instruction
stringlengths 48
868
| input
stringclasses 1
value | output
stringlengths 7
2.47k
|
|---|---|---|
Convert the following SMILES notation CC(C)COc1ccc(CN(CCO)CCO)cc1[N+](=O)[O-] into its IUPAC nomenclature. | 2-[2-hydroxyethyl-[[4-(2-methylpropoxy)-3-nitrophenyl]methyl]amino]ethanol |
|
Translate the given SMILES formula of a molecule CCC(C)OP(=O)(Oc1cccc([N+](C)(C)C)c1)OC(C)CC into its IUPAC name. | [3-di(butan-2-yloxy)phosphoryloxyphenyl]-trimethylazanium |
|
CN(C)CCOCCOC(=O)c1ccc(N)cc1 is the SMILES representation of a molecule. What is its IUPAC name? | 2-[2-(dimethylamino)ethoxy]ethyl 4-aminobenzoate |
|
Translate the given SMILES formula of a molecule CN1CCOC1c1ccc(C#N)cc1 into its IUPAC name. | 4-(3-methyl-1,3-oxazolidin-2-yl)benzonitrile |
|
Convert the following SMILES notation O=Cc1ccc(OCCCN2CCN(c3ccccc3)CC2)cc1 into its IUPAC nomenclature. | 4-[3-(4-phenylpiperazin-1-yl)propoxy]benzaldehyde |
|
Determine the IUPAC name for the molecule denoted by COc1cc(C(=O)OC2CN3CCC2CC3)cc(OC)c1OC . | 1-azabicyclo[2.2.2]octan-3-yl 3,4,5-trimethoxybenzoate |
|
Can you give the IUPAC name of the molecule CC(NCCN(C)C)C(=O)O ? | 2-[2-(dimethylamino)ethylamino]propanoic acid |
|
Turn the given SMILES symbol of a molecule CC1=C(COC(=O)C(O)(c2ccccc2)C2CCCC2)CN(C)CC1 into its respective IUPAC name. | (1,4-dimethyl-3,6-dihydro-2H-pyridin-5-yl)methyl 2-cyclopentyl-2-hydroxy-2-phenylacetate |
|
Determine the IUPAC name for the molecule denoted by CCCC(=O)N(C)C(=O)ON=C1CSCCS1 . | (1,4-dithian-2-ylideneamino) N-butanoyl-N-methylcarbamate |
|
Can you give the IUPAC name of the molecule COc1ccc(C(=O)Nc2ccc(C(=O)NN=Cc3ccc(OC)c(OC)c3)cc2)cc1 ? | N-[(3,4-dimethoxyphenyl)methylideneamino]-4-[(4-methoxybenzoyl)amino]benzamide |
|
Provide the IUPAC name for the molecule represented as C=CCOc1c(CC=C)cc(C(=O)O)cc1CC=C . | 4-prop-2-enoxy-3,5-bis(prop-2-enyl)benzoic acid |
|
Translate the given SMILES formula of a molecule CCCCn1cc(C(=O)C(=O)N(C)C)c2ccccc21 into its IUPAC name. | 2-(1-butylindol-3-yl)-N,N-dimethyl-2-oxoacetamide |
|
Turn the given SMILES symbol of a molecule O=C1N=CCN1c1ncc([N+](=O)[O-])s1 into its respective IUPAC name. | 3-(5-nitro-1,3-thiazol-2-yl)-4H-imidazol-2-one |
|
Determine the IUPAC name for the molecule represented by the following SMILES representation: C=C(C)C(O)(C(=O)OC1CC(C)N(C)C(C)(C)C1)c1ccccc1 . | (1,2,2,6-tetramethylpiperidin-4-yl) 2-hydroxy-3-methyl-2-phenylbut-3-enoate |
|
Translate the given SMILES formula of a molecule CC#CC(O)(C(=O)OC1CN2CCC1CC2)c1ccccc1 into its IUPAC name. | 1-azabicyclo[2.2.2]octan-3-yl 2-hydroxy-2-phenylpent-3-ynoate |
|
Can you give the IUPAC name of the molecule CCOC(=O)C(CN(CCCl)CCCl)(C(=O)OCC)[N+](=O)[O-] ? | diethyl 2-[bis(2-chloroethyl)aminomethyl]-2-nitropropanedioate |
|
CCN(CC)CCSCC(=O)Nc1ccccc1C is the SMILES representation of a molecule. What is its IUPAC name? | 2-[2-(diethylamino)ethylsulfanyl]-N-(2-methylphenyl)acetamide |
|
Please write the IUPAC name of the molecule C[N+](C)(C)CCCN1CC2CCCC(C1)[N+]2(C)C . | 3-(9,9-dimethyl-3-aza-9-azoniabicyclo[3.3.1]nonan-3-yl)propyl-trimethylazanium |
|
Turn the given SMILES symbol of a molecule CCOC(=O)C(CCc1ccccc1)NC(C)C(=O)N1N=C(C(C)(C)C)SC1C(=O)O into its respective IUPAC name. | 5-tert-butyl-3-[2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-2H-1,3,4-thiadiazole-2-carboxylic acid |
|
What is the IUPAC name of the molecule O=C(O)CNCC(O)NCC(=O)O ? | 2-[[2-(carboxymethylamino)-2-hydroxyethyl]amino]acetic acid |
|
Provide the IUPAC name for the molecule represented as CCCCOCCOC(C)CO . | 2-(2-butoxyethoxy)propan-1-ol |
|
Provide the IUPAC name for the molecule represented as Cc1nc2ccccc2c(=O)n1CCCN1CCCCC1 . | 2-methyl-3-(3-piperidin-1-ylpropyl)quinazolin-4-one |
|
Determine the IUPAC name for the molecule denoted by Cc1c(O)cccc1-n1c(CF)nc2ccc(N)cc2c1=O . | 6-amino-2-(fluoromethyl)-3-(3-hydroxy-2-methylphenyl)quinazolin-4-one |
|
O=C(NCCC12CC3CC(CC(C3)C1)C2)c1ccccn1 is the SMILES representation of a molecule. What is its IUPAC name? | N-[2-(1-adamantyl)ethyl]pyridine-2-carboxamide |
|
Provide the IUPAC name for the molecule represented as COc1ccc(CCN(C)CCCN2CCc3cc(OC)c(OC)cc3CC2=O)cc1OC . | 3-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]propyl]-7,8-dimethoxy-2,5-dihydro-1H-3-benzazepin-4-one |
|
Convert the following SMILES notation NC(=O)c1nc[nH]c1C(N)=O into its IUPAC nomenclature. | 1H-imidazole-4,5-dicarboxamide |
|
Translate the given SMILES formula of a molecule CC(C)c1nnc(NS(=O)(=O)c2ccc(N)cc2)s1 into its IUPAC name. | 4-amino-N-(5-propan-2-yl-1,3,4-thiadiazol-2-yl)benzenesulfonamide |
|
Provide the IUPAC name for the molecule represented as O=C(O)c1nccnc1C(=O)O . | pyrazine-2,3-dicarboxylic acid |
|
Determine the IUPAC name for the molecule represented by the following SMILES representation: CC(C)OCCC#N . | 3-propan-2-yloxypropanenitrile |
|
O=C(Nc1ccc2c(O)cc(S(=O)(=O)O)cc2c1)c1ccc([N+](=O)[O-])cc1 is the SMILES representation of a molecule. What is its IUPAC name? | 4-hydroxy-7-[(4-nitrobenzoyl)amino]naphthalene-2-sulfonic acid |
|
Convert the following SMILES notation O=C(Nc1cccc([N+](=O)[O-])c1)c1ccc([N+](=O)[O-])cc1 into its IUPAC nomenclature. | 4-nitro-N-(3-nitrophenyl)benzamide |
|
Determine the IUPAC name for the molecule represented by the following SMILES representation: N#CC(F)(F)C(F)(F)F . | 2,2,3,3,3-pentafluoropropanenitrile |
|
Can you give the IUPAC name of the molecule CCOc1cccc(C=O)c1O ? | 3-ethoxy-2-hydroxybenzaldehyde |
|
What is the IUPAC name for the molecule whose SMILES representation is CCN(CC)CCOC(=O)C1N2C(=O)C(NC(=O)c3c(OC)cccc3OC)C2SC1(C)C ? | 2-(diethylamino)ethyl (2S,5R,6R)-6-[(2,6-dimethoxybenzoyl)amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|
Convert the following SMILES notation O=C1C=C(O)C(=O)C=C1O into its IUPAC nomenclature. | 2,5-dihydroxycyclohexa-2,5-diene-1,4-dione |
|
Determine the IUPAC name for the molecule represented by the following SMILES representation: c1ccc2c(c1)CC2 . | bicyclo[4.2.0]octa-1,3,5-triene |
|
Translate the given SMILES formula of a molecule O=S(=O)(Cl)CCF into its IUPAC name. | 2-fluoroethanesulfonyl chloride |
|
What is the IUPAC name for the molecule whose SMILES representation is C[SiH2]c1ccccc1 ? | methyl(phenyl)silane |
|
Translate the given SMILES formula of a molecule CC(C)(C)OC(=O)NN into its IUPAC name. | tert-butyl N-aminocarbamate |
|
NNC(=O)Cc1ccccc1 The above is a SMILES representation. Write the IUPAC name of the corresponding molecule. | 2-phenylacetohydrazide |
|
Provide the IUPAC name for the molecule represented as C[Si](c1ccccc1)(c1ccccc1)[Si](C)(c1ccccc1)c1ccccc1 . | methyl-[methyl(diphenyl)silyl]-diphenylsilane |
|
Provide the IUPAC name for the molecule represented as CC1(C)SC2C(NC(=O)C(Oc3ccccc3)c3ccccc3)C(=O)N2C1C(=O)O . | (2S,5R,6R)-3,3-dimethyl-7-oxo-6-[(2-phenoxy-2-phenylacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|
Determine the IUPAC name for the molecule represented by the following SMILES representation: CC(C)NCC(O)COc1cccc2[nH]c3ccccc3c12 . | 1-(9H-carbazol-4-yloxy)-3-(propan-2-ylamino)propan-2-ol |
|
Convert the following SMILES notation Cc1cn(C2CC(O)C(CO)O2)c(=O)[nH]c1=O into its IUPAC nomenclature. | 1-[(2R,4R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|
What is the IUPAC name for the molecule whose SMILES representation is CC(C)C(NC(=O)C(CCCN=C(N)N)NC(=O)NC(Cc1ccccc1)C(=O)O)C(=O)NC(C=O)Cc1ccccc1 ? | (2S)-2-[[(2S)-5-(diaminomethylideneamino)-1-[[(2S)-3-methyl-1-oxo-1-[[(2S)-1-oxo-3-phenylpropan-2-yl]amino]butan-2-yl]amino]-1-oxopentan-2-yl]carbamoylamino]-3-phenylpropanoic acid |
|
What is the IUPAC name for the molecule whose SMILES representation is O=c1[nH]c(=O)n(COCCO)cc1F ? | 5-fluoro-1-(2-hydroxyethoxymethyl)pyrimidine-2,4-dione |
|
C=C1C(=O)OC2CC3(C)CCCC(C)C3=CC12 The above is a SMILES representation. Write the IUPAC name of the corresponding molecule. | (3aR,5S,8aR,9aR)-5,8a-dimethyl-3-methylidene-5,6,7,8,9,9a-hexahydro-3aH-benzo[f][1]benzofuran-2-one |
|
Provide the IUPAC name for the molecule represented as Nc1ccc2c(c1)C(=O)NC2=O . | 5-aminoisoindole-1,3-dione |
|
What is the IUPAC name for the molecule whose SMILES representation is COc1ccc(C2CC(=O)c3c(O)cc(OC4OC(CO)C(O)C(O)C4OC4OC(C)C(O)C(O)C4O)cc3O2)cc1O ? | (2S)-7-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-2,3-dihydrochromen-4-one |
|
Convert the SMILES representation of a molecule N#CN1CCOCC1 into IUPAC name. | morpholine-4-carbonitrile |
|
Convert the following SMILES notation ClC(Cl)[Si](Cl)(Cl)Cl into its IUPAC nomenclature. | trichloro(dichloromethyl)silane |
|
What is the IUPAC name for the molecule whose SMILES representation is COC(=O)CCCC(=O)Cl ? | methyl 5-chloro-5-oxopentanoate |
|
Turn the given SMILES symbol of a molecule c1ccc(-c2ccc(-c3ccccc3)s2)cc1 into its respective IUPAC name. | 2,5-diphenylthiophene |
|
Convert the SMILES representation of a molecule OCCn1ccnc1 into IUPAC name. | 2-imidazol-1-ylethanol |
|
Translate the given SMILES formula of a molecule C[Si]1(C)O[Si](C)(C)O[Si](c2ccccc2)(c2ccccc2)O[Si](C)(C)O1 into its IUPAC name. | 2,2,4,4,6,6-hexamethyl-8,8-diphenyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
|
C=C(C)O[Si](C)(C)C is the SMILES representation of a molecule. What is its IUPAC name? | trimethyl(prop-1-en-2-yloxy)silane |
|
Translate the given SMILES formula of a molecule Cc1cccc(N=Nc2ccc(N=Nc3cc(C)ccc3O)cc2C)c1 into its IUPAC name. | 4-methyl-2-[[3-methyl-4-[(3-methylphenyl)diazenyl]phenyl]diazenyl]phenol |
|
What is the IUPAC name of the molecule CC(=O)Nc1ccc(C(=O)OCCN(C)C)cc1 ? | 2-(dimethylamino)ethyl 4-acetamidobenzoate |
|
Determine the IUPAC name for the molecule denoted by Nc1ccc2c(ccc3ccccc32)c1 . | phenanthren-2-amine |
|
What is the IUPAC name for the molecule whose SMILES representation is Cc1cc(C)[n+]([O-])c(C)c1 ? | 2,4,6-trimethyl-1-oxidopyridin-1-ium |
|
Can you give the IUPAC name of the molecule O=C(CS(=O)(=O)c1ccccc1)c1ccccc1 ? | 2-(benzenesulfonyl)-1-phenylethanone |
|
Please write the IUPAC name of the molecule FC(F)=C(F)CCSc1ncccn1 . | 2-(3,4,4-trifluorobut-3-enylsulfanyl)pyrimidine |
|
What is the IUPAC name for the molecule whose SMILES representation is O=C(CBr)C(F)(F)F ? | 3-bromo-1,1,1-trifluoropropan-2-one |
|
Convert the SMILES representation of a molecule O=C(S)CCl into IUPAC name. | 2-chloroethanethioic S-acid |
|
Provide the IUPAC name for the molecule represented as CCCCCCCCCCCCSC(=NC)NC . | dodecyl N,N'-dimethylcarbamimidothioate |
|
Please write the IUPAC name of the molecule CCN(CC)CCCNC . | N',N'-diethyl-N-methylpropane-1,3-diamine |
|
Convert the SMILES representation of a molecule CC1(C)OC(=O)C2(CC2)C(=O)O1 into IUPAC name. | 6,6-dimethyl-5,7-dioxaspiro[2.5]octane-4,8-dione |
|
Convert the following SMILES notation C1CCCCNCCC1 into its IUPAC nomenclature. | azonane |
|
Determine the IUPAC name for the molecule denoted by Cc1ccc(S(=O)(=O)CC#N)cc1 . | 2-(4-methylphenyl)sulfonylacetonitrile |
|
O=C(Oc1ccccc1O)c1ccccc1 The above is a SMILES representation. Write the IUPAC name of the corresponding molecule. | (2-hydroxyphenyl) benzoate |
|
Determine the IUPAC name for the molecule denoted by O=C1OC(=O)c2ccc([N+](=O)[O-])c3cccc1c23 . | 8-nitro-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione |
|
Please write the IUPAC name of the molecule C=CC(=O)OCC(CC)(CO)CO . | 2,2-bis(hydroxymethyl)butyl prop-2-enoate |
|
Turn the given SMILES symbol of a molecule O=C(NO)Nc1ccccc1 into its respective IUPAC name. | 1-hydroxy-3-phenylurea |
|
Can you give the IUPAC name of the molecule CCC[Sn](=O)CCC ? | oxo(dipropyl)tin |
|
Provide the IUPAC name for the molecule represented as COCCN1CCOCC1 . | 4-(2-methoxyethyl)morpholine |
|
What is the IUPAC name of the molecule COc1ccc([N+](=O)[O-])cc1C#N ? | 2-methoxy-5-nitrobenzonitrile |
|
CCCSP(C)(=O)OCC The above is a SMILES representation. Write the IUPAC name of the corresponding molecule. | 1-[ethoxy(methyl)phosphoryl]sulfanylpropane |
|
Determine the IUPAC name for the molecule denoted by COC(=O)C1C(CC(=O)c2ccccc2)CC2CCC1N2C . | methyl (1R,2S,3R,5S)-8-methyl-3-phenacyl-8-azabicyclo[3.2.1]octane-2-carboxylate |
|
What is the IUPAC name of the molecule O=C(CCCCC1C2NC(=O)NC2CS1=O)NCCNC(=O)CCc1ccc(O)c(I)c1 ? | 5-[(3aS,4S,6aR)-2,5-dioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-[3-(4-hydroxy-3-(125I)iodanylphenyl)propanoylamino]ethyl]pentanamide |
|
What is the IUPAC name for the molecule whose SMILES representation is COC(=O)c1nc(Cl)c(Cl)c(N)c1Cl ? | methyl 4-amino-3,5,6-trichloropyridine-2-carboxylate |
|
Provide the IUPAC name for the molecule represented as CC1(C)COP(=O)(Cc2ccccc2)OC1 . | 2-benzyl-5,5-dimethyl-1,3,2lambda5-dioxaphosphinane 2-oxide |
|
Provide the IUPAC name for the molecule represented as CCOC1(c2ccccc2)OCCN(C)C1C . | 2-ethoxy-3,4-dimethyl-2-phenylmorpholine |
|
Convert the SMILES representation of a molecule CC(C)OC(=O)C1(S(=O)(=O)c2ccc([N+](=O)[O-])cc2)CCC1 into IUPAC name. | propan-2-yl 1-(4-nitrophenyl)sulfonylcyclobutane-1-carboxylate |
|
Convert the SMILES representation of a molecule ClC1=C(Cl)C2(Cl)C3C(Br)C(Br)CC3C1(Cl)C2(Cl)Cl into IUPAC name. | 3,4-dibromo-1,7,8,9,10,10-hexachlorotricyclo[5.2.1.02,6]dec-8-ene |
|
Determine the IUPAC name for the molecule represented by the following SMILES representation: CCCC1(CCC(C)C)C(=O)NC(=O)NC1=O . | 5-(3-methylbutyl)-5-propyl-1,3-diazinane-2,4,6-trione |
|
Turn the given SMILES symbol of a molecule C[Si](C)(C)OC(=O)CC(=O)O[Si](C)(C)C into its respective IUPAC name. | bis(trimethylsilyl) propanedioate |
|
CCCCCCCCC(=O)OCCOCCCC The above is a SMILES representation. Write the IUPAC name of the corresponding molecule. | 2-butoxyethyl nonanoate |
|
CCN(CC)c1ccc(C(=O)O)c(O)c1 The above is a SMILES representation. Write the IUPAC name of the corresponding molecule. | 4-(diethylamino)-2-hydroxybenzoic acid |
|
Convert the following SMILES notation Cc1onc(-c2ccccc2Cl)c1C(=O)O into its IUPAC nomenclature. | 3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxylic acid |
|
Convert the SMILES representation of a molecule O=C1CCC(=O)N1c1cc(Cl)cc(Cl)c1 into IUPAC name. | 1-(3,5-dichlorophenyl)pyrrolidine-2,5-dione |
|
Convert the following SMILES notation CCc1ccccc1NS(=O)(=O)C1=CC(=[N+]=[N-])C=CC1=NS(=O)(=O)c1ccc(C)cc1 into its IUPAC nomenclature. | 3-diazo-N-(2-ethylphenyl)-6-(4-methylphenyl)sulfonyliminocyclohexa-1,4-diene-1-sulfonamide |
|
CCC(C)OC(=O)C(C)C The above is a SMILES representation. Write the IUPAC name of the corresponding molecule. | butan-2-yl 2-methylpropanoate |
|
Can you give the IUPAC name of the molecule N#CC(OC1OC(CO)C(O)C(O)C1O)c1ccccc1 ? | (2S)-2-phenyl-2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyacetonitrile |
|
Convert the SMILES representation of a molecule CC1=CCCC2(C)OC2CC1 into IUPAC name. | 1,5-dimethyl-9-oxabicyclo[6.1.0]non-4-ene |
|
What is the IUPAC name of the molecule CC1(C)CCC2(C)CC=C3C(C)(CCC4C3(C)CCC3C(C)(C)C(O)CCC43C)C2C1 ? | (3S,4aR,6aR,6aS,8aR,12aR,14aR,14bR)-4,4,6a,6a,8a,11,11,14b-octamethyl-1,2,3,4a,5,6,8,9,10,12,12a,13,14,14a-tetradecahydropicen-3-ol |
|
What is the IUPAC name of the molecule CCCCCCCCP(=O)(CCCCCC)CCCCCCCC ? | 1-[hexyl(octyl)phosphoryl]octane |
|
CC(=CC=O)CCCC(C)C is the SMILES representation of a molecule. What is its IUPAC name? | 3,7-dimethyloct-2-enal |
|
Please write the IUPAC name of the molecule CCOP(OCC)n1cncn1 . | diethoxy(1,2,4-triazol-1-yl)phosphane |
|
Determine the IUPAC name for the molecule represented by the following SMILES representation: CC(C)=CC#N . | 3-methylbut-2-enenitrile |
|
Convert the following SMILES notation CCC1(COP(C)(=O)OCC2(CC)COP(C)(=O)OC2)COP(C)(=O)OC1 into its IUPAC nomenclature. | 5-ethyl-5-[[(5-ethyl-2-methyl-2-oxo-1,3,2lambda5-dioxaphosphinan-5-yl)methoxy-methylphosphoryl]oxymethyl]-2-methyl-1,3,2lambda5-dioxaphosphinane 2-oxide |
Subsets and Splits
No saved queries yet
Save your SQL queries to embed, download, and access them later. Queries will appear here once saved.