molecules
dict | messages
listlengths 3
3
|
|---|---|
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure and proton trap for oxidative phosphorylation, and it impacts tangier disease. The molecule is a cholesterol translocation and apoptosis, and it impacts diabetic heart disease. The molecule is a stabilizing cytochrome oxidase that impacts barth syndrome, non-alcoholic fatty liver disease, and aging.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure and a apoptosis, impacting both aging and diabetic heart disease. The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation, impacting both tangier disease and barth syndrome.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation, a apoptosis, and a cholesterol translocation. The molecule is a stabilizing cytochrome oxidase that impacts diabetic heart disease, barth syndrome, and non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure that impacts both tangier disease and aging.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "It impacts tangier disease, non-alcoholic fatty liver disease, and aging. The molecule is a stabilizing mitochondrial structure, a stabilizing cytochrome oxidase, and a apoptosis, and it impacts diabetic heart disease. The molecule is a proton trap for oxidative phosphorylation and cholesterol translocation, and it impacts barth syndrome.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase and a apoptosis, impacting both tangier disease and diabetic heart disease. The molecule is a stabilizing mitochondrial structure, a proton trap for oxidative phosphorylation, and a cholesterol translocation, and it impacts non-alcoholic fatty liver disease. It impacts both aging and barth syndrome.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "It impacts tangier disease. The molecule is a apoptosis and a stabilizing cytochrome oxidase, impacting both barth syndrome and aging. The molecule is a cholesterol translocation, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease and diabetic heart disease.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase and a stabilizing mitochondrial structure, impacting both barth syndrome and tangier disease. The molecule is a cholesterol translocation and a apoptosis that impacts diabetic heart disease, aging, and non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation, impacting both barth syndrome and tangier disease. The molecule is a apoptosis and a stabilizing mitochondrial structure that impacts diabetic heart disease, non-alcoholic fatty liver disease, and aging. The molecule is a stabilizing cytochrome oxidase.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation, a cholesterol translocation, and a stabilizing cytochrome oxidase, and it impacts diabetic heart disease. The molecule is a stabilizing mitochondrial structure and a apoptosis, impacting both aging and tangier disease. It impacts both barth syndrome and non-alcoholic fatty liver disease.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease, tangier disease, and diabetic heart disease. The molecule is a stabilizing mitochondrial structure, a proton trap for oxidative phosphorylation, and a cholesterol translocation, and it impacts barth syndrome. The molecule is a apoptosis that impacts aging.",
"role": "assistant"
}
]
|
{
"smiles": [
"CSCC1OC(n2ccc3cncnc32)CC1C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a prmt5 inhibitor.",
"role": "assistant"
}
]
|
{
"smiles": [
"CSCC1OC(n2ccc3cncnc32)CC1C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a prmt5 inhibitor.",
"role": "assistant"
}
]
|
{
"smiles": [
"CSCC1OC(n2ccc3cncnc32)CC1C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a prmt5 inhibitor.",
"role": "assistant"
}
]
|
{
"smiles": [
"CSCC1OC(n2ccc3cncnc32)CC1C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a prmt5 inhibitor.",
"role": "assistant"
}
]
|
{
"smiles": [
"CSCC1OC(n2ccc3cncnc32)CC1C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a prmt5 inhibitor.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCCCCCCC=CCC=CCC=CCC)COC(=O)CCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a thyroxine treatment that impacts atherosclerosis, pancreatitis, and metabolic syndrome. The molecule is a nutrient and fat storage, and it impacts cardiovascular disease.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCCCCCCC=CCC=CCC=CCC)COC(=O)CCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a nutrient and a fat storage, which impacts both metabolic syndrome and pancreatitis, and is characterized as thyroxine treatment. It impacts both cardiovascular disease and atherosclerosis.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCCCCCCC=CCC=CCC=CCC)COC(=O)CCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is thyroxine treatment and it impacts cardiovascular disease. The molecule is a fat storage and a nutrient that impacts atherosclerosis, metabolic syndrome, and pancreatitis.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCCCCCCC=CCC=CCC=CCC)COC(=O)CCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a nutrient that impacts cardiovascular disease, metabolic syndrome, atherosclerosis, and thyroxine treatment. The molecule is a fat storage that impacts pancreatitis.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCCCCCCC=CCC=CCC=CCC)COC(=O)CCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a fat storage and thyroxine treatment, and it impacts cardiovascular disease. The molecule is a nutrient that impacts pancreatitis, metabolic syndrome, and atherosclerosis.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCC=CCC=CCC=CCC=CCCCCCCC(=O)OC(COC(=O)CCCCCCCC=CCCCCCCCC)COP(=O)([O-])OCC[N+](C)(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a nutrient that affects cervical cancer by impacting ulcerative colitis, atherosclerosis, and breast cancer.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCC=CCC=CCC=CCC=CCCCCCCC(=O)OC(COC(=O)CCCCCCCC=CCCCCCCCC)COP(=O)([O-])OCC[N+](C)(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a nutrient that affects both breast cancer and cervical cancer, and also impacts atherosclerosis and ulcerative colitis.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCC=CCC=CCC=CCC=CCCCCCCC(=O)OC(COC(=O)CCCCCCCC=CCCCCCCCC)COP(=O)([O-])OCC[N+](C)(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a nutrient that affects both breast cancer and cervical cancer, and also impacts ulcerative colitis and atherosclerosis.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCC=CCC=CCC=CCC=CCCCCCCC(=O)OC(COC(=O)CCCCCCCC=CCCCCCCCC)COP(=O)([O-])OCC[N+](C)(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a nutrient that affects cervical cancer by impacting ulcerative colitis, atherosclerosis, and breast cancer.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCC=CCC=CCC=CCC=CCCCCCCC(=O)OC(COC(=O)CCCCCCCC=CCCCCCCCC)COP(=O)([O-])OCC[N+](C)(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "It has an effect on cervical cancer. The molecule is a nutrient that affects breast cancer by impacting both atherosclerosis and ulcerative colitis.",
"role": "assistant"
}
]
|
{
"smiles": [
"CC12CCC3c4ccc(OS(=O)(=O)O)cc4CCC3C1CC(OC1OC(C(=O)O)C(O)C(O)C1O)C2O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a energy source. The molecule is a energy storage, a membrane stabilizer, and a surfactant. The molecule is a emulsifier, signalling molecule, waste product and belongs to the drug metabolite class of molecules.",
"role": "assistant"
}
]
|
{
"smiles": [
"CC12CCC3c4ccc(OS(=O)(=O)O)cc4CCC3C1CC(OC1OC(C(=O)O)C(O)C(O)C1O)C2O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a membrane stabilizer, surfactant, energy source, emulsifier and belongs to the drug metabolite class of molecules. The molecule is a waste product, a energy storage, and a signalling molecule.",
"role": "assistant"
}
]
|
{
"smiles": [
"CC12CCC3c4ccc(OS(=O)(=O)O)cc4CCC3C1CC(OC1OC(C(=O)O)C(O)C(O)C1O)C2O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is a surfactant, a signalling molecule, and a membrane stabilizer. The molecule is a emulsifier, energy source, energy storage and belongs to the drug metabolite class of molecules. The molecule is a waste product.",
"role": "assistant"
}
]
|
{
"smiles": [
"CC12CCC3c4ccc(OS(=O)(=O)O)cc4CCC3C1CC(OC1OC(C(=O)O)C(O)C(O)C1O)C2O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a signalling molecule. The molecule is a surfactant and a membrane stabilizer, belonging to the drug metabolite class of molecules. The molecule is a energy storage, energy source, emulsifier, waste product.",
"role": "assistant"
}
]
|
{
"smiles": [
"CC12CCC3c4ccc(OS(=O)(=O)O)cc4CCC3C1CC(OC1OC(C(=O)O)C(O)C(O)C1O)C2O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is both a emulsifier and a energy source. The molecule is a signalling molecule, membrane stabilizer, surfactant, waste product, energy storage and belongs to the drug metabolite class of molecules.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation and a apoptosis, impacting both aging and barth syndrome. The molecule is a stabilizing mitochondrial structure, cholesterol translocation, stabilizing cytochrome oxidase that impacts tangier disease and non-alcoholic fatty liver disease. It impacts diabetic heart disease.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a apoptosis that impacts both aging and diabetic heart disease. The molecule is a stabilizing mitochondrial structure and cholesterol translocation, and it impacts tangier disease. The molecule is a stabilizing cytochrome oxidase and a proton trap for oxidative phosphorylation, impacting both barth syndrome and non-alcoholic fatty liver disease.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure and a cholesterol translocation that impacts tangier disease, diabetic heart disease, and non-alcoholic fatty liver disease. The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, apoptosis that impacts barth syndrome and aging.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase, a apoptosis, and a proton trap for oxidative phosphorylation, and it impacts barth syndrome. The molecule is a stabilizing mitochondrial structure and a cholesterol translocation that impacts diabetic heart disease, tangier disease, aging, and non-alcoholic fatty liver disease.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation that impacts both diabetic heart disease and aging. The molecule is a stabilizing mitochondrial structure and a proton trap for oxidative phosphorylation, impacting both tangier disease and barth syndrome. The molecule is a stabilizing cytochrome oxidase and apoptosis, and it impacts non-alcoholic fatty liver disease.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCC=CCC=CCC=CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation that impacts diabetic heart disease, tangier disease, aging, and non-alcoholic fatty liver disease. The molecule is a apoptosis, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts barth syndrome.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCC=CCC=CCC=CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure and apoptosis, and it impacts barth syndrome. The molecule is a proton trap for oxidative phosphorylation that impacts both diabetic heart disease and tangier disease. The molecule is a cholesterol translocation and a stabilizing cytochrome oxidase, impacting both non-alcoholic fatty liver disease and aging.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCC=CCC=CCC=CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation, apoptosis, cholesterol translocation that impacts non-alcoholic fatty liver disease and aging. The molecule is a stabilizing mitochondrial structure and a stabilizing cytochrome oxidase that impacts tangier disease, diabetic heart disease, and barth syndrome.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCC=CCC=CCC=CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "It impacts both non-alcoholic fatty liver disease and tangier disease. The molecule is a apoptosis and a stabilizing cytochrome oxidase, impacting both barth syndrome and diabetic heart disease. The molecule is a cholesterol translocation, a stabilizing mitochondrial structure, and a proton trap for oxidative phosphorylation, and it impacts aging.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCC=CCC=CCC=CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts diabetic heart disease, tangier disease, and aging. The molecule is a stabilizing mitochondrial structure and a apoptosis, impacting both non-alcoholic fatty liver disease and barth syndrome.",
"role": "assistant"
}
]
|
{
"smiles": [
"CC(O)C(NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C1CC2CC2N1C(=O)C(NC(=O)OC(C)(C)C)C(C)O)C(N)=O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a nmda receptor modulator.",
"role": "assistant"
}
]
|
{
"smiles": [
"CC(O)C(NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C1CC2CC2N1C(=O)C(NC(=O)OC(C)(C)C)C(C)O)C(N)=O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "It belongs to the nmda receptor modulator class of molecules.",
"role": "assistant"
}
]
|
{
"smiles": [
"CC(O)C(NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C1CC2CC2N1C(=O)C(NC(=O)OC(C)(C)C)C(C)O)C(N)=O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is nmda receptor modulator.",
"role": "assistant"
}
]
|
{
"smiles": [
"CC(O)C(NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C1CC2CC2N1C(=O)C(NC(=O)OC(C)(C)C)C(C)O)C(N)=O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is nmda receptor modulator.",
"role": "assistant"
}
]
|
{
"smiles": [
"CC(O)C(NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C1CC2CC2N1C(=O)C(NC(=O)OC(C)(C)C)C(C)O)C(N)=O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a nmda receptor modulator.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCC=CCC=CCCCCCCCCCCCC(=O)OCC(O)COC(=O)CCCCCCCC=CCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "It impacts insulin resistance.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCC=CCC=CCCCCCCCCCCCC(=O)OCC(O)COC(=O)CCCCCCCC=CCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "It impacts insulin resistance.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCC=CCC=CCCCCCCCCCCCC(=O)OCC(O)COC(=O)CCCCCCCC=CCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "It impacts insulin resistance.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCC=CCC=CCCCCCCCCCCCC(=O)OCC(O)COC(=O)CCCCCCCC=CCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "It impacts insulin resistance.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCC=CCC=CCCCCCCCCCCCC(=O)OCC(O)COC(=O)CCCCCCCC=CCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "It impacts insulin resistance.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCCCCC=CCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a member of the thyroxine treatment class and affects both atherosclerosis and cardiovascular disease. The molecule is a fat storage and a nutrient, impacting both pancreatitis and metabolic syndrome.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCCCCC=CCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a thyroxine treatment that impacts both cardiovascular disease and pancreatitis. The molecule is a nutrient and a fat storage, impacting both metabolic syndrome and atherosclerosis.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCCCCC=CCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a nutrient that impacts both atherosclerosis and pancreatitis. The molecule is a fat storage and thyroxine treatment, impacting both metabolic syndrome and cardiovascular disease.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCCCCC=CCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a nutrient and thyroxine treatment, and it impacts cardiovascular disease. The molecule is a fat storage that impacts metabolic syndrome, atherosclerosis, and pancreatitis.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCCCCC=CCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a thyroxine treatment and a fat storage that impacts cardiovascular disease, metabolic syndrome, atherosclerosis, and pancreatitis. The molecule is a nutrient.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCC=CCC=CCC=CCC=CCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase that impacts tangier disease, aging, non-alcoholic fatty liver disease, and barth syndrome. The molecule is a stabilizing mitochondrial structure, apoptosis, proton trap for oxidative phosphorylation, cholesterol translocation that impacts diabetic heart disease.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCC=CCC=CCC=CCC=CCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "It impacts barth syndrome. The molecule is a stabilizing mitochondrial structure and a stabilizing cytochrome oxidase, impacting both diabetic heart disease and tangier disease. The molecule is a cholesterol translocation, proton trap for oxidative phosphorylation, apoptosis that impacts aging and non-alcoholic fatty liver disease.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCC=CCC=CCC=CCC=CCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase, apoptosis that impacts barth syndrome. The molecule is a stabilizing mitochondrial structure that impacts aging, tangier disease, non-alcoholic fatty liver disease, and diabetic heart disease.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCC=CCC=CCC=CCC=CCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase and apoptosis, and it impacts aging. The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation, impacting both diabetic heart disease and non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure that impacts both tangier disease and barth syndrome.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCC=CCC=CCC=CCC=CCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation that impacts both tangier disease and barth syndrome. The molecule is a stabilizing mitochondrial structure, a stabilizing cytochrome oxidase, and a cholesterol translocation, and it impacts aging. The molecule is a apoptosis that impacts both diabetic heart disease and non-alcoholic fatty liver disease.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a apoptosis, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts tangier disease, diabetic heart disease, and aging. The molecule is a proton trap for oxidative phosphorylation and a cholesterol translocation, impacting both non-alcoholic fatty liver disease and barth syndrome.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase, apoptosis, cholesterol translocation, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure that impacts aging. It impacts diabetic heart disease, non-alcoholic fatty liver disease, barth syndrome, and tangier disease.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure, a stabilizing cytochrome oxidase, and a cholesterol translocation. The molecule is a proton trap for oxidative phosphorylation and a apoptosis, impacting both tangier disease and aging. It impacts non-alcoholic fatty liver disease, diabetic heart disease, and barth syndrome.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase and a proton trap for oxidative phosphorylation that impacts tangier disease, diabetic heart disease, and aging. The molecule is a cholesterol translocation, stabilizing mitochondrial structure, apoptosis that impacts non-alcoholic fatty liver disease and barth syndrome.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase and a stabilizing mitochondrial structure, impacting both tangier disease and aging. The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation, impacting both barth syndrome and non-alcoholic fatty liver disease. The molecule is a apoptosis that impacts diabetic heart disease.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCC=CCC=CCC=CCC=CCC=CCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a food additive. The molecule is a stabilizing mitochondrial structure and smooth, impacting both diabetic heart disease and barth syndrome. The molecule is a energy storage, a cholesterol translocation, and a energy source, and it impacts aging. The molecule is a emulsifier, stabilizing cytochrome oxidase, membrane stabilizer, proton trap for oxidative phosphorylation. The molecule is a nutritional supplement, apoptosis, surfactant that impacts tangier disease and non-alcoholic fatty liver disease.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCC=CCC=CCC=CCC=CCC=CCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase, a cholesterol translocation, a energy storage, and smooth. The molecule is a nutritional supplement, a surfactant, and a stabilizing mitochondrial structure, and it impacts non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation, emulsifier, apoptosis, membrane stabilizer that impacts aging. The molecule is a food additive and a energy source that impacts barth syndrome, tangier disease, and diabetic heart disease.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCC=CCC=CCC=CCC=CCC=CCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation and a emulsifier, it impacts tangier disease, and is smooth. The molecule is a energy source, a stabilizing cytochrome oxidase, and a membrane stabilizer, and it impacts diabetic heart disease. The molecule is a surfactant, a apoptosis, and a food additive, and it impacts aging. The molecule is a stabilizing mitochondrial structure, energy storage, nutritional supplement that impacts non-alcoholic fatty liver disease and barth syndrome. The molecule is a proton trap for oxidative phosphorylation.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCC=CCC=CCC=CCC=CCC=CCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase, nutritional supplement, membrane stabilizer, apoptosis that impacts non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure, surfactant, proton trap for oxidative phosphorylation that impacts aging and tangier disease. The molecule is a energy source, a cholesterol translocation, a emulsifier, and smooth. The molecule is a food additive and a energy storage, impacting both barth syndrome and diabetic heart disease.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCC=CCC=CCC=CCC=CCC=CCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation that impacts aging. The molecule is a membrane stabilizer and a stabilizing cytochrome oxidase, it impacts barth syndrome, and is smooth. The molecule is a nutritional supplement, stabilizing mitochondrial structure, emulsifier, energy storage. The molecule is a proton trap for oxidative phosphorylation, a surfactant, and a food additive, and it impacts non-alcoholic fatty liver disease. The molecule is a apoptosis and a energy source, impacting both diabetic heart disease and tangier disease.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation that impacts both diabetic heart disease and barth syndrome. The molecule is a stabilizing mitochondrial structure and a stabilizing cytochrome oxidase, impacting both tangier disease and non-alcoholic fatty liver disease. The molecule is a cholesterol translocation and apoptosis, and it impacts aging.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase and a cholesterol translocation, impacting both aging and diabetic heart disease. The molecule is a apoptosis, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation that impacts barth syndrome, tangier disease, and non-alcoholic fatty liver disease.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase, cholesterol translocation, proton trap for oxidative phosphorylation that impacts barth syndrome, tangier disease, and diabetic heart disease. The molecule is a apoptosis and a stabilizing mitochondrial structure, impacting both aging and non-alcoholic fatty liver disease.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "It impacts tangier disease, barth syndrome, and aging. The molecule is a stabilizing cytochrome oxidase and a stabilizing mitochondrial structure, impacting both diabetic heart disease and non-alcoholic fatty liver disease. The molecule is a cholesterol translocation, a apoptosis, and a proton trap for oxidative phosphorylation.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase. The molecule is a cholesterol translocation and a apoptosis, impacting both non-alcoholic fatty liver disease and barth syndrome. The molecule is a stabilizing mitochondrial structure and a proton trap for oxidative phosphorylation that impacts tangier disease, aging, and diabetic heart disease.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a membrane stabilizer and nutrient, and it impacts obesity. The molecule is a inflammatory and thyroxine treatment, impacting pancreatitis, cardiovascular disease, and atherosclerosis. The molecule is a energy source, fat storage, energy storage that impacts cancer and metabolic syndrome.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is both a energy source and a nutrient. The molecule is a energy storage that impacts cardiovascular disease, thyroxine treatment, obesity, and pancreatitis. The molecule is a inflammatory, fat storage, membrane stabilizer that impacts cancer, atherosclerosis, and metabolic syndrome.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is thyroxine treatment. The molecule is a energy source and a membrane stabilizer that impacts metabolic syndrome, cardiovascular disease, obesity, and pancreatitis. The molecule is a inflammatory, nutrient, energy storage, fat storage that impacts cancer and atherosclerosis.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a membrane stabilizer that impacts thyroxine treatment. The molecule is a energy storage and a inflammatory that impacts atherosclerosis, cardiovascular disease, and obesity. The molecule is a fat storage, nutrient, and energy source that has an effect on cancer and impacts both metabolic syndrome and pancreatitis.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a energy source that impacts both metabolic syndrome and cancer. The molecule is a nutrient and a inflammatory that impacts thyroxine treatment, pancreatitis, and cardiovascular disease. The molecule is a membrane stabilizer, energy storage, fat storage that impacts obesity and atherosclerosis.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a apoptosis. The molecule is a cholesterol translocation that impacts non-alcoholic fatty liver disease, tangier disease, and diabetic heart disease. The molecule is a proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts barth syndrome and aging.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a apoptosis and stabilizing mitochondrial structure, and it impacts aging. The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation, impacting both barth syndrome and tangier disease. The molecule is a stabilizing cytochrome oxidase that impacts both diabetic heart disease and non-alcoholic fatty liver disease.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase, a stabilizing mitochondrial structure, and a proton trap for oxidative phosphorylation, and it impacts barth syndrome. The molecule is a cholesterol translocation and a apoptosis that impacts tangier disease, aging, non-alcoholic fatty liver disease, and diabetic heart disease.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase, a stabilizing mitochondrial structure, and a proton trap for oxidative phosphorylation, and it impacts aging. The molecule is a apoptosis and a cholesterol translocation that impacts tangier disease, non-alcoholic fatty liver disease, barth syndrome, and diabetic heart disease.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure and a proton trap for oxidative phosphorylation, impacting both tangier disease and diabetic heart disease. The molecule is a apoptosis, a cholesterol translocation, and a stabilizing cytochrome oxidase, and it impacts aging. It impacts both barth syndrome and non-alcoholic fatty liver disease.",
"role": "assistant"
}
]
|
{
"smiles": [
"CC1CC2CC(c3cc(F)c(C(F)(F)Oc4cc(F)c(-c5cc(F)c(F)c(F)c5)c(F)c4)c(F)c3)CC2C1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is both a liquid crystal and a liquid crystal compound.",
"role": "assistant"
}
]
|
{
"smiles": [
"CC1CC2CC(c3cc(F)c(C(F)(F)Oc4cc(F)c(-c5cc(F)c(F)c(F)c5)c(F)c4)c(F)c3)CC2C1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is both a liquid crystal and a liquid crystal compound.",
"role": "assistant"
}
]
|
{
"smiles": [
"CC1CC2CC(c3cc(F)c(C(F)(F)Oc4cc(F)c(-c5cc(F)c(F)c(F)c5)c(F)c4)c(F)c3)CC2C1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is both a liquid crystal and a liquid crystal compound.",
"role": "assistant"
}
]
|
{
"smiles": [
"CC1CC2CC(c3cc(F)c(C(F)(F)Oc4cc(F)c(-c5cc(F)c(F)c(F)c5)c(F)c4)c(F)c3)CC2C1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is a liquid crystal compound and belongs to the liquid crystal class of molecules.",
"role": "assistant"
}
]
|
{
"smiles": [
"CC1CC2CC(c3cc(F)c(C(F)(F)Oc4cc(F)c(-c5cc(F)c(F)c(F)c5)c(F)c4)c(F)c3)CC2C1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is both a liquid crystal compound and a liquid crystal.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCCCCCCCCCCCCC(CO)OP(=O)([O-])OCC[N+](C)(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a asthma treatment.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCCCCCCCCCCCCC(CO)OP(=O)([O-])OCC[N+](C)(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "It belongs to the asthma treatment class of molecules.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCCCCCCCCCCCCC(CO)OP(=O)([O-])OCC[N+](C)(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a asthma treatment.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCCCCCCCCCCCCC(CO)OP(=O)([O-])OCC[N+](C)(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a asthma treatment.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCCCCCCCCCCCCC(CO)OP(=O)([O-])OCC[N+](C)(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "It belongs to the asthma treatment class of molecules.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCc1oc(CCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCC2C(O)CC(O)C2C=CC(O)CCCCC)COP(=O)([O-])OCC[N+](C)(C)C)c(C)c1C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a nutrient that impacts breast cancer, ulcerative colitis, cervical cancer, and atherosclerosis.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCc1oc(CCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCC2C(O)CC(O)C2C=CC(O)CCCCC)COP(=O)([O-])OCC[N+](C)(C)C)c(C)c1C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a nutrient that affects both cervical cancer and breast cancer, and also impacts ulcerative colitis and atherosclerosis.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCc1oc(CCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCC2C(O)CC(O)C2C=CC(O)CCCCC)COP(=O)([O-])OCC[N+](C)(C)C)c(C)c1C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a nutrient that impacts both breast cancer and atherosclerosis. It impacts both cervical cancer and ulcerative colitis.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCc1oc(CCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCC2C(O)CC(O)C2C=CC(O)CCCCC)COP(=O)([O-])OCC[N+](C)(C)C)c(C)c1C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "It has an effect on cervical cancer, impacting both breast cancer and ulcerative colitis. The molecule is a nutrient that impacts atherosclerosis.",
"role": "assistant"
}
]
|
{
"smiles": [
"CCCCCc1oc(CCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCC2C(O)CC(O)C2C=CC(O)CCCCC)COP(=O)([O-])OCC[N+](C)(C)C)c(C)c1C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "It impacts breast cancer. The molecule is a nutrient that impacts ulcerative colitis, cervical cancer, and atherosclerosis.",
"role": "assistant"
}
]
|
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.