instruction
stringlengths 41
142
| input
stringlengths 0
478
| output
stringlengths 4
382
|
|---|---|---|
Provide the SMILES representation for the building block token <BB_0>.
|
C=CCc1ccc(F)c(C)c1
|
|
What is the building block token for the following molecule?
|
C=CCc1ccc(F)c(C)c1
|
<BB_0>
|
What is the molecular formula for <BB_0>?
|
The molecular formula for <BB_0> (C=CCc1ccc(F)c(C)c1) is C10H11F.
|
|
Describe the ring structures in building block <BB_0>.
|
The molecule contains 1 ring(s): an aromatic ring of size 6.
|
|
List the primary functional groups present in <BB_0>.
|
The molecule contains the following groups: Halogen (F,Cl,Br,I).
|
|
Provide a comprehensive chemical profile for the building block <BB_0>.
|
**Token:** <BB_0>
**SMILES:** C=CCc1ccc(F)c(C)c1
**Molecular Formula:** C10H11F
**Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6.
**Functional Groups:** Halogen (F,Cl,Br,I)
|
|
Provide the SMILES representation for the building block token <BB_1>.
|
CC(C)(c1ccc(C=O)cc1)C(F)(F)F
|
|
What is the building block token for the following molecule?
|
CC(C)(c1ccc(C=O)cc1)C(F)(F)F
|
<BB_1>
|
What is the molecular formula for <BB_1>?
|
The molecular formula for <BB_1> (CC(C)(c1ccc(C=O)cc1)C(F)(F)F) is C11H11F3O.
|
|
Describe the ring structures in building block <BB_1>.
|
The molecule contains 1 ring(s): an aromatic ring of size 6.
|
|
List the primary functional groups present in <BB_1>.
|
The molecule contains the following groups: Aldehyde, Halogen (F,Cl,Br,I).
|
|
Provide a comprehensive chemical profile for the building block <BB_1>.
|
**Token:** <BB_1>
**SMILES:** CC(C)(c1ccc(C=O)cc1)C(F)(F)F
**Molecular Formula:** C11H11F3O
**Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6.
**Functional Groups:** Aldehyde, Halogen (F,Cl,Br,I)
|
|
Provide the SMILES representation for the building block token <BB_2>.
|
CCNC(=O)NC(C)(C)C(=O)O
|
|
What is the building block token for the following molecule?
|
CCNC(=O)NC(C)(C)C(=O)O
|
<BB_2>
|
What is the molecular formula for <BB_2>?
|
The molecular formula for <BB_2> (CCNC(=O)NC(C)(C)C(=O)O) is C7H14N2O3.
|
|
Describe the ring structures in building block <BB_2>.
|
The molecule is acyclic (contains no rings).
|
|
List the primary functional groups present in <BB_2>.
|
The molecule contains the following groups: Carboxylic Acid, Amide.
|
|
Provide a comprehensive chemical profile for the building block <BB_2>.
|
**Token:** <BB_2>
**SMILES:** CCNC(=O)NC(C)(C)C(=O)O
**Molecular Formula:** C7H14N2O3
**Ring System:** The molecule is acyclic (contains no rings).
**Functional Groups:** Carboxylic Acid, Amide
|
|
Provide the SMILES representation for the building block token <BB_3>.
|
CC(C)(C)c1ccc(S(=O)(=O)NCCC(=O)O)cc1
|
|
What is the building block token for the following molecule?
|
CC(C)(C)c1ccc(S(=O)(=O)NCCC(=O)O)cc1
|
<BB_3>
|
What is the molecular formula for <BB_3>?
|
The molecular formula for <BB_3> (CC(C)(C)c1ccc(S(=O)(=O)NCCC(=O)O)cc1) is C13H19NO4S.
|
|
Describe the ring structures in building block <BB_3>.
|
The molecule contains 1 ring(s): an aromatic ring of size 6.
|
|
List the primary functional groups present in <BB_3>.
|
The molecule contains the following groups: Carboxylic Acid, Secondary Amine, Sulfonamide.
|
|
Provide a comprehensive chemical profile for the building block <BB_3>.
|
**Token:** <BB_3>
**SMILES:** CC(C)(C)c1ccc(S(=O)(=O)NCCC(=O)O)cc1
**Molecular Formula:** C13H19NO4S
**Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6.
**Functional Groups:** Carboxylic Acid, Secondary Amine, Sulfonamide
|
|
Provide the SMILES representation for the building block token <BB_4>.
|
COC(=O)c1cc(Br)ccc1C
|
|
What is the building block token for the following molecule?
|
COC(=O)c1cc(Br)ccc1C
|
<BB_4>
|
What is the molecular formula for <BB_4>?
|
The molecular formula for <BB_4> (COC(=O)c1cc(Br)ccc1C) is C9H9BrO2.
|
|
Describe the ring structures in building block <BB_4>.
|
The molecule contains 1 ring(s): an aromatic ring of size 6.
|
|
List the primary functional groups present in <BB_4>.
|
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
|
|
Provide a comprehensive chemical profile for the building block <BB_4>.
|
**Token:** <BB_4>
**SMILES:** COC(=O)c1cc(Br)ccc1C
**Molecular Formula:** C9H9BrO2
**Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6.
**Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
|
|
Provide the SMILES representation for the building block token <BB_5>.
|
COC(=O)C(N)C(O)C(C)C.Cl
|
|
What is the building block token for the following molecule?
|
COC(=O)C(N)C(O)C(C)C.Cl
|
<BB_5>
|
What is the molecular formula for <BB_5>?
|
The molecular formula for <BB_5> (COC(=O)C(N)C(O)C(C)C.Cl) is C7H16ClNO3.
|
|
Describe the ring structures in building block <BB_5>.
|
The molecule is acyclic (contains no rings).
|
|
List the primary functional groups present in <BB_5>.
|
The molecule contains the following groups: Amine, Ester, Alcohol, Ether, Halogen (F,Cl,Br,I).
|
|
Provide a comprehensive chemical profile for the building block <BB_5>.
|
**Token:** <BB_5>
**SMILES:** COC(=O)C(N)C(O)C(C)C.Cl
**Molecular Formula:** C7H16ClNO3
**Ring System:** The molecule is acyclic (contains no rings).
**Functional Groups:** Amine, Ester, Alcohol, Ether, Halogen (F,Cl,Br,I)
|
|
Provide the SMILES representation for the building block token <BB_6>.
|
Cn1cc(C=O)c(-c2ccccc2)n1
|
|
What is the building block token for the following molecule?
|
Cn1cc(C=O)c(-c2ccccc2)n1
|
<BB_6>
|
What is the molecular formula for <BB_6>?
|
The molecular formula for <BB_6> (Cn1cc(C=O)c(-c2ccccc2)n1) is C11H10N2O.
|
|
Describe the ring structures in building block <BB_6>.
|
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
|
|
List the primary functional groups present in <BB_6>.
|
The molecule contains the following groups: Aldehyde.
|
|
Provide a comprehensive chemical profile for the building block <BB_6>.
|
**Token:** <BB_6>
**SMILES:** Cn1cc(C=O)c(-c2ccccc2)n1
**Molecular Formula:** C11H10N2O
**Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
**Functional Groups:** Aldehyde
|
|
Provide the SMILES representation for the building block token <BB_7>.
|
CN(C1CCCCC1)C1CCCCC1
|
|
What is the building block token for the following molecule?
|
CN(C1CCCCC1)C1CCCCC1
|
<BB_7>
|
What is the molecular formula for <BB_7>?
|
The molecular formula for <BB_7> (CN(C1CCCCC1)C1CCCCC1) is C13H25N.
|
|
Describe the ring structures in building block <BB_7>.
|
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6.
|
|
List the primary functional groups present in <BB_7>.
|
The molecule contains the following groups: Tertiary Amine.
|
|
Provide a comprehensive chemical profile for the building block <BB_7>.
|
**Token:** <BB_7>
**SMILES:** CN(C1CCCCC1)C1CCCCC1
**Molecular Formula:** C13H25N
**Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6.
**Functional Groups:** Tertiary Amine
|
|
Provide the SMILES representation for the building block token <BB_8>.
|
C#CCC1(C(=O)Cl)CCCCC1
|
|
What is the building block token for the following molecule?
|
C#CCC1(C(=O)Cl)CCCCC1
|
<BB_8>
|
What is the molecular formula for <BB_8>?
|
The molecular formula for <BB_8> (C#CCC1(C(=O)Cl)CCCCC1) is C10H13ClO.
|
|
Describe the ring structures in building block <BB_8>.
|
The molecule contains 1 ring(s): an aliphatic ring of size 6.
|
|
List the primary functional groups present in <BB_8>.
|
The molecule contains the following groups: Halogen (F,Cl,Br,I).
|
|
Provide a comprehensive chemical profile for the building block <BB_8>.
|
**Token:** <BB_8>
**SMILES:** C#CCC1(C(=O)Cl)CCCCC1
**Molecular Formula:** C10H13ClO
**Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6.
**Functional Groups:** Halogen (F,Cl,Br,I)
|
|
Provide the SMILES representation for the building block token <BB_9>.
|
CCn1nccc1C1CCNCC1
|
|
What is the building block token for the following molecule?
|
CCn1nccc1C1CCNCC1
|
<BB_9>
|
What is the molecular formula for <BB_9>?
|
The molecular formula for <BB_9> (CCn1nccc1C1CCNCC1) is C10H17N3.
|
|
Describe the ring structures in building block <BB_9>.
|
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6.
|
|
List the primary functional groups present in <BB_9>.
|
The molecule contains the following groups: Secondary Amine.
|
|
Provide a comprehensive chemical profile for the building block <BB_9>.
|
**Token:** <BB_9>
**SMILES:** CCn1nccc1C1CCNCC1
**Molecular Formula:** C10H17N3
**Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6.
**Functional Groups:** Secondary Amine
|
|
Provide the SMILES representation for the building block token <BB_10>.
|
CCCCC(=CCO)CCCC
|
|
What is the building block token for the following molecule?
|
CCCCC(=CCO)CCCC
|
<BB_10>
|
What is the molecular formula for <BB_10>?
|
The molecular formula for <BB_10> (CCCCC(=CCO)CCCC) is C11H22O.
|
|
Describe the ring structures in building block <BB_10>.
|
The molecule is acyclic (contains no rings).
|
|
List the primary functional groups present in <BB_10>.
|
The molecule contains the following groups: Alcohol.
|
|
Provide a comprehensive chemical profile for the building block <BB_10>.
|
**Token:** <BB_10>
**SMILES:** CCCCC(=CCO)CCCC
**Molecular Formula:** C11H22O
**Ring System:** The molecule is acyclic (contains no rings).
**Functional Groups:** Alcohol
|
|
Provide the SMILES representation for the building block token <BB_11>.
|
CC(F)(F)CCCO
|
|
What is the building block token for the following molecule?
|
CC(F)(F)CCCO
|
<BB_11>
|
What is the molecular formula for <BB_11>?
|
The molecular formula for <BB_11> (CC(F)(F)CCCO) is C5H10F2O.
|
|
Describe the ring structures in building block <BB_11>.
|
The molecule is acyclic (contains no rings).
|
|
List the primary functional groups present in <BB_11>.
|
The molecule contains the following groups: Alcohol, Halogen (F,Cl,Br,I).
|
|
Provide a comprehensive chemical profile for the building block <BB_11>.
|
**Token:** <BB_11>
**SMILES:** CC(F)(F)CCCO
**Molecular Formula:** C5H10F2O
**Ring System:** The molecule is acyclic (contains no rings).
**Functional Groups:** Alcohol, Halogen (F,Cl,Br,I)
|
|
Provide the SMILES representation for the building block token <BB_12>.
|
CCC(=O)c1ccc(Cl)c(S(=O)(=O)Cl)c1
|
|
What is the building block token for the following molecule?
|
CCC(=O)c1ccc(Cl)c(S(=O)(=O)Cl)c1
|
<BB_12>
|
What is the molecular formula for <BB_12>?
|
The molecular formula for <BB_12> (CCC(=O)c1ccc(Cl)c(S(=O)(=O)Cl)c1) is C9H8Cl2O3S.
|
|
Describe the ring structures in building block <BB_12>.
|
The molecule contains 1 ring(s): an aromatic ring of size 6.
|
|
List the primary functional groups present in <BB_12>.
|
The molecule contains the following groups: Ketone, Halogen (F,Cl,Br,I).
|
|
Provide a comprehensive chemical profile for the building block <BB_12>.
|
**Token:** <BB_12>
**SMILES:** CCC(=O)c1ccc(Cl)c(S(=O)(=O)Cl)c1
**Molecular Formula:** C9H8Cl2O3S
**Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6.
**Functional Groups:** Ketone, Halogen (F,Cl,Br,I)
|
|
Provide the SMILES representation for the building block token <BB_13>.
|
COCC1(N)CCC(F)(F)CC1.Cl
|
|
What is the building block token for the following molecule?
|
COCC1(N)CCC(F)(F)CC1.Cl
|
<BB_13>
|
What is the molecular formula for <BB_13>?
|
The molecular formula for <BB_13> (COCC1(N)CCC(F)(F)CC1.Cl) is C8H16ClF2NO.
|
|
Describe the ring structures in building block <BB_13>.
|
The molecule contains 1 ring(s): an aliphatic ring of size 6.
|
|
List the primary functional groups present in <BB_13>.
|
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
|
|
Provide a comprehensive chemical profile for the building block <BB_13>.
|
**Token:** <BB_13>
**SMILES:** COCC1(N)CCC(F)(F)CC1.Cl
**Molecular Formula:** C8H16ClF2NO
**Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6.
**Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
|
|
Provide the SMILES representation for the building block token <BB_14>.
|
Cn1c(N2CCNCC2)nc(Cl)c1C#N
|
|
What is the building block token for the following molecule?
|
Cn1c(N2CCNCC2)nc(Cl)c1C#N
|
<BB_14>
|
What is the molecular formula for <BB_14>?
|
The molecular formula for <BB_14> (Cn1c(N2CCNCC2)nc(Cl)c1C#N) is C9H12ClN5.
|
|
Describe the ring structures in building block <BB_14>.
|
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6.
|
|
List the primary functional groups present in <BB_14>.
|
The molecule contains the following groups: Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I), Nitrile.
|
|
Provide a comprehensive chemical profile for the building block <BB_14>.
|
**Token:** <BB_14>
**SMILES:** Cn1c(N2CCNCC2)nc(Cl)c1C#N
**Molecular Formula:** C9H12ClN5
**Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6.
**Functional Groups:** Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I), Nitrile
|
|
Provide the SMILES representation for the building block token <BB_15>.
|
CC1Cc2cccc(CN)c2N1
|
|
What is the building block token for the following molecule?
|
CC1Cc2cccc(CN)c2N1
|
<BB_15>
|
What is the molecular formula for <BB_15>?
|
The molecular formula for <BB_15> (CC1Cc2cccc(CN)c2N1) is C10H14N2.
|
|
Describe the ring structures in building block <BB_15>.
|
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
|
|
List the primary functional groups present in <BB_15>.
|
The molecule contains the following groups: Amine, Secondary Amine.
|
|
Provide a comprehensive chemical profile for the building block <BB_15>.
|
**Token:** <BB_15>
**SMILES:** CC1Cc2cccc(CN)c2N1
**Molecular Formula:** C10H14N2
**Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
**Functional Groups:** Amine, Secondary Amine
|
|
Provide the SMILES representation for the building block token <BB_16>.
|
Fc1ccc(CCN2CCNCC2)cc1
|
|
What is the building block token for the following molecule?
|
Fc1ccc(CCN2CCNCC2)cc1
|
<BB_16>
|
What is the molecular formula for <BB_16>?
|
The molecular formula for <BB_16> (Fc1ccc(CCN2CCNCC2)cc1) is C12H17FN2.
|
|
Describe the ring structures in building block <BB_16>.
|
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
|
End of preview. Expand
in Data Studio
No dataset card yet
- Downloads last month
- 7