instruction
stringlengths 39
871
| input
stringclasses 1
value | output
stringlengths 2
23
|
|---|---|---|
I'd like to know the molecular formula of COC(=O)C1=C(C(=O)OC)N(c2cccc(-c3nc(C)c(C)o3)c2)C(N)=C(C#N)C1c1ccccc1 . Can you tell me? | C27H24N4O5 |
|
The representation CCCOc1ccc(C(=O)OCCN(CC)CC)cc1N1C(N)=C(C#N)C(c2ccccc2)C(C(=O)OC)=C1C(=O)OC represents a specific molecule. Can you reveal its molecular formula? | C32H38N4O7 |
|
Given the representation COC(=O)C1=C(C(=O)OC)N(c2ccc(NC(=O)c3ccco3)c(OC)c2)C(N)=C(C#N)C1c1ccccc1, what would be its molecular formula? | C28H24N4O7 |
|
Convert the representation of a molecule COC(=O)C1=C(C(=O)OC)N(c2ccc3nc(-c4cccc(O)c4)[nH]c3c2)C(N)=C(C#N)C1c1ccccc1 into molecular formula. | C29H23N5O5 |
|
Please write the molecular formula of the molecule COC(=O)C1=C(C(=O)OC)N(c2ccc3c(c2)C(=O)N(C(C)(C)C)C3=O)C(N)=C(C#N)C1c1ccccc1 . | C28H26N4O6 |
|
Can you tell me the molecular formula of CCN(CC)C(=O)c1ccccc1N1C(N)=C(C#N)C(c2ccccc2)C(C(=O)OC)=C1C(=O)OC ? | C27H28N4O5 |
|
What is the molecular formula of COC(=O)C1=C(C(=O)OC)N(c2c(C(C)C)cccc2C(C)C)C(N)=C(C#N)C1c1ccccc1 ? | C28H31N3O4 |
|
Considering the code CCc1cc(Br)cc(Br)c1N1C=CC=CC(C(=O)OC)=C1C(=O)OC, can you determine the corresponding molecular formula? | C18H17Br2NO4 |
|
COC(=O)C1=C(C(=O)OC)N(c2cccc3c2CCO3)C=CC=C1 is the representation of a molecule. What is its molecular formula? | C18H17NO5 |
|
Please provide the molecular formula for COC(=O)C1=C(C(=O)OC)N(c2cccc(-c3nncn3C)c2C)C=CC=C1 . | C20H20N4O4 |
|
Can you give the molecular molecular formula of CCc1nc2cc(N3C=CC=CC(C(=O)OC)=C3C(=O)OC)ccc2n1C ? | C20H21N3O4 |
|
Convert the representation of a molecule CCN1CCN(Cc2ccc(N3C=CC=CC(C(=O)OC)=C3C(=O)OC)cc2C(F)(F)F)CC1 into molecular formula. | C24H28F3N3O4 |
|
Considering the code COC(=O)C1=C(C(=O)OC)N(c2cccc(Cl)c2N2CCN(C(=O)C(C)C)CC2)C=CC=C1, can you determine the corresponding molecular formula? | C24H28ClN3O5 |
|
What is the molecular formula of COC(=O)C1=C(C(=O)OC)N(c2ccccc2Oc2ccc(C(=O)OC)cc2)C=CC=C1 ? | C24H21NO7 |
|
Given the representation COC(=O)C1=C(C(=O)OC)N(c2ccc(F)cc2B(O)O)C=CC=C1, what would be its molecular formula? | C16H15BFNO6 |
|
Considering the code COC(=O)C1=C(C(=O)OC)N(c2ccccc2C(=O)c2ccc(OC)cc2)C=CC=C1, can you determine the corresponding molecular formula? | C24H21NO6 |
|
What is the molecular formula for the molecule denoted by COC(=O)C1=C(C(=O)OC)N(c2ccccc2-c2nc3ccccc3c(=O)o2)C=CC=C1 ? | C24H18N2O6 |
|
What is the molecular formula for the molecule denoted by COC(=O)C1=C(C(=O)OC)N(c2ccc(C)c(C(=O)O)c2)C=CC=C1 ? | C18H17NO6 |
|
Please provide the molecular formula for COC(=O)C1=C(C(=O)OC)N(c2ccc(S(=O)(=O)NC(C)=O)cc2)C=CC=C1 . | C18H18N2O7S |
|
What is the formula of the molecule COC(=O)C1=C(C(=O)OC)N(c2cccc(C(=O)O)c2C)C=CC=C1 ? | C18H17NO6 |
|
What is the molecular formula for the molecule denoted by CC(C)(C)c1cc(Br)c(NC=O)c([N+](=O)[O-])c1 ? | C11H13BrN2O3 |
|
Cc1ccc(Oc2ccc(NC=O)cc2C)cn1 is the representation of a molecule. What is its molecular formula? | C14H14N2O2 |
|
I'd like to know the molecular formula of COC(=O)Nc1ccc(NC=O)cc1OC . Can you tell me? | C10H12N2O4 |
|
What is the molecular formula of O=CNc1ccccc1OCCn1cccn1 ? | C12H13N3O2 |
|
What is the molecular formula of Cn1nccc1COc1ccc(NC=O)cc1 ? | C12H13N3O2 |
|
The representation O=CNc1ccc(NC2CCN(C(=O)OCc3ccccc3)CC2)cc1 represents a specific molecule. Can you reveal its molecular formula? | C20H23N3O3 |
|
Please provide the molecular formula for O=CNc1c([N+](=O)[O-])cc(C(=O)O)c(F)c1F . | C8H4F2N2O5 |
|
What is the molecular formula of CCC(CC)c1ccc(NC=O)cc1 ? | C12H17NO |
|
Considering the code COC(=O)c1ccc(Oc2ccc3c(c2)OCO3)c(NC=O)c1, can you determine the corresponding molecular formula? | C16H13NO6 |
|
Given the representation O=CNc1cc(F)c(I)cc1Br, what would be its molecular formula? | C7H4BrFINO |
|
Given the representation CC(=O)c1ccc(N2CCOCC2)c(NC=O)c1, what would be its molecular formula? | C13H16N2O3 |
|
I'd like to know the molecular formula of O=CNc1c(Br)ccc(I)c1O . Can you tell me? | C7H5BrINO2 |
|
Given the representation Cc1cc(C)n(-c2ccc3cccc(NC=O)c3n2)n1, what would be its molecular formula? | C15H14N4O |
|
Given the representation N#Cc1cn2ccccc2c1-c1cn2ccccc2n1, what would be its molecular formula? | C16H10N4 |
|
I'd like to know the molecular formula of [N-]=[N+]=NCC1CC(=O)N(C2CCCCC2O)C1 . Can you tell me? | C11H18N4O2 |
|
What is the molecular formula for the molecule denoted by CCc1ccc(C(C)N2CC(CN=[N+]=[N-])CC2=O)cc1 ? | C15H20N4O |
|
Can you give the molecular molecular formula of Cc1cc(O)cc(N2CC(CN=[N+]=[N-])CC2=O)c1 ? | C12H14N4O2 |
|
[N-]=[N+]=NCC1CC(=O)N(c2c(Cl)cccc2[N+](=O)[O-])C1 is the representation of a molecule. What is its molecular formula? | C11H10ClN5O3 |
|
What is the formula of the molecule CN(C)C1CCCCC1N1CC(CN)CC1=O ? | C13H25N3O |
|
Can you give the molecular molecular formula of CCC(CCN)N1CC(CN)CC1=O ? | C10H21N3O |
|
The representation COC(=O)CCC(C(=O)O)N1CC(CN)CC1=O represents a specific molecule. Can you reveal its molecular formula? | C11H18N2O5 |
|
Considering the code COC(=O)c1cc(F)ccc1N1CC(CN)CC1=O, can you determine the corresponding molecular formula? | C13H15FN2O3 |
|
Can you tell me the molecular formula of Cc1cnc(Br)c(N2CC(CN)CC2=O)c1 ? | C11H14BrN3O |
|
Please provide the molecular formula for NCCNCCN1CC(CN)CC1=O . | C9H20N4O |
|
I'd like to know the molecular formula of CC(C)(C)OC(=O)N1CCCC(N2CC(CO)CC2=O)CC1 . Can you tell me? | C16H28N2O4 |
|
CCc1cc(C(=O)OC)c(N2CC(CO)CC2=O)s1 is the representation of a molecule. What is its molecular formula? | C13H17NO4S |
|
What is the formula of the molecule COc1ccc(N2CC(CO)CC2=O)cc1C(F)(F)F ? | C13H14F3NO3 |
|
The representation COc1ccc(N2CC(CO)CC2=O)c(C#N)c1 represents a specific molecule. Can you reveal its molecular formula? | C13H14N2O3 |
|
The representation Cc1cc(Br)c(Cl)cc1N1CC(CO)CC1=O represents a specific molecule. Can you reveal its molecular formula? | C12H13BrClNO2 |
|
Please provide the molecular formula for O=C1CC(CO)CN1c1cc(B(O)O)ccc1Cl . | C11H13BClNO4 |
|
I'd like to know the molecular formula of O=C1CC(CO)CN1c1ccc(OC(F)(F)F)cc1Br . Can you tell me? | C12H11BrF3NO3 |
|
What is the molecular formula for the molecule denoted by O=C1CC(CO)CN1c1cncc(Cl)n1 ? | C9H10ClN3O2 |
|
Given the representation O=C1CC(CO)CN1c1ncn[nH]1, what would be its molecular formula? | C7H10N4O2 |
Subsets and Splits
No saved queries yet
Save your SQL queries to embed, download, and access them later. Queries will appear here once saved.