instruction
stringlengths 48
868
| input
stringclasses 1
value | output
stringlengths 7
2.47k
|
---|---|---|
I[Sn](c1ccccc1)(c1ccccc1)c1ccccc1 The above is a SMILES representation. Write the IUPAC name of the corresponding molecule. | iodo(triphenyl)stannane |
|
What is the IUPAC name for the molecule whose SMILES representation is S=P1(N(CCCl)CCCl)NCCCO1 ? | N,N-bis(2-chloroethyl)-2-sulfanylidene-1,3,2lambda5-oxazaphosphinan-2-amine |
|
What is the IUPAC name for the molecule whose SMILES representation is Cc1c[n+]([O-])cc(C)c1[N+](=O)[O-] ? | 3,5-dimethyl-4-nitro-1-oxidopyridin-1-ium |
|
Fc1ccccc1-c1nnc(-c2cccc3ccccc23)o1 is the SMILES representation of a molecule. What is its IUPAC name? | 2-(2-fluorophenyl)-5-naphthalen-1-yl-1,3,4-oxadiazole |
|
What is the IUPAC name of the molecule Clc1ccc(C#Cc2ccc(Cl)cc2)cc1 ? | 1-chloro-4-[2-(4-chlorophenyl)ethynyl]benzene |
|
Convert the following SMILES notation CCCCCCCCC=CCCCCCCCC1=NCCO1 into its IUPAC nomenclature. | 2-heptadec-8-enyl-4,5-dihydro-1,3-oxazole |
|
What is the IUPAC name for the molecule whose SMILES representation is CC(OC(N)=O)C(F)(F)C(F)F ? | 3,3,4,4-tetrafluorobutan-2-yl carbamate |
|
Turn the given SMILES symbol of a molecule ClC=C(c1ccc(Cl)cc1)c1ccc(Cl)cc1 into its respective IUPAC name. | 1-chloro-4-[2-chloro-1-(4-chlorophenyl)ethenyl]benzene |
|
Determine the IUPAC name for the molecule denoted by C=CCc1cc(CNCCCO)c(O)c(OC)c1 . | 2-[(3-hydroxypropylamino)methyl]-6-methoxy-4-prop-2-enylphenol |
|
Provide the IUPAC name for the molecule represented as CCN(CC)P(=O)(OC)OC . | N-dimethoxyphosphoryl-N-ethylethanamine |
|
O=P1(N(CCCl)CCCl)NC(O)CCO1 is the SMILES representation of a molecule. What is its IUPAC name? | 2-[bis(2-chloroethyl)amino]-2-oxo-1,3,2lambda5-oxazaphosphinan-4-ol |
|
Determine the IUPAC name for the molecule represented by the following SMILES representation: CCOC(=O)C1=C(C)NC(C)=C(C(=O)OCC)C1c1cccnc1 . | diethyl 2,6-dimethyl-4-pyridin-3-yl-1,4-dihydropyridine-3,5-dicarboxylate |
|
O=C(O)C1(NO)CCCCC1 is the SMILES representation of a molecule. What is its IUPAC name? | 1-(hydroxyamino)cyclohexane-1-carboxylic acid |
|
Can you give the IUPAC name of the molecule Nc1cccc(Cl)c1[N+](=O)[O-] ? | 3-chloro-2-nitroaniline |
|
Please write the IUPAC name of the molecule O=c1cc(Br)[nH]c(=O)[nH]1 . | 6-bromo-1H-pyrimidine-2,4-dione |
|
CC(=O)OC1CCC23COC(CC4C5CCC(C(C)CCCC(C)C)C5(C)CCC42)C3(Br)C1 is the SMILES representation of a molecule. What is its IUPAC name? | [(1R,2S,5R,6R,9S,10S,12R,13R,15S)-13-bromo-5-methyl-6-[(2R)-6-methylheptan-2-yl]-19-oxapentacyclo[10.5.2.01,13.02,10.05,9]nonadecan-15-yl] acetate |
|
Can you give the IUPAC name of the molecule CC(C)c1ccc(OCC2CO2)cc1 ? | 2-[(4-propan-2-ylphenoxy)methyl]oxirane |
|
Please write the IUPAC name of the molecule CCOC(=O)C1CN(CC)c2nc(SC)ncc2C1=O . | ethyl 8-ethyl-2-methylsulfanyl-5-oxo-6,7-dihydropyrido[2,3-d]pyrimidine-6-carboxylate |
|
Determine the IUPAC name for the molecule represented by the following SMILES representation: COC1(C)CCc2c(C)c(O)c(C)c(C)c2O1 . | 2-methoxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-ol |
|
O=C(S)SSSSC(=O)S is the SMILES representation of a molecule. What is its IUPAC name? | (sulfanylcarbonyltetrasulfanyl)methanethioic S-acid |
|
Determine the IUPAC name for the molecule denoted by N#CSc1ccc(N)c([N+](=O)[O-])c1 . | (4-amino-3-nitrophenyl) thiocyanate |
|
What is the IUPAC name for the molecule whose SMILES representation is S=C(S)C1CCCN1 ? | (2S)-pyrrolidine-2-carbodithioic acid |
|
Please write the IUPAC name of the molecule [Eu+3] . | europium(3+) |
|
Please write the IUPAC name of the molecule Cc1ccc(C)c(Oc2cccc(C(=O)NC(C)(C)C)c2)c1 . | N-tert-butyl-3-(2,5-dimethylphenoxy)benzamide |
|
What is the IUPAC name of the molecule CC1=CC(C)CC(CO)C1 ? | (3,5-dimethylcyclohex-3-en-1-yl)methanol |
|
What is the IUPAC name of the molecule CCCC(=O)C(C)CC(=O)OCC ? | ethyl 3-methyl-4-oxoheptanoate |
|
Convert the following SMILES notation N#CCCN(CCC#N)CC(O)CO into its IUPAC nomenclature. | 3-[2-cyanoethyl(2,3-dihydroxypropyl)amino]propanenitrile |
|
Translate the given SMILES formula of a molecule COC(C)COC(C)COB(OCC(C)OCC(C)OC)OCC(C)OCC(C)OC into its IUPAC name. | tris[2-(2-methoxypropoxy)propyl] borate |
|
Turn the given SMILES symbol of a molecule CCCCCCCCCCCC[Si](C)(OCC)OCC into its respective IUPAC name. | dodecyl-diethoxy-methylsilane |
|
Please write the IUPAC name of the molecule COC(CC(C)CCCC(C)C)OC . | 1,1-dimethoxy-3,7-dimethyloctane |
|
Determine the IUPAC name for the molecule denoted by CC(Br)CCCC(Cl)C(Br)CC(Br)CCl . | 2,4,9-tribromo-1,5-dichlorodecane |
|
Please write the IUPAC name of the molecule O=C(Nc1ccc(N=Nc2c(O)ccc3ccccc23)cc1)c1ccc(N=Nc2c(O)ccc3ccccc23)cc1 . | 4-[(2-hydroxynaphthalen-1-yl)diazenyl]-N-[4-[(2-hydroxynaphthalen-1-yl)diazenyl]phenyl]benzamide |
|
CCCC(=O)OC1=C(C)CCC1=O is the SMILES representation of a molecule. What is its IUPAC name? | (2-methyl-5-oxocyclopenten-1-yl) butanoate |
|
What is the IUPAC name of the molecule CCC(=O)OCCN(CCC#N)c1ccccc1 ? | 2-[N-(2-cyanoethyl)anilino]ethyl propanoate |
|
CCC(CO)(CO)COC(=O)CCCCCCCCCCCCCCC(C)C is the SMILES representation of a molecule. What is its IUPAC name? | 2,2-bis(hydroxymethyl)butyl 16-methylheptadecanoate |
|
Turn the given SMILES symbol of a molecule NC(CCc1ccccc1)c1ccccc1 into its respective IUPAC name. | 1,3-diphenylpropan-1-amine |
|
Turn the given SMILES symbol of a molecule CC1CCCN(CN2CCCC(C)C2)C1 into its respective IUPAC name. | 3-methyl-1-[(3-methylpiperidin-1-yl)methyl]piperidine |
|
Convert the SMILES representation of a molecule COC(=O)CN(C)C=O into IUPAC name. | methyl 2-[formyl(methyl)amino]acetate |
|
CC(CCNCCC#N)CC(C)(C)CN is the SMILES representation of a molecule. What is its IUPAC name? | 3-[(6-amino-3,5,5-trimethylhexyl)amino]propanenitrile |
|
Convert the SMILES representation of a molecule CCC(=Cc1sc2cc(OC)c(OC)cc2[n+]1CCCS(=O)(=O)O)C=C1Oc2ccc(-c3ccccc3)cc2N1CCC(C)S(=O)(=O)O into IUPAC name. | 4-[2-[2-[[5,6-dimethoxy-3-(3-sulfopropyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]butylidene]-5-phenyl-1,3-benzoxazol-3-yl]butane-2-sulfonic acid |
|
Determine the IUPAC name for the molecule represented by the following SMILES representation: CC(C)(C)c1ccc(SSc2cc(C(C)(C)C)ccc2O)c(O)c1 . | 4-tert-butyl-2-[(4-tert-butyl-2-hydroxyphenyl)disulfanyl]phenol |
|
CC1CN(C)C2Cc3c[nH]c4cccc(c34)C2C1O The above is a SMILES representation. Write the IUPAC name of the corresponding molecule. | (6aR,9S,10R,10aR)-7,9-dimethyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-10-ol |
|
Please write the IUPAC name of the molecule CCC(=O)N1CC2CCC(C1)N2C(=O)CC . | 1-(8-propanoyl-3,8-diazabicyclo[3.2.1]octan-3-yl)propan-1-one |
|
Provide the IUPAC name for the molecule represented as CN1C(=O)CC2(C1=O)c1ccccc1CCc1ccccc12 . | 1-methylspiro[pyrrolidine-3,2'-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene]-2,5-dione |
|
Convert the following SMILES notation CCCCC=NCCOC(=O)c1cccc(OC)c1OC into its IUPAC nomenclature. | 2-(pentylideneamino)ethyl 2,3-dimethoxybenzoate |
|
Translate the given SMILES formula of a molecule Cc1ccc(NN=C(C#N)C#N)c([N+](=O)[O-])c1 into its IUPAC name. | 2-[(4-methyl-2-nitrophenyl)hydrazinylidene]propanedinitrile |
|
Determine the IUPAC name for the molecule denoted by CCCCCOc1ccc(C(=O)CC(c2ccc(OCCCCC)cc2)C2CCCCC2=O)cc1 . | 2-[3-oxo-1,3-bis(4-pentoxyphenyl)propyl]cyclohexan-1-one |
|
Please write the IUPAC name of the molecule CCCC(C)(COC(N)=O)COC(=O)NCC . | [2-(carbamoyloxymethyl)-2-methylpentyl] N-ethylcarbamate |
|
Cc1c2occc2cc2ccc(=O)oc12 The above is a SMILES representation. Write the IUPAC name of the corresponding molecule. | 9-methylfuro[3,2-g]chromen-7-one |
|
Provide the IUPAC name for the molecule represented as CNC#N . | methylcyanamide |
|
Can you give the IUPAC name of the molecule CCOP(=O)(OCC)OP(=S)(OC)OC ? | dimethoxyphosphinothioyl diethyl phosphate |
|
CCCOP(=O)(OCCCl)Oc1ccc([N+](=O)[O-])cc1 is the SMILES representation of a molecule. What is its IUPAC name? | 2-chloroethyl (4-nitrophenyl) propyl phosphate |
|
What is the IUPAC name for the molecule whose SMILES representation is OC1CCC2CN3CCc4c([nH]c5ccccc45)C3CC2C1CCl ? | (1S,15R,18S,19R,20S)-19-(chloromethyl)-1,3,11,12,14,15,16,17,18,19,20,21-dodecahydroyohimban-18-ol |
|
Cn1ncc(N2CCOCC2)c(Cl)c1=O The above is a SMILES representation. Write the IUPAC name of the corresponding molecule. | 4-chloro-2-methyl-5-morpholin-4-ylpyridazin-3-one |
|
Convert the following SMILES notation Cc1ncc(CSS(=O)(=O)O)c(CO)c1O into its IUPAC nomenclature. | 3-hydroxy-4-(hydroxymethyl)-2-methyl-5-(sulfosulfanylmethyl)pyridine |
|
Determine the IUPAC name for the molecule represented by the following SMILES representation: COc1nc(C)nc(OC)c1[N+](=O)[O-] . | 4,6-dimethoxy-2-methyl-5-nitropyrimidine |
|
Convert the following SMILES notation CC(NC(=O)C(Cc1ccccc1)NC(=O)CN)C(=O)NC(CC(=O)O)C(=O)O into its IUPAC nomenclature. | (2S)-2-[[(2R)-2-[[(2R)-2-[(2-aminoacetyl)amino]-3-phenylpropanoyl]amino]propanoyl]amino]butanedioic acid |
|
What is the IUPAC name for the molecule whose SMILES representation is CC(CCC(=O)NCCC[N+](C)(C)CC(O)CS(=O)(=O)[O-])C1CCC2C3C(O)CC4CC(O)CCC4(C)C3CC(O)C12C ? | 3-[dimethyl-[3-[[(4R)-4-[(3R,5S,7R,8R,9S,10S,12S,13R,14S,17R)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]amino]propyl]azaniumyl]-2-hydroxypropane-1-sulfonate |
|
CC(=O)C(N=Nc1ccc(Cl)cc1[N+](=O)[O-])C(=O)Nc1ccc(Cl)cc1C is the SMILES representation of a molecule. What is its IUPAC name? | N-(4-chloro-2-methylphenyl)-2-[(4-chloro-2-nitrophenyl)diazenyl]-3-oxobutanamide |
|
Turn the given SMILES symbol of a molecule Cc1cc(C)c(SCC[n+]2noc([O-])c2C)c(C)c1 into its respective IUPAC name. | 4-methyl-3-[2-(2,4,6-trimethylphenyl)sulfanylethyl]oxadiazol-3-ium-5-olate |
|
Determine the IUPAC name for the molecule represented by the following SMILES representation: O=C(NCCCl)Oc1ccc([N+](=O)[O-])cc1 . | (4-nitrophenyl) N-(2-chloroethyl)carbamate |
|
Convert the SMILES representation of a molecule CCC(C)C(NC(=O)C(N)C(C)C)C(=O)NC(CCCCN)C(=O)Nc1ccc([N+](=O)[O-])cc1 into IUPAC name. | (2S)-6-amino-2-[[2-[[(2R)-2-amino-3-methylbutanoyl]amino]-3-methylpentanoyl]amino]-N-(4-nitrophenyl)hexanamide |
|
Translate the given SMILES formula of a molecule CCC(C)C(NC(=O)C1CCC(=O)N1)C(=O)NC(C(=O)NC(Cc1ccccc1)C(=O)NC(C(=O)N1CCCC1C(=O)NC(CC(N)=O)C(=O)NC(Cc1c[nH]c2ccccc12)C(N)=O)C(C)O)C(C)O into its IUPAC name. | (2S)-N-[(2S)-1-amino-3-(1H-indol-3-yl)-1-oxopropan-2-yl]-2-[[1-[(2S,3R)-3-hydroxy-2-[[(2S)-2-[[(2S,3R)-3-hydroxy-2-[[(2S)-3-methyl-2-[(5-oxopyrrolidine-2-carbonyl)amino]pentanoyl]amino]butanoyl]amino]-3-phenylpropanoyl]amino]butanoyl]pyrrolidine-2-carbonyl]amino]butanediamide |
|
What is the IUPAC name of the molecule NCC1CC(c2ccc(Cl)cc2)OC1=O ? | 3-(aminomethyl)-5-(4-chlorophenyl)oxolan-2-one |
|
Oc1cccc2c1CCC1NCCCC21 is the SMILES representation of a molecule. What is its IUPAC name? | (4aR,10bR)-1,2,3,4,4a,5,6,10b-octahydrobenzo[f]quinolin-7-ol |
|
Turn the given SMILES symbol of a molecule CNC(C)Cc1cc2c(cc1O)OCO2 into its respective IUPAC name. | 6-[(2S)-2-(methylamino)propyl]-1,3-benzodioxol-5-ol |
|
CN(C)C(=O)NN(CCCN)C(=O)Oc1ccc([N+](=O)[O-])cc1 The above is a SMILES representation. Write the IUPAC name of the corresponding molecule. | (4-nitrophenyl) N-(3-aminopropyl)-N-(dimethylcarbamoylamino)carbamate |
|
Turn the given SMILES symbol of a molecule COC1CCC(OC2CC(C3OC(C)(O)C(C)CC3C)OC2C2(C)CCC(C3(C)CCC4(CC(O)C(C)C(C(C)C5OC(O)(CC(=O)O)C(C)C(OC6CCC(OC)C(C)O6)C5OC)O4)O3)O2)OC1C into its respective IUPAC name. | 2-[(2R,3S,4S,5R,6S)-2-hydroxy-6-[(1R)-1-[(2S,7S,8R,9S)-7-hydroxy-2-[(2R,5S)-5-[(2R,3S)-5-[(2S,3S,5R,6S)-6-hydroxy-3,5,6-trimethyloxan-2-yl]-3-[(2S,5S,6R)-5-methoxy-6-methyloxan-2-yl]oxyoxolan-2-yl]-5-methyloxolan-2-yl]-2,8-dimethyl-1,10-dioxaspiro[4.5]decan-9-yl]ethyl]-5-methoxy-4-[(2S,5S,6R)-5-methoxy-6-methyloxan-2-yl]oxy-3-methyloxan-2-yl]acetic acid |
|
What is the IUPAC name of the molecule CCn1c(N=NN(C)C)nc2c1c(=O)n(C)c(=O)n2C ? | 8-(dimethylaminodiazenyl)-7-ethyl-1,3-dimethylpurine-2,6-dione |
|
Convert the SMILES representation of a molecule CCCC[Sn](CCCC)(CCCC)c1c(OC)ccc(C(=O)ON2C(=O)CCC2=O)c1OC into IUPAC name. | (2,5-dioxopyrrolidin-1-yl) 2,4-dimethoxy-3-tributylstannylbenzoate |
|
Convert the SMILES representation of a molecule CC(C)C(C)CCC(C)C1CC(O)C2C3CCC4CC(O)CCC4(C)C3CCC12C into IUPAC name. | (3S,5S,8R,9S,10S,13R,14S,15S,17R)-17-[(2R,5S)-5,6-dimethylheptan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,15-diol |
|
Provide the IUPAC name for the molecule represented as CCCOc1ccc2[nH]cc(C3=CCNCC3)c2c1 . | 5-propoxy-3-(1,2,3,6-tetrahydropyridin-4-yl)-1H-indole |
|
Determine the IUPAC name for the molecule denoted by Cc1cc2c(N)c(=O)occ2c2nc(N)n(C)c12 . | 2,6-diamino-3,4-dimethylpyrano[3,4-e]benzimidazol-7-one |
|
Please write the IUPAC name of the molecule CN1CCC2(C)c3cc(OC(=O)N4CCc5ccccc5C4)ccc3N(C)C12 . | [(3aR,8bS)-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-yl] 3,4-dihydro-1H-isoquinoline-2-carboxylate |
|
CC(C)c1nc(-c2ccc(F)cc2)c(-c2ccc(F)cc2)n1C=CC(O)CC(O)CC(=O)O The above is a SMILES representation. Write the IUPAC name of the corresponding molecule. | (3S,5R)-7-[4,5-bis(4-fluorophenyl)-2-propan-2-ylimidazol-1-yl]-3,5-dihydroxyhept-6-enoic acid |
|
Convert the SMILES representation of a molecule Nc1ncnc2c1ncn2C1C=CC(C(O)CO)C1 into IUPAC name. | 1-[4-(6-aminopurin-9-yl)cyclopent-2-en-1-yl]ethane-1,2-diol |
|
What is the IUPAC name of the molecule Cc1ccc(O)cc1CCC1C(=O)CC(O)C2(C)C(=O)CCC12 ? | (3aS,4S,7R,7aR)-7-hydroxy-4-[2-(5-hydroxy-2-methylphenyl)ethyl]-7a-methyl-2,3,3a,4,6,7-hexahydroindene-1,5-dione |
|
Determine the IUPAC name for the molecule denoted by CCCCCCCCC(O)CCCCCCC=CC(=O)O . | 10-hydroxyoctadec-2-enoic acid |
|
Determine the IUPAC name for the molecule denoted by [N-]=[N+]=Nc1cccc2c(N=C=S)cccc12 . | 1-azido-5-isothiocyanatonaphthalene |
|
Translate the given SMILES formula of a molecule NC(=O)NNCCc1ccccc1 into its IUPAC name. | (2-phenylethylamino)urea |
|
NC(CCC(=O)NC(CSSCC(NC(=O)CCC(N)C(=O)O)C(=O)N(CC(=O)O)c1c([N+](=O)[O-])cc([N+](=O)[O-])cc1[N+](=O)[O-])C(=O)NCC(=O)O)C(=O)O is the SMILES representation of a molecule. What is its IUPAC name? | (2S)-2-amino-5-[[(2R)-3-[[(2R)-2-[[(4S)-4-amino-4-carboxybutanoyl]amino]-3-[N-(carboxymethyl)-2,4,6-trinitroanilino]-3-oxopropyl]disulfanyl]-1-(carboxymethylamino)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
|
What is the IUPAC name of the molecule CC1OC(OP(=O)(O)O)C(O)C1O ? | [(3R,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl] dihydrogen phosphate |
|
c1cnc2nccnc2n1 is the SMILES representation of a molecule. What is its IUPAC name? | pyrazino[2,3-b]pyrazine |
|
Determine the IUPAC name for the molecule represented by the following SMILES representation: Fc1cccs1 . | 2-fluorothiophene |
|
Provide the IUPAC name for the molecule represented as C[Si](C)(C)O[Si](C)(O[Si](C)(C)C)c1ccccc1 . | trimethyl-(methyl-phenyl-trimethylsilyloxysilyl)oxysilane |
|
What is the IUPAC name of the molecule CC(C)(C)c1cc(C(C)(C)C)c(C(C)(C)C)cc1C(C)(C)C ? | 1,2,4,5-tetratert-butylbenzene |
|
Can you give the IUPAC name of the molecule O=C1CC=CC=CC1 ? | cyclohepta-3,5-dien-1-one |
|
What is the IUPAC name of the molecule CCC=COCC ? | 1-ethoxybut-1-ene |
|
Determine the IUPAC name for the molecule represented by the following SMILES representation: CCCCCOC(C)C . | 1-propan-2-yloxypentane |
|
Convert the SMILES representation of a molecule CC(C)(C)c1ccco1 into IUPAC name. | 2-tert-butylfuran |
|
Convert the following SMILES notation C#CSC into its IUPAC nomenclature. | methylsulfanylethyne |
|
What is the IUPAC name for the molecule whose SMILES representation is Clc1ccc2c(c1)Sc1ccccc1O2 ? | 2-chlorophenoxathiine |
|
Provide the IUPAC name for the molecule represented as CCCC(C)C(C)CCC . | 4,5-dimethyloctane |
|
Can you give the IUPAC name of the molecule Cc1cccc(N=Nc2cc(C)ccc2O)c1 ? | 4-methyl-2-[(3-methylphenyl)diazenyl]phenol |
|
What is the IUPAC name of the molecule COC(=O)CC(C)(C)CC(=O)OC ? | dimethyl 3,3-dimethylpentanedioate |
|
CCCCc1ccc(F)cc1 The above is a SMILES representation. Write the IUPAC name of the corresponding molecule. | 1-butyl-4-fluorobenzene |
|
Convert the following SMILES notation C=CC(C=C)(C=C)C=C into its IUPAC nomenclature. | 3,3-bis(ethenyl)penta-1,4-diene |
|
Provide the IUPAC name for the molecule represented as CC([N+](=O)[O-])([N+](=O)[O-])C(C)([N+](=O)[O-])[N+](=O)[O-] . | 2,2,3,3-tetranitrobutane |
|
What is the IUPAC name of the molecule COC(=O)CCCc1ccc(Oc2ccccc2)cc1 ? | methyl 4-(4-phenoxyphenyl)butanoate |
|
Determine the IUPAC name for the molecule represented by the following SMILES representation: Oc1cccc(N2CCOCC2)c1 . | 3-morpholin-4-ylphenol |
Subsets and Splits
No saved queries yet
Save your SQL queries to embed, download, and access them later. Queries will appear here once saved.