Datasets:

kguo2
/

scaffold_finetune

Modalities:

Text

Formats:

Size:

Libraries:

Dataset card Data Studio Files Files and versions

xet

Community

Dataset Viewer

Auto-converted to Parquet

Split (1)

train · 29k rows

problem stringlengths 733 744	scaffold stringclasses 17 values
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C18H22N4O5S Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1ccc2c(c1)C=CC3=CC=CC=C23
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C18H22N4O5S Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1ccc2c3ccccc3ccc2c1
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C17H19FN2O4 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1ccc2c(c1)C=CC3=CC=CC=C23
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C17H19FN2O4 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1ccc2c3ccccc3ccc2c1
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C18H23BrClNO6 Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1ccc2ccccc2c1
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C18H26N2O3 Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1ccc2ccccc2c1
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C13H15NO3 Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1ccc2ccccc2c1
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C18H24N2O Degree of Unsaturation (DoU): 8.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	O=C1C=CC(=O)c2ccccc12
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C18H24N2O Degree of Unsaturation (DoU): 8.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1cncc2c1[nH]c(=O)[nH]c2=O
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C16H24N6O2S Degree of Unsaturation (DoU): 8.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	O=C1C=CC(=O)c2ccccc12
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C16H24N6O2S Degree of Unsaturation (DoU): 8.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1cncc2c1[nH]c(=O)[nH]c2=O
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C15H16N2O3S Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1ccc2c(c1)C=CC3=CC=CC=C23
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C15H16N2O3S Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1ccc2c3ccccc3ccc2c1
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C16H20N2O4S Degree of Unsaturation (DoU): 8.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	O=C1C=CC(=O)c2ccccc12
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C16H20N2O4S Degree of Unsaturation (DoU): 8.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1cncc2c1[nH]c(=O)[nH]c2=O
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C18H18ClNO2 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1ccc2c(c1)C=CC3=CC=CC=C23
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C18H18ClNO2 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1ccc2c3ccccc3ccc2c1
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C10H12N4O5S Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1ccc2ccccc2c1
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C15H25N3O3S Degree of Unsaturation (DoU): 5.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	C1COc2ccccc12
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C20H28N4O2 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1ccc2c(c1)C=CC3=CC=CC=C23
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C20H28N4O2 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1ccc2c3ccccc3ccc2c1
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C18H21FN4O2 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1ccc2c(c1)C=CC3=CC=CC=C23
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C18H21FN4O2 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1ccc2c3ccccc3ccc2c1
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C19H24N2O3 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1ccc2c(c1)C=CC3=CC=CC=C23
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C19H24N2O3 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1ccc2c3ccccc3ccc2c1
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C17H20N2O5S2 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1ccc2c(c1)C=CC3=CC=CC=C23
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C17H20N2O5S2 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1ccc2c3ccccc3ccc2c1
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C15H14O2 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1ccc2c(c1)C=CC3=CC=CC=C23
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C15H14O2 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1ccc2c3ccccc3ccc2c1
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C19H23F2NO2 Degree of Unsaturation (DoU): 8.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	O=C1C=CC(=O)c2ccccc12
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C19H23F2NO2 Degree of Unsaturation (DoU): 8.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1cncc2c1[nH]c(=O)[nH]c2=O
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C16H21N3O2S Degree of Unsaturation (DoU): 8.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	O=C1C=CC(=O)c2ccccc12
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C16H21N3O2S Degree of Unsaturation (DoU): 8.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1cncc2c1[nH]c(=O)[nH]c2=O
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C20H26F3N3O2 Degree of Unsaturation (DoU): 8.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	O=C1C=CC(=O)c2ccccc12
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C20H26F3N3O2 Degree of Unsaturation (DoU): 8.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1cncc2c1[nH]c(=O)[nH]c2=O
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C15H18BrNO4S Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1ccc2ccccc2c1
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C13H19NO2S Degree of Unsaturation (DoU): 5.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	C1COc2ccccc12
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C11H8BrNO Degree of Unsaturation (DoU): 8.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	O=C1C=CC(=O)c2ccccc12
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C11H8BrNO Degree of Unsaturation (DoU): 8.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1cncc2c1[nH]c(=O)[nH]c2=O
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C19H22N2O3 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1ccc2c(c1)C=CC3=CC=CC=C23
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C19H22N2O3 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1ccc2c3ccccc3ccc2c1
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C18H23F2NO2 Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1ccc2ccccc2c1
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C17H20N2O4 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1ccc2c(c1)C=CC3=CC=CC=C23
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C17H20N2O4 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1ccc2c3ccccc3ccc2c1
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C18H18FNO2 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1ccc2c(c1)C=CC3=CC=CC=C23
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C18H18FNO2 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1ccc2c3ccccc3ccc2c1
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C11H17ClN2O2S2 Degree of Unsaturation (DoU): 4.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1ccccc1
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C11H17ClN2O2S2 Degree of Unsaturation (DoU): 4.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1ccncc1
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C14H10F3NO3S Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1ccc2c(c1)C=CC3=CC=CC=C23
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C14H10F3NO3S Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1ccc2c3ccccc3ccc2c1
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C20H26N2O2S Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1ccc2c(c1)C=CC3=CC=CC=C23
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C20H26N2O2S Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1ccc2c3ccccc3ccc2c1
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C20H24ClN3O Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1ccc2c(c1)C=CC3=CC=CC=C23
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C20H24ClN3O Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1ccc2c3ccccc3ccc2c1
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C13H14Cl2N4O Degree of Unsaturation (DoU): 8.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	O=C1C=CC(=O)c2ccccc12
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C13H14Cl2N4O Degree of Unsaturation (DoU): 8.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1cncc2c1[nH]c(=O)[nH]c2=O
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C10H9IN4S Degree of Unsaturation (DoU): 8.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	O=C1C=CC(=O)c2ccccc12
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C10H9IN4S Degree of Unsaturation (DoU): 8.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1cncc2c1[nH]c(=O)[nH]c2=O
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C21H26N2O3 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1ccc2c(c1)C=CC3=CC=CC=C23
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C21H26N2O3 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1ccc2c3ccccc3ccc2c1
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C13H17N3OS Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1ccc2ccccc2c1
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C14H18ClNO2S Degree of Unsaturation (DoU): 6.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1ccc2C=CCc2c1
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C17H24ClN3O2 Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1ccc2ccccc2c1
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C14H16N4O4S Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1ccc2c(c1)C=CC3=CC=CC=C23
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C14H16N4O4S Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1ccc2c3ccccc3ccc2c1
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C18H20F2N2O3 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1ccc2c(c1)C=CC3=CC=CC=C23
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C18H20F2N2O3 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1ccc2c3ccccc3ccc2c1
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C20H28N4O2 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1ccc2c(c1)C=CC3=CC=CC=C23
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C20H28N4O2 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1ccc2c3ccccc3ccc2c1
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C16H22N2OS Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1ccc2ccccc2c1
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C14H20BrNO Degree of Unsaturation (DoU): 5.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	C1COc2ccccc12
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C18H18INO2 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1ccc2c(c1)C=CC3=CC=CC=C23
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C18H18INO2 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1ccc2c3ccccc3ccc2c1
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C20H26N4O3 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1ccc2c(c1)C=CC3=CC=CC=C23
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C20H26N4O3 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1ccc2c3ccccc3ccc2c1
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C15H24N4O4S Degree of Unsaturation (DoU): 6.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1ccc2C=CCc2c1
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C14H22N2O3S Degree of Unsaturation (DoU): 5.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	C1COc2ccccc12
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C22H30N4O3 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1ccc2c(c1)C=CC3=CC=CC=C23
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C22H30N4O3 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1ccc2c3ccccc3ccc2c1
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C13H17ClFNO2S Degree of Unsaturation (DoU): 5.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	C1COc2ccccc12
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C16H20FNO2S Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1ccc2ccccc2c1
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C13H14F2N4O2 Degree of Unsaturation (DoU): 8.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	O=C1C=CC(=O)c2ccccc12
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C13H14F2N4O2 Degree of Unsaturation (DoU): 8.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1cncc2c1[nH]c(=O)[nH]c2=O
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C17H15F3N2O5S2 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1ccc2c(c1)C=CC3=CC=CC=C23
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C17H15F3N2O5S2 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1ccc2c3ccccc3ccc2c1
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C16H22F2N2O2 Degree of Unsaturation (DoU): 6.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1ccc2C=CCc2c1
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C10H9N3O Degree of Unsaturation (DoU): 8.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	O=C1C=CC(=O)c2ccccc12
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C10H9N3O Degree of Unsaturation (DoU): 8.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1cncc2c1[nH]c(=O)[nH]c2=O
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C19H21ClN2O3 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1ccc2c(c1)C=CC3=CC=CC=C23
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C19H21ClN2O3 Degree of Unsaturation (DoU): 10.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1ccc2c3ccccc3ccc2c1
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C8H15F3N2O Degree of Unsaturation (DoU): 1.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	C=CCC
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C8H15F3N2O Degree of Unsaturation (DoU): 1.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	C1CCCCC1
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C12H14BrN5O Degree of Unsaturation (DoU): 8.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	O=C1C=CC(=O)c2ccccc12
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C12H14BrN5O Degree of Unsaturation (DoU): 8.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1cncc2c1[nH]c(=O)[nH]c2=O
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C18H24N4O2 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1ccc2c(c1)C=CC3=CC=CC=C23
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C18H24N4O2 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1ccc2c3ccccc3ccc2c1
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C16H23N3O2S Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1ccc2ccccc2c1
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C17H29N5O Degree of Unsaturation (DoU): 6.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1ccc2C=CCc2c1
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C13H14Cl2N2O3 Degree of Unsaturation (DoU): 7.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1ccc2ccccc2c1
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. Input: You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. Task: Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. Constraints:\n * The generated SMILES string must be chemically valid.\n * The generated scaffold must be consistent with the provided Molecular Formula and DoU.\n4. Output: Respond only with the generated SMILES string and nothing else. Molecular Formula: C19H25N3O2 Degree of Unsaturation (DoU): 9.0 Generate a chemically valid core molecular scaffold as a SMILES string that is consistent with the given formula and DoU.	c1ccc2c(c1)C=CC3=CC=CC=C23

End of preview. Expand in Data Studio

README.md exists but content is empty.

Downloads last month: 8

Size of downloaded dataset files:

961 kB

Size of the auto-converted Parquet files:

961 kB

Number of rows:

29,047