cc(F)c(F)cc1Cl . |
|
Using CC(=O)OC(C)=O.O=C(OCC1CC(O)C(n2cc(F)c(=O)[nH]c2=O)O1)c1ccccc1.CCO.c1ccncc1 as the reactants and reagents, tell me the potential product. | CC(=O)OC1CC(COC(=O)c2ccccc2)OC1n1cc(F)c(=O)[nH]c1=O . |
|
Predict a possible product from the listed reactants and reagents. COc1ccc(C(=O)O)cc1OC.Nc1cc(NC(=O)c2ccccc2)ccc1Cl.Cl.O=P(Cl)(Cl)Cl.c1ccncc1 | COc1ccc(C(=O)Nc2cc(NC(=O)c3ccccc3)ccc2Cl)cc1OC . |
|
Using CCCCCCCNCCCCCSc1nc(-c2ccccc2)c(-c2ccccc2)[nH]1.CCCN=C=O.CCCCCC as the reactants and reagents, tell me the potential product. | CCCCCCCN(CCCCCSc1nc(-c2ccccc2)c(-c2ccccc2)[nH]1)C(=O)NCCC . |
|
Consider that for a chemical reaction, if CCOCCCN(Cc1ccc(C(C)C)cc1)C(=O)CCc1ccc(OCc2ccccc2C(=O)OC)cc1.C1CCOC1.CCOC(C)=O.O.[Li+].[OH-] is/are the reactants and reagents, what can be the product? | CCOCCCN(Cc1ccc(C(C)C)cc1)C(=O)CCc1ccc(OCc2ccccc2C(=O)O)cc1 . |
|
Propose a potential product given these reactants and reagents. CCCCS(=O)(=O)Oc1ccc(CCCc2ccc(CCC(=O)OC)cc2OCC2CC2)cc1OC.C1CCOC1.CC(=O)O.CO.O.O.O.[Li+].[OH-] | CCCCS(=O)(=O)Oc1ccc(CCCc2ccc(CCC(=O)O)cc2OCC2CC2)cc1OC . |
|
Given the following reactants and reagents, please provide a possible product. CCCCCCCCCCCCCCCCS(=O)(=O)Cl.Nc1cccc2ccc(O)cc12.c1ccncc1 | CCCCCCCCCCCCCCCCS(=O)(=O)Nc1cccc2ccc(O)cc12 . |
|
A chemical reaction has started with the substance(s) CC1(C)CCCNc2cc([N+](=O)[O-])ccc21.O=C(Cl)CN1C(=O)c2ccccc2C1=O.CN(C)c1ccncc1.ClCCCl.c1ccncc1 as the reactants and reagents, what could be a probable product? | A probable product: CC1(C)CCCN(C(=O)CN2C(=O)c3ccccc3C2=O)c2cc([N+](=O)[O-])ccc21 . |
|
Predict the product of a chemical reaction with CS(=O)(=O)Cl.Fc1ccc(-c2nc(C3CCNCC3)co2)cc1.CCN(C(C)C)C(C)C.ClCCl.O as the reactants and reagents. | CS(=O)(=O)N1CCC(c2coc(-c3ccc(F)cc3)n2)CC1 . |
|
Using CC(C)n1ncnc1-c1nc2c(s1)CCOc1cc(C3CN(C(=O)C(C)(C)NC(=O)OC(C)(C)C)C3)ccc1-2.ClCCl.O=C(O)C(F)(F)F as the reactants and reagents, tell me the potential product. | CC(C)n1ncnc1-c1nc2c(s1)CCOc1cc(C3CN(C(=O)C(C)(C)N)C3)ccc1-2 . |
|
Please provide a feasible product that could be formed using these reactants and reagents: Nc1ccc(Br)c(F)c1C(=O)O.B.C1CCOC1.C1CCOC1 . | Nc1ccc(Br)c(F)c1CO . |
|
Can you tell me the potential product of a chemical reaction that uses CCOC(=O)C1CCN(c2ccc([N+](=O)[O-])c(NCc3ccccc3)c2)CC1.C1CCOC1.O.[Li+].[OH-] as the reactants and reagents? | Sure. A potential product: O=C(O)C1CCN(c2ccc([N+](=O)[O-])c(NCc3ccccc3)c2)CC1 . |
|
Propose a potential product given these reactants and reagents. BrC(Br)(Br)Br.CCCCN(C)C(=O)COCCCO.c1ccc(P(c2ccccc2)c2ccccc2)cc1 | CCCCN(C)C(=O)COCCCBr . |
|
A chemical reaction has started with the substance(s) CC1(C)OB(B2OC(C)(C)C(C)(C)O2)OC1(C)C.Cc1ccc(S(=O)(=O)n2nccc2-c2cn(S(=O)(=O)c3ccc(C)cc3)c3ncc(Br)cc23)cc1.CC(=O)[O-].CN(C)C=O.ClCCl.Cl[Pd]Cl.[Fe+2].[Na+].c1ccc(P(c2ccccc2)[c-]2cccc2)cc1.c1ccc(P(c2ccccc2)[c-]2cccc2)cc1 as the reactants and reagents, what could be a probable product? | A probable product: Cc1ccc(S(=O)(=O)n2nccc2-c2cn(S(=O)(=O)c3ccc(C)cc3)c3ncc(B4OC(C)(C)C(C)(C)O4)cc23)cc1 . |
|
Predict a possible product from the listed reactants and reagents. O=C(Cl)OCc1ccccc1.O=C(O)C1(O)CNC1.Cl.O.[Na+].[OH-] | O=C(OCc1ccccc1)N1CC(O)(C(=O)O)C1 . |
|
Consider that for a chemical reaction, if Cc1nc(Cl)c([N+](=O)[O-])c(NCCCCCO)c1C.Oc1ccccc1.C1CCOC1.O.[H-].[Na+] is/are the reactants and reagents, what can be the product? | Cc1nc(Oc2ccccc2)c([N+](=O)[O-])c(NCCCCCO)c1C . |
|
Please provide a feasible product that could be formed using these reactants and reagents: Cc1cccc(-c2nc(C3CCNCC3)n[nH]2)n1.O=Cc1ccc(-c2nc3nccn3cc2-c2ccccc2F)cc1.CC(=O)O.CC(=O)O[BH-](OC(C)=O)OC(C)=O.CCN(CC)CC.CN1CCCC1=O.O=C([O-])O.[Na+].[Na+] . | Cc1cccc(-c2nc(C3CCN(Cc4ccc(-c5nc6nccn6cc5-c5ccccc5F)cc4)CC3)n[nH]2)n1 . |
|
A chemical reaction has started with the substance(s) CC(C)CC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O.CCC(N)B1OC(C)(C)C(C)(CCC(C)CC(=O)OC(C)(C)C)O1.CC(C)COC(=O)Cl.CN1CCOCC1.ClCCl as the reactants and reagents, what could be a probable product? | A probable product: CCC(NC(=O)C(CC(C)C)NC(=O)OCC1c2ccccc2-c2ccccc21)B1OC(C)(C)C(C)(CCC(C)CC(=O)OC(C)(C)C)O1 . |
|
Consider that for a chemical reaction, if CC(C)(C)OC(=O)NN1CCC(CO)CC1.CSc1nc(Cl)cc(-n2c(C(F)F)nc3ccccc32)n1.CC(=O)N(C)C.O.O=C([O-])[O-].[Cs+].[Cs+] is/are the reactants and reagents, what can be the product? | CSc1nc(OCC2CCN(NC(=O)OC(C)(C)C)CC2)cc(-n2c(C(F)F)nc3ccccc32)n1 . |
|
Using CCOC(=O)c1nn(-c2ccc(F)cc2)cc1OCC.CCO.ClCCl.O.[K+].[OH-] as the reactants and reagents, tell me the potential product. | CCOc1cn(-c2ccc(F)cc2)nc1C(=O)O . |
|
Please provide a feasible product that could be formed using these reactants and reagents: O=c1c2cc(F)ccc2cc(-c2ccc(O)cc2)n1Cc1ccc(F)cc1F.OB(O)c1ccccc1.CC(=O)[O-].CC(=O)[O-].CCN(CC)CC.ClCCl.[Cu+2] . | O=c1c2cc(F)ccc2cc(-c2ccc(Oc3ccccc3)cc2)n1Cc1ccc(F)cc1F . |
|
CCOC(=O)c1c(CSc2ccccc2)ccc(CC)c1OC.O=C(OO)c1cccc(Cl)c1.ClCCl Based on the reactants and reagents given above, suggest a possible product. | A possible product can be CCOC(=O)c1c(CS(=O)c2ccccc2)ccc(CC)c1OC . |
|
Clc1ccc(-c2csc(COCc3ccccc3)n2)cc1.BrB(Br)Br.ClCCl.O=C([O-])O.[Na+] Given the above reactants and reagents, what could be a probable product of their reaction? | A probable product could be OCc1nc(-c2ccc(Cl)cc2)cs1 . |
|
CC(C)c1cc(C#N)cc2nc(-c3ccc(C(=O)NCC4CCNCCO4)cc3)oc12.FC(F)(F)c1cccc(CBr)c1.CO.O=C([O-])[O-].[K+].[K+] Given the above reactants and reagents, what could be a probable product of their reaction? | A probable product could be CC(C)c1cc(C#N)cc2nc(-c3ccc(C(=O)NCC4CCN(Cc5cccc(C(F)(F)F)c5)CCO4)cc3)oc12 . |
|
CC(O)(C#C[Si](C)(C)C)c1ccc(F)cn1.CCOC(C)=O.CO.[F-].[K+] Considering the given starting materials, what might be the resulting product in a chemical reaction? | C#CC(C)(O)c1ccc(F)cn1 . |
|
Given the following reactants and reagents, please provide a possible product. CC(=O)c1ccncc1.NO.CO.C[O-].Cl.[Na+] | CC(=NO)c1ccncc1 . |
|
A chemical reaction has started with the substance(s) COC(=O)c1ccccc1-c1ccc(Cn2c(C3CC3)nc3c(C)ccnc32)cc1.CCO.[Na+].[OH-] as the reactants and reagents, what could be a probable product? | A probable product: Cc1ccnc2c1nc(C1CC1)n2Cc1ccc(-c2ccccc2C(=O)O)cc1 . |
|
COC(=O)c1cc2ccc(SC)cc2[nH]1.[Na+].[OH-] Based on the reactants and reagents given above, suggest a possible product. | A possible product can be CSc1ccc2cc(C(=O)O)[nH]c2c1 . |
|
Consider that for a chemical reaction, if COC(=O)CBr.NC(=O)c1cccc2c1c1c(O)cccc1n2Cc1cccc2ccccc12.CCOC(C)=O.CN(C)C=O is/are the reactants and reagents, what can be the product? | COC(=O)COc1cccc2c1c1c(C(N)=O)cccc1n2Cc1cccc2ccccc12 . |
|
Please provide a feasible product that could be formed using these reactants and reagents: Clc1ncc(Cl)c(Cl)n1.Nc1cccc(NS(=O)(=O)Cc2cccc([N+](=O)[O-])c2)c1.CCN(CC)CC.CN(C)C=O.Cl.O=C([O-])[O-].[K+].[K+] . | O=[N+]([O-])c1cccc(CS(=O)(=O)Nc2cccc(Nc3nc(Cl)ncc3Cl)c2)c1 . |
|
Based on the given reactants and reagents: COc1cc(N)c(Cl)cc1C(=O)NCC1CCNCC1.ClCCCCCCSc1ccccc1.Cl.Cl, what product could potentially be produced? | The product can be COc1cc(N)c(Cl)cc1C(=O)NCC1CCN(CCCCCCSc2ccccc2)CC1 . |
|
Predict the product of a chemical reaction with CC(=O)Cl.Fc1ccccc1.FB(F)F as the reactants and reagents. | CC(=O)c1ccc(F)cc1 . |
|
CCOC(=O)c1cn(C(C)(C)C)c2nc(Cl)c(F)cc2c1=O.O=C(N1C2CCC1CNC2)C(F)(F)F.C1CCC2=NCCCN2CC1.CC#N.Cl Given the above reactants and reagents, what could be a probable product of their reaction? | A probable product could be CCOC(=O)c1cn(C(C)(C)C)c2nc(N3CC4CCC(C3)N4C(=O)C(F)(F)F)c(F)cc2c1=O . |
|
CCc1cc(C(=O)OC)c(=O)n(Cc2ccc(OC)cc2OC)c1-c1ccc2c(c1)cc(CCO)n2C.CS(=O)(=O)Cl.CCN(CC)CC.ClCCl Given the above reactants and reagents, what could be a probable product of their reaction? | A probable product could be CCc1cc(C(=O)OC)c(=O)n(Cc2ccc(OC)cc2OC)c1-c1ccc2c(c1)cc(CCOS(C)(=O)=O)n2C . |
|
Can you tell me the potential product of a chemical reaction that uses Cc1cc(C#N)ccc1[N+](=O)[O-].CC(=O)O.Cl.Cl[Sn]Cl.O.O.[NH4+].[OH-] as the reactants and reagents? | Sure. A potential product: Cc1cc(C#N)ccc1N . |
|
Can you tell me the potential product of a chemical reaction that uses COc1ccc(C(=O)c2c(-c3ccc(OC)cc3)sc3cc(OC)ccc23)cc1.CC[S-].CN(C)C=O.O.[Na+] as the reactants and reagents? | Sure. A potential product: COc1ccc(-c2sc3cc(OC)ccc3c2C(=O)c2ccc(O)cc2)cc1 . |
|
Propose a potential product given these reactants and reagents. COc1cc(-n2nc(-c3c(F)cccc3Cl)[nH]c2=O)ccc1C(=O)O.NC1(c2ccc(C(F)(F)F)cc2)CC1.C1CCOC1.CCN(C(C)C)C(C)C.CN(C)C(On1nnc2ccccc21)=[N+](C)C.F[B-](F)(F)F | COc1cc(-n2nc(-c3c(F)cccc3Cl)[nH]c2=O)ccc1C(=O)NC1(c2ccc(C(F)(F)F)cc2)CC1 . |
|
CC(C)(C#N)c1cccc(C(=O)Cl)c1.Cc1ccc(N)cc1O.C1CCOC1.O.O=C([O-])O.[Na+] Considering the given starting materials, what might be the resulting product in a chemical reaction? | Cc1ccc(NC(=O)c2cccc(C(C)(C)C#N)c2)cc1O . |
|
Based on the given reactants and reagents: Ic1cnccc1C1CC1.O=C(OO)c1cccc(Cl)c1.ClCCl, what product could potentially be produced? | The product can be [O-][n+]1ccc(C2CC2)c(I)c1 . |
Subsets and Splits
No saved queries yet
Save your SQL queries to embed, download, and access them later. Queries will appear here once saved.