molecules
dict | messages
listlengths 3
3
|
|---|---|
{
"smiles": [
"CCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "It impacts barth syndrome. The molecule is a apoptosis and a proton trap for oxidative phosphorylation, impacting both aging and tangier disease. The molecule is a cholesterol translocation, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease and diabetic heart disease.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation, a proton trap for oxidative phosphorylation, and a apoptosis, and it impacts diabetic heart disease. The molecule is a stabilizing mitochondrial structure and a stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease, tangier disease, barth syndrome, and aging.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is a apoptosis and a cholesterol translocation, impacting both tangier disease and diabetic heart disease. The molecule is a stabilizing mitochondrial structure and a proton trap for oxidative phosphorylation that impacts barth syndrome, aging, and non-alcoholic fatty liver disease. The molecule is a stabilizing cytochrome oxidase.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase and proton trap for oxidative phosphorylation, and it impacts tangier disease. The molecule is a cholesterol translocation that impacts both barth syndrome and non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure and a apoptosis, impacting both diabetic heart disease and aging.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase that impacts tangier disease. The molecule is a stabilizing mitochondrial structure and a cholesterol translocation, impacting both non-alcoholic fatty liver disease and diabetic heart disease. The molecule is a apoptosis and a proton trap for oxidative phosphorylation, impacting both aging and barth syndrome.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)CC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation and a stabilizing cytochrome oxidase, impacting both diabetic heart disease and tangier disease. The molecule is a apoptosis and a proton trap for oxidative phosphorylation, impacting both barth syndrome and non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure that impacts aging.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)CC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation and apoptosis, and it impacts barth syndrome. The molecule is a cholesterol translocation, a stabilizing mitochondrial structure, and a stabilizing cytochrome oxidase, and it impacts diabetic heart disease. It impacts non-alcoholic fatty liver disease, tangier disease, and aging.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)CC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "It impacts diabetic heart disease. The molecule is a cholesterol translocation that impacts barth syndrome, tangier disease, and non-alcoholic fatty liver disease. The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, apoptosis, proton trap for oxidative phosphorylation that impacts aging.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)CC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase, cholesterol translocation, stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease and diabetic heart disease. The molecule is a apoptosis and a proton trap for oxidative phosphorylation that impacts aging, barth syndrome, and tangier disease.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)CC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation that impacts tangier disease and barth syndrome. The molecule is a apoptosis and a stabilizing mitochondrial structure that impacts aging, diabetic heart disease, and non-alcoholic fatty liver disease.",
"role": "assistant"
}
]
|
{
"smiles": [
"O=C(C1CC1)N1CCC(Cn2nnnc2-c2ccc(Br)cc2)C1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is cancer treatment.",
"role": "assistant"
}
]
|
{
"smiles": [
"O=C(C1CC1)N1CCC(Cn2nnnc2-c2ccc(Br)cc2)C1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "It impacts cancer treatment.",
"role": "assistant"
}
]
|
{
"smiles": [
"O=C(C1CC1)N1CCC(Cn2nnnc2-c2ccc(Br)cc2)C1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is cancer treatment.",
"role": "assistant"
}
]
|
{
"smiles": [
"O=C(C1CC1)N1CCC(Cn2nnnc2-c2ccc(Br)cc2)C1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "It impacts cancer treatment.",
"role": "assistant"
}
]
|
{
"smiles": [
"O=C(C1CC1)N1CCC(Cn2nnnc2-c2ccc(Br)cc2)C1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a cancer treatment.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCC=CCC=CCC=CCC=CCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease. The molecule is a cholesterol translocation and a stabilizing cytochrome oxidase, impacting both barth syndrome and tangier disease. The molecule is a stabilizing mitochondrial structure and a apoptosis, impacting both diabetic heart disease and aging.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCC=CCC=CCC=CCC=CCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation and a apoptosis, impacting both barth syndrome and diabetic heart disease. The molecule is a stabilizing mitochondrial structure, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease, aging, and tangier disease.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCC=CCC=CCC=CCC=CCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase and a proton trap for oxidative phosphorylation, impacting both barth syndrome and tangier disease. The molecule is a stabilizing mitochondrial structure that impacts diabetic heart disease, non-alcoholic fatty liver disease, and aging. The molecule is both a apoptosis and a cholesterol translocation.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCC=CCC=CCC=CCC=CCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation and a stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease, barth syndrome, and diabetic heart disease. The molecule is a apoptosis, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation that impacts tangier disease and aging.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCC=CCC=CCC=CCC=CCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a apoptosis, cholesterol translocation, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts tangier disease and non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure that impacts diabetic heart disease, barth syndrome, and aging.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a nutrient and a fat storage, with effects on cancer and impacts on pancreatitis. The molecule is a membrane stabilizer and a energy source, impacting both cardiovascular disease and atherosclerosis. The molecule is a energy storage and a inflammatory that impacts thyroxine treatment, metabolic syndrome, and obesity.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a energy source, thyroxine treatment, nutrient, membrane stabilizer that impacts atherosclerosis and obesity. The molecule is a energy storage and inflammatory, and it impacts cardiovascular disease. The molecule is a fat storage that affects cancer by impacting both pancreatitis and metabolic syndrome.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a inflammatory that impacts cancer, metabolic syndrome, and obesity. The molecule is a fat storage, membrane stabilizer, energy storage, thyroxine treatment. The molecule is a nutrient and a energy source that impacts cardiovascular disease, pancreatitis, and atherosclerosis.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a energy storage, nutrient, membrane stabilizer, energy source and belongs to the thyroxine treatment class of molecules. The molecule is a fat storage and a inflammatory that impacts metabolic syndrome, cardiovascular disease, obesity, and pancreatitis. It impacts both cancer and atherosclerosis.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a nutrient and membrane stabilizer, affecting cancer, and impacting metabolic syndrome, cardiovascular disease, and atherosclerosis. The molecule is a energy source and inflammatory, and it impacts pancreatitis. The molecule is a fat storage and a energy storage, impacting both obesity and thyroxine treatment.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation that impacts both barth syndrome and tangier disease. The molecule is a stabilizing cytochrome oxidase and cholesterol translocation, and it impacts diabetic heart disease. The molecule is a apoptosis and a stabilizing mitochondrial structure, impacting both non-alcoholic fatty liver disease and aging.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation, stabilizing cytochrome oxidase, apoptosis that impacts tangier disease and aging. The molecule is a stabilizing mitochondrial structure and a proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease, diabetic heart disease, and barth syndrome.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation. The molecule is a stabilizing cytochrome oxidase that impacts aging, tangier disease, and barth syndrome. The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, apoptosis that impacts non-alcoholic fatty liver disease and diabetic heart disease.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase that impacts both barth syndrome and diabetic heart disease. The molecule is a stabilizing mitochondrial structure and a apoptosis, impacting both non-alcoholic fatty liver disease and tangier disease. The molecule is a cholesterol translocation and proton trap for oxidative phosphorylation, and it impacts aging.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase that impacts diabetic heart disease. The molecule is a cholesterol translocation that impacts aging, barth syndrome, and non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure, a apoptosis, and a proton trap for oxidative phosphorylation, and it impacts tangier disease.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is both a stabilizing mitochondrial structure and a cholesterol translocation. The molecule is a stabilizing cytochrome oxidase and a apoptosis, impacting both non-alcoholic fatty liver disease and aging. The molecule is a proton trap for oxidative phosphorylation that impacts diabetic heart disease, tangier disease, and barth syndrome.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure that impacts diabetic heart disease. The molecule is a stabilizing cytochrome oxidase and a proton trap for oxidative phosphorylation, impacting both tangier disease and aging. The molecule is a apoptosis and a cholesterol translocation, impacting both non-alcoholic fatty liver disease and barth syndrome.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation and a apoptosis, impacting both barth syndrome and aging. The molecule is a stabilizing cytochrome oxidase and a cholesterol translocation that impacts tangier disease, non-alcoholic fatty liver disease, and diabetic heart disease. The molecule is a stabilizing mitochondrial structure.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a apoptosis, stabilizing mitochondrial structure, cholesterol translocation that impacts aging, tangier disease, and non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation and a stabilizing cytochrome oxidase, impacting both diabetic heart disease and barth syndrome.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, cholesterol translocation that impacts non-alcoholic fatty liver disease and tangier disease. The molecule is a apoptosis and a proton trap for oxidative phosphorylation that impacts diabetic heart disease, aging, and barth syndrome.",
"role": "assistant"
}
]
|
{
"smiles": [
"c1ccc(CN2CCOCC2Cn2cccn2)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a fgfr inhibitor.",
"role": "assistant"
}
]
|
{
"smiles": [
"c1ccc(CN2CCOCC2Cn2cccn2)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a fgfr inhibitor.",
"role": "assistant"
}
]
|
{
"smiles": [
"c1ccc(CN2CCOCC2Cn2cccn2)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a fgfr inhibitor.",
"role": "assistant"
}
]
|
{
"smiles": [
"c1ccc(CN2CCOCC2Cn2cccn2)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a fgfr inhibitor.",
"role": "assistant"
}
]
|
{
"smiles": [
"c1ccc(CN2CCOCC2Cn2cccn2)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is a fgfr inhibitor.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCC(O)C(O)CC=CCCCCC)COP(=O)(O)OC1C(O)C(O)C(O)C(O)C1O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "It has an effect on stomach cancer, impacting both alzheimer's disease and seizure. It has an effect on breast cancer, and impacts diabetes mellitus, cardiovascular disease, and parkinson's disease. It impacts colorectal cancer.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCC(O)C(O)CC=CCCCCC)COP(=O)(O)OC1C(O)C(O)C(O)C(O)C1O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "It impacts colorectal cancer, parkinson's disease, and alzheimer's disease. It has an effect on breast cancer, and impacts diabetes mellitus, stomach cancer, cardiovascular disease, and seizure.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCC(O)C(O)CC=CCCCCC)COP(=O)(O)OC1C(O)C(O)C(O)C(O)C1O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "It has an effect on and impacts multiple systems, including breast cancer, colorectal cancer, stomach cancer, cardiovascular disease, parkinson's disease, and seizure. It impacts both diabetes mellitus and alzheimer's disease.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCC(O)C(O)CC=CCCCCC)COP(=O)(O)OC1C(O)C(O)C(O)C(O)C1O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "It has an effect on stomach cancer, impacting both breast cancer and diabetes mellitus. It impacts seizure, colorectal cancer, cardiovascular disease, parkinson's disease, and alzheimer's disease.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCC(O)C(O)CC=CCCCCC)COP(=O)(O)OC1C(O)C(O)C(O)C(O)C1O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "It impacts alzheimer's disease, parkinson's disease, and colorectal cancer. It has an effect on stomach cancer, and impacts cardiovascular disease, breast cancer, and seizure. It impacts diabetes mellitus.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation that impacts barth syndrome. The molecule is a stabilizing cytochrome oxidase and a proton trap for oxidative phosphorylation, impacting both non-alcoholic fatty liver disease and aging. The molecule is a stabilizing mitochondrial structure and a apoptosis, impacting both tangier disease and diabetic heart disease.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "It impacts aging. The molecule is a apoptosis, a stabilizing mitochondrial structure, and a stabilizing cytochrome oxidase, and it impacts non-alcoholic fatty liver disease. The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation that impacts diabetic heart disease, barth syndrome, and tangier disease.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase, cholesterol translocation, apoptosis that impacts barth syndrome and tangier disease. The molecule is a stabilizing mitochondrial structure that impacts aging, non-alcoholic fatty liver disease, and diabetic heart disease.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation and a stabilizing cytochrome oxidase that impacts diabetic heart disease, aging, and tangier disease. The molecule is a proton trap for oxidative phosphorylation, stabilizing mitochondrial structure, apoptosis that impacts barth syndrome and non-alcoholic fatty liver disease.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation and apoptosis, and it impacts non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure, a stabilizing cytochrome oxidase, and a cholesterol translocation, and it impacts diabetic heart disease. It impacts barth syndrome, tangier disease, and aging.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC(C)CC)COC(=O)CCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a inflammatory and a nutrient that impacts atherosclerosis, cardiovascular disease, obesity, and metabolic syndrome. The molecule is a energy storage that impacts both thyroxine treatment and pancreatitis. The molecule is a fat storage, a membrane stabilizer, and a energy source, and it impacts cancer.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC(C)CC)COC(=O)CCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a inflammatory, energy storage, membrane stabilizer that impacts atherosclerosis and cardiovascular disease. The molecule is a nutrient and thyroxine treatment, which has an effect on cancer and impacts obesity, metabolic syndrome, and pancreatitis. The molecule is both a fat storage and a energy source.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC(C)CC)COC(=O)CCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "It impacts obesity, pancreatitis, and cardiovascular disease. The molecule is a fat storage, energy storage, inflammatory that impacts atherosclerosis and metabolic syndrome. The molecule is a energy source, nutrient, membrane stabilizer that has an effect on cancer and impacts thyroxine treatment.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC(C)CC)COC(=O)CCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is a nutrient and a energy storage, impacting both obesity and atherosclerosis. The molecule is a thyroxine treatment and a inflammatory, impacting both pancreatitis and cardiovascular disease. The molecule is a membrane stabilizer, fat storage, energy source that has an effect on cancer and impacts metabolic syndrome.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC(C)CC)COC(=O)CCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a nutrient, inflammatory, fat storage, energy storage with an effect on cancer. The molecule is a energy source that impacts atherosclerosis, metabolic syndrome, pancreatitis, thyroxine treatment, and cardiovascular disease. The molecule is a membrane stabilizer that impacts obesity.",
"role": "assistant"
}
]
|
{
"smiles": [
"CC(Oc1ccc(C2(S(=O)(=O)c3ccc(F)cc3)CCN(C(=O)C3CCS(=O)(=O)CC3)C2)cc1)c1ccccc1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is a cancer treatment.",
"role": "assistant"
}
]
|
{
"smiles": [
"CC(Oc1ccc(C2(S(=O)(=O)c3ccc(F)cc3)CCN(C(=O)C3CCS(=O)(=O)CC3)C2)cc1)c1ccccc1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is cancer treatment.",
"role": "assistant"
}
]
|
{
"smiles": [
"CC(Oc1ccc(C2(S(=O)(=O)c3ccc(F)cc3)CCN(C(=O)C3CCS(=O)(=O)CC3)C2)cc1)c1ccccc1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a cancer treatment.",
"role": "assistant"
}
]
|
{
"smiles": [
"CC(Oc1ccc(C2(S(=O)(=O)c3ccc(F)cc3)CCN(C(=O)C3CCS(=O)(=O)CC3)C2)cc1)c1ccccc1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "It belongs to the cancer treatment class of molecules.",
"role": "assistant"
}
]
|
{
"smiles": [
"CC(Oc1ccc(C2(S(=O)(=O)c3ccc(F)cc3)CCN(C(=O)C3CCS(=O)(=O)CC3)C2)cc1)c1ccccc1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is cancer treatment.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "It impacts both aging and diabetic heart disease. The molecule is a stabilizing mitochondrial structure and a cholesterol translocation, impacting both barth syndrome and non-alcoholic fatty liver disease. The molecule is a stabilizing cytochrome oxidase, a proton trap for oxidative phosphorylation, and a apoptosis, and it impacts tangier disease.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation, a cholesterol translocation, and a stabilizing cytochrome oxidase, and it impacts barth syndrome. The molecule is a stabilizing mitochondrial structure that impacts aging, diabetic heart disease, and non-alcoholic fatty liver disease. The molecule is a apoptosis that impacts tangier disease.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation, impacting both diabetic heart disease and aging. The molecule is a apoptosis, stabilizing mitochondrial structure, stabilizing cytochrome oxidase that impacts barth syndrome, non-alcoholic fatty liver disease, and tangier disease.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase, cholesterol translocation, proton trap for oxidative phosphorylation that impacts tangier disease and diabetic heart disease. The molecule is a stabilizing mitochondrial structure and a apoptosis that impacts aging, non-alcoholic fatty liver disease, and barth syndrome.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase that impacts barth syndrome, diabetic heart disease, and aging. The molecule is a proton trap for oxidative phosphorylation, apoptosis, cholesterol translocation, stabilizing mitochondrial structure that impacts tangier disease and non-alcoholic fatty liver disease.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCCCCC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(N)C(=O)O)OC(=O)CCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is both a emulsifier and a membrane stabilizer. The molecule is a food additive, a nutrient, and smooth. The molecule is a energy source, nutritional supplement, energy storage, surfactant.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCCCCC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(N)C(=O)O)OC(=O)CCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a membrane stabilizer, nutritional supplement, surfactant, emulsifier. The molecule is a nutrient, a energy source, a energy storage, and smooth. The molecule is a food additive.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCCCCC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(N)C(=O)O)OC(=O)CCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is both a emulsifier and a surfactant. The molecule is a membrane stabilizer, a food additive, and smooth. The molecule is a nutritional supplement, nutrient, energy source, energy storage.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCCCCC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(N)C(=O)O)OC(=O)CCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a nutritional supplement, a energy source, and smooth. The molecule is a membrane stabilizer, surfactant, emulsifier, energy storage, food additive, nutrient.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCCCCC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(N)C(=O)O)OC(=O)CCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a energy storage, food additive, nutritional supplement, nutrient, membrane stabilizer. The molecule is a emulsifier, a surfactant, a energy source, and smooth.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCC=CC=CCCCCCCCCC(=O)OC(CC(=O)[O-])C[N+](C)(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "It has an effect on breast cancer. It impacts celiac disease, inflammatory bowel disease, and renal cell carcinoma. The molecule is a energy source that impacts cardiovascular disease, heart failure, and diabetes mellitus type 2.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCC=CC=CCCCCCCCCC(=O)OC(CC(=O)[O-])C[N+](C)(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "It impacts breast cancer, inflammatory bowel disease, and cardiovascular disease. It impacts diabetes mellitus type 2, renal cell carcinoma, heart failure, and celiac disease. The molecule is a energy source.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCC=CC=CCCCCCCCCC(=O)OC(CC(=O)[O-])C[N+](C)(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "It impacts heart failure. It impacts cardiovascular disease, diabetes mellitus type 2, and renal cell carcinoma. The molecule is a energy source that impacts inflammatory bowel disease, celiac disease, and breast cancer.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCC=CC=CCCCCCCCCC(=O)OC(CC(=O)[O-])C[N+](C)(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a energy source that affects breast cancer by impacting inflammatory bowel disease. It impacts celiac disease, cardiovascular disease, heart failure, and diabetes mellitus type 2. It impacts renal cell carcinoma.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCC=CC=CCCCCCCCCC(=O)OC(CC(=O)[O-])C[N+](C)(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a energy source that impacts both breast cancer and celiac disease. It impacts inflammatory bowel disease, heart failure, renal cell carcinoma, and diabetes mellitus type 2. It impacts cardiovascular disease.",
"role": "assistant"
}
]
|
{
"smiles": [
"C[N+](C)(C)CC(CC(=O)[O-])OC(=O)CCCCC(=O)OCCO"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "It impacts both heart failure and inflammatory bowel disease. The molecule is a energy source that impacts breast cancer, diabetes mellitus type 2, cardiovascular disease, renal cell carcinoma, and celiac disease.",
"role": "assistant"
}
]
|
{
"smiles": [
"C[N+](C)(C)CC(CC(=O)[O-])OC(=O)CCCCC(=O)OCCO"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a energy source that impacts both heart failure and celiac disease. It impacts diabetes mellitus type 2, cardiovascular disease, renal cell carcinoma, and inflammatory bowel disease. It has an effect on breast cancer.",
"role": "assistant"
}
]
|
{
"smiles": [
"C[N+](C)(C)CC(CC(=O)[O-])OC(=O)CCCCC(=O)OCCO"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a energy source that impacts both renal cell carcinoma and diabetes mellitus type 2. It impacts celiac disease, heart failure, cardiovascular disease, and inflammatory bowel disease. It has an effect on breast cancer.",
"role": "assistant"
}
]
|
{
"smiles": [
"C[N+](C)(C)CC(CC(=O)[O-])OC(=O)CCCCC(=O)OCCO"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "It has an effect on breast cancer, and impacts celiac disease, renal cell carcinoma, diabetes mellitus type 2, heart failure, and cardiovascular disease. The molecule is a energy source that impacts inflammatory bowel disease.",
"role": "assistant"
}
]
|
{
"smiles": [
"C[N+](C)(C)CC(CC(=O)[O-])OC(=O)CCCCC(=O)OCCO"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "It impacts heart failure, renal cell carcinoma, and celiac disease. The molecule is a energy source that affects breast cancer by impacting inflammatory bowel disease, cardiovascular disease, and diabetes mellitus type 2.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCC=CCC=CCC=CCC=CCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase and a stabilizing mitochondrial structure, impacting both barth syndrome and diabetic heart disease. The molecule is a proton trap for oxidative phosphorylation, apoptosis, cholesterol translocation that impacts aging, non-alcoholic fatty liver disease, and tangier disease.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCC=CCC=CCC=CCC=CCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure and proton trap for oxidative phosphorylation, and it impacts diabetic heart disease. The molecule is a apoptosis that impacts both non-alcoholic fatty liver disease and tangier disease. The molecule is a stabilizing cytochrome oxidase and a cholesterol translocation, impacting both barth syndrome and aging.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCC=CCC=CCC=CCC=CCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase that impacts both aging and tangier disease. The molecule is a proton trap for oxidative phosphorylation and apoptosis, and it impacts barth syndrome. The molecule is a cholesterol translocation and a stabilizing mitochondrial structure, impacting both non-alcoholic fatty liver disease and diabetic heart disease.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCC=CCC=CCC=CCC=CCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation and stabilizing cytochrome oxidase, and it impacts barth syndrome. It impacts aging, non-alcoholic fatty liver disease, tangier disease, and diabetic heart disease. The molecule is a stabilizing mitochondrial structure, a apoptosis, and a cholesterol translocation.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCC=CCC=CCC=CCC=CCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is both a cholesterol translocation and a proton trap for oxidative phosphorylation. The molecule is a stabilizing mitochondrial structure that impacts aging, barth syndrome, and tangier disease. The molecule is a stabilizing cytochrome oxidase and a apoptosis, impacting both diabetic heart disease and non-alcoholic fatty liver disease.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCOc1ccc(NC(=O)N(S)C(=O)c2ccc(CO)nc2)cc1C(F)(F)F"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "It belongs to the anti viral class of molecules.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCOc1ccc(NC(=O)N(S)C(=O)c2ccc(CO)nc2)cc1C(F)(F)F"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is anti viral.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCOc1ccc(NC(=O)N(S)C(=O)c2ccc(CO)nc2)cc1C(F)(F)F"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a anti viral.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCOc1ccc(NC(=O)N(S)C(=O)c2ccc(CO)nc2)cc1C(F)(F)F"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is anti viral.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCOc1ccc(NC(=O)N(S)C(=O)c2ccc(CO)nc2)cc1C(F)(F)F"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is anti viral.",
"role": "assistant"
}
]
|
{
"smiles": [
"CC12CCC(C(=O)O)C1(C)OC2=O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a jak3 inhibitor.",
"role": "assistant"
}
]
|
{
"smiles": [
"CC12CCC(C(=O)O)C1(C)OC2=O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a jak3 inhibitor.",
"role": "assistant"
}
]
|
{
"smiles": [
"CC12CCC(C(=O)O)C1(C)OC2=O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a jak3 inhibitor.",
"role": "assistant"
}
]
|
{
"smiles": [
"CC12CCC(C(=O)O)C1(C)OC2=O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a jak3 inhibitor.",
"role": "assistant"
}
]
|
{
"smiles": [
"CC12CCC(C(=O)O)C1(C)OC2=O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a jak3 inhibitor.",
"role": "assistant"
}
]
|
{
"smiles": [
"CC1(C)c2ccccc2-c2ccc(N(c3cc(-c4ccccc4)cc(-c4ccccc4)c3)c3ccc4cc(-c5ccc6oc7ccccc7c6c5)ccc4c3)cc21"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a optoelectronic member of the organic optoelectronic device class.",
"role": "assistant"
}
]
|
{
"smiles": [
"CC1(C)c2ccccc2-c2ccc(N(c3cc(-c4ccccc4)cc(-c4ccccc4)c3)c3ccc4cc(-c5ccc6oc7ccccc7c6c5)ccc4c3)cc21"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a organic optoelectronic device and belongs to the optoelectronic class of molecules.",
"role": "assistant"
}
]
|
{
"smiles": [
"CC1(C)c2ccccc2-c2ccc(N(c3cc(-c4ccccc4)cc(-c4ccccc4)c3)c3ccc4cc(-c5ccc6oc7ccccc7c6c5)ccc4c3)cc21"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is both a organic optoelectronic device and a optoelectronic.",
"role": "assistant"
}
]
|
{
"smiles": [
"CC1(C)c2ccccc2-c2ccc(N(c3cc(-c4ccccc4)cc(-c4ccccc4)c3)c3ccc4cc(-c5ccc6oc7ccccc7c6c5)ccc4c3)cc21"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "It belongs to both the optoelectronic and organic optoelectronic device classes of molecules.",
"role": "assistant"
}
]
|
{
"smiles": [
"CC1(C)c2ccccc2-c2ccc(N(c3cc(-c4ccccc4)cc(-c4ccccc4)c3)c3ccc4cc(-c5ccc6oc7ccccc7c6c5)ccc4c3)cc21"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a organic optoelectronic device and is optoelectronic.",
"role": "assistant"
}
]
|
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.