broad_id
string | depmap_id
string | ccle_name
string | screen_id
string | upper_limit
int64 | lower_limit
float64 | slope
float64 | r2
float64 | auc
float64 | ec50
float64 | ic50
float64 | name
string | moa
string | target
string | disease.area
string | indication
string | smiles
string | phase
string | passed_str_profiling
bool | row_name
string |
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
BRD-A98990573-003-01-3 | ACH-000367 | NCIH226_LUNG | HTS002 | 1 | 2.478964 | 0.057529 | -0.037068 | 1.433468 | 380,001.249781 | null | epinastine | histamine receptor antagonist | ADRA1A, ADRA2A, HRH1, HRH2, HTR2A, HTR7 | ophthalmology | conjunctivitis | NC1=NCC2N1c1ccccc1Cc1ccccc21 | Launched | true | ACH-000367 |
BRD-A98990573-003-01-3 | ACH-001190 | SKMEL2_SKIN | HTS002 | 1 | 1.246811 | -0.015808 | -0.229736 | 1.150525 | 149,107,225,833.317 | null | epinastine | histamine receptor antagonist | ADRA1A, ADRA2A, HRH1, HRH2, HTR2A, HTR7 | ophthalmology | conjunctivitis | NC1=NCC2N1c1ccccc1Cc1ccccc21 | Launched | true | ACH-001190 |
BRD-A98990573-003-01-3 | ACH-000713 | CAOV3_OVARY | HTS002 | 1 | 1.346589 | 0.135358 | 0.001704 | 1.168214 | 0.122368 | null | epinastine | histamine receptor antagonist | ADRA1A, ADRA2A, HRH1, HRH2, HTR2A, HTR7 | ophthalmology | conjunctivitis | NC1=NCC2N1c1ccccc1Cc1ccccc21 | Launched | true | ACH-000713 |
BRD-A98990573-003-01-3 | ACH-000672 | IALM_LUNG | HTS002 | 1 | 3.397769 | -0.115197 | 0.097976 | 1.771578 | 0.000103 | null | epinastine | histamine receptor antagonist | ADRA1A, ADRA2A, HRH1, HRH2, HTR2A, HTR7 | ophthalmology | conjunctivitis | NC1=NCC2N1c1ccccc1Cc1ccccc21 | Launched | true | ACH-000672 |
BRD-A98990573-003-01-3 | ACH-000875 | NCIH2347_LUNG | HTS002 | 1 | 2.050145 | 0.171866 | 0.013351 | 1.467693 | 0.301243 | null | epinastine | histamine receptor antagonist | ADRA1A, ADRA2A, HRH1, HRH2, HTR2A, HTR7 | ophthalmology | conjunctivitis | NC1=NCC2N1c1ccccc1Cc1ccccc21 | Launched | true | ACH-000875 |
BRD-A98990573-003-01-3 | ACH-000423 | SKMEL3_SKIN | HTS002 | 1 | 1.550757 | 0.143829 | 0.003124 | 1.296959 | 0.02509 | null | epinastine | histamine receptor antagonist | ADRA1A, ADRA2A, HRH1, HRH2, HTR2A, HTR7 | ophthalmology | conjunctivitis | NC1=NCC2N1c1ccccc1Cc1ccccc21 | Launched | true | ACH-000423 |
BRD-A98990573-003-01-3 | ACH-000553 | SQ1_LUNG | HTS002 | 1 | 1.429767 | 0.050656 | -0.045753 | 1.211948 | 0.134356 | null | epinastine | histamine receptor antagonist | ADRA1A, ADRA2A, HRH1, HRH2, HTR2A, HTR7 | ophthalmology | conjunctivitis | NC1=NCC2N1c1ccccc1Cc1ccccc21 | Launched | true | ACH-000553 |
BRD-A98990573-003-01-3 | ACH-000834 | UMUC1_URINARY_TRACT | HTS002 | 1 | 2.420943 | -0.386907 | 0.025175 | 1.570848 | 0.02106 | null | epinastine | histamine receptor antagonist | ADRA1A, ADRA2A, HRH1, HRH2, HTR2A, HTR7 | ophthalmology | conjunctivitis | NC1=NCC2N1c1ccccc1Cc1ccccc21 | Launched | true | ACH-000834 |
BRD-A98990573-003-01-3 | ACH-000252 | LS1034_LARGE_INTESTINE | HTS002 | 1 | 1.764826 | 0.318103 | 0.075741 | 1.460723 | 0.016555 | null | epinastine | histamine receptor antagonist | ADRA1A, ADRA2A, HRH1, HRH2, HTR2A, HTR7 | ophthalmology | conjunctivitis | NC1=NCC2N1c1ccccc1Cc1ccccc21 | Launched | true | ACH-000252 |
BRD-A98990573-003-01-3 | ACH-000123 | COV434_OVARY | HTS002 | 1 | 1.871036 | 0.971387 | 0.042252 | 1.23525 | 0.790329 | null | epinastine | histamine receptor antagonist | ADRA1A, ADRA2A, HRH1, HRH2, HTR2A, HTR7 | ophthalmology | conjunctivitis | NC1=NCC2N1c1ccccc1Cc1ccccc21 | Launched | true | ACH-000123 |
BRD-A98990573-003-01-3 | ACH-000329 | CCFSTTG1_CENTRAL_NERVOUS_SYSTEM | HTS002 | 1 | 2.043009 | -0.033437 | -0.174835 | 1.543977 | 1.035926 | null | epinastine | histamine receptor antagonist | ADRA1A, ADRA2A, HRH1, HRH2, HTR2A, HTR7 | ophthalmology | conjunctivitis | NC1=NCC2N1c1ccccc1Cc1ccccc21 | Launched | true | ACH-000329 |
BRD-A98990573-003-01-3 | ACH-000717 | COLO680N_OESOPHAGUS | HTS002 | 1 | 1.78235 | -0.034124 | -0.001352 | 1.389012 | 0.056457 | null | epinastine | histamine receptor antagonist | ADRA1A, ADRA2A, HRH1, HRH2, HTR2A, HTR7 | ophthalmology | conjunctivitis | NC1=NCC2N1c1ccccc1Cc1ccccc21 | Launched | true | ACH-000717 |
BRD-A98990573-003-01-3 | ACH-000669 | SW900_LUNG | HTS002 | 1 | 1.832861 | -0.00685 | -0.103785 | 1.426702 | 105.043676 | null | epinastine | histamine receptor antagonist | ADRA1A, ADRA2A, HRH1, HRH2, HTR2A, HTR7 | ophthalmology | conjunctivitis | NC1=NCC2N1c1ccccc1Cc1ccccc21 | Launched | true | ACH-000669 |
BRD-A98990573-003-01-3 | ACH-000764 | SH10TC_STOMACH | HTS002 | 1 | 1.051229 | 0.112602 | -0.402757 | 1.030866 | 0.001776 | null | epinastine | histamine receptor antagonist | ADRA1A, ADRA2A, HRH1, HRH2, HTR2A, HTR7 | ophthalmology | conjunctivitis | NC1=NCC2N1c1ccccc1Cc1ccccc21 | Launched | true | ACH-000764 |
BRD-A98990573-003-01-3 | ACH-000288 | BT549_BREAST | HTS002 | 1 | 1.701641 | 0.191987 | 0.074533 | 1.347764 | 0.086103 | null | epinastine | histamine receptor antagonist | ADRA1A, ADRA2A, HRH1, HRH2, HTR2A, HTR7 | ophthalmology | conjunctivitis | NC1=NCC2N1c1ccccc1Cc1ccccc21 | Launched | true | ACH-000288 |
BRD-A98990573-003-01-3 | ACH-000228 | BICR31_UPPER_AERODIGESTIVE_TRACT | HTS002 | 1 | 2.25861 | 0.069242 | 0.033481 | 1.551604 | 2.911644 | null | epinastine | histamine receptor antagonist | ADRA1A, ADRA2A, HRH1, HRH2, HTR2A, HTR7 | ophthalmology | conjunctivitis | NC1=NCC2N1c1ccccc1Cc1ccccc21 | Launched | true | ACH-000228 |
BRD-A98990573-003-01-3 | ACH-000977 | LNCAPCLONEFGC_PROSTATE | HTS002 | 1 | 0.971757 | 0.693095 | -0.229357 | 0.983601 | 0.033669 | null | epinastine | histamine receptor antagonist | ADRA1A, ADRA2A, HRH1, HRH2, HTR2A, HTR7 | ophthalmology | conjunctivitis | NC1=NCC2N1c1ccccc1Cc1ccccc21 | Launched | true | ACH-000977 |
BRD-A98990573-003-01-3 | ACH-000397 | TEN_ENDOMETRIUM | HTS002 | 1 | 2.376421 | -0.009003 | -0.041521 | 1.814746 | 68,925,885,048,248,780 | null | epinastine | histamine receptor antagonist | ADRA1A, ADRA2A, HRH1, HRH2, HTR2A, HTR7 | ophthalmology | conjunctivitis | NC1=NCC2N1c1ccccc1Cc1ccccc21 | Launched | true | ACH-000397 |
BRD-A98990573-003-01-3 | ACH-000565 | RCM1_LARGE_INTESTINE | HTS002 | 1 | 1.558587 | -0.55099 | 0.033954 | 1.278205 | 0.076446 | null | epinastine | histamine receptor antagonist | ADRA1A, ADRA2A, HRH1, HRH2, HTR2A, HTR7 | ophthalmology | conjunctivitis | NC1=NCC2N1c1ccccc1Cc1ccccc21 | Launched | true | ACH-000565 |
BRD-A98990573-003-01-3 | ACH-000927 | BT474_BREAST | HTS002 | 1 | 1.343573 | -0.196606 | -0.171738 | 1.231561 | 4.08948 | null | epinastine | histamine receptor antagonist | ADRA1A, ADRA2A, HRH1, HRH2, HTR2A, HTR7 | ophthalmology | conjunctivitis | NC1=NCC2N1c1ccccc1Cc1ccccc21 | Launched | true | ACH-000927 |
BRD-K47832606-001-30-1 | ACH-000879 | MFE296_ENDOMETRIUM | HTS002 | 1 | 0.123092 | 7.885006 | 0.523307 | 0.726373 | 0.48411 | 0.501776 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000879 |
BRD-K47832606-001-30-1 | ACH-000320 | PSN1_PANCREAS | HTS002 | 1 | 0.10514 | 4.771221 | 0.972544 | 0.336463 | 0.007499 | 0.007879 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000320 |
BRD-K47832606-001-30-1 | ACH-001145 | OC316_OVARY | HTS002 | 1 | 0.099077 | 3.864619 | 0.803485 | 0.485618 | 0.039244 | 0.041552 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-001145 |
BRD-K47832606-001-30-1 | ACH-000873 | KYSE270_OESOPHAGUS | HTS002 | 1 | 0.060055 | 3.816708 | 0.775195 | 0.548483 | 0.094523 | 0.097745 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000873 |
BRD-K47832606-001-30-1 | ACH-000855 | KYSE150_OESOPHAGUS | HTS002 | 1 | 0.390028 | 5.593754 | 0.711406 | 0.631609 | 0.028491 | 0.037349 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000855 |
BRD-K47832606-001-30-1 | ACH-000913 | ESS1_ENDOMETRIUM | HTS002 | 1 | 0.27864 | 2.113099 | 0.413024 | 0.647397 | 0.087092 | 0.128069 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000913 |
BRD-K47832606-001-30-1 | ACH-000558 | A172_CENTRAL_NERVOUS_SYSTEM | HTS002 | 1 | 0.219398 | 1.167315 | 0.603356 | 0.580288 | 0.054058 | 0.088671 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000558 |
BRD-K47832606-001-30-1 | ACH-000593 | BC3C_URINARY_TRACT | HTS002 | 1 | 0.285356 | 3.283477 | 0.629942 | 0.645974 | 0.0817 | 0.105699 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000593 |
BRD-K47832606-001-30-1 | ACH-000488 | TE11_OESOPHAGUS | HTS002 | 1 | 0.236216 | 3.808991 | 0.794521 | 0.598061 | 0.060558 | 0.071628 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000488 |
BRD-K47832606-001-30-1 | ACH-000832 | CAL27_UPPER_AERODIGESTIVE_TRACT | HTS002 | 1 | 0.278338 | 2.946289 | 0.812135 | 0.564635 | 0.028676 | 0.037794 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000832 |
BRD-K47832606-001-30-1 | ACH-000781 | NCIH2023_LUNG | HTS002 | 1 | 0.379814 | 9.909888 | 0.441305 | 0.690942 | 0.0794 | 0.091684 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000781 |
BRD-K47832606-001-30-1 | ACH-000833 | RH30_SOFT_TISSUE | HTS002 | 1 | 0.322819 | 1.710281 | 0.592769 | 0.543245 | 0.01433 | 0.026284 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000833 |
BRD-K47832606-001-30-1 | ACH-000137 | 8MGBA_CENTRAL_NERVOUS_SYSTEM | HTS002 | 1 | 0.188678 | 2.328343 | 0.757438 | 0.581448 | 0.066961 | 0.082072 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000137 |
BRD-K47832606-001-30-1 | ACH-000632 | HS944T_SKIN | HTS002 | 1 | 0.185653 | 3.906275 | 0.661074 | 0.560786 | 0.05333 | 0.060058 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000632 |
BRD-K47832606-001-30-1 | ACH-000319 | MPP89_PLEURA | HTS002 | 1 | 2.515378 | -0.014656 | -0.013553 | 1.771409 | 0.925875 | null | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000319 |
BRD-K47832606-001-30-1 | ACH-000630 | YD8_UPPER_AERODIGESTIVE_TRACT | HTS002 | 1 | 0.425762 | 2.865641 | 0.030134 | 0.85194 | 0.819372 | 1.594198 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000630 |
BRD-K47832606-001-30-1 | ACH-000266 | SNU213_PANCREAS | HTS002 | 1 | 1.522356 | -6.680382 | 0.191283 | 1.111944 | 0.004884 | null | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000266 |
BRD-K47832606-001-30-1 | ACH-000047 | GCIY_STOMACH | HTS002 | 1 | 0.223612 | 2.620157 | 0.775777 | 0.573586 | 0.048452 | 0.060754 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000047 |
BRD-K47832606-001-30-1 | ACH-000273 | SF539_CENTRAL_NERVOUS_SYSTEM | HTS002 | 1 | 0.131052 | 4.46567 | 0.760405 | 0.492328 | 0.034496 | 0.036926 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000273 |
BRD-K47832606-001-30-1 | ACH-000682 | SNU1066_UPPER_AERODIGESTIVE_TRACT | HTS002 | 1 | 0.22864 | 2.817694 | 0.774301 | 0.572712 | 0.046286 | 0.057498 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000682 |
BRD-K47832606-001-30-1 | ACH-000359 | MG63_BONE | HTS002 | 1 | 0.293324 | 2.729806 | 0.654008 | 0.750275 | 0.324131 | 0.447995 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000359 |
BRD-K47832606-001-30-1 | ACH-000846 | FADU_UPPER_AERODIGESTIVE_TRACT | HTS002 | 1 | 0.101684 | 0.891676 | 0.883318 | 0.492464 | 0.040847 | 0.052711 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000846 |
BRD-K47832606-001-30-1 | ACH-000804 | NB1_AUTONOMIC_GANGLIA | HTS002 | 1 | 0.073301 | 1.959961 | 0.972829 | 0.421177 | 0.023306 | 0.025269 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000804 |
BRD-K47832606-001-30-1 | ACH-000609 | SF126_CENTRAL_NERVOUS_SYSTEM | HTS002 | 1 | -0.038818 | 0.519385 | 0.784649 | 0.418278 | 0.030612 | 0.026508 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000609 |
BRD-K47832606-001-30-1 | ACH-000974 | SNGM_ENDOMETRIUM | HTS002 | 1 | 0.226438 | 3.244132 | 0.466407 | 0.649378 | 0.122966 | 0.148088 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000974 |
BRD-K47832606-001-30-1 | ACH-000987 | MEWO_SKIN | HTS002 | 1 | 0.149936 | 1.387641 | 0.812502 | 0.592523 | 0.095506 | 0.123481 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000987 |
BRD-K47832606-001-30-1 | ACH-000787 | LXF289_LUNG | HTS002 | 1 | 0.229243 | 5.140688 | 0.849299 | 0.521692 | 0.024247 | 0.02732 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000787 |
BRD-K47832606-001-30-1 | ACH-000561 | TT_OESOPHAGUS | HTS002 | 1 | 0.194131 | 3.821604 | 0.732601 | 0.536222 | 0.037549 | 0.042702 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000561 |
BRD-K47832606-001-30-1 | ACH-000212 | CAL120_BREAST | HTS002 | 1 | 0.169088 | 1.825458 | 0.844268 | 0.639196 | 0.147939 | 0.185473 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000212 |
BRD-K47832606-001-30-1 | ACH-000753 | JMSU1_URINARY_TRACT | HTS002 | 1 | 0.071853 | 1.297696 | 0.77363 | 0.652125 | 0.265021 | 0.298676 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000753 |
BRD-K47832606-001-30-1 | ACH-000305 | ECGI10_OESOPHAGUS | HTS002 | 1 | 0.33356 | 2.198212 | 0.786261 | 0.693634 | 0.115508 | 0.190516 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000305 |
BRD-K47832606-001-30-1 | ACH-000138 | CFPAC1_PANCREAS | HTS002 | 1 | 0.100176 | 0.899843 | 0.676359 | 0.409957 | 0.016351 | 0.020963 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000138 |
BRD-K47832606-001-30-1 | ACH-000250 | KMRC20_KIDNEY | HTS002 | 1 | 0.325036 | 5.218719 | 0.656166 | 0.666281 | 0.082467 | 0.100847 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000250 |
BRD-K47832606-001-30-1 | ACH-000856 | CAL51_BREAST | HTS002 | 1 | 0.242264 | 5.051557 | 0.81304 | 0.571427 | 0.041337 | 0.047131 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000856 |
BRD-K47832606-001-30-1 | ACH-000046 | ACHN_KIDNEY | HTS002 | 1 | 0.032024 | 2.346294 | 0.797691 | 0.441029 | 0.036839 | 0.037893 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000046 |
BRD-K47832606-001-30-1 | ACH-000878 | HCC15_LUNG | HTS002 | 1 | 0.292419 | 3.746697 | 0.852231 | 0.602022 | 0.042619 | 0.053889 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000878 |
BRD-K47832606-001-30-1 | ACH-000766 | NCIH1648_LUNG | HTS002 | 1 | 0.178486 | 6.801478 | 0.839077 | 0.530087 | 0.038843 | 0.041448 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000766 |
BRD-K47832606-001-30-1 | ACH-000666 | NCIH1355_LUNG | HTS002 | 1 | 0.486426 | 2.745142 | 0.401085 | 0.75265 | 0.093375 | 0.347363 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000666 |
BRD-K47832606-001-30-1 | ACH-000014 | HS294T_SKIN | HTS002 | 1 | 0.190261 | 3.40639 | 0.653899 | 0.546061 | 0.04339 | 0.04994 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000014 |
BRD-K47832606-001-30-1 | ACH-000701 | RMUGS_OVARY | HTS002 | 1 | 0.327732 | 1.554079 | 0.635325 | 0.641891 | 0.056868 | 0.112887 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000701 |
BRD-K47832606-001-30-1 | ACH-000884 | MDAMB435S_SKIN | HTS002 | 1 | 1.468327 | -2.133493 | 0.420368 | 1.246145 | 0.10014 | null | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000884 |
BRD-K47832606-001-30-1 | ACH-000037 | S117_SOFT_TISSUE | HTS002 | 1 | 0.24471 | 2.80327 | 0.534332 | 0.647703 | 0.1082 | 0.137521 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000037 |
BRD-K47832606-001-30-1 | ACH-000504 | SNB75_CENTRAL_NERVOUS_SYSTEM | HTS002 | 1 | 0.145945 | 4.673798 | 0.540869 | 0.601978 | 0.108622 | 0.116947 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000504 |
BRD-K47832606-001-30-1 | ACH-000502 | TCCPAN2_PANCREAS | HTS002 | 1 | 0.240968 | 4.698223 | 0.74694 | 0.646632 | 0.109136 | 0.125534 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000502 |
BRD-K47832606-001-30-1 | ACH-000886 | NCIH2009_LUNG | HTS002 | 1 | 0.053788 | 6.749659 | 0.887671 | 0.30824 | 0.008297 | 0.008438 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000886 |
BRD-K47832606-001-30-1 | ACH-000035 | NCIH1650_LUNG | HTS002 | 1 | 0.549551 | 8.693176 | 0.452271 | 0.773775 | 0.076459 | null | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000035 |
BRD-K47832606-001-30-1 | ACH-000661 | WM1799_SKIN | HTS002 | 1 | 0.172981 | 0.997392 | 0.751888 | 0.459293 | 0.016976 | 0.025985 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000661 |
BRD-K47832606-001-30-1 | ACH-000391 | MHHES1_BONE | HTS002 | 1 | 0.057975 | 5.871609 | 0.689743 | 0.513058 | 0.066302 | 0.067708 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000391 |
BRD-K47832606-001-30-1 | ACH-000843 | HARA_LUNG | HTS002 | 1 | 0.266728 | 2.027041 | 0.643432 | 0.590675 | 0.044402 | 0.064677 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000843 |
BRD-K47832606-001-30-1 | ACH-000711 | JIMT1_BREAST | HTS002 | 1 | 0.258613 | 3.917281 | 0.331083 | 0.668526 | 0.130536 | 0.157205 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000711 |
BRD-K47832606-001-30-1 | ACH-000232 | U251MG_CENTRAL_NERVOUS_SYSTEM | HTS002 | 1 | 0.111125 | 1.786807 | 0.673534 | 0.508229 | 0.046588 | 0.053625 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000232 |
BRD-K47832606-001-30-1 | ACH-000060 | PANC1005_PANCREAS | HTS002 | 1 | 0.365577 | 5.680825 | 0.614259 | 0.653408 | 0.049844 | 0.062812 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000060 |
BRD-K47832606-001-30-1 | ACH-000322 | HT144_SKIN | HTS002 | 1 | 0.156055 | 4.765827 | 0.456102 | 0.617693 | 0.123272 | 0.133339 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000322 |
BRD-K47832606-001-30-1 | ACH-000736 | SNU601_STOMACH | HTS002 | 1 | 0.064045 | 2.857174 | 0.893413 | 0.338135 | 0.010464 | 0.010978 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000736 |
BRD-K47832606-001-30-1 | ACH-000809 | KYSE410_OESOPHAGUS | HTS002 | 1 | 0.249972 | 1.284933 | 0.829526 | 0.563619 | 0.035185 | 0.060339 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000809 |
BRD-K47832606-001-30-1 | ACH-000747 | NCIH1703_LUNG | HTS002 | 1 | 0.104899 | 1.18601 | 0.90381 | 0.676512 | 0.303697 | 0.370394 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000747 |
BRD-K47832606-001-30-1 | ACH-000364 | U2OS_BONE | HTS002 | 1 | 1.435834 | -6.467609 | 0.29223 | 1.137719 | 0.013101 | null | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000364 |
BRD-K47832606-001-30-1 | ACH-000679 | OE19_OESOPHAGUS | HTS002 | 1 | 0.23987 | 4.833581 | 0.682862 | 0.658406 | 0.127667 | 0.146147 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000679 |
BRD-K47832606-001-30-1 | ACH-000985 | LS411N_LARGE_INTESTINE | HTS002 | 1 | 0.148856 | 3.086933 | 0.699415 | 0.539835 | 0.052662 | 0.05905 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000985 |
BRD-K47832606-001-30-1 | ACH-000441 | SH4_SKIN | HTS002 | 1 | 0.502221 | 5.618827 | 0.659641 | 0.770076 | 0.113072 | null | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000441 |
BRD-K47832606-001-30-1 | ACH-001113 | LC1SQSF_LUNG | HTS002 | 1 | 0.482338 | 3.09893 | 0.214854 | 0.764082 | 0.12004 | 0.353063 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-001113 |
BRD-K47832606-001-30-1 | ACH-000620 | JHH1_LIVER | HTS002 | 1 | 0.655783 | 9.945614 | 0.358919 | 0.827884 | 0.078108 | null | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000620 |
BRD-K47832606-001-30-1 | ACH-000853 | NCIH661_LUNG | HTS002 | 1 | 0.52168 | 2.862689 | 0.48102 | 0.768694 | 0.091619 | null | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000853 |
BRD-K47832606-001-30-1 | ACH-000102 | GMS10_CENTRAL_NERVOUS_SYSTEM | HTS002 | 1 | 0.250206 | 1.810383 | 0.68131 | 0.579092 | 0.04306 | 0.063176 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000102 |
BRD-K47832606-001-30-1 | ACH-000648 | NCIH28_PLEURA | HTS002 | 1 | 0.28697 | 7.031266 | 0.539409 | 0.666134 | 0.10633 | 0.120048 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000648 |
BRD-K47832606-001-30-1 | null | null | HTS002 | 1 | 0.131836 | 1.959351 | 0.906137 | 0.401642 | 0.012437 | 0.01454 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | false | ACH-000925_FAILED_STR |
BRD-K47832606-001-30-1 | ACH-001239 | WM2664_SKIN | HTS002 | 1 | 0.163677 | 2.237879 | 0.855226 | 0.565935 | 0.064959 | 0.077552 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-001239 |
BRD-K47832606-001-30-1 | ACH-001321 | TT_THYROID | HTS002 | 1 | 0.384921 | 3.278042 | 0.722054 | 0.835351 | 0.744516 | 1.165452 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-001321 |
BRD-K47832606-001-30-1 | ACH-000279 | EWS502_BONE | HTS002 | 1 | 0.062731 | 1.855873 | 0.74678 | 0.431616 | 0.027802 | 0.029884 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000279 |
BRD-K47832606-001-30-1 | ACH-000172 | TM87_SOFT_TISSUE | HTS002 | 1 | 0.110156 | 3.392582 | 0.895632 | 0.5249 | 0.056216 | 0.060494 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000172 |
BRD-K47832606-001-30-1 | ACH-001128 | MON_SOFT_TISSUE | HTS002 | 1 | 0.125018 | 9.151695 | 0.585093 | 0.569529 | 0.08445 | 0.087147 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-001128 |
BRD-K47832606-001-30-1 | ACH-000437 | SW1088_CENTRAL_NERVOUS_SYSTEM | HTS002 | 1 | 0.109291 | 1.89719 | 0.694857 | 0.393217 | 0.013438 | 0.015304 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000437 |
BRD-K47832606-001-30-1 | ACH-000735 | PECAPJ49_UPPER_AERODIGESTIVE_TRACT | HTS002 | 1 | 0.09273 | 1.218993 | 0.882721 | 0.39397 | 0.015064 | 0.017824 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000735 |
BRD-K47832606-001-30-1 | ACH-000643 | HDQP1_BREAST | HTS002 | 1 | 0.379726 | 7.466043 | 0.719555 | 0.696771 | 0.087041 | 0.105343 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000643 |
BRD-K47832606-001-30-1 | ACH-000207 | DETROIT562_UPPER_AERODIGESTIVE_TRACT | HTS002 | 1 | 0.266922 | 3.327026 | 0.572965 | 0.590454 | 0.044212 | 0.055612 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000207 |
BRD-K47832606-001-30-1 | ACH-000456 | BCPAP_THYROID | HTS002 | 1 | 0.054028 | 0.735584 | 0.795512 | 0.506728 | 0.062682 | 0.073225 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000456 |
BRD-K47832606-001-30-1 | ACH-000260 | SKNAS_AUTONOMIC_GANGLIA | HTS002 | 1 | 0.219911 | 5.482424 | 0.412103 | 0.558627 | 0.041256 | 0.045855 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000260 |
BRD-K47832606-001-30-1 | ACH-000019 | MCF7_BREAST | HTS002 | 1 | 0.331773 | 1.034922 | 0.695635 | 0.706686 | 0.142477 | 0.408183 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000019 |
BRD-K47832606-001-30-1 | ACH-000582 | COLO741_SKIN | HTS002 | 1 | 0.26895 | 1.045834 | 0.580407 | 0.71155 | 0.220731 | 0.461781 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000582 |
BRD-K47832606-001-30-1 | ACH-000990 | HEC108_ENDOMETRIUM | HTS002 | 1 | 0.346441 | 3.549785 | 0.620228 | 0.650627 | 0.055859 | 0.077898 | floxuridine | DNA synthesis inhibitor | TYMS | oncology | colorectal cancer | OC[C@H]1OC(C[C@H]1O)n1cc(F)c(=O)[nH]c1=O, OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(=O)[nH]c1=O | Launched | true | ACH-000990 |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.