hexsha
stringlengths 40
40
| size
int64 5
129k
| content
stringlengths 5
129k
| avg_line_length
float64 4
98.3
| max_line_length
int64 5
660
| alphanum_fraction
float64 0.25
0.98
|
|---|---|---|---|---|---|
7aa1c81cfacc2e14437bcf28871795e2518a5d30 | 425 | export modinfo = {
type: "function"
id: "localScript"
func: (Source, Parent) ->
return unless CreateLocalScript
NewScript = ConfigSystem("Get", "LocalScriptClone")\Clone!
NewScript\ClearAllChildren!
Souc = CreateInstance"StringValue"
Parent: NewScript
Name: ConfigSystem "Get", "SourceName"
Value: Source
NewScript.Disabled = true
NewScript.Parent = Parent
NewScript.Disabled = false
NewScript
}
| 23.611111 | 60 | 0.729412 |
349a1491c3670f605266834ab3f1ad58433122a2 | 2,731 | -- tildeath
-- My own dialect of ~ATH
-- By daelvn
re = require "re"
inspect = require "inspect"
shorthand = (s) ->
s = s\gsub "$(%w+)", [[{:tag: "" -> "%1" :}]]
s = s\gsub "&(%w+)", [[{:%1: %1 :}]]
s = s\gsub ";(%w+)", [[{:id: %1 :}]]
return s
grammar = re.compile shorthand [[
-- program
program <- chunk
-- chunks and blocks
block <- ws "{" ws chunk ws "}"
chunk <- ws {| $chunk (statement ";" ws)* |}
marker <- "->" id
-- statements
statement <- import / define / bifurcate / execute / die / slabel / loop / directive / run
label <- blabel / mlabel / llabel
slabel <- llabel / blabel
llabel <- {| $label "#" &id {:labeled: loop :} |}
blabel <- {| $label "#" &id {:labeled: block :} |}
mlabel <- {| $label "#" &id {:labeled: marker :} |}
loop <- "~ATH(" ws {| $loop &expr ws ")" ws &block ws &execute |}
die <- {| $die &type ":DIE()" |}
execute <- "EXECUTE(" ws {| $execute (&type / &statement) |} ws ")"
bifurcate <- "bifurcate" rs {| $bifur ;cid ws &list |}
import <- "import" rs {| $import {:library:cid:} rs ;cid |}
define <- "define" rs {| $define ;cid rs {:value: symbol / string / list :} |}
directive <- "==>" ws {| $directive &id (rs &string)? |}
run <- "RUN" {| $run &list |}
scope <- "->" {| $scope &block |}
-- recombine syntax
list <- ws "[" ws {| $list tlist |} ws "]"
tlist <- (type / string) ("," ws (type / string))*
-- types
expr <- null / {| $neg "!" type |} / id / list / mlabel
type <- null / id / list / mlabel
-- primitives
string <- {| $string '"' {[^"]*} '"' / "'" {[^']*} "'" |}
symbol <- {| $symbol ":" id |}
null <- {| $null "NULL" |}
cid <- id / mlabel
id <- {| $id {%w valid*} |}
valid <- [%w'!/@$%^&*<>_~-%.]
rs <- (%s / "//" [^%nl]*)+
ws <- (%s / "//" [^%nl]*)*
]]
reduce = (t, tint="white") ->
switch t.tag
when "execute"
t = t.type or t.statement
when "symbol"
t[1] = t[1][1]
when "label"
tint = string.lower t.id[1]
-- tint
t.tint = tint
-- iterate
if "table" == type t
for k, v in pairs t
continue if k == "tint"
if "table" == type v
t[k] = reduce v, tint
--
return t
parse = (s) ->
ast = grammar\match s
error "Failed to parse: #{s}" unless ast
return reduce ast
collect = (ast, t={}) ->
for i, stat in ipairs ast
if stat.tag == "define"
-- FIXME make it work for lists (tables)
print "Collected -> #{stat.id[1]} = #{stat.value[1]}"
t[stat.id[1]] = stat.value[1]
t
{
:NULL
:grammar
:parse, :reduce
:collect
} | 28.747368 | 94 | 0.465763 |
d396011753d8b3fc811284fe2abc4fd209d4c33c | 1,247 | export state = require "lib/state"
export util = require "lib/util"
export shine = require "lib/shine"
export bump = require "lib/bump"
export world = bump.newWorld!
export post_effect = shine.scanlines!\chain (shine.crt!\set "x", 0.05)\set "y", 0.055
with love
.graphics.setBackgroundColor 255, 255, 255
.run = ->
dt = 0
update_time = 0
target_delta = 1 / 1200
.math.setRandomSeed os.time! if .math
.load! if .load
.timer.step! if .timer
state\set "src/core"
state\load!
while true
update_time += dt
if love.event
.event.pump!
for name, a, b, c, d, e, f in .event.poll!
if "quit" == name
return a unless .quit or not .event.quit!
.handlers[name] a, b, c, d, e, f
if .timer
.timer.step!
dt = .timer.getDelta!
if update_time > target_delta
state\update dt
if .graphics and .graphics.isActive!
.graphics.clear .graphics.getBackgroundColor!
.graphics.setColor 255, 255, 255
.graphics.origin!
post_effect\draw ->
state\draw!
.graphics.present!
.timer.sleep 0.001 if .timer | 22.267857 | 85 | 0.561347 |
c74227175fb7fe77eedf225938ec2af3bbe2bc76 | 630 | Dorothy!
CharacterSettingView = require "View.Control.Unit.CharacterSetting"
ActionChooser = require "Control.AI.ActionChooser"
import Struct from require "Lib.Utils"
MessageBox = require "Control.Basic.MessageBox"
Class CharacterSettingView,
__init:=>
@actionPanel.itemSource = Struct.Array!
@actionPanel\slot "SizeChanged",->
@updateSize!
@emit "SizeChanged",@
@actionPanel\slot "AddToList",(items)->
with ActionChooser!
\slot "Selected",(file)->
return unless file
if items\contains file
MessageBox text:"Action Exist!",okOnly:true
else
items\insert file
| 27.391304 | 68 | 0.701587 |
2a2070dc682c1e417420cf9ea12afc8bd180d18e | 16,977 | -- Copyright 2017 The Howl Developers
-- License: MIT (see LICENSE.md at the top-level directory of the distribution)
{:app, :Buffer, :breadcrumbs, :config} = howl
{:File} = howl.io
{:Window} = howl.ui
describe 'breadcrumbs', ->
local editor, cursor, old_tolerance
buffer = (text) ->
with Buffer {}
.text = text
setup ->
app.window = Window!
editor = app\new_editor!
cursor = editor.cursor
app.editor = editor
breadcrumbs.init!
old_tolerance = config.breadcrumb_tolerance
teardown ->
config.breadcrumb_tolerance = old_tolerance
app.editor = nil
app.window\destroy!
before_each ->
app.editor.buffer = buffer ''
config.breadcrumb_tolerance = 0
after_each ->
breadcrumbs.clear!
describe 'drop(opts)', ->
it 'accepts a file and a pos', ->
File.with_tmpfile (file) ->
breadcrumbs.drop :file, pos: 3
assert.same {:file, pos: 3}, breadcrumbs.previous
it 'accepts a file path and a pos', ->
File.with_tmpfile (file) ->
breadcrumbs.drop :file, pos: 3
assert.same {file: File(file), pos: 3}, breadcrumbs.previous
it 'accepts a buffer and a pos', ->
File.with_tmpfile (file) ->
file.contents = '123456789\nabcdefgh'
b = buffer ''
b.file = file
breadcrumbs.drop buffer: b, pos: 3
assert.equals b.file, breadcrumbs.previous.file
assert.equals 3, breadcrumbs.previous.pos
assert.not_nil breadcrumbs.previous.buffer_marker
context 'when a buffer is present', ->
it 'sets a marker in the buffer pointing to the crumb', ->
b = buffer '123456789\nabcdefgh'
breadcrumbs.drop buffer: b, pos: 3
assert.equals 3, breadcrumbs.previous.pos
assert.not_nil breadcrumbs.previous.buffer_marker
m = breadcrumbs.previous.buffer_marker
marker_buffer = m.buffer
markers = marker_buffer.markers\find name: m.name
assert.equals 1, #markers
assert.equals 3, markers[1].start_offset
assert.equals 3, markers[1].end_offset
context 'when opts is missing', ->
it 'adds a crumb for the current buffer and position', ->
File.with_tmpfile (file) ->
file.contents = '1234\n6789'
editor.buffer.file = file
cursor.pos = 7
breadcrumbs.drop!
crumb = breadcrumbs.previous
assert.equals 7, crumb.pos
assert.equals editor.buffer, crumb.buffer_marker.buffer
assert.equals file, crumb.file
context 'when forward crumbs exists', ->
it 'invalidates all such crumbs and buffer markers', ->
b = buffer '123456789\nabcdefgh'
editor.buffer = b
breadcrumbs.drop buffer: b, pos: 3
breadcrumbs.drop buffer: b, pos: 6
breadcrumbs.drop buffer: b, pos: 9
cursor.pos = 10
breadcrumbs.go_back! -- loc 3
assert.equals 4, #breadcrumbs.trail
breadcrumbs.go_back! -- loc 2
assert.equals 4, #breadcrumbs.trail
assert.is_not_nil breadcrumbs.trail[2]
assert.is_not_nil breadcrumbs.trail[3]
assert.is_not_nil breadcrumbs.trail[4]
assert.equals 2, breadcrumbs.location
breadcrumbs.drop buffer: b, pos: 4
assert.equals 4, breadcrumbs.trail[2].pos
assert.is_nil breadcrumbs.trail[3]
markers = [m.start_offset for m in *b.markers\find({})]
table.sort markers
assert.same { 3, 4 }, markers
context '(tolerance handling)',
it 'merges crumbs when their distance is within the tolerance', ->
buf = editor.buffer
buf.text = string.rep('123456789\n', 10)
config.breadcrumb_tolerance = 5
breadcrumbs.drop buffer: buf, pos: 1
breadcrumbs.drop buffer: buf, pos: 6
assert.equals 1, #breadcrumbs.trail
assert.equals 6, breadcrumbs.trail[1].pos
markers = [m.start_offset for m in *buf.markers\find({})]
assert.same { 6 }, markers
breadcrumbs.drop buffer: buf, pos: 12
assert.equals 2, #breadcrumbs.trail
assert.equals 12, breadcrumbs.trail[2].pos
markers = [m.start_offset for m in *buf.markers\find({})]
assert.same { 6, 12 }, markers
context 'house cleaning according to breadcrumb_limit', ->
local old_limit
before_each ->
old_limit = config.breadcrumb_limit
config.breadcrumb_limit = 2
after_each ->
config.breadcrumb_limit = old_limit
it 'purges old crumbs according to breadcrumb_limit', ->
b = buffer '123456789\nabcdefgh'
breadcrumbs.drop buffer: b, pos: 1
breadcrumbs.drop buffer: b, pos: 2
breadcrumbs.drop buffer: b, pos: 3
assert.equals 2, #breadcrumbs.trail
assert.equals 3, breadcrumbs.location
assert.same {2, 3}, [c.pos for c in *breadcrumbs.trail]
describe 'crumb cleaning', ->
it 'removes duplicate crumbs', ->
b = buffer '123456789'
breadcrumbs.drop buffer: b, pos: 3
breadcrumbs.drop buffer: b, pos: 3
assert.equals 1, #breadcrumbs.trail
markers = b.markers\find {}
assert.equals 1, #markers
it 'reduces unnecessary loops', ->
b = buffer '123456789'
breadcrumbs.drop buffer: b, pos: 3
breadcrumbs.drop buffer: b, pos: 6
breadcrumbs.drop buffer: b, pos: 3
breadcrumbs.drop buffer: b, pos: 6
assert.equals 2, #breadcrumbs.trail
assert.equals 3, breadcrumbs.location
describe 'clear', ->
it 'invalidates any existing crumbs (buffer markers and crumbs)', ->
b = buffer '123456789\nabcdefgh'
breadcrumbs.drop buffer: b, pos: 3
crumb = breadcrumbs.previous
breadcrumbs.clear!
assert.equals 1, breadcrumbs.location
assert.same {}, b.markers\find name: crumb.buffer_marker.name
assert.is_nil breadcrumbs.trail[1]
describe 'go_back', ->
context 'with a buffer and pos available', ->
it 'opens the buffer and set the current position', ->
b = buffer '123456789\nabcdefgh'
breadcrumbs.drop buffer: b, pos: 3
breadcrumbs.go_back!
assert.equals 3, cursor.pos
assert.equals b, editor.buffer
assert.equals 1, breadcrumbs.location
it 'uses a buffer marker for positioning to account for updates', ->
b = buffer '123456789'
breadcrumbs.drop buffer: b, pos: 6
b\insert 'xx', 2
breadcrumbs.go_back!
assert.equals 8, cursor.pos
context 'with a file and pos available', ->
it 'opens the file and sets the current position', ->
File.with_tmpfile (file) ->
file.contents = '123456789\nabcdefgh'
breadcrumbs.drop file: file, pos: 3
breadcrumbs.go_back!
assert.equals 3, cursor.pos
assert.equals file, editor.buffer.file
context 'when the buffer has been collected', ->
it 'falls back to the file when available', ->
File.with_tmpfile (file) ->
file.contents = '1234\n6789'
b = buffer ''
b.file = file
breadcrumbs.drop file: file, buffer: b, pos: 3
b = nil
collectgarbage!
breadcrumbs.go_back!
assert.equals 3, cursor.pos
assert.equals file, editor.buffer.file
it 'moves to the crumb before if present', ->
b1 = buffer 'buffer1'
breadcrumbs.drop buffer: b1, pos: 3
b2 = buffer 'buffer2'
breadcrumbs.drop buffer: b2, pos: 5
b2 = nil
collectgarbage!
breadcrumbs.go_back!
assert.equals 3, cursor.pos
assert.equals b1, editor.buffer
assert.equals 1, breadcrumbs.location
it 'inserts a crumb if needed before going back', ->
b = buffer '123456789'
editor.buffer = b
cursor.pos = 2
breadcrumbs.drop buffer: b, pos: 3
breadcrumbs.drop buffer: b, pos: 5
cursor.pos = 7
breadcrumbs.go_back!
assert.equals 5, cursor.pos -- at pos 5
assert.equals 2, breadcrumbs.location -- at breadcrumbs location 2
assert.equals 3, #breadcrumbs.trail -- with two forward crumbs
assert.equals 5, breadcrumbs.trail[2].pos -- the old one
assert.equals 7, breadcrumbs.trail[3].pos -- and the newly inserted
breadcrumbs.go_back!
assert.equals 3, cursor.pos -- at pos 3
assert.equals 1, breadcrumbs.location -- at breadcrumbs location 1
-- we shouldn't have any added crumb added for this case
assert.equals 3, #breadcrumbs.trail -- only three forward crumbs
assert.same {3, 5, 7}, [c.pos for c in *breadcrumbs.trail]
context '(tolerance handling)', ->
it 'moves beyond the previous crumb if it is within the distance', ->
b = editor.buffer
b.text = string.rep('1234567890', 2)
config.breadcrumb_tolerance = 2
breadcrumbs.drop buffer: b, pos: 1
breadcrumbs.drop buffer: b, pos: 4
breadcrumbs.drop buffer: b, pos: 7
breadcrumbs.drop buffer: b, pos: 10
cursor.pos = 12
breadcrumbs.go_back!
assert.equals 7, cursor.pos
breadcrumbs.go_back!
assert.equals 4, cursor.pos
describe 'go_forward', ->
context 'with a buffer and pos available', ->
it 'opens the buffer and set the current position', ->
b = buffer '123456789\nabcdefgh'
breadcrumbs.drop buffer: b, pos: 3
breadcrumbs.drop buffer: b, pos: 7
breadcrumbs.go_back!
breadcrumbs.go_back!
breadcrumbs.go_forward!
assert.equals 7, cursor.pos
assert.equals b, editor.buffer
it 'uses a buffer marker for positioning to account for updates', ->
b = buffer '123456789'
breadcrumbs.drop buffer: b, pos: 1
breadcrumbs.drop buffer: b, pos: 6
breadcrumbs.go_back!
breadcrumbs.go_back!
b\insert 'xx', 2
breadcrumbs.go_forward!
assert.equals 8, cursor.pos
context 'with a file and pos available', ->
it 'opens the file and sets the current position', ->
File.with_tmpfile (file) ->
file.contents = '123456789\nabcdefgh'
breadcrumbs.drop file: file, pos: 3
breadcrumbs.drop file: file, pos: 7
breadcrumbs.go_back!
breadcrumbs.go_back!
breadcrumbs.go_forward!
assert.equals 7, cursor.pos
assert.equals file, editor.buffer.file
context 'when the buffer has been collected', ->
it 'falls back to the file when available', ->
File.with_tmpfile (file) ->
file.contents = '1234\n6789'
b = buffer ''
b.file = file
breadcrumbs.drop file: file, buffer: b, pos: 3
breadcrumbs.drop file: file, buffer: b, pos: 7
b = nil
breadcrumbs.go_back!
breadcrumbs.go_back!
collectgarbage!
breadcrumbs.go_forward!
assert.equals 7, cursor.pos
assert.equals file, editor.buffer.file
it 'moves to the crumb after if present', ->
b1 = buffer 'buffer1'
breadcrumbs.drop buffer: b1, pos: 3
breadcrumbs.drop buffer: b1, pos: 4
b2 = buffer 'buffer2'
breadcrumbs.drop buffer: b2, pos: 5
breadcrumbs.go_back!
breadcrumbs.go_back!
b1 = nil
collectgarbage!
breadcrumbs.go_forward!
assert.equals 5, cursor.pos
assert.equals b2, editor.buffer
it 'inserts a crumb if needed before going forward', ->
b = buffer '123456789'
editor.buffer = b
breadcrumbs.drop buffer: b, pos: 3
breadcrumbs.drop buffer: b, pos: 5
breadcrumbs.drop buffer: b, pos: 7
cursor.pos = 7
breadcrumbs.go_back!
breadcrumbs.go_back!
breadcrumbs.go_back!
-- we start out with the three crumbs above, at pos 3
assert.equals 3, cursor.pos
assert.equals 3, #breadcrumbs.trail -- with three forward crumbs
assert.equals 1, breadcrumbs.location -- at breadcrumbs location 1
-- -- we'll move the cursor some and then go forward
cursor.pos = 4
breadcrumbs.go_forward!
assert.equals 5, cursor.pos -- at pos 5
-- -- this should have inserted a new crumb at the interim location
assert.equals 4, #breadcrumbs.trail -- with two forward crumbs
assert.equals 3, breadcrumbs.location -- with location thus = 3
assert.equals 3, breadcrumbs.trail[1].pos -- old back crumb
assert.equals 4, breadcrumbs.trail[2].pos -- newly inserted
assert.equals 5, breadcrumbs.trail[3].pos -- old forward crumb
assert.equals 7, breadcrumbs.trail[4].pos -- old forward crumb
-- -- -- forward again, without interim movement
breadcrumbs.go_forward!
assert.equals 7, cursor.pos -- at pos 5
-- -- -- this should not have introduced any new crumb
assert.equals 4, #breadcrumbs.trail
assert.equals 4, breadcrumbs.location
context '(tolerance handling)', ->
it 'moves beyond the next crumb if it is within the distance', ->
b = editor.buffer
b.text = string.rep('1234567890', 2)
config.breadcrumb_tolerance = 2
breadcrumbs.drop buffer: b, pos: 1
breadcrumbs.drop buffer: b, pos: 4
breadcrumbs.drop buffer: b, pos: 7
breadcrumbs.go_back!
breadcrumbs.go_back!
breadcrumbs.go_back!
cursor.pos = 2
breadcrumbs.go_forward!
assert.equals 7, cursor.pos
describe 'location', ->
it 'points to the current crumb position', ->
b = editor.buffer
b.text = string.rep('1234567890', 2)
assert.equals 1, breadcrumbs.location
breadcrumbs.drop buffer: b, pos: 1
assert.equals 2, breadcrumbs.location
breadcrumbs.drop buffer: b, pos: 4
assert.equals 3, breadcrumbs.location
it 'can be assigned to move to a specific location', ->
b = editor.buffer
b.text = string.rep('1234567890', 2)
breadcrumbs.drop buffer: b, pos: 1
breadcrumbs.drop buffer: b, pos: 4
breadcrumbs.drop buffer: b, pos: 8
breadcrumbs.location = 2
assert.equals 2, breadcrumbs.location
assert.equals 4, cursor.pos
describe '.trail', ->
it 'contains a list of breadcrumbs', ->
b = buffer '123456789'
File.with_tmpfile (file) ->
breadcrumbs.drop buffer: b, pos: 3
breadcrumbs.drop :file, pos: 6
crumbs = breadcrumbs.trail
assert.equals 3, crumbs[1].pos
assert.equals b, crumbs[1].buffer_marker.buffer
assert.same {:file, pos: 6}, crumbs[2]
it 'is automatically cleaned', ->
b1 = buffer '123456789'
b2 = buffer '123456789'
breadcrumbs.drop buffer: b1, pos: 3
breadcrumbs.drop buffer: b2, pos: 6
b1 = nil
collectgarbage!
crumbs = breadcrumbs.trail
assert.equals 1, #crumbs
assert.equals 6, crumbs[1].pos
context 'when a buffer is closed', ->
it 'removes any crumbs missing a file reference', ->
b1 = buffer '123456789'
b2 = app\new_buffer!
b2.text = '123456789'
b2.modified = false
breadcrumbs.drop buffer: b1, pos: 3
breadcrumbs.drop buffer: b2, pos: 5
breadcrumbs.drop buffer: b1, pos: 7
assert.equals 3, #breadcrumbs.trail
assert.equals 4, breadcrumbs.location
app\close_buffer b2
assert.equals 2, #breadcrumbs.trail
assert.equals 3, breadcrumbs.location
assert.same {3, 7}, [c.pos for c in *breadcrumbs.trail]
it 'clears any buffer references for crumbs with a file reference', ->
File.with_tmpfile (file) ->
file.contents = '123456789'
b1 = buffer '123456789'
b2 = app\new_buffer!
b2.file = file
breadcrumbs.drop buffer: b1, pos: 3
breadcrumbs.drop buffer: b2, pos: 5
breadcrumbs.drop buffer: b1, pos: 7
assert.equals 3, #breadcrumbs.trail
assert.equals 4, breadcrumbs.location
app\close_buffer b2
assert.is_nil breadcrumbs.trail[2].buffer_marker
assert.equals 3, #breadcrumbs.trail
assert.equals 4, breadcrumbs.location
it 'moves the current location down as necessary', ->
File.with_tmpfile (file) ->
file.contents = '123456789'
b1 = buffer '123456789'
b2 = app\new_buffer!
b2.file = file
breadcrumbs.drop buffer: b1, pos: 3
breadcrumbs.drop buffer: b2, pos: 5
breadcrumbs.drop buffer: b2, pos: 7
assert.equals 4, breadcrumbs.location
app\close_buffer b2
assert.equals 1, breadcrumbs.location
context 'memory management', ->
it 'keeps weak references to buffers', ->
holder = setmetatable {
buffer: buffer '123456789\nabcdefgh'
}, __mode: 'v'
breadcrumbs.drop buffer: holder.buffer, pos: 3
collectgarbage!
assert.is_nil holder.buffer
| 35.221992 | 79 | 0.624315 |
2fb95e86746aef915077ea3b53a7d969c90731d4 | 1,837 |
module "moonscript", package.seeall
require "moonscript.compile"
require "moonscript.parse"
require "moonscript.util"
import concat, insert from table
import split, dump from util
lua = :loadstring
export to_lua, moon_chunk, moon_loader, dirsep, line_tables
export dofile, loadfile, loadstring
dirsep = "/"
line_tables = {}
-- create moon path package from lua package path
create_moonpath = (package_path) ->
paths = split package_path, ";"
for i, path in ipairs paths
p = path\match "^(.-)%.lua$"
if p then paths[i] = p..".moon"
concat paths, ";"
to_lua = (text) ->
if "string" != type text
t = type text
error "expecting string (got ".. t ..")", 2
tree, err = parse.string text
if not tree
error err, 2
code, ltable, pos = compile.tree tree
if not code
error compile.format_error(ltable, pos, text), 2
code, ltable
moon_loader = (name) ->
name_path = name\gsub "%.", dirsep
file, file_path = nil, nil
for path in *split package.moonpath, ";"
file_path = path\gsub "?", name_path
file = io.open file_path
break if file
if file
text = file\read "*a"
loadstring text, file_path
else
nil, "Could not find moon file"
if not package.moonpath
package.moonpath = create_moonpath package.path
init_loader = ->
insert package.loaders, 2, moon_loader
init_loader! if not _G.moon_no_loader
loadstring = (str, chunk_name) ->
passed, code, ltable = pcall -> to_lua str
if not passed
error chunk_name .. ": " .. code, 2
line_tables[chunk_name] = ltable if chunk_name
lua.loadstring code, chunk_name or "=(moonscript.loadstring)"
loadfile = (fname) ->
file, err = io.open fname
return nil, err if not file
text = assert file\read "*a"
loadstring text, fname
-- throws errros
dofile = (fname) ->
f = assert loadfile fname
f!
| 21.869048 | 63 | 0.677735 |
3cea9e192b507678cc926f71db3654210386c883 | 1,282 | require "busted"
require "tests.mock_love"
import List from require "LunoPunk.utils.List"
describe "list", ->
l = nil
before_each ->
l = List!
l\push i*2 for i=1, 10
it "push/pop/peek/shift/unshift/first/last", ->
assert.are.equal 10, l\len!
assert.are.equal 20, l\pop!
assert.are.equal 18, l\pop!
assert.are.equal 8, l\__len!
l\push 10 -- last element
assert.are.equal 10, l\peek!
assert.are.equal 10, l\last!
assert.are.equal 2, l\first!
assert.are.equal 2, l\shift!
assert.are.equal 4, l\first!
l\unshift 2
assert.are.equal 2, l\first!
it "tostring", ->
t = string.format "{ %s }", table.concat {i, i*2 for i=1, 10}, ", "
assert.are.equal t, tostring l
it "ipairs", ->
for i, v in l\ipairs!
assert.are.equal i*2, l\index i
assert.are.equal 10, l\len!
it "ripairs", ->
for i, v in l\ripairs!
assert.are.equal i*2, l\index i
assert.are.equal 10, l\len!
it "pairs", ->
i = 0
len = l\len! -- original length
for v in l\pairs!
i += 1
assert.are.equal i*2, l\index i
assert.are.equal len, i -- I should be the original length
assert.are.equal 10, l\len!
it "rpairs", ->
i = l\len!
for v in l\rpairs!
assert.are.equal i*2, l\index i
i -= 1
assert.are.equal 0, i
assert.are.equal 10, l\len!
| 21.366667 | 69 | 0.627925 |
5ac2668479d3c6b1740944a699c2d50ed22a4692 | 601 | M = {}
TK = require "PackageToolkit"
pathsep = (TK.module.import ..., "../_os/_pathsep").pathsep
-- chop off the last part of a directory path
-- and return a standard version of the directory path
-- separated by the OS path separator
M.chop = (path) ->
if (string.match path, "[/\\%.]") == nil
-- if both caller and callee modules live at the root directory
return ""
else
-- example "a.b/c.d" => "a.b/c"
result, _ = string.gsub (string.match path, "(.-)[/\\%.]?[^%./\\]+$"), "%.", pathsep()
return result
return M
| 35.352941 | 98 | 0.549085 |
d1abfc7b34e1f84ea001a4960e9d6a8ddc3bca70 | 2,091 | import app, signal, config, bindings, command from howl
import Editor from howl.ui
state = bundle_load 'state'
maps = {
command: bundle_load 'command_map', state
insert: bundle_load 'insert_map', state
visual: bundle_load 'visual_map', state
}
signal_handlers = {
'editor-focused': (args) -> state.change_mode args.editor, state.mode if state.active
'editor-defocused': (args) -> args.editor.indicator.vi.label = '' if state.active
'after-buffer-switch': (args) -> state.change_mode args.editor, 'command' if state.active
'selection-changed': (args) ->
if state.active
if state.mode == 'visual'
state.map.__on_selection_changed args.editor, args.selection
elseif not args.selection.empty
state.change_mode args.editor, 'visual'
'buffer-saved': (args) ->
if state.active and app.editor.buffer == args.buffer
state.change_mode app.editor, 'command'
}
vi_commands = {
{
name: 'vi-on',
description: 'Switches VI mode on'
handler: -> state.activate(app.editor) unless state.active
}
{
name: 'vi-off',
description: 'Switches VI mode off'
handler: ->
if state.active
state.deactivate!
for editor in *howl.app.editors
with editor
.indicator.vi.label = ''
.cursor.style = 'line'
.cursor.blink_interval = config.cursor_blink_interval
}
{
name: 'vi-toggle',
description: 'Toggles VI mode'
handler: -> if state.active then command.vi_off! else command.vi_on!
}
}
unload = ->
command.vi_off!
for name, handler in pairs signal_handlers
signal.disconnect name, handler
command.unregister cmd.name for cmd in *vi_commands
Editor.unregister_indicator 'vi'
-- Hookup
Editor.register_indicator 'vi', 'bottom_left'
state.init maps, 'command'
for name, handler in pairs signal_handlers
signal.connect name, handler
command.register cmd for cmd in *vi_commands
-- state.activate!
info = {
author: 'The Howl Developers',
description: 'VI bundle',
license: 'MIT',
}
return :info, :unload, :maps, :state
| 24.892857 | 91 | 0.677666 |
731c79206512cf9750bd89e98550d8ddd244e47a | 178 | Font = require "Lutron/Font/Font"
class Sofia24 extends Font
new: () =>
super 'Lutron/Font/Sofia24.png', " abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ0123456789"
| 29.666667 | 102 | 0.775281 |
ae76a66457f32f4515b0ba654d391c2826cd4f75 | 1,551 | import pcall from _G
import readFileSync, mkdirSync from require "fs"
import decode from "novacbn/properties/exports"
import PROJECT_PATH from "novacbn/gmodproj/lib/constants"
import enableFileLogging, logError, logFatal from "novacbn/gmodproj/lib/logging"
import isDir, isFile from "novacbn/gmodproj/lib/utilities/fs"
import ProjectOptions from "novacbn/gmodproj/schemas/ProjectOptions"
-- ::configureEnvironment() -> void
-- Configures the project's directory environment
-- export
export configureEnvironment = () ->
-- Create the directories needed and enable file logging
mkdirSync(PROJECT_PATH.data) unless isDir(PROJECT_PATH.data)
mkdirSync(PROJECT_PATH.cache) unless isDir(PROJECT_PATH.cache)
mkdirSync(PROJECT_PATH.plugins) unless isDir(PROJECT_PATH.plugins)
mkdirSync(PROJECT_PATH.logs) unless isDir(PROJECT_PATH.logs)
enableFileLogging()
-- ::readManifest() -> table
-- Reads the project's manifest file, fatally exits process on errors
-- export
export readManifest = () ->
-- Read the project's manifest file if it exists
logFatal(".gmodmanifest is a directory!") if isDir(PROJECT_PATH.manifest)
options = {}
options = decode(readFileSync(PROJECT_PATH.manifest), {propertiesEncoder: "moonscript"}) if isFile(PROJECT_PATH.manifest)
-- Validate the project's manifest, alerting users to any validation errors
success, err = pcall(ProjectOptions.new, ProjectOptions, options)
unless success
logError(err)
logFatal("Failed to validate .gmodmanifest!")
return err | 39.769231 | 125 | 0.762089 |
a810996f4620fb7b99cec5ffac6062ccd48374ac | 451 |
if ngx
return { md5: ngx.md5 }
local md5
pcall ->
digest = require "openssl.digest"
hex_char = (c) -> string.format "%02x", string.byte c
hex = (str) -> (str\gsub ".", hex_char)
md5 = (str) ->
hex digest.new("md5")\final str
unless md5
pcall ->
crypto = require "crypto"
md5 = (str) ->
crypto.digest "md5", str
unless md5
error "Either luaossl (recommended) or LuaCrypto is required to calculate md5"
{ :md5 }
| 16.703704 | 80 | 0.614191 |
394c59b1ffe747b6bc7d733567785bd19e32c598 | 6,127 |
describe "class", ->
it "should make a class with constructor", ->
class Thing
new: =>
@color = "blue"
instance = Thing!
assert.same instance, { color: "blue" }
it "should have instance methods", ->
class Thing
get_color: => @color
new: =>
@color = "blue"
instance = Thing!
assert.same instance\get_color!, "blue"
it "should have base properies from class", ->
class Thing
color: "blue"
get_color: => @color
instance = Thing!
assert.same instance\get_color!, "blue"
assert.same Thing.color, "blue"
it "should inherit another class", ->
class Base
get_property: => @[@property]
new: (@property) =>
class Thing extends Base
color: "green"
instance = Thing "color"
assert.same instance\get_property!, "green"
it "should have class properties", ->
class Base
class Thing extends Base
instance = Thing!
assert.same Base.__name, "Base"
assert.same Thing.__name, "Thing"
assert.is_true Thing.__parent == Base
assert.is_true instance.__class == Thing
it "should have name when assigned", ->
Thing = class
assert.same Thing.__name, "Thing"
it "should not expose class properties on instance", ->
class Thing
@height: 10
Thing.color = "blue"
instance = Thing!
assert.same instance.color, nil
assert.same instance.height, nil
it "should expose new things added to __base", ->
class Thing
instance = Thing!
Thing.__base.color = "green"
assert.same instance.color, "green"
it "should call with correct receiver", ->
local instance
class Thing
is_class: => assert.is_true @ == Thing
is_instance: => assert.is_true @ == instance
go: =>
@@is_class!
@is_instance!
instance = Thing!
instance\go!
it "should have class properies take precedence over base properties", ->
class Thing
@prop: "hello"
prop: "world"
assert.same "hello", Thing.prop
describe "super", ->
it "should call super constructor", ->
class Base
new: (@property) =>
class Thing extends Base
new: (@name) =>
super "name"
instance = Thing "the_thing"
assert.same instance.property, "name"
assert.same instance.name, "the_thing"
it "should call super method", ->
class Base
_count: 111
counter: => @_count
class Thing extends Base
counter: => "%08d"\format super!
instance = Thing!
assert.same instance\counter!, "00000111"
it "should call other method from super", ->
class Base
_count: 111
counter: =>
@_count
class Thing extends Base
other_method: => super\counter!
instance = Thing!
assert.same instance\other_method!, 111
it "should get super class", ->
class Base
class Thing extends Base
get_super: => super
instance = Thing!
assert.is_true instance\get_super! == Base
it "should get a bound method from super", ->
class Base
count: 1
get_count: => @count
class Thing extends Base
get_count: => "this is wrong"
get_method: => super\get_count
instance = Thing!
assert.same instance\get_method!!, 1
it "class properties take precedence in super class over base", ->
class Thing
@prop: "hello"
prop: "world"
class OtherThing extends Thing
assert.same "hello", OtherThing.prop
it "gets value from base in super class", ->
class Thing
prop: "world"
class OtherThing extends Thing
assert.same "world", OtherThing.prop
it "should let parent be replaced on class", ->
class A
@prop: "yeah"
cool: => 1234
plain: => "a"
class B
@prop: "okay"
cool: => 9999
plain: => "b"
class Thing extends A
cool: =>
super! + 1
get_super: =>
super
instance = Thing!
assert.same "a", instance\plain!
assert.same 1235, instance\cool!
assert A == instance\get_super!, "expected super to be B"
Thing.__parent = B
setmetatable Thing.__base, B.__base
assert.same "b", instance\plain!
assert.same 10000, instance\cool!
assert B == instance\get_super!, "expected super to be B"
it "should resolve many levels of super", ->
class One
a: =>
1
class Two extends One
a: =>
super! + 2
class Three extends Two
a: =>
super! + 3
i = Three!
assert.same 6, i\a!
it "should resolve many levels of super with a gap", ->
class One
a: =>
1
class Two extends One
class Three extends Two
a: =>
super! + 3
class Four extends Three
a: =>
super! + 4
i = Four!
assert.same 8, i\a!
it "should call correct class/instance super methods", ->
class Base
doit: =>
"instance"
@doit: =>
"class"
class One extends Base
doit: => super!
@doit: => super!
assert.same "instance", One!\doit!
assert.same "class", One\doit!
it "should resolve many levels of super on class methods", ->
class One
@a: =>
1
class Two extends One
class Three extends Two
@a: =>
super! + 3
class Four extends Three
@a: =>
super! + 4
assert.same 8, Four\a!
it "super should still work when method wrapped", ->
add_some = (opts) ->
=> opts.amount + opts[1] @
class Base
value: => 1
class Sub extends Base
value: add_some {
amount: 12
=>
super! + 100
}
class OtherSub extends Base
value: if true
=> 5 + super!
else
=> 2 + super!
assert.same 1 + 100 + 12, Sub!\value!
assert.same 6, OtherSub!\value!
| 20.560403 | 75 | 0.558022 |
b58a3e2f3841f05ebd5d1458ab839cb0fa4cc3a4 | 693 | import Widget from require "lapis.html"
filesize = require "filesize"
config = require("lapis.config").get!
class Edit extends Widget
content: =>
form method: "POST", action: @url_for("edit2", token: @token), ->
element "table", ->
tr ->
td -> input name: "password", type: "password", size: 20
td -> p "Password (required)"
tr ->
td -> input name: "filename", size: 20, value: @p_filename
td -> p "File name (optional)"
textarea name: "content", cols: 80, rows: 24, @p_content
br!
text "Max size: #{filesize(config.max_pasta_size)} bytes"
br!
br!
input type: "submit", value: "Update"
| 30.130435 | 69 | 0.577201 |
508ecdabb8329e5c4baf97ba52b408f4690292bb | 1,366 |
for impl in *{'pure', 'native'} do
mtype = require('mtype.'..impl).type
describe "#{impl}:", ->
for value in *{ true, false, 42, 'aloha!', {}, -> 'hi!' } do
context type(value), ->
it 'returns same type as type()', ->
assert.same type(value), mtype(value)
context 'nil', ->
it 'returns "nil"', ->
assert.same 'nil', mtype(nil)
context 'file', ->
it 'returns same type as io.type()', ->
value = io.open('/dev/null')
assert.same io.type(value), mtype(value)
value\close()
assert.same io.type(value), mtype(value)
context 'table with metatype', ->
context 'when __type is string', ->
value = setmetatable({}, { __type: 'meta' })
it 'returns __type value', ->
assert.same 'meta', mtype(value)
context 'when __type is function', ->
it 'calls __type and returns return value', ->
value = setmetatable({}, { __type: -> 'meta' })
assert.same 'meta', mtype(value)
it 'calls __type with the value as 1st argument', ->
value = setmetatable({}, { __type: (t) -> t })
assert.equals value, mtype(value)
context 'and returns nil', ->
it 'returns "table"', ->
value = setmetatable({}, { __type: -> nil })
assert.same 'table', mtype(value)
| 31.045455 | 64 | 0.535871 |
7d2dd5878298e6e645ff4d2e69961f86dbb3489f | 1,624 |
import Flow from require "lapis.flow"
describe "lapis.flow", ->
local base_object
base_object = {
msg: "hello"
get_msg: => @msg
check_base_object: =>
assert.equal base_object, base_object
}
it "should create a flow", ->
flow = Flow base_object, {
cool: 10
proxy_to_message: => @get_msg!
raw_message: => @msg
get_cool: => @cool
check_self: (other) =>
assert.same other, @
}
assert.same "hello", flow\get_msg!
assert.same "hello", flow\proxy_to_message!
assert.same "hello", flow\raw_message!
assert.same "hello", flow.msg
assert.same 10, flow\get_cool!
assert.same 10, flow.cool
flow\check_base_object!
flow\check_self flow
it "should create a flow with inheritance", ->
class MyFlow extends Flow
some_val: 999
get_some_val: => @some_val
proxy_to_message: => @get_msg!
check_self: (other) =>
assert.same other, @
flow = MyFlow base_object
assert.same "hello", flow\get_msg!
assert.same "hello", flow\proxy_to_message!
assert.same "hello", flow.msg
assert.same 999, flow\get_some_val!
assert.same 999, flow.some_val
flow\check_base_object!
flow\check_self flow
it "should let flows inherit each other", ->
class BaseFlow extends Flow
the_data: 100
the_method: =>
@the_data
class ChildFlow extends BaseFlow
the_method: =>
super! + 11
proxy_to_message: => @get_msg!
flow = ChildFlow base_object
assert.same 111, flow\the_method!
assert.same "hello", flow\proxy_to_message!
| 22.246575 | 48 | 0.639163 |
f2a2cc6a5b44f11b0b8b22eb5e9526073656eea9 | 1,497 | local rshift, lshift, band, ok, _
local string_loader
-- lua5.1 has separate 'loadstring' and 'load'
-- functions ('load' doesn't accept strings).
-- This provides a function that 'load' can use,
-- and will work on all versions of lua
string_loader = (str) ->
sent = false
return ->
if sent then
return nil
sent = true
return str
-- use load to treat as a string to prevent
-- parse errors under lua < 5.3
-- luajit uses 32-bit integers for bitwise ops, but lua5.3+
-- uses 32-bit or 64-bit integers, so these wrappers will
-- truncate results and/or extend the sign, as appropriate
-- to match luajit's behavior.
ok, band = pcall(load(string_loader([[
return function(a,b)
a = a & b
if a > 0x7FFFFFFF then
-- extend the sign bit
a = ~0xFFFFFFFF | a
end
return a
end
]])))
if ok then
_, lshift = pcall(load(string_loader([[
return function(x,y)
-- limit to 32-bit shifts
y = y % 32
x = x << y
if x > 0x7FFFFFFF then
-- extend the sign bit
x = ~0xFFFFFFFF | x
end
return x
end
]])))
_, rshift = pcall(load(string_loader([[
return function(x,y)
y = y % 32
-- truncate to 32-bit before applying shift
x = x & 0xFFFFFFFF
x = x >> y
if x > 0x7FFFFFFF then
x = ~0xFFFFFFFF | x
end
return x
end
]])))
else
import rshift, lshift, band from require "bit"
return {
rshift: rshift
lshift: lshift
band: band
}
| 21.084507 | 59 | 0.604542 |
48217f87fb236d85a926921d89d6bdfab2ab48b1 | 562 | -- Copyright 2013-2015 The Howl Developers
-- License: MIT (see LICENSE.md)
import formatting from howl
completer = bundle_load 'css_completer'
class CSSMode
new: =>
@lexer = bundle_load 'css_lexer'
@completers = { completer, 'in_buffer' }
default_config:
word_pattern: r'\\b[-_\\w]+\\b'
comment_syntax: { '/*', '*/' }
auto_pairs: {
'(': ')'
'[': ']'
'{': '}'
'"': '"'
"'": "'"
}
on_completion_accepted: (completion, context) =>
@completer or= completer!
@completer.finish_completion completion, context
| 20.071429 | 52 | 0.601423 |
a71dd0aad31eaa48f4b3cc79c806efb30164f861 | 1,797 | --- fish lexer for howl from textadept fish.lua as reference.
-- See @{README.md} for details on usage.
-- @author [Alejandro Baez](https://keybase.io/baez)
-- @copyright 2016
-- @license MIT (see LICENSE)
-- @module fish
howl.util.lpeg_lexer ->
c = capture
-- shorthand for lexer.word
ident = (alpha + '_')^1 * (alpha + digit + '_')^0
-- Whitespace.
ws = c 'whitespace', space
-- Comments.
comment = c 'comment', P'#' * scan_until eol
-- Strings.
dq_str = span '"', '"', '\\'
sq_str = span "'", "'"
string = c 'string', any {dq_str, sq_str}
-- Numbers
number = c 'number', any {float, digit}
-- Keywords.
keyword = c 'keyword', word {
'alias', 'and', 'begin', 'bg', 'bind', 'block', 'break', 'breakpoint',
'builtin', 'case', 'cd', 'command', 'commandline', 'complete', 'contains',
'continue', 'count', 'dirh', 'dirs', 'echo', 'else', 'emit', 'end', 'eval',
'exec', 'exit', 'fg', 'fish', 'fish_config', 'fish_indent', 'fish_pager',
'fish_prompt', 'fish_right_prompt', 'fish_update_completions', 'fishd', 'for',
'funced', 'funcsave', 'function', 'functions', 'help', 'history', 'if', 'in',
'isatty', 'jobs', 'math', 'mimedb', 'nextd', 'not', 'open', 'or', 'popd',
'prevd', 'psub', 'pushd', 'pwd', 'random', 'read', 'return', 'set',
'set_color', 'source', 'status', 'string', 'switch', 'test', 'trap', 'type',
'ulimit', 'umask', 'vared', 'while'
}
-- Identifiers.
identifier = c 'identifier', ident
-- Variables.
var = P'$' * ((P'{' * ident * P'}') + ident)
variable = c 'variable', var
-- Operators.
operator = c 'operator', S'=!<>+-/*^&|~.,:;?()[]{}'
P {
'all'
all: any {
keyword,
identifier,
variable,
string,
comment,
number,
operator
}
}
| 27.646154 | 82 | 0.553144 |
1ba736b64678e83e12f1ee79d87a6543c3ada43f | 40 | export ok_require = "ok"
return "hello"
| 13.333333 | 24 | 0.725 |
41d177c6ea0a5bae48026157f3a2b87bcf2b9d8a | 8,500 | http = require 'lapis.nginx.http'
stringy = require 'stringy'
sass = require 'sass'
import map, table_index from require 'lib.utils'
import from_json, to_json, trim from require 'lapis.util'
import aql, document_get, foxx_upgrade from require 'lib.arango'
--------------------------------------------------------------------------------
write_content = (filename, content)->
file = io.open(filename, 'w+')
io.output(file)
io.write(content)
io.close(file)
--------------------------------------------------------------------------------
read_file = (filename)->
file = io.open(filename, 'r')
io.input(file)
data = io.read('*all')
io.close(file)
data
--------------------------------------------------------------------------------
install_service = (sub_domain, name)->
if name\match('^[%w_%-%d]+$') -- allow only [a-zA-Z0-9_-]+
path = "install_service/#{sub_domain}/#{name}"
os.execute("mkdir -p #{path}/APP/routes")
os.execute("mkdir #{path}/APP/scripts")
os.execute("mkdir #{path}/APP/tests")
os.execute("mkdir #{path}/APP/libs")
request = 'FOR api IN apis FILTER api.name == @name
LET routes = (FOR r IN api_routes FILTER r.api_id == api._key RETURN r)
LET scripts = (FOR s IN api_scripts FILTER s.api_id == api._key RETURN s)
LET tests = (FOR t IN api_tests FILTER t.api_id == api._key RETURN t)
LET libs = (FOR l IN api_libs FILTER l.api_id == api._key RETURN l)
RETURN { api, routes, scripts, tests, libs }'
api = aql("db_#{sub_domain}", request, { 'name': name })[1]
write_content("#{path}/APP/main.js", api.api.code)
write_content("#{path}/APP/package.json", api.api.package)
write_content("#{path}/APP/manifest.json", api.api.manifest)
for k, item in pairs api.routes
write_content("#{path}/APP/routes/#{item.name}.js", item.javascript)
for k, item in pairs api.tests
write_content("#{path}/APP/tests/#{item.name}.js", item.javascript)
for k, item in pairs api.libs
write_content("#{path}/APP/libs/#{item.name}.js", item.javascript)
for k, item in pairs api.scripts
write_content("#{path}/APP/scripts/#{item.name}.js", item.javascript)
os.execute("cd install_service/#{sub_domain}/#{name}/APP && export PATH='$PATH:/usr/local/bin' && yarn")
os.execute("cd install_service/#{sub_domain} && zip -rq #{name}.zip #{name}/")
os.execute("rm --recursive install_service/#{sub_domain}/#{name}")
foxx_upgrade(
"db_#{sub_domain}", name, read_file("install_service/#{sub_domain}/#{name}.zip")
)
--------------------------------------------------------------------------------
install_script = (sub_domain, name) ->
if name\match('^[%w_%-%d]+$') -- allow only [a-zA-Z0-9_-]+
path = "scripts/#{sub_domain}/#{name}"
os.execute("mkdir -p #{path}")
request = 'FOR script IN scripts FILTER script.name == @name RETURN script'
script = aql("db_#{sub_domain}", request, { 'name': name })[1]
write_content("#{path}/package.json", script.package)
os.execute("export PATH='$PATH:/usr/local/bin' && cd #{path} && yarn")
write_content("#{path}/index.js", script.code)
--------------------------------------------------------------------------------
deploy_site = (sub_domain, settings) ->
config = require('lapis.config').get!
db_config = require('lapis.config').get("db_#{config._name}")
path = "dump/#{sub_domain[1]}/"
home = from_json(settings.home)
deploy_to = stringy.split(settings.deploy_secret, '#')
request = 'FOR s IN settings LIMIT 1 RETURN s'
sub_domain_settings = aql(deploy_to[1], request)[1]
if deploy_to[2] == sub_domain_settings.secret
os.execute("mkdir -p #{path}")
command = "arangodump --collection layouts --collection partials --collection components --collection spas --collection redirections --collection datatypes --collection aqls --collection helpers --collection apis --collection api_libs --collection api_routes --collection api_scripts --collection api_tests --collection scripts --collection pages --collection folder_path --collection folders --collection scripts --include-system-collections true --server.database db_#{sub_domain} --server.username #{db_config.login} --server.password #{db_config.pass} --server.endpoint #{db_config.endpoint} --output-directory #{path} --overwrite true"
command ..= " --collection datasets" if home['deploy_datasets']
command ..= " --collection trads" if home['deploy_trads']
os.execute(command)
os.execute("arangorestore --include-system-collections true --server.database #{deploy_to[1]} --server.username #{db_config.login} --server.password #{db_config.pass} --server.endpoint #{db_config.endpoint} --input-directory #{path} --overwrite true")
os.execute("rm -Rf #{path}")
-- Restart scripts
-- scripts = aql(deploy_to[1], 'FOR script IN scripts RETURN script')
-- for k, item in pairs scripts
-- install_script(deploy_to[1], item.name)
-- Restart apis
apis = aql(deploy_to[1], 'FOR api IN apis RETURN api')
for k, item in pairs apis
install_service(deploy_to[1]\gsub('db_', ''), item.name)
--------------------------------------------------------------------------------
compile_riotjs = (sub_domain, name, id) ->
if name\match('^[%w_%-%d]+$') -- allow only [a-zA-Z0-9_-]+
path = "compile_tag/#{sub_domain}/#{name}"
os.execute("mkdir -p #{path}")
tag = document_get("db_" .. sub_domain, id)
write_content("#{path}/#{name}.riot", tag.html)
command = "export PATH=\"$PATH;/usr/local/bin\" && riot --format umd #{path}/#{name}.riot --output #{path}/#{name}.js && terser --compress --mangle -o #{path}/#{name}.js #{path}/#{name}.js"
handle = io.popen(command)
result = handle\read('*a')
handle\close()
read_file("#{path}/#{name}.js")
--------------------------------------------------------------------------------
compile_tailwindcss = (sub_domain, layout_id, field) ->
subdomain = 'db_' .. sub_domain
layout = document_get(subdomain, "layouts/" .. layout_id)
settings = aql(subdomain, 'FOR s IN settings LIMIT 1 RETURN s')[1]
home_settings = from_json(settings.home)
langs = stringy.split(settings.langs, ',')
path = "compile_tailwind/#{subdomain}/#{layout_id}"
os.execute("mkdir -p #{path}")
write_content("#{path}/#{layout_id}.css", sass.compile(layout[field], 'compressed'))
-- default config file
config_file = "module.exports = {
mode: 'jit',
purge: ['./*.html'],
darkMode: false,
theme: { extend: {} },
variants: {},
plugins: []
}"
-- check if we have defined a config file
if home_settings.tailwindcss_config
config_file = aql(
subdomain,
'FOR page IN partials FILTER page.slug == @slug RETURN page.html',
{ slug: home_settings.tailwindcss_config }
)[1]
write_content("#{path}/tailwind.config.js", config_file) if config_file
-- Layouts
layouts = aql(subdomain, 'FOR doc IN layouts RETURN { html: doc.html }')
for k, item in pairs layouts
write_content("#{path}/layout_#{k}.html", item.html)
-- Pages
pages = aql(subdomain, 'FOR doc IN pages RETURN { html: doc.html, raw_html: doc.raw_html }')
for k, item in pairs pages
for k2, lang in pairs langs
lang = stringy.strip(lang)
html = ""
if type(item['raw_html']) == 'table' and item['raw_html'][lang]
html = html .. item['raw_html'][lang]
if type(item['html']) == "table" and item['html'][lang] and item['html'][lang].html
html = html .. item['html'][lang].html
write_content("#{path}/page_#{k}_#{lang}.html", html)
-- Components
components = aql(subdomain, 'FOR doc IN components RETURN { html: doc.html }')
for k, item in pairs components
write_content("#{path}/component_#{k}.html", item.html)
-- Partials
partials = aql(subdomain, 'FOR doc IN partials RETURN { html: doc.html }')
for k, item in pairs partials
write_content("#{path}/partial_#{k}.html", item.html)
command = "cd #{path} && export PATH=\"$PATH;/usr/local/bin\" && NODE_ENV=production tailwindcss build -m -i #{layout_id}.css -o #{layout_id}_compiled.css"
handle = io.popen(command)
result = handle\read('*a')
handle\close()
data = read_file("#{path}/#{layout_id}_compiled.css")
os.execute("rm -Rf #{path}")
data
--------------------------------------------------------------------------------
-- expose methods
{ :install_service, :install_script, :deploy_site, :compile_riotjs, :compile_tailwindcss } | 45.945946 | 644 | 0.612118 |
7cb98d0c26a993947e2de174251b5b6e8914a134 | 672 | -- Copyright 2014-2015 The Howl Developers
-- License: MIT (see LICENSE.md at the top-level directory of the distribution)
ffi = require 'ffi'
require 'ljglibs.cdefs.gdk'
core = require 'ljglibs.core'
gobject = require 'ljglibs.gobject'
ref_ptr = gobject.ref_ptr
C = ffi.C
core.define 'GdkScreen', {
properties: {
font_options: 'gpointer'
resolution: 'gdouble'
-- Added properties
number: => C.gdk_screen_get_number @
width: => C.gdk_screen_get_width @
height: => C.gdk_screen_get_height @
width_mm: => C.gdk_screen_get_width_mm @
height_mm: => C.gdk_screen_get_height_mm @
}
get_default: -> ref_ptr C.gdk_screen_get_default!
}
| 24 | 79 | 0.708333 |
1d1cbad80e5446a3d23b1c8dfbd3ced5ffb2cbb1 | 1,466 | import java, File from sauce3
Gdx = java.require "com.badlogic.gdx.Gdx"
Sauce3VM = java.require "sauce3.Sauce3VM"
append = (path, v, t) ->
file = new_file path, t
file\append v
copy = (old, new, old_t, new_t) ->
old_f = new_file old, old_t
new_f = new_file new, new_t
old_f\copy new_f
exists = (f, t) ->
file = new_file f, t
file\exists!
dir_create = (f, t) ->
file = new_file f, t
file\create_dir!
dir_list = (f, t) ->
file = new_file f, t
file\list!
get_external_path = ->
Gdx.files\getLocalStoragePath!
get_working_path = ->
file = new_file(".")\file!
file\getAbsolutePath!
get_last_modified = (f, t) ->
file = new_file f, t
file\last_modified!
get_size = (f, t) ->
file = new_file f, t
file\size!
is_dir = (f, t) ->
file = new_file f, t
file\is_directory!
is_file = (f, t) ->
file = new_file f, t
file\is_file!
load = (f, t) ->
file = new_file f, t
Sauce3VM.lua\load file\reader!, file
move = (old, new, old_t, new_t) ->
old_f = new_file old, old_t
new_f = new_file new, new_t
old_f\move new_f
new_file = (f, t) ->
File f, t
read = (f, t) ->
file = new_file f, t
file\read!
remove = (f, t) ->
file = new_file f, t
file\remove!
write = (f, v, t) ->
file = new_file f, t
file\write v
{
:append
:copy
:exists
:dir_create
:dir_list
:get_external_path
:get_working_path
:get_last_modified
:get_size
:load
:move
:new_file
:read
:remove
:write
}
| 15.763441 | 45 | 0.622783 |
28aeeb623d4220908197bae435bf99efa0d6192d | 475 | {
lexer: bundle_load 'lexer'
comment_syntax: { '/*', '*/' }
auto_pairs:
'(': ')'
'[': ']'
'{': '}'
'"': '"'
"'": "'"
indentation:
more_after: {
r'(if|elif|else|for|while|match|struct|union)\\b',
r'pkg\\b.*=$'
':$'
r'=\\s*{[^}]*$',
}
less_for: {r'}|;;$'}
code_blocks:
multiline: {
{r'(if|elif|else|for|while|match|struct|union)\\b', '^%s*;;$', ';;'}
{r'=\\s*{[^}]*$', '^%s*}', '}'}
}
}
| 16.964286 | 74 | 0.374737 |
0d1addc01b443fc903f93a31b7de5441fb679b94 | 44 | result => random => stop =>
(stop result)
| 14.666667 | 27 | 0.590909 |
9541da899cfb21f23a295cbd8527493ce5eeeb02 | 522 | html2unicode = require'html'
PRIVMSG:
'^%panagram (.+)$': (s, d, arg) =>
ivar2.util.simplehttp "http://www.wordsmith.org/anagram/anagram.cgi?t=50&anagram=" .. ivar2.util.urlEncode(arg), (s) ->
s = s\match "(Displaying%s.-)</?[Pp][ />]"
unless s
return say "Did not find result"
s = s\gsub "[\r\n]", ""
s = s\gsub "<script>.*", ""
s = s\gsub "<[Bb][Rr][ />]", ", "
-- Strip tags
s = s\gsub "%b<>", ""
say html2unicode(s)\gsub(":%s*,", ":")\gsub(",%s*$", "")
| 30.705882 | 123 | 0.48659 |
1dc145d0f2579b15786c842e6096e0df103d9936 | 711 | export modinfo = {
type: "function"
id: "GetOutput"
func: (recipient) ->
if recipient == LocalPlayer
FindOutModel = ConfigSystem("Get", "Camera")\FindFirstChild"Shutsuryoku::PersonScript"
if not FindOutModel
NewModel = CreateInstance"Model"
Parent: ConfigSystem "Get", "Camera"
Name: "Shutsuryoku::PersonScript"
return NewModel
else
return FindOutModel
FindOutModel = ConfigSystem("Get", "Camera")\FindFirstChild(string.format("Shutsuryoku::%s",recipient.Name))
if not FindOutModel
NewModel = CreateInstance"Model"
Parent: ConfigSystem("Get", "Camera")
Name: string.format("Shutsuryoku::%s", recipient.Name)
return NewModel
else
return FindOutModel
}
| 29.625 | 110 | 0.71308 |
08dbe393199b6a005d63e6a6c74d208d53fb34bf | 14,265 | socket = require "pgmoon.socket"
import insert from table
import rshift, lshift, band from require "pgmoon.bit"
local pl_file
local ssl
if ngx
pl_file = require "pl.file"
ssl = require "ngx.ssl"
unpack = table.unpack or unpack
VERSION = "2.2.0"
_len = (thing, t=type(thing)) ->
switch t
when "string"
#thing
when "table"
l = 0
for inner in *thing
inner_t = type inner
if inner_t == "string"
l += #inner
else
l += _len inner, inner_t
l
else
error "don't know how to calculate length of #{t}"
_debug_msg = (str) ->
require("moon").dump [p for p in str\gmatch "[^%z]+"]
flipped = (t) ->
keys = [k for k in pairs t]
for key in *keys
t[t[key]] = key
t
MSG_TYPE = flipped {
status: "S"
auth: "R"
backend_key: "K"
ready_for_query: "Z"
query: "Q"
notice: "N"
notification: "A"
password: "p"
row_description: "T"
data_row: "D"
command_complete: "C"
error: "E"
}
ERROR_TYPES = flipped {
severity: "S"
code: "C"
message: "M"
position: "P"
detail: "D"
schema: "s"
table: "t"
constraint: "n"
}
PG_TYPES = {
[16]: "boolean"
[17]: "bytea"
[20]: "number" -- int8
[21]: "number" -- int2
[23]: "number" -- int4
[700]: "number" -- float4
[701]: "number" -- float8
[1700]: "number" -- numeric
[114]: "json" -- json
[3802]: "json" -- jsonb
-- arrays
[1000]: "array_boolean" -- bool array
[1005]: "array_number" -- int2 array
[1007]: "array_number" -- int4 array
[1016]: "array_number" -- int8 array
[1021]: "array_number" -- float4 array
[1022]: "array_number" -- float8 array
[1231]: "array_number" -- numeric array
[1009]: "array_string" -- text array
[1015]: "array_string" -- varchar array
[1002]: "array_string" -- char array
[1014]: "array_string" -- bpchar array
[2951]: "array_string" -- uuid array
[199]: "array_json" -- json array
[3807]: "array_json" -- jsonb array
}
NULL = "\0"
tobool = (str) ->
str == "t"
class Postgres
convert_null: false
NULL: {"NULL"}
:PG_TYPES
user: "postgres"
host: "127.0.0.1"
port: "5432"
ssl: false
-- custom types supplementing PG_TYPES
type_deserializers: {
json: (val, name) =>
import decode_json from require "pgmoon.json"
decode_json val
bytea: (val, name) =>
@decode_bytea val
array_boolean: (val, name) =>
import decode_array from require "pgmoon.arrays"
decode_array val, tobool
array_number: (val, name) =>
import decode_array from require "pgmoon.arrays"
decode_array val, tonumber
array_string: (val, name) =>
import decode_array from require "pgmoon.arrays"
decode_array val
array_json: (val, name) =>
import decode_array from require "pgmoon.arrays"
import decode_json from require "pgmoon.json"
decode_array val, decode_json
hstore: (val, name) =>
import decode_hstore from require "pgmoon.hstore"
decode_hstore val
}
set_type_oid: (oid, name) =>
unless rawget(@, "PG_TYPES")
@PG_TYPES = {k,v for k,v in pairs @PG_TYPES}
@PG_TYPES[assert tonumber oid] = name
setup_hstore: =>
res = unpack @query "SELECT oid FROM pg_type WHERE typname = 'hstore'"
assert res, "hstore oid not found"
@set_type_oid tonumber(res.oid), "hstore"
new: (opts) =>
@sock, @sock_type = socket.new opts and opts.socket_type
if opts
@user = opts.user
@host = opts.host
@database = opts.database
@port = opts.port
@password = opts.password
@ssl = opts.ssl
@ssl_verify = opts.ssl_verify
@ssl_required = opts.ssl_required
@pool_name = opts.pool
key = opts.key
cert = opts.cert
if @sock_type == "nginx" and key and cert
key = assert(ssl.parse_pem_priv_key(pl_file.read(key, true)))
cert = assert(ssl.parse_pem_cert(pl_file.read(cert, true)))
@luasec_opts = {
key: key
cert: cert
cafile: opts.cafile
ssl_version: opts.ssl_version or "tlsv1_2"
}
connect: =>
opts = if @sock_type == "nginx"
{
pool: @pool_name or "#{@host}:#{@port}:#{@database}:#{@user}"
}
ok, err = @sock\connect @host, @port, opts
return nil, err unless ok
if @sock\getreusedtimes! == 0
if @ssl
success, err = @send_ssl_message!
return nil, err unless success
success, err = @send_startup_message!
return nil, err unless success
success, err = @auth!
return nil, err unless success
success, err = @wait_until_ready!
return nil, err unless success
true
settimeout: (...) =>
@sock\settimeout ...
disconnect: =>
sock = @sock
@sock = nil
sock\close!
keepalive: (...) =>
sock = @sock
@sock = nil
sock\setkeepalive ...
auth: =>
t, msg = @receive_message!
return nil, msg unless t
unless MSG_TYPE.auth == t
@disconnect!
if MSG_TYPE.error == t
return nil, @parse_error msg
error "unexpected message during auth: #{t}"
auth_type = @decode_int msg, 4
switch auth_type
when 0 -- trust
true
when 3 -- cleartext password
@cleartext_auth msg
when 5 -- md5 password
@md5_auth msg
else
error "don't know how to auth: #{auth_type}"
cleartext_auth: (msg) =>
assert @password, "missing password, required for connect"
@send_message MSG_TYPE.password, {
@password
NULL
}
@check_auth!
md5_auth: (msg) =>
import md5 from require "pgmoon.crypto"
salt = msg\sub 5, 8
assert @password, "missing password, required for connect"
@send_message MSG_TYPE.password, {
"md5"
md5 md5(@password .. @user) .. salt
NULL
}
@check_auth!
check_auth: =>
t, msg = @receive_message!
return nil, msg unless t
switch t
when MSG_TYPE.error
nil, @parse_error msg
when MSG_TYPE.auth
true
else
error "unknown response from auth"
query: (q) =>
if q\find NULL
return nil, "invalid null byte in query"
@post q
local row_desc, data_rows, command_complete, err_msg
local result, notifications
num_queries = 0
while true
t, msg = @receive_message!
return nil, msg unless t
switch t
when MSG_TYPE.data_row
data_rows or= {}
insert data_rows, msg
when MSG_TYPE.row_description
row_desc = msg
when MSG_TYPE.error
err_msg = msg
when MSG_TYPE.command_complete
command_complete = msg
next_result = @format_query_result row_desc, data_rows, command_complete
num_queries += 1
if num_queries == 1
result = next_result
elseif num_queries == 2
result = { result, next_result }
else
insert result, next_result
row_desc, data_rows, command_complete = nil
when MSG_TYPE.ready_for_query
break
when MSG_TYPE.notification
notifications = {} unless notifications
insert notifications, @parse_notification(msg)
-- when MSG_TYPE.notice
-- TODO: do something with notices
if err_msg
return nil, @parse_error(err_msg), result, num_queries, notifications
result, num_queries, notifications
post: (q) =>
@send_message MSG_TYPE.query, {q, NULL}
wait_for_notification: =>
while true
t, msg = @receive_message!
return nil, msg unless t
switch t
when MSG_TYPE.notification
return @parse_notification(msg)
format_query_result: (row_desc, data_rows, command_complete) =>
local command, affected_rows
if command_complete
command = command_complete\match "^%w+"
affected_rows = tonumber command_complete\match "(%d+)%z$"
if row_desc
return {} unless data_rows
fields = @parse_row_desc row_desc
num_rows = #data_rows
for i=1,num_rows
data_rows[i] = @parse_data_row data_rows[i], fields
if affected_rows and command != "SELECT"
data_rows.affected_rows = affected_rows
return data_rows
if affected_rows
{ :affected_rows }
else
true
parse_error: (err_msg) =>
local severity, message, detail, position
error_data = {}
offset = 1
while offset <= #err_msg
t = err_msg\sub offset, offset
str = err_msg\match "[^%z]+", offset + 1
break unless str
offset += 2 + #str
if field = ERROR_TYPES[t]
error_data[field] = str
switch t
when ERROR_TYPES.severity
severity = str
when ERROR_TYPES.message
message = str
when ERROR_TYPES.position
position = str
when ERROR_TYPES.detail
detail = str
msg = "#{severity}: #{message}"
if position
msg = "#{msg} (#{position})"
if detail
msg = "#{msg}\n#{detail}"
msg, error_data
parse_row_desc: (row_desc) =>
num_fields = @decode_int row_desc\sub(1,2)
offset = 3
fields = for i=1,num_fields
name = row_desc\match "[^%z]+", offset
offset += #name + 1
-- 4: object id of table
-- 2: attribute number of column (4)
-- 4: object id of data type (6)
data_type = @decode_int row_desc\sub offset + 6, offset + 6 + 3
data_type = @PG_TYPES[data_type] or "string"
-- 2: data type size (10)
-- 4: type modifier (12)
-- 2: format code (16)
-- we only know how to handle text
format = @decode_int row_desc\sub offset + 16, offset + 16 + 1
assert 0 == format, "don't know how to handle format"
offset += 18
{name, data_type}
fields
parse_data_row: (data_row, fields) =>
-- 2: number of values
num_fields = @decode_int data_row\sub(1,2)
out = {}
offset = 3
for i=1,num_fields
field = fields[i]
continue unless field
{field_name, field_type} = field
-- 4: length of value
len = @decode_int data_row\sub offset, offset + 3
offset += 4
if len < 0
out[field_name] = @NULL if @convert_null
continue
value = data_row\sub offset, offset + len - 1
offset += len
switch field_type
when "number"
value = tonumber value
when "boolean"
value = value == "t"
when "string"
nil
else
if fn = @type_deserializers[field_type]
value = fn @, value, field_type
out[field_name] = value
out
parse_notification: (msg) =>
pid = @decode_int msg\sub 1, 4
offset = 4
channel, payload = msg\match "^([^%z]+)%z([^%z]*)%z$", offset + 1
unless channel
error "parse_notification: failed to parse notification"
{
operation: "notification"
pid: pid
channel: channel
payload: payload
}
wait_until_ready: =>
while true
t, msg = @receive_message!
return nil, msg unless t
if MSG_TYPE.error == t
@disconnect!
return nil, @parse_error(msg)
break if MSG_TYPE.ready_for_query == t
true
receive_message: =>
t, err = @sock\receive 1
unless t
@disconnect!
return nil, "receive_message: failed to get type: #{err}"
len, err = @sock\receive 4
unless len
@disconnect!
return nil, "receive_message: failed to get len: #{err}"
len = @decode_int len
len -= 4
msg = @sock\receive len
t, msg
send_startup_message: =>
assert @user, "missing user for connect"
assert @database, "missing database for connect"
data = {
@encode_int 196608
"user", NULL
@user, NULL
"database", NULL
@database, NULL
"application_name", NULL
"pgmoon", NULL
NULL
}
@sock\send {
@encode_int _len(data) + 4
data
}
send_ssl_message: =>
success, err = @sock\send {
@encode_int 8,
@encode_int 80877103
}
return nil, err unless success
t, err = @sock\receive 1
return nil, err unless t
if t == MSG_TYPE.status
if @sock_type == "nginx"
@sock\tlshandshake {
verify: @ssl_verify,
client_cert: @luasec_opts.cert,
client_priv_key: @luasec_opts.key,
}
else
@sock\sslhandshake @ssl_verify, @luasec_opts
elseif t == MSG_TYPE.error or @ssl_required
@disconnect!
nil, "the server does not support SSL connections"
else
true -- no SSL support, but not required by client
send_message: (t, data, len) =>
len = _len data if len == nil
len += 4 -- includes the length of the length integer
@sock\send {
t
@encode_int len
data
}
decode_int: (str, bytes=#str) =>
switch bytes
when 4
d, c, b, a = str\byte 1, 4
a + lshift(b, 8) + lshift(c, 16) + lshift(d, 24)
when 2
b, a = str\byte 1, 2
a + lshift(b, 8)
else
error "don't know how to decode #{bytes} byte(s)"
-- create big endian binary string of number
encode_int: (n, bytes=4) =>
switch bytes
when 4
a = band n, 0xff
b = band rshift(n, 8), 0xff
c = band rshift(n, 16), 0xff
d = band rshift(n, 24), 0xff
string.char d, c, b, a
else
error "don't know how to encode #{bytes} byte(s)"
decode_bytea: (str) =>
if str\sub(1, 2) == '\\x'
str\sub(3)\gsub '..', (hex) ->
string.char tonumber hex, 16
else
str\gsub '\\(%d%d%d)', (oct) ->
string.char tonumber oct, 8
encode_bytea: (str) =>
string.format "E'\\\\x%s'", str\gsub '.', (byte) ->
string.format '%02x', string.byte byte
escape_identifier: (ident) =>
'"' .. (tostring(ident)\gsub '"', '""') .. '"'
escape_literal: (val) =>
switch type val
when "number"
return tostring val
when "string"
return "'#{(val\gsub "'", "''")}'"
when "boolean"
return val and "TRUE" or "FALSE"
error "don't know how to escape value: #{val}"
__tostring: =>
"<Postgres socket: #{@sock}>"
{ :Postgres, new: Postgres, :VERSION }
| 22.824 | 82 | 0.585839 |
df274323722b4bd197841b8a903cb0ca98879887 | 6,125 |
describe "class", ->
it "should make a class with constructor", ->
class Thing
new: =>
@color = "blue"
instance = Thing!
assert.same instance, { color: "blue" }
it "should have instance methods", ->
class Thing
get_color: => @color
new: =>
@color = "blue"
instance = Thing!
assert.same instance\get_color!, "blue"
it "should have base properies from class", ->
class Thing
color: "blue"
get_color: => @color
instance = Thing!
assert.same instance\get_color!, "blue"
assert.same Thing.color, "blue"
it "should inherit another class", ->
class Base
get_property: => @[@property]
new: (@property) =>
class Thing extends Base
color: "green"
instance = Thing "color"
assert.same instance\get_property!, "green"
it "should have class properties", ->
class Base
class Thing extends Base
instance = Thing!
assert.same Base.__name, "Base"
assert.same Thing.__name, "Thing"
assert.is_true Thing.__parent == Base
assert.is_true instance.__class == Thing
it "should have name when assigned", ->
Thing = class
assert.same Thing.__name, "Thing"
it "should not expose class properties on instance", ->
class Thing
@height: 10
Thing.color = "blue"
instance = Thing!
assert.same instance.color, nil
assert.same instance.height, nil
it "should expose new things added to __base", ->
class Thing
instance = Thing!
Thing.__base.color = "green"
assert.same instance.color, "green"
it "should call with correct receiver", ->
local instance
class Thing
is_class: => assert.is_true @ == Thing
is_instance: => assert.is_true @ == instance
go: =>
@@is_class!
@is_instance!
instance = Thing!
instance\go!
it "should have class properies take precedence over base properties", ->
class Thing
@prop: "hello"
prop: "world"
assert.same "hello", Thing.prop
describe "super", ->
it "should call super constructor", ->
class Base
new: (@property) =>
class Thing extends Base
new: (@name) =>
super "name"
instance = Thing "the_thing"
assert.same instance.property, "name"
assert.same instance.name, "the_thing"
it "should call super method", ->
class Base
_count: 111
counter: => @_count
class Thing extends Base
counter: => "%08d"\format super!
instance = Thing!
assert.same instance\counter!, "00000111"
it "should call other method from super", ->
class Base
_count: 111
counter: =>
@_count
class Thing extends Base
other_method: => super\counter!
instance = Thing!
assert.same instance\other_method!, 111
it "should get super class", ->
class Base
class Thing extends Base
get_super: => super
instance = Thing!
assert.is_true instance\get_super! == Base
it "should get a bound method from super", ->
class Base
count: 1
get_count: => @count
class Thing extends Base
get_count: => "this is wrong"
get_method: => super\get_count
instance = Thing!
assert.same instance\get_method!!, 1
it "class properties take precedence in super class over base", ->
class Thing
@prop: "hello"
prop: "world"
class OtherThing extends Thing
assert.same "hello", OtherThing.prop
it "gets value from base in super class", ->
class Thing
prop: "world"
class OtherThing extends Thing
assert.same "world", OtherThing.prop
it "should let parent be replaced on class", ->
class A
@prop: "yeah"
cool: => 1234
plain: => "a"
class B
@prop: "okay"
cool: => 9999
plain: => "b"
class Thing extends A
cool: =>
super! + 1
get_super: =>
super
instance = Thing!
assert.same "a", instance\plain!
assert.same 1235, instance\cool!
assert A == instance\get_super!, "expected super to be B"
Thing.__parent = B
setmetatable Thing.__base, B.__base
assert.same "b", instance\plain!
assert.same 10000, instance\cool!
assert B == instance\get_super!, "expected super to be B"
it "should resolve many levels of super", ->
class One
a: =>
1
class Two extends One
a: =>
super! + 2
class Three extends Two
a: =>
super! + 3
i = Three!
assert.same 6, i\a!
it "should resolve many levels of super with a gap", ->
class One
a: =>
1
class Two extends One
class Three extends Two
a: =>
super! + 3
class Four extends Three
a: =>
super! + 4
i = Four!
assert.same 8, i\a!
it "should call correct class/instance super methods", ->
class Base
doit: =>
"instance"
@doit: =>
"class"
class One extends Base
doit: => super!
@doit: => super!
assert.same "instance", One!\doit!
assert.same "class", One\doit!
it "should resolve many levels of super on class methods", ->
class One
@a: =>
1
class Two extends One
class Three extends Two
@a: =>
super! + 3
class Four extends Three
@a: =>
super! + 4
assert.same 8, Four\a!
it "super should still work when method wrapped", ->
add_some = (opts) ->
=> opts.amount + opts[1] @
class Base
value: => 1
class Sub extends Base
value: add_some {
amount: 12
=>
super! + 100
}
class OtherSub extends Base
value: if true
=> 5 + super!
else
=> 2 + super!
assert.same 1 + 100 + 12, Sub!\value!
assert.same 6, OtherSub!\value!
| 20.692568 | 75 | 0.558204 |
891cfb80059fa219146778f290c7664a566fae37 | 2,579 |
-- adapted from: http://thiemonge.org/getting-started-with-uinput
ffi = require "ffi"
import bor from require "bit"
ffi.cdef [[
typedef int ssize_t;
static const int O_WRONLY = 1;
static const int O_NONBLOCK = 2048;
static const int EV_SYN = 0;
static const int EV_KEY = 1;
static const int KEY_LEFTSHIFT = 42;
static const int UI_SET_EVBIT = 1074025828;
static const int UI_SET_KEYBIT = 1074025829;
static const int UI_SET_RELBIT = 1074025830;
static const int UI_DEV_CREATE = 21761;
static const int UI_DEV_DESTROY = 21762;
static const int BUS_USB = 3;
int open(const char *path, int oflag, ...);
int ioctl(int fildes, int request, ...);
ssize_t write(int fildes, const void *buf, size_t nbyte);
unsigned int sleep(unsigned int seconds);
typedef unsigned int __u32;
typedef signed int __s32;
typedef unsigned short __u16;
typedef signed short __s16;
struct input_id {
__u16 bustype;
__u16 vendor;
__u16 product;
__u16 version;
};
struct uinput_user_dev {
char name[80];
struct input_id id;
__u32 ff_effects_max;
__s32 absmax[64];
__s32 absmin[64];
__s32 absfuzz[64];
__s32 absflat[64];
};
struct timeval {
long tv_sec;
long tv_usec;
};
struct input_event {
struct timeval time;
__u16 type;
__u16 code;
__s32 value;
};
]]
import
O_WRONLY, O_NONBLOCK
EV_KEY, EV_SYN
UI_SET_EVBIT, UI_SET_KEYBIT
UI_DEV_CREATE, UI_DEV_DESTROY
KEY_LEFTSHIFT
BUS_USB
from ffi.C
fd = ffi.C.open "/dev/uinput", bor(O_WRONLY, O_NONBLOCK)
print bor(O_WRONLY, O_NONBLOCK)
if fd < 0
print "Failed to open uinput file #{fd}"
os.exit 1
assert 0 <= ffi.C.ioctl fd, UI_SET_EVBIT, EV_KEY
assert 0 <= ffi.C.ioctl fd, UI_SET_EVBIT, EV_SYN
assert 0 <= ffi.C.ioctl fd, UI_SET_KEYBIT, KEY_LEFTSHIFT
device = ffi.new "struct uinput_user_dev"
device.name = "uinput-sample"
device.id.bustype = BUS_USB
device.id.version = 1
device.id.vendor = 1
device.id.product = 1
assert 0 <= ffi.C.write fd, device, ffi.sizeof(device)
assert 0 <= ffi.C.ioctl fd, UI_DEV_CREATE
print "Creating..."
ffi.C.sleep 10 -- wait for X to find it
send_event = (typ, code, value)->
input = ffi.new "struct input_event"
input.type = typ if typ
input.code = code if code
input.value = value if value
assert 0 <= ffi.C.write fd, input, ffi.sizeof(input)
send_event EV_KEY, KEY_LEFTSHIFT, 1
send_event EV_SYN
print "Shift on..."
ffi.C.sleep 10
send_event EV_KEY, KEY_LEFTSHIFT, 0
send_event EV_SYN
print "Shift off..."
ffi.C.sleep 1
ffi.C.ioctl fd, UI_DEV_DESTROY
| 21.139344 | 65 | 0.702986 |
0df1aa9f0b1b5c4da24b20050422f02b7d228952 | 78 | import (
"../pricing/schema.moon"
)
struct Order {
candle pricing.Candle
}
| 9.75 | 25 | 0.679487 |
58cee11f86f40c7e863e060072390f01c1afbade | 1,139 | import floor from math
export class Entity
new: (x, y, sprite) =>
@pos = Vector x, y
@changeSprite sprite, false
@body = world\add @, @pos.x, @pos.y, @dim.x, @dim.y
filter: (item, other) ->
return "cross"
changeSprite: (@sprite, update = true) =>
@dim = Vector @sprite.width, @sprite.height
@offset = @dim / 2
if update
world\update @, @pos.x, @pos.y, @dim.x, @dim.y
draw: (offset = false) =>
love.graphics.setColor @sprite.color
if debugDrawSprites
love.graphics.draw @sprite.img, floor(@pos.x), floor(@pos.y)
if debugDrawCollisionBoxes
x, y, w, h = world\getRect @
love.graphics.rectangle "line", x, y, w, h
update: =>
setPosition: (@pos) =>
world\update @, @pos.x, @pos.y
move: (velocity) =>
goal = @pos + velocity
actual = Vector!
local cols, len
actual.x, actual.y, cols, len = world\move @, goal.x, goal.y, @filter
@pos = actual
if @onCollision then @onCollision cols
onCollision: (cols) =>
for col in *cols
other = col.other
switch other.__class
when Player
other\damage!
| 25.886364 | 73 | 0.590869 |
5862915dbfea492bfd5bf292111aa89171718ea2 | 1,941 | -- Copyright 2012-2015 The Howl Developers
-- License: MIT (see LICENSE.md at the top-level directory of the distribution)
_G = _G
import table from _G
import config, signal from howl
append = table.insert
config.define
name: 'max_log_entries'
description: 'Maximum number of log entries to keep in memory'
default: 1000
type_of: 'number'
signal.register 'log-entry-appended',
description: 'Called when a new entry is appended to the log'
parameters:
essentials: 'The log message essentials'
level: 'The log level (one of info, warning, error)'
message: 'The log message'
signal.register 'log-trimmed',
description: 'Called when the log is trimmed to the given size'
parameters:
size: 'The new number of entries in the log'
log = {}
setfenv 1, log
emitting = false
safe_emit = (name, options) ->
if emitting
-- safe_emit called into signal.emit, which tried to log an error. Back out now
-- to avoid a stack overflow.
return
emitting = true
signal.emit name, options
emitting = false
export entries = {}
essentials_of = (s) ->
first_line = s\match '[^\n\r]*'
essentials = first_line\match '^%[[^]]+%]:%d+: (.+)'
unless essentials
essentials = first_line\match ':%d+: (.-)[\'"]?$'
essentials or first_line
dispatch = (level, message) ->
essentials = essentials_of message
entry = :essentials, :message, :level
append entries, entry
safe_emit 'log-entry-appended', entry
if #entries > config.max_log_entries
to_remove = #entries - config.max_log_entries
for i=1,to_remove
table.remove entries, i
safe_emit 'log-trimmed', size: #entries
entry
export *
last_error = nil
info = (message) -> dispatch 'info', message
warning = (message) -> dispatch 'warning', message
warn = warning
error = (message) -> last_error = dispatch 'error', message
clear = ->
entries = {}
last_error = nil
signal.emit 'log-trimmed', size: 0
return log
| 24.56962 | 83 | 0.691396 |
b369b7dc3ae9afa7e9d30f721b38ec6441a4f75f | 2,514 | ----------------------------------------------------------------
-- A specialized @{Block} which contains two @{SpaceBlock}s and
-- allows children to be added to either.
--
-- @classmod DoubleBlock
-- @author Richard Voelker
-- @license MIT
----------------------------------------------------------------
local Block
local SpaceBlock
if game
pluginModel = script.Parent.Parent.Parent.Parent
Block = require(pluginModel.com.blacksheepherd.code.Block)
SpaceBlock = require(pluginModel.com.blacksheepherd.code.SpaceBlock)
else
Block = require "com.blacksheepherd.code.Block"
SpaceBlock = require "com.blacksheepherd.code.SpaceBlock"
-- {{ TBSHTEMPLATE:BEGIN }}
class DoubleBlock extends Block
----------------------------------------------------------------
-- Constant for adding children to the top @{Block}.
--
-- @prop TOP
----------------------------------------------------------------
@TOP: "top"
----------------------------------------------------------------
-- Constant for adding children to the bottom @{Block}.
--
-- @prop BOTTOM
----------------------------------------------------------------
@BOTTOM: "bottom"
new: =>
super!
@_topBlock = SpaceBlock!
@_bottomBlock = SpaceBlock!
table.insert @_children, @_topBlock
table.insert @_children, @_bottomBlock
SetIndent: (indent) =>
@_indent = indent
@_topBlock\SetIndent "#{indent} "
@_bottomBlock\SetIndent "#{indent} "
----------------------------------------------------------------
-- Adds a child to either of the two @{Block}s.
--
-- @tparam DoubleBlock self
-- @tparam string block One of DoubleBlock.TOP or
-- DoubleBlock.BOTTOM
-- @tparam Block/Line child The child to add.
----------------------------------------------------------------
AddChild: (block, child) =>
if block == @@TOP
@_topBlock\AddChild child
elseif block == @@BOTTOM
@_bottomBlock\AddChild child
----------------------------------------------------------------
-- @tparam DoubleBlock self
-- @treturn string The code that will be added to the buffer
-- that will be added in between the content of the two
-- @{Block}s.
----------------------------------------------------------------
MiddleRender: =>
Render: =>
buffer = ""
buffer ..= @\BeforeRender!
buffer ..= "\n"
buffer ..= @_topBlock\Render!
buffer ..= "\n"
buffer ..= @\MiddleRender!
buffer ..= "\n"
buffer ..= @_bottomBlock\Render!
buffer ..= "\n"
buffer .. @\AfterRender!
-- {{ TBSHTEMPLATE:END }}
return DoubleBlock
| 27.626374 | 69 | 0.50716 |
79cf2e171ca8cb73ca76dbd0eb7daf27fee0fbd9 | 2,066 | module_reset = ->
keep = {k, true for k in pairs package.loaded}
->
count = 0
for mod in *[k for k in pairs package.loaded when not keep[k]]
count += 1
package.loaded[mod] = nil
true, count
class Runner
attach_server: (env, overrides) =>
overrides or= {}
overrides.logging = false
assert not @current_server, "there's already a server thread"
import AttachedServer from require "lapis.cmd.cqueues.attached_server"
server = AttachedServer!
server\start env, overrides
@current_server = server
@current_server
detach_server: =>
assert @current_server, "no current server"
class Server
new: (@server) =>
stop: =>
@server\close!
start: =>
logger = require "lapis.logging"
port = select 3, @server\localname!
logger.start_server port
package.loaded["lapis.running_server"] = "cqueues"
assert @server\loop!
package.loaded["lapis.running_server"] = nil
create_server = (app_module) ->
config = require("lapis.config").get!
http_server = require "http.server"
import dispatch from require "lapis.cqueues"
load_app = ->
app_cls = if type(app_module) == "string"
require(app_module)
else
app_module
if app_cls.__base -- is a class
app_cls!
else
app_cls\build_router!
app_cls
onstream = if config.code_cache == false or config.code_cache == "off"
reset = module_reset!
(stream) =>
reset!
app = load_app!
dispatch app, @, stream
else
app = load_app!
(stream) => dispatch app, @, stream
server = http_server.listen {
host: "127.0.0.1"
port: assert config.port, "missing server port"
:onstream
onerror: (context, op, err, errno) =>
msg = op .. " on " .. tostring(context) .. " failed"
if err
msg = msg .. ": " .. tostring(err)
assert io.stderr\write msg, "\n"
}
Server server
start_server = (...) ->
server = create_server ...
server\start!
{
type: "cqueues"
:create_server
:start_server
runner: Runner!
}
| 22.215054 | 74 | 0.630203 |
43e7dc9f1631881b13b9321762e4e759c48964f6 | 8,492 | import Widget from require "lapis.html"
class Portfolio extends Widget
content: =>
link rel: "stylesheet", href: "/static/css/portfolio/main.css"
center ->
h1 "Projects I've Worked On"
div class: "row", ->
div class: "col-xs-12 col-sm-6 col-md-6 col-lg-6", ->
div class: "box", ->
div class: "box-icon", ->
center ->
img src: "/static/img/projects/flitter.png", width: 70, height: 70, style: "position: relative; top: 50%; transform: translateY(12%);"
div class: "info", ->
h4 class: "text-center", "Flitter"
p "Flitter is an experimental platform-as-a-service implementation from scratch in Go. It uses mostly handrolled tools and Vulcand for HTTP proxying to applications. It is currently not being maintained but it is able to deploy applications with a Dockerfile via a heroku-style git push."
a href: "/projects/flitter", class: "btn", "Learn More"
div class: "col-xs-12 col-sm-6 col-md-6 col-lg-6", ->
div class: "box", ->
div class: "box-icon", ->
span class: "fa fa-4x fa-server"
div class: "info", ->
h4 class: "text-center", "Scalable Deployment"
p ->
text "This site and a few others I host are deployed inside Docker containers and are updated using "
code "git push"
text ". The code for this site is available to the public at the link below. This is a simple Lapis application inside nginx and deployed using my docker-lapis image."
a href: "http://github.com/Xe/christine.website", class: "btn", "Learn More"
div class: "col-xs-12 col-sm-6 col-md-6 col-lg-6", ->
div class: "box", ->
div class: "box-icon", ->
center ->
img src: "/static/img/projects/cod.png", width: 70, height: 70, style: "position: relative; top: 50%; transform: translateY(25%);"
div class: "info", ->
h4 class: "text-center", "Cod"
p "Cod is an opinionated set of extended services for IRC networks. It's written from scratch in Python and currently is in active use on a network with over 250 users daily. It works with any Charybdis family IRC daemon but will work best with Elemental-IRCd."
a href: "https://github.com/cod-services/cod", class: "btn", "Learn More"
div class: "col-xs-12 col-sm-6 col-md-6 col-lg-6", ->
div class: "box", ->
div class: "box-icon", ->
center ->
img src: "/static/img/projects/tetra.png", width: 70, height: 70, style: "position: relative; top: 50%; transform: translateY(25%);"
div class: "info", ->
h4 class: "text-center", "Tetra"
p "Tetra is the successor to Cod. It is rewritten from the ground up with the core in Go and all plugins in either Moonscript or Lua. It is in development but master is considered stable. Any active development that could break things is done in feature branches that will PR to master."
a href: "/projects/Tetra", class: "btn", "Learn More"
div class: "col-xs-12 col-sm-6 col-md-6 col-lg-6", ->
div class: "box", ->
div class: "box-icon", ->
span class: "fa fa-4x fa-code"
div class: "info", ->
h4 class: "text-center", "Elemental-IRCd"
p "Elemental-IRCd is a fork of the (now defunct) ShadowIRCd project. It is also a fork of Atheme's Charybdis irc daemon with more user-friendly features. Most of these things are security patches, network staff usability features, patches that make centralized management simpler and extra status levels in channels; but the resulting core changes mean it needs to be its own project."
a href: "https://github.com/elemental-ircd/elemental-ircd", class: "btn", "Learn More"
div class: "col-xs-12 col-sm-6 col-md-6 col-lg-6", ->
div class: "box", ->
div class: "box-icon", ->
span class: "fa fa-4x fa-music"
div class: "info", ->
h4 class: "text-center", "PonyvilleFM"
p "PonyvilleFM is an online radio station with both live DJ's and a continuously shuffling set of playlists. My main contribution to them has been helping maintain and deploy their cross-network utility and relay IRC bot as well as help with research and development for future projects still in research and development phases."
a href: "http://ponyvillefm.com", class: "btn", "Learn More"
div class: "col-xs-12 col-sm-6 col-md-6 col-lg-6", ->
div class: "box", ->
div class: "box-icon", ->
center ->
img src: "/static/img/projects/glue.png", width: 70, height: 70, style: "position: relative; top: 50%; transform: translateY(18%);"
div class: "info", ->
h4 class: "text-center", "Glue"
p "Glue is a small shim I needed to make in order to test some aspects of Tetra outside of the main environment. Its name comes from the fact that it needed to glue things together as well as the fact that it combines Go and Lua together."
a href: "https://github.com/Xe/glue", class: "btn", "Learn More"
div class: "col-xs-12 col-sm-6 col-md-6 col-lg-6", ->
div class: "box", ->
div class: "box-icon", ->
center ->
img src: "https://camo.githubusercontent.com/0842ae6eb213b4d95efc9f2137085bbbd8e52258/68747470733a2f2f692e696d6775722e636f6d2f4379337a4f6f772e706e67", width: 70, height: 70, style: "position: relative; top: 50%; transform: translateY(18%);"
div class: "info", ->
h4 class: "text-center", "Shuo"
p ->
text "Originally a fork of "
a href: "https://github.com/erming/shout", "Shout"
text ", Shuo is a stable and proven web interface to IRC. It has a server written in Node.JS and uses socket.io to communicate with the HTML5 client. It is pending a large scale rewrite with a backend in Haskell or Go."
a href: "https://github.com/ponychat/shuo", class: "btn", "Learn More"
div class: "col-xs-12 col-sm-6 col-md-6 col-lg-6", ->
div class: "box", ->
div class: "box-icon", ->
center ->
img src: "/static/img/projects/ponyapi.png", width: 70, height: 70, style: "position: relative; top: 50%; transform: translateY(18%);"
div class: "info", ->
h4 class: "text-center", "PonyAPI"
p "A simple JSON api for information on episodes of My Little Pony: Friendship is Magic. It uses data scraped by hand over 4 years and presents as JSON via a server written in Nim. It also follows best practices for not breaking existing code when adding improvements."
a href: "https://github.com/Xe/PonyAPI", class: "btn", "Learn More"
h3 ->
text "Web Portfolio"
div class: "row", ->
div class: "col-md-6", ->
a href: "https://yolo-swag.com", ->
img src: "http://api.webthumbnail.org/?width=420&height=330&screen=1280&url=https://yolo-swag.com"
div class: "col-md-6", ->
a href: "http://xeserv.us", ->
img src: "http://api.webthumbnail.org/?width=420&height=330&screen=1280&url=http://xeserv.us"
div class: "col-md-6", ->
a href: "http://diddy-kong.racing", ->
img src: "http://api.webthumbnail.org/?width=420&height=330&screen=1280&url=http://diddy-kong.racing"
div class: "col-md-6", ->
a href: "https://ponychat.net", ->
img src: "http://api.webthumbnail.org/?width=420&height=330&screen=1280&url=https://ponychat.net"
div class: "col-md-6", ->
a href: "https://clop.science", ->
img src: "http://api.webthumbnail.org/?width=420&height=330&screen=1280&url=https://clop.science"
div class: "col-md-6", ->
a href: "http://cinemaquestria.com", ->
img src: "http://api.webthumbnail.org/?width=420&height=330&screen=1280&url=http://cinemaquestria.com"
div class: "col-md-6", ->
a href: "https://bnc.ponychat.net", ->
img src: "http://api.webthumbnail.org/?width=420&height=330&screen=1280&url=https://bnc.ponychat.net"
div class: "col-md-6", ->
a href: "https://bnc-signup.ponychat.net", ->
img src: "http://api.webthumbnail.org/?width=420&height=330&screen=1280&url=https://bnc-signup.ponychat.net"
| 60.22695 | 397 | 0.616934 |
aa28801a35c392ddff73cee55fb03122dfc16e37 | 390 | import readproc from require 'mon.util'
() ->
output = {}
v4, v6 = 0, 0
for address in string.gmatch (readproc 'hostname -I'), '%S+'
if string.match address, '%.'
output["ipv4:addr#{v4}"] =
value: address
name: "Network - IPv4 - Address #{v4}"
v4 += 1
else
output["ipv6:addr#{v6}"] =
value: address
name: "Network - IPv6 - Address #{v6}"
v6 += 1
output
| 21.666667 | 61 | 0.579487 |
854f6297c69108e205410573997dfcf97372cf0a | 3,119 | #!/this/is/ignored
a = 1 + 2* 3 / 6
a, bunch, go, here = another, world
func arg1, arg2, another, arg3
here, we = () ->, yeah
the, different = () -> approach; yeah
dad()
dad(lord)
hello(one,two)()
(5 + 5)(world)
fun(a)(b)
fun(a) b
fun(a) b, bad hello
hello world what are you doing here
what(the)[3243] world, yeck heck
hairy[hands][are](gross) okay okay[world]
(get[something] + 5)[years]
i,x = 200, 300
yeah = (1 + 5) * 3
yeah = ((1+5)*3)/2
yeah = ((1+5)*3)/2 + i % 100
whoa = (1+2) * (3+4) * (4+5)
->
if something
return 1,2,4
print "hello"
->
if hello
"heloo", "world"
else
no, way
-> 1,2,34
return 5 + () -> 4 + 2
return 5 + (() -> 4) + 2
print 5 + () ->
34
good nads
something 'else', "ya"
something'else'
something"else"
something[[hey]] * 2
something[======[hey]======] * 2
something'else', 2
something"else", 2
something[[else]], 2
something 'else', 2
something "else", 2
something [[else]], 2
here(we)"go"[12123]
-- this runs
something =
test: 12323
what: -> print "hello world"
print something.test
frick = hello: "world"
argon =
num: 100
world: (self) ->
print self.num
return {
something: -> print "hi from something"
}
somethin: (self, str) ->
print "string is", str
return world: (a,b) -> print "sum", a + b
something.what()
argon\world().something()
argon\somethin"200".world(1,2)
x = -434
x = -hello world one two
hi = -"herfef"
x = -[x for x in x]
print "hello" if cool
print "hello" unless cool
print "hello" unless 1212 and 3434 -- hello
print "hello" for i=1,10
print "nutjob"
if hello then 343
print "what" if cool else whack
arg = {...}
x = (...) ->
dump {...}
x = not true
y = not(5+5)
y = #"hello"
x = #{#{},#{1},#{1,2}}
hello, world
something\hello(what) a,b
something\hello what
something.hello\world a,b
something.hello\world(1,2,3) a,b
x = 1232
x += 10 + 3
j -= "hello"
y *= 2
y /= 100
m %= 2
hello ..= "world"
@@something += 10
@something += 10
a["hello"] += 10
a["hello#{tostring ff}"] += 10
a[four].x += 10
x = 0
(if ntype(v) == "fndef" then x += 1) for v in *values
hello =
something: world
if: "hello"
else: 3434
function: "okay"
good: 230203
div class: "cool"
5 + what wack
what whack + 5
5 - what wack
what whack - 5
x = hello - world - something
((something = with what
\cool 100) ->
print something)!
if something
03589
-- okay what about this
else
3434
if something
yeah
elseif "ymmm"
print "cool"
else
okay
-- test names containing keywords
x = notsomething
y = ifsomething
z = x and b
z = x andb
-- undelimited tables
while 10 > something
something: "world"
print "yeah"
x =
okay: sure
yeah
okay: man
sure: sir
hello "no comma"
yeah: dada
another: world
hello "comma",
something: hello_world
frick: you
-- creates two tables
another hello, one,
two, three, four, yeah: man
okay: yeah
--
a += 3 - 5
a *= 3 + 5
a *= 3
a >>= 3
a <<= 3
a /= func "cool"
---
x.then = "hello"
x.while.true = "hello"
--
x or= "hello"
x and= "hello"
--
z = a-b
z = a -b
z = a - b
z = a- b
-- cooool
| 11.424908 | 53 | 0.587047 |
34c15e8734fd0e9586968ed9a454a48b004d80f7 | 30 | require "lapis.features.etlua" | 30 | 30 | 0.833333 |
df480ff81b6edb2d9cf7cf87678e5e8858aa215f | 2,461 | -- Copyright 2012-2015 The Howl Developers
-- License: MIT (see LICENSE.md at the top-level directory of the distribution)
{:config} = howl
config.define
name: 'hidden_file_extensions'
description: 'File extensions that determine which files should be hidden in file selection lists'
scope: 'global'
type_of: 'string_list'
default: {'a', 'bc', 'git', 'hg', 'o', 'pyc', 'so', 'svn', 'cvs'}
config.define {
name: 'complete'
description: 'Controls the operation of auto-completion'
default: 'auto'
options: {
{ 'manual', 'Only complete when explicitly asked' }
{ 'auto', 'Complete whenever it is deemed appropriate' }
{ 'always', 'Alway start completion automatically' }
}
}
config.define
name: 'auto_format'
description: 'Whether to automatically format code when possible'
default: true
type_of: 'boolean'
config.define
name: 'preview_files'
description: 'Whether to automatically preview the selected file or buffer'
default: true
type_of: 'boolean'
scope: 'global'
config.define {
name: 'inspectors_on_idle'
description: 'List of on-idle inspectors to run for a buffer'
type_of: 'string_list'
default: {}
}
config.define {
name: 'inspectors_on_save'
description: 'List of on-save inspectors to run for a buffer'
type_of: 'string_list'
default: {}
}
config.define {
name: 'auto_inspect'
description: 'When to automatically inspect code for abberrations'
default: 'on'
options: {
{ 'off', 'Run all inspectors only when explicitly asked to' }
{ 'on', 'Run on-idle inspectors on idle and on-save inspectors on save' }
{ 'save_only', 'Run all inspectors, but only on save' }
}
}
config.define {
name: 'display_inspections_delay'
description: 'The delay before inspections are displayed at the current pos (ms, minimum 500ms)'
type_of: 'number'
default: 500
scope: 'global'
validate: (v) ->
return false unless type(v) == 'number'
v >= 500
}
config.define {
name: 'activities_popup_delay'
description: 'The delay before a popup is displayed for a running activity (ms)'
type_of: 'number'
default: 700
scope: 'global'
}
config.define {
name: 'popup_menu_accept_key'
description: 'What key should be used for accepting the current option of a popup menu?'
default: 'enter'
scope: 'global'
options: {
{ 'enter', 'Pressing <ENTER> accepts the current option' }
{ 'tab', 'Pressing <TAB> accepts the current option' }
}
}
| 26.75 | 100 | 0.696059 |
31f5c469fe303e3a568603e62940581a0d3ac6f6 | 1,084 | import sin, floor from math
help = {}
help.text = "Help"
help.height = 16
help.y = help.height
move = ->
flux.to(help, 0.48, {y: help.height + 16 })\ease("cubicin")\oncomplete(->
flux.to(help, 0.48, {y: help.height})\ease("cubicout")\oncomplete(move)
)
move!
textCentered = (s, font, y) ->
x = gameWidth / 2 - font\getWidth(s) / 2
love.graphics.setFont font
love.graphics.print(s, x, y)
text = (s, font, y) ->
love.graphics.setFont font
love.graphics.print(s, 0, y)
help.update = (dt) =>
flux.update dt
help.draw = () =>
-- draw the level
push\start!
textCentered @text, fontFantasy, floor(@y)
text "WASD - MOVEMENT\n\nARROW KEYS - ATTACK\n\n
YOUR GOAL IS TO FIND THE SECRETS\n
OF THE UNKNOWN DEPTHS. THE\n
DEEPER YOU GO THE MORE YOU WILL\n
DISCOVER. WATCH OUT FOR THE\n
DEADLY CREATURES OF THE DEPTHS,\n
THEY WILL TRY TO STOP YOU.", fontRetro, 96
push\finish!
help.keypressed = (key) =>
if key == "return" or key == "escape" or key == "h"
manager\pop!
if key == "f"
push\switchFullscreen(windowedWidth, windowedHeight)
return help | 23.565217 | 75 | 0.658672 |
601ed87e76f0b53d4d1fad9919f61f452ad9424c | 360 | {:capture} = require "command"
->
acpi = capture("acpi -b")\split('\n')
batt = ([line for line in *acpi when line\match '^Battery'])[1]
return unless batt
status = batt\match ':%s(%a+),'
status = status\lower!
percent = tonumber batt\match(',%s(%d+)%%')
time_remaining = batt\match ',%s(%d+:%d+):%d+%s%a+'
{:status, :percent, :time_remaining}
| 30 | 65 | 0.602778 |
fed2d1e125921457ef997679788bbe4c67144e07 | 201 | export ^
class State
update: (dt) =>
draw: =>
mousereleased: (x, y, button) =>
mousepressed: (x, y, button) =>
keypressed: (k) =>
keyreleased: (k) =>
wheelmoved: (x, y) =>
| 18.272727 | 36 | 0.517413 |
57ed5583b0d18847cd970f7136a46868dffa0c5d | 140 | return {
RouteNotFoundError: require "tbsp.errors.route_not_found"
StaticFileNotFoundError: require "tbsp.errors.static_file_not_found"
}
| 28 | 69 | 0.835714 |
d07bedb6d561292619dcbf389d48867a16716e7a | 646 | class Utils
contains: (input, el) ->
return false if not input
return false if not el
for _, value in pairs(input)
return true if value == el
return false
concat: (a, b) ->
return a if not b
return b if not a
result = {unpack(a)}
table.move(b, 1, #b, #result + 1, result)
return result
explode: (div, str) ->
return false if div == ''
pos,arr = 0, {}
for st, sp in () -> string.find(str,div,pos,true)
table.insert(arr, string.sub(str, pos, st - 1))
pos = sp + 1
return arr
return Utils
| 21.533333 | 59 | 0.503096 |
430d44643dda9bf2c5a65cfcbe8f45fc674b044c | 738 | export redis = require 'redis'
export config = require 'config'
export library = require 'library'
export inspect = require 'inspect'
export socket = require 'socket'
export plugins = {}
-- load plugins
for i, plugin in ipairs config.plugins
name, param = nil, nil
if type(plugin) == 'string'
name = plugin
else
name, param = plugin[1], plugin[2]
require_string = "return require('" .. name .. "')"
library.log("Loading plugin: " .. name)
plugins[i] = {
name: name,
param: param,
plugin: loadstring(require_string)
}
-- seed math.random
math.randomseed(socket.gettime! * 1000)
library.log('Redis host: ' .. config.redis_host .. ':' .. config.redis_port)
return nil
| 24.6 | 76 | 0.638211 |
e5a3eceea46aa1e672faff6373847f6d61289e95 | 10,972 | -- Copyright 2012-2015 The Howl Developers
-- License: MIT (see LICENSE.md at the top-level directory of the distribution)
Gtk = require 'ljglibs.gtk'
require 'howl.ui.icons.font_awesome'
import bindings, dispatch from howl
import PropertyObject from howl.util.moon
import NotificationWidget, BufferPopup, TextWidget, IndicatorBar, ContentBox, HelpContext, style from howl.ui
append = table.insert
style.define_default 'prompt', 'keyword'
class CommandLine extends PropertyObject
new: (@window) =>
super!
@def = {}
@bin = Gtk.Box Gtk.ORIENTATION_HORIZONTAL
@box = nil
@command_widget = nil
@header = nil
@indic_title = nil
@indic_info = nil
@is_open = false
@is_hidden = false
@_help_context = nil
@_title = nil
@_prompt = ''
@_widgets = {} -- maps string name to widget object
to_gobject: => @bin
_initialize_box: =>
@box = Gtk.Box Gtk.ORIENTATION_VERTICAL
@command_widget = TextWidget
line_wrap: 'char'
on_keypress: (event) ->
result = true
if not @handle_keypress(event)
result = false
@post_keypress!
return result
on_changed: ->
@handle_text_change!
on_focus_lost: ->
-- don't let focus leave command line, even if user clicks the editor, we'll grab focus back while open
if @is_open and not @is_hidden and howl.activities.nr_visible == 0
@command_widget\focus!
@command_widget.visible_rows = 1
@box\pack_end @command_widget\to_gobject!, false, 0, 0
@notification = NotificationWidget!
@box\pack_end @notification\to_gobject!, false, 0, 0
@header = IndicatorBar 'header'
@indic_title = @header\add 'left', 'title'
@indic_info = @header\add 'right', 'info'
@box.margin_left = 2
@box.margin_top = 2
c_box = ContentBox 'command_line', @box, {
header: @header\to_gobject!
}
@bin\add c_box\to_gobject!
_destroy_box: =>
@box\destroy!
@box = nil
@property title:
get: => @_title
set: (text) =>
@_title = text
if text == nil or text.is_empty
@header\to_gobject!\hide!
else
@header\to_gobject!\show!
@indic_title.label = tostring text
@property prompt:
get: => @_prompt or ''
set: (prompt='') =>
@command_widget\delete 1, @_prompt_end
@command_widget\insert prompt, 1, 'prompt'
@_prompt = prompt
@_cursor_to_end!
@property _prompt_end:
get: => if @_prompt then @_prompt.ulen else 0
@property text:
get: => @command_widget.text\usub 1 + @_prompt_end
set: (text) =>
@clear!
@write text
clear: =>
@command_widget\delete 1 + @_prompt_end, @command_widget.text.ulen
@\_cursor_to_end!
write: (text) =>
@command_widget\append text
@\_cursor_to_end!
@\handle_text_change!
_cursor_to_end: =>
@command_widget.cursor\eof!
post_keypress: =>
@_enforce_left_pos!
_enforce_left_pos: =>
-- don't allow cursor to go left into prompt
left_pos = @_prompt_end + 1
if @command_widget.cursor.pos < left_pos
@command_widget.cursor.pos = left_pos
handle_text_change: =>
@command_widget\adjust_height! -- expand or contract on wrapping
return unless @def.on_text_changed
-- avoid deep recursive calls to short circuit cyclic bugs in the code
@_update_recursive_count or= 0
@_update_recursive_count += 1
if @_update_recursive_count > 1000
error 'command line hit on_text_changed recursion limit'
ok, err = pcall -> @def\on_text_changed @text
@_update_recursive_count -= 1
error err unless ok
handle_keypress: (event) =>
-- keymaps checked in order:
-- @preemptive_keymap - command line keystrokes that cannot be remapped
-- @opts.cancel_for_keymap - if dispatch is successful, this command_line is cancelled
-- @def.keymap - keymap provided by definition table passed into run()
-- @default_keymap - standard keys such ask arrows and backspace
return true if bindings.dispatch event, 'command_line', { @preemptive_keymap }, self
@window.status\clear!
@close_help!
if @opts.cancel_for_keymap and bindings.can_dispatch event, 'command_line', { @opts.cancel_for_keymap }
text = @text
@finish!
bindings.dispatch event, 'command_line', { @opts.cancel_for_keymap }, :text
return true
if @def and @def.keymap
return true if bindings.dispatch event, 'command_line', { @def.keymap }, @def
return true if bindings.dispatch event, 'command_line', { @default_keymap }, self
return false
preemptive_keymap:
ctrl_shift_backspace: => @finish! if @parking
escape: =>
if @help_popup
@close_help!
return true
return false
default_keymap:
f1: => @show_help!
binding_for:
["cursor-home"]: => @command_widget.cursor.pos = @_prompt_end
["cursor-line-end"]: => @_cursor_to_end!
["cursor-left"]: => @command_widget.cursor\left!
["cursor-right"]: => @command_widget.cursor\right!
["editor-delete-back"]: =>
if @command_widget.cursor.pos <= @_prompt_end + 1
-- backspace attempted into prompt
if @def.handle_back
@def\handle_back!
return true
else
return true
range_start = @command_widget.selection\range!
return if range_start and range_start < @_prompt_end
@command_widget\delete_back!
["editor-paste"]: =>
import clipboard from howl
if clipboard.current
@write clipboard.current.text
add_widget: (name, widget, pos='bottom') =>
error('No widget provided', 2) if not widget
@remove_widget name
local pack
if pos == 'bottom'
pack = @box\pack_end
elseif pos == 'top'
pack = @box\pack_start
else
error "Invalid pos #{pos}"
pack widget\to_gobject!, false, 0, 0
@_widgets[name] = widget
widget\show!
remove_widget: (name) =>
widget = @_widgets[name]
return unless widget
widget\to_gobject!\destroy!
@_widgets[name] = nil
get_widget: (name) => @_widgets[name]
clear_widgets: =>
names = [name for name, _ in pairs @_widgets]
for name in *names
@remove_widget name
load_help: =>
-- merge help provided by @def and @opts
@_help_context = HelpContext!
if @opts.help
@_help_context\merge @opts.help
def_help = @def.get_help and @def\get_help!
if def_help
@_help_context\merge def_help
-- when help is available, show help info/keyboard icons in header
info_icon = howl.ui.icon.get('font-awesome-info')
keyboard_icon = howl.ui.icon.get('font-awesome-keyboard-o')
text = ''
if #@_help_context.sections > 0
text = info_icon.text
if #@_help_context.keys > 0
text ..= " #{keyboard_icon.text}"
unless text.is_empty
text ..= ': f1'
@indic_info.label = text
show_help: =>
help_buffer = @_help_context\get_buffer!
return unless help_buffer and not help_buffer.text.is_blank
-- display help buffer in a centered popup
popup = BufferPopup help_buffer
@close_help!
popup\show howl.app.window\to_gobject!, x:1, y:1
popup\center!
@help_popup = popup
close_help: =>
if @help_popup
@help_popup\destroy!
@help_popup = nil
open: =>
return if @is_open
@bin\show_all!
@notification\hide!
@title = @title
@is_open = true
@is_hidden = false
@command_widget\focus!
hide: =>
@bin\hide!
@is_hidden = true
unhide: =>
@bin\show!
@is_hidden = false
@command_widget\focus!
close: =>
return if not @box
if @def.on_close
@def\on_close!
@reset!
if @is_open
@bin\hide!
@_destroy_box!
@is_open = false
reset: =>
@def = {}
@parking = nil
@title = ''
@prompt = ''
@text = ''
run: (def, opts={}) =>
error 'def not provided' unless def
error 'def.init not provided' unless def.init
@_initialize_box! unless @box
@def = def
@opts = moon.copy opts
@load_help!
@parking = dispatch.park 'command_line'
status, err = pcall -> def\init self, max_height: @window.allocated_height * 0.5, max_width: @window.allocated_width - 20
unless status
log.error 'def.init returned error: ', :err
@open!
-- calls @def.on_text_changed
dispatch.launch -> @text = opts.text or ''
result = dispatch.wait @parking
@close!
return result
finish: (result) =>
error 'no handler to finish' unless @parking
dispatch.resume @parking, result
class CommandPanel extends PropertyObject
new: (@window) =>
super!
@command_lines = {}
@bin = Gtk.Box Gtk.ORIENTATION_VERTICAL
to_gobject: => @bin
@property is_active: get: => #@command_lines > 0
@property active_command_line: get: => @command_lines[#@command_lines]
_push: (command_line) =>
@bin\pack_end command_line\to_gobject!, false, 0, 0
append @command_lines, command_line
_remove: (command_line) =>
before_count = #@command_lines
@command_lines = [cl for cl in *@command_lines when cl != command_line]
after_count = #@command_lines
if after_count < before_count
@bin\remove command_line\to_gobject!
return command_line
run: (def, opts={}) =>
current_command_line = @command_lines[#@command_lines] -- currently active command line
unless current_command_line
-- first command line, save focus of current editor
@last_focused = @window.focus if not @last_focused
@window\remember_focus!
if current_command_line
-- hide currently active command line
-- this should also hide all related widgets because they're in the same bin
-- *important*: this should always happen before we run the new command
-- line otherwise both command_lines will fight for the focus (see
-- on_focus_lost)
current_command_line\hide!
else
@window.status\hide!
@bin\show!
-- create the new command line and run it
command_line = CommandLine @window
@_push command_line
result = table.pack command_line\run def, opts
@_remove command_line
-- after the run, revert to previous state
if current_command_line
-- re display the previous command line
current_command_line\unhide!
else
-- no more command lines, close up the entire panel
@bin\hide!
@last_focused\grab_focus! if @last_focused
@last_focused = nil
@window.status\show!
return table.unpack result
notify: (message, level) =>
return unless @is_active
with @active_command_line.notification
\notify level, message
\show!
cancel: =>
command_lines = [command_line for _, command_line in ipairs @command_lines]
dispatch.launch ->
for idx = #command_lines, 1, -1
command_lines[idx]\finish!
return CommandPanel
| 27.361596 | 125 | 0.65175 |
02f45cdc843184b844a71f413944fcbf218ed716 | 1,443 | Timer = require 'vendor.hump.timer'
deep = require 'vendor.deep'
V = require 'vector'
import copy from require 'moon'
Node = require 'node'
class Block extends Node
@BASE_SIZE: 38
@SPACING_FACTOR: 0.07
@DEFAULT_SPACING: @BASE_SIZE * @SPACING_FACTOR
@RADIUS_DIVISOR: 5
@STATES: {
SELECT: factor: 0.62, padding: 0.00
GRABBED: factor: 1.00, padding: 0.10
PLACED: factor: 1.00, padding: 0.00
}
new: (game, parent, pos, color, state) =>
super game, parent, pos
@state = copy state or @@STATES.PLACED
size = @@BASE_SIZE * @state.factor
@size = w: size, h: size
@color = color or 'def' -- string corresponding to theme color name
@onTop = false -- set by Polies
getSpacing: =>
@size.w * @@SPACING_FACTOR
setState: (state) =>
@game.timer\tween(.2, @state, state, 'out-back')
update: =>
size = @@BASE_SIZE * @state.factor
@size = w: size, h: size
draw: =>
padding = @state.padding * @size.w
size = @size.w - padding
radius = size / @@RADIUS_DIVISOR
deep.queue @onTop and 2 or 1, ->
love.graphics.setColor @game.theme[@color]
love.graphics.rectangle('fill',
@pos.x + padding, @pos.y + padding,
size, size,
radius)
return Block
| 28.294118 | 76 | 0.540541 |
5b9bd9a83185cd2fc5f0d8a2ad7bd4d8e86e1a3c | 3,848 |
{graphics: g} = love
class TileGenerator extends Box
w: 16
h: 16
x: 0
y: 0
new: (@seed) =>
@render!
draw: =>
@outline!
g.draw @canvas, @x, @y if @canvas
render: =>
unless @canvas
@canvas = g.newCanvas @w, @h
@canvas\setFilter "nearest", "nearest"
g.setCanvas @canvas
@render_tile!
g.setCanvas!
render_tile: =>
update: (dt) =>
true
class GrassGenerator extends TileGenerator
render_tile: =>
@rng = love.math.newRandomGenerator @seed + 777
@rng\random! for i=1,3
Box.draw @, C.grass
for color in *{C.grass_dark, C.grass_light}
for i=1,20
x = @rng\random 0, 15
y = @rng\random 0, 15
w = @rng\random 1, 2
h = @rng\random 2, 4
Box(x,y,w,h)\draw color
class DirtGenerator extends TileGenerator
colors: =>
C.dirt, C.dirt_dark
render_tile: =>
@rng = love.math.newRandomGenerator @seed
@rng\random! for i=1,3
light, dark = @colors!
Box.draw @, light
COLOR\push dark
g.setPointSize 1
for i=1,3
x = @rng\random 0, 15
y = @rng\random 0, 15
g.point x,y
g.setPointSize 2
for i=1,3
x = @rng\random 0, 15
y = @rng\random 0, 15
g.point x,y
g.setPointSize 3
for i=1,3
x = @rng\random 0, 15
y = @rng\random 0, 15
g.point x,y
COLOR\pop!
class WetDirtGenerator extends DirtGenerator
colors: =>
C.dirt_dark, C.dirt_darker
class TilledDirtGenerator extends TileGenerator
colors: =>
C.dirt, C.dirt_dark
render_tile: =>
@rng = love.math.newRandomGenerator @seed + 327
light, dark = @colors!
Box.draw @, light
@rng\random! for i=1,3
g.push!
g.translate @w/2, @h/2
g.rotate @rng\random!
g.translate -@w/2, -@h/2
oy = @rng\random 1,4
for y=0,2
Box(0,oy + y * 4,16,2)\draw dark
g.pop!
class WetTilledDirtGenerator extends TilledDirtGenerator
colors: =>
C.dirt_dark, C.dirt_darker
class WoodGenerator extends TileGenerator
render_tile: =>
@rng = love.math.newRandomGenerator @seed
@rng\random! for i=1,3
Box.draw @, C.wood
for color in *{C.wood_dark, C.wood_light}
for i=1,3
y = @rng\random 0, 15
Box(0,y,16,2)\draw color
class FloorGenerator extends TileGenerator
render_tile: =>
@rng = love.math.newRandomGenerator @seed
@rng\random! for i=1,3
Box.draw @, C.floor
g.setPointSize 2
COLOR\push C.floor_light
ox = @rng\random 1,4
oy = @rng\random 1,4
dt = @rng\random 3,5
g.push!
g.translate ox, oy
g.translate @w/2, @h/2
g.rotate @rng\random!
g.translate -@w/2, -@h/2
for y=0,4
for x=0,4
g.point x*dt, y*dt
g.pop!
COLOR\pop!
class TopGenerator extends TileGenerator
render_tile: =>
@rng = love.math.newRandomGenerator @seed + 263
Box.draw @, C.top
COLOR\push C.top_light
g.rectangle "line", 0,0, @w, @h
COLOR\pop!
class TileSheet
w: 7
new: =>
{:w, :h} = TileGenerator
rows = {
[GrassGenerator i for i=2,1+@w]
[DirtGenerator i for i=2,1+@w]
[WoodGenerator i for i=2,1+@w]
[FloorGenerator i for i=2,1+@w]
[TopGenerator i for i=2,1+@w]
[WetDirtGenerator i for i=2,1+@w]
[TilledDirtGenerator i for i=2,1+@w]
[WetTilledDirtGenerator i for i=2,1+@w]
}
@h = #rows
@canvas = g.newCanvas w * @w, h * @h
@canvas\setFilter "nearest", "nearest"
g.setCanvas @canvas
for y, row in ipairs rows
for x, gen in ipairs row
g.draw gen.canvas, (x - 1) * w, (y - 1) * h
g.setCanvas!
row_tid: (row) =>
row * @w
spriter: =>
Spriter Image\from_tex(@canvas),
TileGenerator.w, TileGenerator.h
{ :TileGenerator, :GrassGenerator, :DirtGenerator,
:WoodGenerator, :TileSheet }
| 19.049505 | 56 | 0.588098 |
b0fa1babca636c5814bfc339bf15973569681ba0 | 3,304 | lfs = require "lfs"
import with_dev from require "spec.helpers"
pattern = ...
unpack = table.unpack or unpack
options = {
in_dir: "spec/inputs",
out_dir: "spec/outputs",
input_pattern: "(.*)%.moon$",
output_ext: ".lua"
show_timings: os.getenv "TIME"
diff: {
tool: "git diff --no-index --color" --color-words"
filter: (str) ->
-- strip the first four lines
table.concat [l for l in *([line for line in str\gmatch("[^\n]+")])[5,]], "\n"
}
}
timings = {}
gettime = nil
pcall ->
require "socket"
gettime = socket.gettime
gettime or= os.clock
benchmark = (fn) ->
if gettime
start = gettime!
res = {fn!}
gettime! - start, unpack res
else
nil, fn!
read_all = (fname) ->
if f = io.open(fname, "r")
with f\read "*a"
f\close!
diff_file = (a_fname, b_fname) ->
out = io.popen(options.diff.tool .. " ".. a_fname .. " " .. b_fname, "r")\read "*a"
if options.diff.filter
out = options.diff.filter out
out
diff_str = (expected, got) ->
a_tmp = os.tmpname! .. ".expected"
b_tmp = os.tmpname! .. ".got"
with io.open(a_tmp, "w")
\write expected
\close!
with io.open(b_tmp, "w")
\write got
\close!
with diff_file a_tmp, b_tmp
os.remove a_tmp
os.remove b_tmp
string_assert = (expected, got) ->
if expected != got
diff = diff_str expected, got
error "string equality assert failed" if os.getenv "HIDE_DIFF"
error "string equality assert failed:\n" .. diff
input_fname = (base) ->
options.in_dir .. "/" .. base .. ".moon"
output_fname = (base) ->
options.out_dir .. "/" .. base .. options.output_ext
inputs = for file in lfs.dir options.in_dir
with match = file\match options.input_pattern
continue unless match
table.sort inputs
describe "input tests", ->
local parse, compile
with_dev ->
parse = require "moonscript.parse"
compile = require "moonscript.compile"
for name in *inputs
input = input_fname name
it input .. " #input", ->
file_str = read_all input_fname name
parse_time, tree, err = benchmark -> parse.string file_str
error err if err
compile_time, code, err, pos = benchmark -> compile.tree tree
error compile.format_error err, pos, file_str unless code
table.insert timings, {name, parse_time, compile_time}
if os.getenv "BUILD"
with io.open output_fname(name), "w"
\write code
\close!
else
expected_str = read_all output_fname name
error "Test not built: " .. input_fname(name) unless expected_str
string_assert expected_str, code
nil
if options.show_timings
teardown ->
format_time = (sec) -> ("%.3fms")\format(sec*1000)
col_width = math.max unpack [#t[1] for t in *timings]
print "\nTimings:"
total_parse, total_compile = 0, 0
for tuple in *timings
name, parse_time, compile_time = unpack tuple
name = name .. (" ")\rep col_width - #name
total_parse += parse_time
total_compile += compile_time
print " * " .. name,
"p: " .. format_time(parse_time),
"c: " .. format_time(compile_time)
print "\nTotal:"
print " parse:", format_time total_parse
print " compile:", format_time total_compile
| 23.6 | 85 | 0.616828 |
5ba1d2bfe606e7f993c15379ba81ed4a0cc957bd | 131 | package.path = "../?.lua;" .. package.path
export test = (klass) -> v! for k, v in pairs(klass.__base) when string.find(k, "test$") | 65.5 | 88 | 0.633588 |
1add34eae61dbab5ed92c5d6335da4525239825a | 1,234 | html_builer = {
"text"
"raw"
"widget"
"element"
"html_5"
"capture"
'area'
"applet"
'base'
'br'
'col'
'embed'
'frame'
'hr'
'img'
'input'
'link'
'meta'
'param'
'a'
'abbr'
'acronym'
'address'
'article'
'aside'
'audio'
'b'
'bdo'
'big'
'blockquote'
'body'
'button'
'canvas'
'caption'
'center'
'cite'
'code'
'colgroup'
'command'
'datalist'
'dd'
'del'
'details'
'dfn'
'dialog'
'div'
'dl'
'dt'
'em'
'fieldset'
'figure'
'footer'
'form'
'frameset'
'h1'
'h2'
'h3'
'h4'
'h5'
'h6'
'head'
'header'
'hgroup'
'html'
'i'
'iframe'
'ins'
'keygen'
'kbd'
'label'
'legend'
'li'
'map'
'mark'
'meter'
'nav'
'noframes'
'noscript'
'object'
'ol'
'optgroup'
'option'
'p'
'pre'
'progress'
'q'
'ruby'
'rt'
'rp'
's'
'samp'
'script'
'section'
'select'
'small'
'source'
'span'
'strike'
'strong'
'style'
'sub'
'sup'
'table'
'tbody'
'td'
'textarea'
'tfoot'
'th'
'thead'
'time'
'title'
'tr'
'tt'
'u'
'ul'
'var'
'video'
}
{
whitelist_globals: {
["."]: {"ngx"}
["lapis/console/views"]: html_builer
}
}
| 8.226667 | 40 | 0.465964 |
5dc2d8ea30415deabf8920d87729ccc809d63810 | 1,066 | import readproc from require 'mon.util'
->
data = readproc 'free -hw'
result = {}
add = (name, tab) ->
for k, v in pairs tab
result["#{name}:#{k}"] =
value: tonumber string.match v, '[0-9.]+'
unit: string.gsub (string.match v, '[a-zA-Z]+'), 'i', ''
min: 0
total, used, free, shared, buffers, cache, available = string.match data, 'Mem:%s+(%S+)%s+(%S+)%s+(%S+)%s+(%S+)%s+(%S+)%s+(%S+)%s+(%S+)'
add 'ram', :total, :used, :free, :shared, :buffers, :cache, :available
total, used, free = string.match data, 'Swap:%s+(%S+)%s+(%S+)%s+(%S+)'
add 'swap', :total, :used, :free
result['ram:total'].name = "RAM - Total"
result['ram:free'].name = "RAM - Free"
result['ram:available'].name = "RAM - Available"
result['ram:used'].name = "RAM - Used (user)"
result['ram:buffers'].name = "RAM - Used (buffers)"
result['ram:cache'].name = "RAM - Used (cache)"
result['ram:shared'].name = "RAM - Used (shared)"
result['swap:total'].name = "Swap - Total"
result['swap:free'].name = "Swap - Free"
result['swap:used'].name = "Swap - Used"
result
| 33.3125 | 137 | 0.585366 |
99d157472d836a9e8aea7b77627dc122e794e7a2 | 325 |
hi = "hello"
hello = "what the heckyes"
print hi
umm = 'umm'
here, another = "yeah", 'world'
aye = "YU'M"
you '"hmmm" I said'
print aye, you
another = [[ hello world ]]
hi_there = [[
hi there
]]
well = [==[ "helo" ]==]
hola = [===[
eat noots]===]
mm = [[well trhere]]
x = "\\"
x = "a\\b"
x = "\\\n"
x = "\""
| 9.558824 | 31 | 0.489231 |
b84388ac1f5deab8fa98f0af31c34e7ce2a8629f | 725 | class PathItem extends Item
getIntersections: (path) =>
-- First check the bounds of the two paths. If they don't intersect,
-- we don't need to iterate through their curves.
return [] if !@getBounds()\touches(path\getBounds())
locations = []
curves1 = @getCurves()
curves2 = path\getCurves()
length2 = curves2.length
values2 = []
i = 0
while i < length2
values2[i] = curves2[i]\getValues()
i++
i = 0
l = curves1.length
while i < l
curve1 = curves1[i]
values1 = curve1\getValues()
j = 0
while j < length2
Curve\getIntersections values1, values2[j], curve1, curves2[j], locations
j++
i++
locations
| 24.166667 | 81 | 0.587586 |
fd4e8ceaf89524b9ecf39e65e3fc0e282a4ce5d3 | 39 | export PILE_OF_CODE_BASE = (...) .. '.' | 39 | 39 | 0.589744 |
f4e0169c5762f89c19aa7e662ae0d989c33f9a2a | 1,006 | describe "helpers.apply_template", ->
apply_template = require("shipwright.transform.helpers").apply_template
it "accepts strings and numbers", ->
x = {
str: "my_string"
int: 10,
float: 99.99,
bool: false,
missing: nil -- wont convert
}
template = "$missing, $str, $int, $float, $bool"
value = apply_template(template, x)
assert.matches("$missing, my_string, 10, 99.99, false", value)
it "calls tostring internally", ->
x = {a: 1}
setmetatable(x, {
__tostring: (v) ->
"to_string"
})
template = "$rep"
value = apply_template(template, {
rep: x
})
assert.matches("to_string", value)
it "warns on tables with no tostring", ->
x = {a: 1}
template = "$rep"
assert.has_error(->
apply_template(template, {
rep: x
}))
it "warns on raw functions", ->
x = ->
template = "$rep"
assert.has_error(->
value = apply_template(template, {
rep: x
}))
| 22.863636 | 73 | 0.565606 |
6eefbfc3a713e3290bf24bd4b9a61227d02f9612 | 6,502 |
--
-- Copyright (C) 2017-2019 DBot
-- Permission is hereby granted, free of charge, to any person obtaining a copy
-- of this software and associated documentation files (the "Software"), to deal
-- in the Software without restriction, including without limitation the rights
-- to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies
-- of the Software, and to permit persons to whom the Software is furnished to do so,
-- subject to the following conditions:
-- The above copyright notice and this permission notice shall be included in all copies
-- or substantial portions of the Software.
-- THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED,
-- INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR
-- PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE
-- FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR
-- OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER
-- DEALINGS IN THE SOFTWARE.
DLib.RegisterAddonName('PPM/2')
mat_dxlevel = GetConVar('mat_dxlevel')
timer.Create 'PPM2.Unsupported', 600, 4, ->
if mat_dxlevel\GetInt() >= 90
timer.Remove 'PPM2.Unsupported'
return
Derma_Message('gui.ppm2.dxlevel.not_supported', 'gui.ppm2.dxlevel.toolow')
timer.Create 'PPM2.ModelChecks', 1, 0, ->
for _, task in ipairs PPM2.NetworkedPonyData.RenderTasks
ent = task.ent
if IsValid(ent)
ent.__cachedIsPony = ent\IsPony()
for _, ply in ipairs player.GetAll()
if not ply\IsDormant()
ply.__cachedIsPony = ply\IsPony()
ponydata = ply\GetPonyData()
if ply.__cachedIsPony
if (not ponydata or ponydata\GetHideWeapons()) and not hook.Run('SuppressPonyWeaponsHide', ply) and not ply.RenderOverride
for _, wep in ipairs ply\GetWeapons()
if wep
if not hook.Run('ShouldDrawPonyWeapon', ply, wep) and (not wep.ShouldPonyDraw or not wep\ShouldPonyDraw(ply))
wep\SetNoDraw(true)
wep.__ppm2_weapon_hit = true
elseif wep.__ppm2_weapon_hit
wep\SetNoDraw(false)
ply.__ppm2_weapon_hit = false
else
for _, wep in ipairs ply\GetWeapons()
if wep and wep.__ppm2_weapon_hit
wep\SetNoDraw(false)
ply.__ppm2_weapon_hit = false
PlayerRespawn = ->
ent = net.ReadEntity()
return if not IsValid(ent)
return if not ent\GetPonyData()
ent\GetPonyData()\PlayerRespawn()
PlayerDeath = ->
ent = net.ReadEntity()
return if not IsValid(ent)
return if not ent\GetPonyData()
ent\GetPonyData()\PlayerDeath()
lastDataSend = 0
lastDataReceived = 0
net.Receive 'PPM2.PlayerRespawn', PlayerRespawn
net.Receive 'PPM2.PlayerDeath', PlayerDeath
concommand.Add 'ppm2_require', ->
net.Start('PPM2.Require')
net.SendToServer()
PPM2.Message 'Requesting pony data...'
concommand.Add 'ppm2_reload', ->
return if lastDataSend > RealTimeL()
lastDataSend = RealTimeL() + 10
instance = PPM2.GetMainData()
newData = instance\CreateNetworkObject()
newData\Create()
instance\SetNetworkData(newData)
PPM2.Message 'Sending pony data to server...'
if not IsValid(LocalPlayer())
times = 0
hook.Add 'Think', 'PPM2.RequireData', ->
ply = LocalPlayer()
return if not IsValid(ply)
times += 1 if ply\GetVelocity()\Length() > 5
return if times < 200
hook.Remove 'Think', 'PPM2.RequireData'
hook.Add 'KeyPress', 'PPM2.RequireData', ->
hook.Remove 'KeyPress', 'PPM2.RequireData'
RunConsoleCommand('ppm2_reload')
timer.Simple 3, -> RunConsoleCommand('ppm2_require')
else
timer.Simple 0, ->
RunConsoleCommand('ppm2_reload')
timer.Simple 3, -> RunConsoleCommand('ppm2_require')
PPM_HINT_COLOR_FIRST = Color(255, 255, 255)
PPM_HINT_COLOR_SECOND = Color(0, 0, 0)
net.receive 'PPM2.EditorCamPos', ->
ply = net.ReadPlayer()
return if not ply\IsValid()
pVector, pAngle = net.ReadVector(), net.ReadAngle()
if not IsValid(ply.__ppm2_cam)
ply.__ppm2_cam = ClientsideModel('models/tools/camera/camera.mdl', RENDERGROUP_BOTH)
ply.__ppm2_cam\SetModelScale(0.4)
ply.__ppm2_cam.RenderOverride = =>
return if not ply.__ppm2_campos_lerp
render.DrawLine(ply.__ppm2_campos_lerp, ply\EyePos(), color_white, true)
@DrawModel()
hook.Add 'Think', ply.__ppm2_cam, =>
return @Remove() if not IsValid(ply) or not ply\GetNWBool('PPM2.InEditor')
findPos, findAng = LocalToWorld(pVector, pAngle, ply\GetPos(), ply\EyeAngles())
ply.__ppm2_campos_lerp = Lerp(RealFrameTime() * 22, ply.__ppm2_campos_lerp or findPos, findPos)
@SetPos(ply.__ppm2_campos_lerp)
@SetAngles(findAng)
hook.Add 'HUDPaint', 'PPM2.EditorStatus', ->
lply = LocalPlayer()
lpos = lply\EyePos()
editortext = DLib.i18n.localize('tip.ppm2.in_editor')
for ply in *player.GetAll()
if ply ~= lply and ply\GetNWBool('PPM2.InEditor')
pos = ply\EyePos()
dist = pos\Distance(lpos)
if dist < 250
pos.z += 10
alpha = (1 - dist\progression(0, 250))\max(0.1) * 255
{:x, :y} = pos\ToScreen()
draw.DrawText(editortext, 'HudHintTextLarge', x, y, Color(0, 0, 0, alpha), TEXT_ALIGN_CENTER)
draw.DrawText(editortext, 'HudHintTextLarge', x + 1, y + 1, Color(255, 255, 255, alpha), TEXT_ALIGN_CENTER)
if ply.__ppm2_campos
pos = Vector(ply.__ppm2_campos)
dist = pos\Distance(lpos)
if dist < 250
pos.z += 9
alpha = (1 - dist\progression(0, 250))\max(0.1) * 255
{:x, :y} = pos\ToScreen()
text = DLib.i18n.localize('tip.ppm2.camera', ply\Nick())
draw.DrawText(text, 'HudHintTextLarge', x, y, Color(0, 0, 0, alpha), TEXT_ALIGN_CENTER)
draw.DrawText(text, 'HudHintTextLarge', x + 1, y + 1, Color(255, 255, 255, alpha), TEXT_ALIGN_CENTER)
concommand.Add 'ppm2_cleanup', ->
for _, ent in ipairs ents.GetAll()
if ent.isPonyPropModel and not IsValid(ent.manePlayer)
ent\Remove()
PPM2.Message('All unused models were removed')
timer.Create 'PPM2.ModelCleanup', 60, 0, ->
for _, ent in ipairs ents.GetAll()
if ent.isPonyPropModel and not IsValid(ent.manePlayer)
ent\Remove()
cvars.AddChangeCallback('mat_picmip', (->
timer.Simple 0, (->
RunConsoleCommand('ppm2_require')
RunConsoleCommand('ppm2_reload')
)
), 'ppm2')
cvars.AddChangeCallback('ppm2_cl_hires_generic', (->
timer.Simple 0, (->
RunConsoleCommand('ppm2_require')
RunConsoleCommand('ppm2_reload')
)
), 'ppm2')
cvars.AddChangeCallback('ppm2_cl_hires_body', (->
timer.Simple 0, (->
RunConsoleCommand('ppm2_require')
RunConsoleCommand('ppm2_reload')
)
), 'ppm2')
return
| 33.005076 | 126 | 0.716549 |
aae9d54eac3b187908ccb2345274703159284730 | 839 | -- hmac auth
util = require "mooncrafts.util"
crypto = require "mooncrafts.crypto"
import string_slit from util
import base64_encode, base64_decode from crypto
import unpack from table
local *
sign = (key, data, algo=crypto.sha256) -> base64_encode(crypto.hmac(key, data, algo).digest())
verify = (key, data, algo=crypto.sha256) -> data == sign(key, data, algo)
sign_custom = (key, data="", ttl=600, ts=os.time(), algo=crypto.sha256) -> "#{ts}:#{ttl}:#{data}:" .. sign("#{ts}:#{ttl}:#{data}")
-- reverse the logic above to hmac verify
verify_custom = (key, payload, algo=crypto.sha256) ->
ts, ttl, data = unpack string_split(payload, ":")
-- validate expiration
return { valid: false, timeout: true } if (ts < (os.time() - tonumber(str[2])))
-- validate
{ valid: (sign(key, data, ttl, ts) == payload) }
{ :sign, :verify }
| 32.269231 | 130 | 0.665077 |
77795418844f2467ef3624f6705d80fee89e9e92 | 1,106 | -- Copyright 2014-2015 The Howl Developers
-- License: MIT (see LICENSE.md at the top-level directory of the distribution)
ffi = require 'ffi'
jit = require 'jit'
require 'ljglibs.cdefs.gtk'
core = require 'ljglibs.core'
gobject = require 'ljglibs.gobject'
require 'ljglibs.gtk.misc'
ffi_string = ffi.string
gc_ptr = gobject.gc_ptr
C = ffi.C
jit.off true, true
core.define 'GtkLabel < GtkMisc', {
properties: {
angle: 'gdouble'
cursor_position: 'gint'
ellipsize: 'PangoEllipsizeMode'
justify: 'GtkJustification'
label: 'gchar*'
lines: 'gint'
max_width_chars: 'gint'
mnemonic_keyval: 'guint'
mnemonic_widget: 'GtkWidget*'
pattern: 'gchar*'
selectable: 'gboolean'
selection_bound: 'gint'
single_line_mode: 'gboolean'
track_visited_links: 'gboolean'
use_markup: 'gboolean'
use_underline: 'gboolean'
width_chars: 'gint'
wrap: 'gboolean'
text:
get: => ffi_string C.gtk_label_get_text @
set: (text) => C.gtk_label_set_text @, text
}
new: (str) ->
gc_ptr C.gtk_label_new str
}, (spec, ...) -> spec.new ...
| 23.041667 | 79 | 0.669982 |
c61b052b8accb2d2b94067b335b2e0ebb11edd3f | 698 | export isnumber = (o using nil) -> type(o) == "number"
export isstring = (o using nil) -> type(o) == "string"
export istable = (o using nil) -> type(o) == "table"
table.GetKeys = (items using nil) -> [key for key, value in pairs items]
export Msg = io.write
export PrintTable = (t, indent=0, done={} using nil) ->
keys = table.GetKeys t
table.sort(keys, (a, b) ->
if isnumber(a) and isnumber(b)
return a < b
return tostring(a) < tostring(b)
)
for key in *keys
value = t[ key ]
Msg string.rep("\t", indent)
if istable(value) and not done[ value ]
done[value] = true
Msg "#{key}:\n"
PrintTable value, indent + 2, done
else
Msg "#{key}\t=\t"
Msg "#{value}\n"
| 23.266667 | 72 | 0.610315 |
a50ebaf201fc5336663afdb8140d2f4eddd27506 | 617 | -- Copyright 2012-2015 The Howl Developers
-- License: MIT (see LICENSE.md at the top-level directory of the distribution)
import PropertyTable from howl.aux
completions = {}
register = (options = {}) ->
error 'Missing parameter `name` for completion', 2 if not options.name
error 'Missing parameter `factory` for completion', 2 if not options.factory
completions[options.name] = options
unregister = (name) ->
completions[name] = nil
mod = setmetatable {
:register,
:unregister
list: get: -> [c for _, c in pairs completions]
}, {
__index: (key) => completions[key]
}
return PropertyTable mod
| 23.730769 | 79 | 0.709887 |
0a46ac8e7bd24e35aeccfd69375aa71a9c33a766 | 3,718 | lapis = require "lapis"
db = require "lapis.db"
import Resources from require "models"
import trim_filter from require "lapis.util"
import validate, validate_functions from require "lapis.validate"
-- Default number of results to show
DEFAULT_SHOW_AMOUNT = 15
-- Custom validator for bounding input between (inclusive) certain values
validate_functions.between = (input, lower, upper) ->
input = tonumber(input)
if not input
return false, "%s is not a number"
(input >= lower) and (input <= upper), "%s must be between " .. lower .. " and " .. upper
class SearchApplication extends lapis.Application
[search: "/search"]: =>
trim_filter @params
hasSearchArguments = false
@errors = validate @params, {
{ "name", exists: true }
{ "type", optional: true, one_of: {"script", "map", "gamemode", "misc", "any"} }
-- { "author", optional: true }
{ "showAmount", exists: true, is_integer: true, between: {1, 100} }
}, keys: true
if @errors
if @errors.showAmount
@params.showAmount = DEFAULT_SHOW_AMOUNT
@errors.showAmount = nil
local hasErrors
if @errors.name
hasErrors = true
@errors = nil
@not_searched = true
else
for _ in pairs @errors
hasErrors = true
break
return render: true if hasErrors
searchingDescription = (@params.description == "true") and true or false
@params.description = searchingDescription and "true" or nil
similarityMode = searchingDescription and "description" or "name"
-- We might not have either param.
unless @params[similarityMode]
@not_searched = true
return render: true
-- create our fields and query objects
query, fields = " WHERE 1=1", "resources.*"
-- checking the resource type
if type = @params.type
-- where it is the same type, and type is not "any"
query..= db.interpolate_query " AND (type = ?)", Resources.types[type] unless type == "any"
-- checking the resource author
if author = @params.author
-- we need to access these tables
query = ", users, resource_admins" .. query
-- beginning of user check query
query ..= " AND ( "
-- check creator
query ..= db.interpolate_query "(resources.creator = users.id)"
-- check inside resource_admins
query ..= db.interpolate_query " OR (resource_admins.user_confirmed AND resource_admins.user = users.id AND resource_admins.resource = resources.id)"
-- end of user check query
query ..= " )"
-- add the actual username check
query ..= db.interpolate_query " AND (users.username % ?)", author
unless searchingDescription -- WHEN SEARCHING INSIDE NAMES
-- Get the total similarity of both names (0 to 2 value)
fields..= db.interpolate_query ", (similarity(name, ?) + similarity(longname, ?)) as similarity", @params.name, @params.name
-- Where names similar
query ..= db.interpolate_query " AND ((name % ?) or (longname % ?))", @params.name, @params.name
else -- WHEN SEARCHING INSIDE DESCRIPTION
-- Get the similarity of just the description
fields..= db.interpolate_query ", similarity(description, ?)", @params.name
-- Find where given description is similarish
query ..= db.interpolate_query " AND (description <-> ?) < 0.9", @params.name
-- Prevent duplicates
query ..= " GROUP BY resources.id"
-- Order by similarity
query ..= " ORDER BY similarity DESC"
-- Limit the number of results returned
query..= " LIMIT " .. tonumber(@params.showAmount) or DEFAULT_SHOW_AMOUNT
-- pull the list with our query and fields
@resourceList = Resources\select query, :fields
-- let's get rendering!
render: true | 34.110092 | 153 | 0.664605 |
0b034d57c886193f8ceafd82726e147deb9aa674 | 1,408 |
ngx_stack = require "lapis.spec.stack"
describe "nginx.context", ->
before_each ->
package.loaded["lapis.nginx.context"] = nil
ngx_stack.push { ctx: {} }
after_each ->
ngx_stack.pop!
it "should add a callback", ->
import after_dispatch from require "lapis.nginx.context"
fn1 = -> 1
fn2 = -> 1
after_dispatch fn1
assert.same { after_dispatch: fn1 }, ngx.ctx
after_dispatch fn2
assert.same { after_dispatch: {fn1, fn2} }, ngx.ctx
it "should run no callbacks", ->
import run_after_dispatch from require "lapis.nginx.context"
run_after_dispatch!
it "should run one callback", ->
import run_after_dispatch, after_dispatch from require "lapis.nginx.context"
local ran
after_dispatch (a, b) ->
assert.same "hello", a
assert.same "world", b
ran = true
run_after_dispatch "hello", "world"
assert.same true, ran
it "should run multiple callbacks", ->
import after_dispatch, run_after_dispatch from require "lapis.nginx.context"
local first, second
fn1 = (a, b) ->
assert.same "hello", a
assert.same "world", b
first = true
fn2 = (a, b) ->
assert.same "hello", a
assert.same "world", b
second = true
after_dispatch fn1
after_dispatch fn2
run_after_dispatch "hello", "world"
assert.same true, first
assert.same true, second
| 22.709677 | 80 | 0.641335 |
2f180984d6bd81af7ca8d6535ad584c32a338883 | 953 | export modinfo = {
type: "command"
desc: "Find a sound"
alias: {"findsound", "fsnd"}
func: (Msg,Speaker) ->
procSnd = (tbl) ->
for i, v in pairs(tbl)
if v\IsA("Sound")
if Msg == "del"
v.Pitch = 0
v.Volume = 0
v.SoundId = ""
elseif Msg == "extinfo"
Output(string.format("ID:%s;Furunemu;%s", v.SoundId, v\GetFullName()),{Colors.Green})
elseif Msg == "noheadext"
if v.Parent.Name ~= "Head"
Output(string.format("ID:%s;Furunemu;%s", v.SoundId, v\GetFullName()),{Colors.Green})
elseif Msg == "nohead"
if v.Parent.Name ~= "Head"
Output(string.format("ID:%s", v.SoundId),{Colors.Green})
else
Output(string.format("ID:%s", v.SoundId),{Colors.Green})
procSnd(getRecursiveChildren(workspace))
procSnd(getRecursiveChildren(game\service"SoundService"))
procSnd(getRecursiveChildren(game\service"Players"))
procSnd(getRecursiveChildren(game\service"Lighting"))
} | 34.035714 | 92 | 0.632739 |
396686d615841e71b78a7c814bf85c0f8ff3c752 | 49 | with require "moonscript.base"
.insert_loader!
| 16.333333 | 30 | 0.77551 |
7aa982a2bfb44c5950274e27319620f78a4423ea | 8,973 |
url = require "socket.url"
json = require "cjson"
import concat, insert from table
unpack = unpack or table.unpack
import floor from math
date = require "date"
local *
-- todo: consider renaming to url_escape/url_unescape
unescape = do
u = url.unescape
(str) -> (u str)
escape = do
e = url.escape
(str) -> (e str)
escape_pattern = do
punct = "[%^$()%.%[%]*+%-?%%]"
(str) -> (str\gsub punct, (p) -> "%"..p)
inject_tuples = (tbl) ->
for tuple in *tbl
tbl[tuple[1]] = tuple[2] or true
parse_query_string = do
import C, P, S, Ct from require "lpeg"
char = (P(1) - S("=&"))
chunk = C char^1
chunk_0 = C char^0
tuple = Ct(chunk / unescape * "=" * (chunk_0 / unescape) + chunk)
query = S"?#"^-1 * Ct tuple * (P"&" * tuple)^0
(str) ->
with out = query\match str
inject_tuples out if out
-- todo: handle nested tables
-- takes either { hello: "world"} or { {"hello", "world"} }
encode_query_string = (t, sep="&") ->
_escape = ngx and ngx.escape_uri or escape
i = 0
buf = {}
for k,v in pairs t
if type(k) == "number" and type(v) == "table"
{k,v} = v
v = true if v == nil -- symmetrical with parse
if v == false
continue
buf[i + 1] = _escape k
if v == true
buf[i + 2] = sep
i += 2
else
buf[i + 2] = "="
buf[i + 3] = _escape v
buf[i + 4] = sep
i += 4
buf[i] = nil
concat buf
parse_content_disposition = do
import C, R, P, S, Ct, Cg from require "lpeg"
white = S" \t"^0
token = C (R("az", "AZ", "09") + S"._-")^1
value = (token + P'"' * C((1 - S('"'))^0) * P'"') / unescape
param = Ct white * token * white * P"=" * white * value
patt = Ct Cg(token, "type") * (white * P";" * param)^0
(str) ->
with out = patt\match str
inject_tuples out if out
parse_cookie_string = (str) ->
return {} unless str
{unescape(key), unescape(value) for key, value in str\gmatch("([^=%s]*)=([^;]*)")}
slugify = (str) ->
(str\gsub("[%s_]+", "-")\gsub("[^%w%-]+", "")\gsub("-+", "-"))\lower!
-- TODO: make this not suck
underscore = (str) ->
words = [word\lower! for word in str\gmatch "%L*%l+"]
concat words, "_"
camelize = do
patt = "[^#{escape_pattern"_"}]+"
(str) ->
concat [part\sub(1,1)\upper! .. part\sub(2) for part in str\gmatch patt]
uniquify = (list) ->
seen = {}
return for item in *list
continue if seen[item]
seen[item] = true
item
trim = (str) ->
str = tostring str
if #str > 200
str\gsub("^%s+", "")\reverse()\gsub("^%s+", "")\reverse()
else
str\match "^%s*(.-)%s*$"
trim_all = (tbl) ->
for k,v in pairs tbl
if type(v) == "string"
tbl[k] = trim v
tbl
-- remove empty string (all whitespace) values from table
-- optionally apply a key filter with second arg
-- set the value to replace empty strings with empty_val
trim_filter = (tbl, keys, empty_val) ->
key_filter tbl, unpack keys if keys
for k,v in pairs tbl
if type(v) == "string"
trimmed = trim v
tbl[k] = if trimmed == "" then empty_val else trimmed
tbl
-- remove all keys except those passed in
key_filter = (tbl, ...) ->
set = {val, true for val in *{...}}
for k,v in pairs tbl
tbl[k] = nil unless set[k]
tbl
encodable_userdata = {
[json.null]: true
}
if json.empty_array
encodable_userdata[json.empty_array] = true
json_encodable = (obj, seen={}) ->
switch type obj
when "table"
unless seen[obj]
seen[obj] = true
{ k, json_encodable(v) for k,v in pairs(obj) when type(k) == "string" or type(k) == "number" }
when "userdata"
encodable_userdata[obj] and obj
when "function", "thread"
nil
else
obj
to_json = (obj) -> json.encode json_encodable obj
from_json = (obj) -> json.decode obj
-- {
-- [path] = "/test"
-- [scheme] = "http"
-- [host] = "localhost.com"
-- [port] = "8080"
-- [fragment] = "yes"
-- [query] = "hello=world"
-- }
build_url = (parts) ->
out = parts.path or ""
out ..= "?" .. parts.query if parts.query
out ..= "#" .. parts.fragment if parts.fragment
if host = parts.host
host = "//" .. host
if parts.port
host ..= ":" .. parts.port
if parts.scheme
if parts.scheme != ""
host = parts.scheme .. ":" .. host
if parts.path and out\sub(1,1) != "/"
out = "/" .. out
out = host .. out
out
date_diff = (later, sooner) ->
if later < sooner
sooner, later = later, sooner
diff = date.diff later, sooner
times = {}
days = floor diff\spandays()
if days >= 365
years = floor diff\spandays() / 365
times.years = years
insert times, {"years", years}
diff\addyears -years
days -= years * 365
if days >= 1
times.days = days
insert times, {"days", days}
diff\adddays -days
hours = floor diff\spanhours()
if hours >= 1
times.hours = hours
insert times, {"hours", hours}
diff\addhours -hours
minutes = floor diff\spanminutes()
if minutes >= 1
times.minutes = minutes
insert times, {"minutes", minutes}
diff\addminutes -minutes
seconds = floor diff\spanseconds()
if seconds >= 1 or not next(times)
times.seconds = seconds
insert times, {"seconds", seconds}
diff\addseconds -seconds
times, true
time_ago = (time) ->
date_diff date(true), date(time)
time_ago_in_words = do
singular = {
years: "year"
days: "day"
hours: "hour"
minutes: "minute"
seconds: "second"
}
(time, parts=1, suffix="ago") ->
ago = type(time) == "table" and time or time_ago time
out = ""
i = 1
while parts > 0
parts -= 1
segment = ago[i]
i += 1
break unless segment
val = segment[2]
word = val == 1 and singular[segment[1]] or segment[1]
out ..= ", " if #out > 0
out ..= val .. " " .. word
if suffix and suffix != ""
out .. " " .. suffix
else
out
title_case = (str) ->
(str\gsub "%S+", (chunk) ->
chunk\gsub "^.", string.upper)
autoload = do
try_require = (mod_name) ->
local mod
success, err = pcall ->
mod = require mod_name
if not success and not err\match "module '#{mod_name}' not found:"
error err
mod
(...) ->
prefixes = {...}
last = prefixes[#prefixes]
t = if type(last) == "table"
prefixes[#prefixes] = nil
last
else
{}
assert next(prefixes), "missing prefixes for autoload"
setmetatable t, __index: (mod_name) =>
local mod
for prefix in *prefixes
mod = try_require prefix .. "." .. mod_name
unless mod
mod = try_require prefix .. "." .. underscore mod_name
break if mod
@[mod_name] = mod
mod
auto_table = (fn) ->
setmetatable {}, __index: (name) =>
result = fn!
getmetatable(@).__index = result
result[name]
mixin_class = do
empty_func = string.dump ->
is_filled_function = (fn) ->
fn and string.dump(fn) != empty_func
combine_before = (existing, new) ->
(...) ->
new ...
existing ...
-- target: a class, to_mix: another class
(target, to_mix, combine_methods=combine_before) ->
base = target.__base
-- copy members
for member_name, member_val in pairs to_mix.__base
continue if member_name\match "^__"
if existing = base[member_name]
if type(existing) == "function" and type(member_val) == "function"
base[member_name] = combine_methods existing, member_val
continue
base[member_name] = member_val
-- constructor
new_ctor = to_mix.__init
if is_filled_function new_ctor
old_ctor = target.__init
if is_filled_function old_ctor
-- combine constructors
target.__init = (...) ->
old_ctor ...
new_ctor ...
else
-- replace
target.__init = new_ctor
-- helper for mixin_class that gets parent scope's self as target
mixin = do
get_local = (search_name, level=1) ->
level += 1
i = 1
while true
name, val = debug.getlocal level, i
break unless name
if name == search_name
return val
i += 1
(...) ->
target = get_local "self", 2
for to_mix in *{...}
mixin_class target, to_mix
get_fields = (obj, key, ...) ->
return unless obj
return unless key
obj[key], get_fields obj, ...
singularize = (name) ->
-- TODO: not very good
out = name\gsub("ies$", "y")\gsub("oes$", "o")
out = if out\sub(-4, -1) == "sses"
out\gsub("sses$", "ss")
else
out\gsub("s$", "")
out
{ :unescape, :escape, :escape_pattern, :parse_query_string,
:parse_content_disposition, :parse_cookie_string, :encode_query_string,
:underscore, :slugify, :uniquify, :trim, :trim_all, :trim_filter,
:key_filter, :to_json, :from_json, :json_encodable, :build_url, :time_ago,
:time_ago_in_words, :camelize, :title_case, :autoload, :auto_table,
:mixin_class, :mixin, :get_fields, :singularize, :date_diff }
| 22.100985 | 102 | 0.577065 |
04038a988d5dfbf40d52de2de1acf49e56c9f545 | 478 | //0.01234 -> 0.01
//0.12345 -> 0.12
//1.23456 -> 1.23
//12.3456 -> 12.3
//123.456 -> 123
//1234.56 -> 1.2k
//12345.6 -> 12k
//1234567 -> 123k
num =>
u = digits => (slc (nts num) 0 digits)
k = digits => (con (slc (nts (div num 1000)) 0 digits) "k")
(if (ltn num 100)
(u 4)
(if (ltn num 1000)
(u 3)
(if (ltn num 10000)
(k 3)
(if (ltn num 100000)
(k 2)
(if (ltn num 1000000)
(k 3)
">1m")))))
| 19.916667 | 61 | 0.441423 |
51b3f59be5a952b9c8e6f916f879638931a389f5 | 115 | require "base/grid"
export *
grid_from_config = (config) ->
return Grid config.width, config.height, config.tile | 19.166667 | 53 | 0.747826 |
79c66e6a0daf779124a95173bad84633de7401dc | 257 | require 'idiot'
-- buzzer
buzzer = pin 1
beep = -> close buzzer, for: seconds(1)
-- setting timer
every second!, -> toggle pin 4
-- controlling button
led = pin 0
on button(5), (pressed)->
if pressed
beep and open led
else
beep and close led
| 15.117647 | 39 | 0.657588 |
3af8dee68b380cdea342c3411c52bf5d50ea28f9 | 13,408 | [[
README
This file is a library of commonly used functions across all my automation
scripts. This way, if there are errors or updates for any of these functions,
I'll only need to update one file.
The filename is a bit vain, perhaps, but I couldn't come up with anything else.
]]
DependencyControl = require("l0.DependencyControl")
version = DependencyControl{
name: "LibLyger",
version: "2.0.0",
description: "Library of commonly used functions across all of lyger's automation scripts.",
author: "lyger",
url: "http://github.com/TypesettingTools/lyger-Aegisub-Scripts",
moduleName: "lyger.LibLyger",
feed: "https://raw.githubusercontent.com/TypesettingTools/lyger-Aegisub-Scripts/master/DependencyControl.json",
{
"aegisub.util", "karaskel"
}
}
util = version\requireModules!
logger = version\getLogger!
class LibLyger
msgs = {
preproc_lines: {
bad_type: "Error: argument #1 must be either a line object, an index into the subtitle object or a table of indexes; got a %s."
}
}
new: (sub, sel, generate_furigana) =>
@set_script sub, sel, generate_furigana if sub
set_sub: (@sub, @sel = {}, generate_furigana = false) =>
local has_script_info
@script_info, @lines, @dialogue, @dlg_cnt = {}, {}, {}, 0
for i, line in ipairs sub
@lines[i] = line
switch line.class
when "info" then @script_info[line.key] = line.value
when "dialogue"
@dlg_cnt += 1
@dialogue[@dlg_cnt], line.i = line, i
@meta, @styles = karaskel.collect_head @sub, generate_furigana
@preproc_lines @sel
insert_line: (line, i = #@lines + 1) =>
table.insert(@lines, i, line)
@sub.insert(i, line)
preproc_lines: (lines) =>
val_type = type lines
-- indexes into the subtitles object
if val_type == "number"
lines, val_type = {@lines[lines]}, "table"
assert val_type == "table", msgs.preproc_lines.bad_type\format val_type
-- line objects
if lines.raw and lines.section and not lines.duration
karaskel.preproc_line @sub, @meta, @styles, lines
-- tables of line numbers/objects such as the selection
else @preproc_lines line for line in *lines
-- returns a "Lua" portable version of the string
exportstring: (s) -> string.format "%q", s
--Lookup table for the nature of each kind of parameter
param_type: {
alpha: "alpha"
"1a": "alpha"
"2a": "alpha"
"3a": "alpha"
"4a": "alpha"
c: "color"
"1c": "color"
"2c": "color"
"3c": "color"
"4c": "color"
fscx: "number"
fscy: "number"
frz: "angle"
frx: "angle"
fry: "angle"
shad: "number"
bord: "number"
fsp: "number"
fs: "number"
fax: "number"
fay: "number"
blur: "number"
be: "number"
xbord: "number"
ybord: "number"
xshad: "number"
yshad: "number"
pos: "point"
org: "point"
clip: "clip"
}
--Convert float to neatly formatted string
float2str: (f) -> "%.3f"\format(f)\gsub("%.(%d-)0+$","%.%1")\gsub "%.$", ""
--Escapes string for use in gsub
esc: (str) -> str\gsub "([%%%(%)%[%]%.%*%-%+%?%$%^])","%%%1"
[[
Tags that can have any character after the tag declaration: \r, \fn
Otherwise, the first character after the tag declaration must be:
a number, decimal point, open parentheses, minus sign, or ampersand
]]
-- Remove listed tags from the given text
line_exclude: (text, exclude) ->
remove_t = false
new_text = text\gsub "\\([^\\{}]*)", (a) ->
if a\match "^r"
for val in *exclude
return "" if val == "r"
elseif a\match "^fn"
for val in *exclude
return "" if val == "fn"
else
tag = a\match "^[1-4]?%a+"
for val in *exclude
if val == tag
--Hacky exception handling for \t statements
if val == "t"
remove_t = true
return "\\#{a}"
elseif a\match "%)$"
return a\match("%b()") and "" or ")"
else
return ""
return "\\"..a
if remove_t
new_text = new_text:gsub "\\t%b()", ""
return new_text\gsub "{}", ""
-- Remove all tags except the given ones
line_exclude_except: (text, exclude) ->
remove_t = true
new_text = text\gsub "\\([^\\{}]*)", (a) ->
if a\match "^r"
for val in *exclude
return "\\#{a}" if val == "r"
elseif a\match "^fn"
for val in *exclude
return "\\#{a}" if val == "fn"
else
tag = a\match "^[1-4]?%a+"
for val in *exclude
if val == tag
remove_t = false if val == "t"
return "\\#{a}"
if a\match "^t"
return "\\#{a}"
elseif a\match "%)$"
return a\match("%b()") and "" or ")"
else return ""
if remove_t
new_text = new_text\gsub "\\t%b()", ""
return new_text
-- Returns the position of a line
get_default_pos: (line, align_x, align_y) =>
@preproc_lines line
x = {
@script_info.PlayResX - line.eff_margin_r,
line.eff_margin_l,
line.eff_margin_l + (@script_info.PlayResX - line.eff_margin_l - line.eff_margin_r) / 2
}
y = {
@script_info.PlayResY - line.eff_margin_b,
@script_info.PlayResY / 2
line.eff_margin_t
}
return x[align_x], y[align_y]
get_pos: (line) =>
posx, posy = line.text\match "\\pos%(([%d%.%-]*),([%d%.%-]*)%)"
unless posx
posx, posy = line.text\match "\\move%(([%d%.%-]*),([%d%.%-]*),"
return tonumber(posx), tonumber(posy) if posx
-- \an alignment
if align = tonumber line.text\match "\\an([%d%.%-]+)"
return @get_default_pos line, align%3 + 1, math.ceil align/3
-- \a alignment
elseif align = tonumber line.text\match "\\a([%d%.%-]+)"
return @get_default_pos line, align%4,
align > 8 and 2 or align> 4 and 3 or 1
-- no alignment tags (take karaskel values)
else return line.x, line.y
-- Returns the origin of a line
get_org: (line) =>
orgx, orgy = line.text\match "\\org%(([%d%.%-]*),([%d%.%-]*)%)"
if orgx
return orgx, orgy
else return @get_pos line
-- Returns a table of default values
style_lookup: (line) =>
@preproc_lines line
return {
alpha: "&H00&"
"1a": util.alpha_from_style line.styleref.color1
"2a": util.alpha_from_style line.styleref.color2
"3a": util.alpha_from_style line.styleref.color3
"4a": util.alpha_from_style line.styleref.color4
c: util.color_from_style line.styleref.color1
"1c": util.color_from_style line.styleref.color1
"2c": util.color_from_style line.styleref.color2
"3c": util.color_from_style line.styleref.color3
"4c": util.color_from_style line.styleref.color4
fscx: line.styleref.scale_x
fscy: line.styleref.scale_y
frz: line.styleref.angle
frx: 0
fry: 0
shad: line.styleref.shadow
bord: line.styleref.outline
fsp: line.styleref.spacing
fs: line.styleref.fontsize
fax: 0
fay: 0
xbord: line.styleref.outline
ybord: line.styleref.outline
xshad: line.styleref.shadow
yshad: line.styleref.shadow
blur: 0
be: 0
}
-- Modify the line tables so they are split at the same locations
match_splits: (line_table1, line_table2) ->
for i=1, #line_table1
text1 = line_table1[i].text
text2 = line_table2[i].text
insert = (target, text, i) ->
for j = #target, i+1, -1
target[j+1] = target[j]
target[i+1] = tag: "{}", text: target[i].text\match "#{LibLyger.esc(text)}(.*)"
target[i] = tag: target[i].tag, :text
if #text1 > #text2
-- If the table1 item has longer text, break it in two based on the text of table2
insert line_table1, text2, i
elseif #text2 > #text1
-- If the table2 item has longer text, break it in two based on the text of table1
insert line_table2, text1, i
return line_table1, line_table2
-- Remove listed tags from any \t functions in the text
time_exclude: (text, exclude) ->
text = text\gsub "(\\t%b())", (a) ->
b = a
for tag in *exclude
if a\match "\\#{tag}"
b = b\gsub(tag == "clip" and "\\#{tag}%b()" or "\\#{tag}[^\\%)]*", "")
return b
-- get rid of empty blocks
return text\gsub "\\t%([%-%.%d,]*%)", ""
-- Returns a state table, restricted by the tags given in "tag_table"
-- WILL NOT WORK FOR \fn AND \r
make_state_table: (line_table, tag_table) ->
this_state_table = {}
for i, val in ipairs line_table
temp_line_table = {}
pstate = LibLyger.line_exclude_except val.tag, tag_table
for j, ctag in ipairs tag_table
-- param MUST start in a non-alpha character, because ctag will never be \r or \fn
-- If it is, you fucked up
param = pstate\match "\\#{ctag}(%A[^\\{}]*)"
temp_line_table[ctag] = param if param
this_state_table[i] = temp_line_table
return this_state_table
interpolate: (this_table, start_state_table, end_state_table, factor, preset) ->
this_current_state = {}
rebuilt_text = for k, val in ipairs this_table
temp_tag = val.tag
-- Cycle through all the tag blocks and interpolate
for ctag, param in pairs start_state_table[k]
temp_tag = "{}" if #temp_tag == 0
temp_tag = temp_tag\gsub "}", ->
tval_start, tval_end = start_state_table[k][ctag], end_state_table[k][ctag]
tag_type = LibLyger.param_type[ctag]
ivalue = switch tag_type
when "alpha"
util.interpolate_alpha factor, tval_start, tval_end
when "color"
util.interpolate_color factor, tval_start, tval_end
when "number", "angle"
nstart, nend = tonumber(tval_start), tonumber(tval_end)
if tag_type == "angle" and preset.c.flip_rot
nstart %= 360
nend %= 360
ndelta = nend - nstart
if 180 < math.abs ndelta
nstart += ndelta * 360 / math.abs ndelta
nvalue = util.interpolate factor, nstart, nend
nvalue += 360 if tag_type == "angle" and nvalue < 0
LibLyger.float2str nvalue
when "point", "clip" then nil -- not touched by this function
else ""
-- check for redundancy
if this_current_state[ctag] == ivalue
return "}"
this_current_state[ctag] = ivalue
return "\\#{ctag..ivalue}}"
temp_tag .. val.text
return table.concat(rebuilt_text)\gsub "{}", ""
write_table: (my_table, file, indent) ->
indent or= ""
charS, charE = " ", "\n"
--Opening brace of the table
file\write "#{indent}{#{charE}"
for key,val in pairs my_table
file\write switch type key
when "number" then indent..charS
when "string" then table.concat {indent, charS, "[", LibLyger.exportstring(key), "]="}
else "#{indent}#{charS}#{key}="
switch type val
when "table"
file\write charE
write_table val, file, indent..charS
file\write indent..charS
when "string" then file\write LibLyger.exportstring val
when "number" then file\write tostring val
when "boolean" then file\write val and "true" or "false"
file\write ","..charE
-- Closing brace of the table
file\write "#{indent}}#{charE}"
:version
return version\register LibLyger | 36.734247 | 139 | 0.508428 |
6d0612edddb1cabee66a78997ae1b620b6444344 | 5,550 | import bundle, mode, config, Buffer from howl
import File from howl.io
import Editor from howl.ui
describe 'moonscript-mode', ->
local m
local buffer, editor, cursor, lines
setup ->
bundle.load_by_name 'lua'
bundle.load_by_name 'moonscript'
m = mode.by_name 'moonscript'
teardown ->
bundle.unload 'moonscript'
bundle.unload 'lua'
before_each ->
m = mode.by_name 'moonscript'
buffer = Buffer m
editor = Editor buffer
cursor = editor.cursor
lines = buffer.lines
it 'registers a mode', ->
assert.not_nil m
it 'handles .moon files', ->
assert.equal mode.for_file(File 'test.moon'), m
describe 'indentation support', ->
indent_level = 2
before_each ->
buffer.config.indent = indent_level
indents = {
'pending function definitions': {
'foo: =>',
'foo: -> '
}
'pending class declarations': {
'class Frob',
'class Frob ',
'class Frob extends Bar ',
}
'hanging assignments': {
'var = ',
'var: ',
}
'open bracket statements': {
'var = { ',
'var = {',
'other: {',
'some(',
'{'
}
'open conditionals': {
'if foo and bar',
'else',
'elseif (foo and bar) or frob',
'elseif true',
'while foo',
'unless bar',
}
'block statements': {
'switch foo!'
'do',
'for i = 1,10',
'with some.object',
'when conditional',
'foo = if bar and frob'
}
}
non_indents = {
'closed conditionals': {
'if foo then bar',
'elseif foo then bar',
'unless foo then bar',
'bar unless foo',
'else bar',
},
'statement modifiers': {
'foo! if bar',
'foo! unless bar',
}
'miscellaneous non-indenting statements': {
'foo = bar',
'foo = bar frob zed'
'foo = not bar(frob zed)'
'ado',
'fortwith bar'
'motif some'
'iffy!'
'dojo_style foo'
'one for two'
}
}
dedents = {
'block starters': {
'else',
'elseif foo',
}
'block enders': {
'}',
}
}
for desc in pairs indents
context 'indents one level for a line after ' .. desc, ->
for code in *indents[desc]
it "e.g. indents for '#{code}'", ->
buffer.text = code .. '\n'
cursor.line = 2
editor\indent!
assert.equal indent_level, editor.current_line.indentation
it 'disregards empty lines above when determining indent', ->
for desc in pairs indents
for code in *indents[desc]
buffer.text = code .. '\n\n'
cursor.line = 3
editor\indent!
assert.equal indent_level, editor.current_line.indentation
for desc in pairs dedents
context 'dedents one level for a line containing ' .. desc, ->
for code in *dedents[desc]
it "e.g. dedents for '#{code}'", ->
buffer.text = ' foo\n ' .. code
cursor.line = 2
editor\indent!
assert.equal 0, editor.current_line.indentation
for desc in pairs non_indents
context 'keeps the current indent for a line after ' .. desc, ->
for code in *non_indents[desc]
it "e.g. does not indent for '#{code}'", ->
buffer.text = " #{code}\n "
cursor.line = 2
editor\indent!
assert.equal 2, editor.current_line.indentation
it 'enforces the same indent after ","', ->
buffer.text = " foo,\nbar"
cursor.line = 2
editor\indent!
assert.equal 2, editor.current_line.indentation
it 'returns a corrected indent for lines that are on incorrect indentation', ->
buffer.text = ' bar\n one_column_offset'
cursor.line = 2
editor\indent!
assert.equal 2, editor.current_line.indentation
it 'returns the indent for the previous line for a line with a non-motivated greater indent', ->
buffer.text = 'bar\n foo'
cursor.line = 2
editor\indent!
assert.equal 0, editor.current_line.indentation
it 'keeps the indent for lines when nothing particular is known', ->
buffer.text = ' foo\nbar'
cursor.line = 2
editor\indent!
assert.equal 0, editor.current_line.indentation
it 'returns the indent for the previous line for a blank line', ->
buffer.text = ' bar\n'
cursor.line = 2
editor\indent!
assert.equal 2, editor.current_line.indentation
describe 'structure(editor)', ->
it 'returns lines that match class and function declarations', ->
buffer.text = [[
bar = -> true
foo = ->
true
but_this_passes_a_callback ->
'no'
also = a_callback ->
class Foo
new: (frob) =>
nil
other: =>
'this one to'
class_f: ->
'oh yeah'
]]
expected = [[
bar = -> true
foo = ->
class Foo
new: (frob) =>
other: =>
class_f: ->
]]
assert.equal expected.stripped, table.concat [tostring(l) for l in *m\structure(editor)], '\n'
it 'always includes the parent line of an included line', ->
buffer.text = [[
take_me! {
foo: -> 'voila'
}
]]
assert.same {1, 3}, [l.nr for l in *m\structure editor]
it 'falls back to the parent structure method if nothing is found', ->
buffer.text = [[
foo {
bar: 1
frob:
zed: 2
}
]]
assert.same {1, 3}, [l.nr for l in *m\structure editor]
| 25 | 100 | 0.554775 |
1784e7055fda62edf6a973dd76c9f4c87d451894 | 1,386 | ffi = require "ffi"
import PNG, has_loaded, version from require "ZPNG.lodepng"
import BUFFER from require "ZF.img.buffer"
-- https://github.com/koreader/koreader-base/tree/master/ffi
class LIBPNG
version: "1.0.1"
new: (@filename = filename) =>
unless has_loaded
libError "lodepng"
setArguments: =>
@rawData = ffi.new "unsigned char*[1]"
@width = ffi.new "int[1]"
@height = ffi.new "int[1]"
decode: =>
@setArguments!
err = PNG.lodepng_decode32_file @rawData, @width, @height, @filename
assert err == 0, ffi.string PNG.lodepng_error_text err
buffer = BUFFER @width[0], @height[0], 5, @rawData[0]
buffer\set_allocated 1
@rawData = buffer
@width = buffer\get_width!
@height = buffer\get_height!
@bit_depth = buffer\get_bpp!
@getPixel = (x, y) => buffer\get_pixel x, y
@getData = =>
@data = ffi.new "color_RGBA[?]", @width * @height
for y = 0, @height - 1
for x = 0, @width - 1
i = y * @width + x
with @getPixel(x, y)\get_color_32!
@data[i].r = .r
@data[i].g = .g
@data[i].b = .b
@data[i].a = .alpha
return @data
return @
{:LIBPNG} | 26.653846 | 76 | 0.507215 |
45545b91bcb945bb8dba519d4b19a82b7ac548d9 | 1,145 |
-- remove front indentation from a multiline string, making it suitable to be
-- parsed
unindent = (str) ->
indent = str\match "^%s+"
return str unless indent
(str\gsub("\n#{indent}", "\n")\gsub("%s+$", "")\gsub "^%s+", "")
in_dev = false
-- this will ensure any moonscript modules included come from the local
-- directory
with_dev = (fn) ->
error "already in dev mode" if in_dev
-- a package loader that only looks in currect directory
import make_loader from require "loadkit"
loader = make_loader "lua", nil, "./?.lua"
import setup, teardown from require "busted"
old_require = _G.require
dev_cache = {}
setup ->
_G.require = (mod) ->
return dev_cache[mod] if dev_cache[mod]
testable = mod\match("moonscript%.") or mod == "moonscript" or
mod\match("moon%.") or mod == "moon"
if testable
fname = assert loader(mod), "failed to find module: #{mod}"
dev_cache[mod] = assert(loadfile fname)!
return dev_cache[mod]
old_require mod
if fn
fn!
teardown ->
_G.require = old_require
in_dev = false
dev_cache
{ :unindent, :with_dev }
| 23.367347 | 77 | 0.633188 |
99c6629117e859906d837117685bfadad6578971 | 138 | Component = require "lib.concord.component"
Sprite = Component (entity, source) ->
entity.source = love.graphics.newImage(source)
Sprite | 27.6 | 47 | 0.768116 |
5b22247afc2cc3d89ccd8bd2893b7005cd2fb831 | 2,831 |
import ntype, mtype, build from require "moonscript.types"
import NameProxy from require "moonscript.transform.names"
import insert from table
import unpack from require "moonscript.util"
import user_error from require "moonscript.errors"
join = (...) ->
with out = {}
i = 1
for tbl in *{...}
for v in *tbl
out[i] = v
i += 1
has_destructure = (names) ->
for n in *names
return true if ntype(n) == "table"
false
extract_assign_names = (name, accum={}, prefix={}) ->
i = 1
for tuple in *name[2]
value, suffix = if #tuple == 1
s = {"index", {"number", i}}
i += 1
tuple[1], s
else
key = tuple[1]
s = if ntype(key) == "key_literal"
key_name = key[2]
if ntype(key_name) == "colon"
key_name
else
{"dot", key_name}
else
{"index", key}
tuple[2], s
suffix = join prefix, {suffix}
switch ntype value
when "value", "ref", "chain", "self"
insert accum, {value, suffix}
when "table"
extract_assign_names value, accum, suffix
else
user_error "Can't destructure value of type: #{ntype value}"
accum
build_assign = (scope, destruct_literal, receiver) ->
extracted_names = extract_assign_names destruct_literal
names = {}
values = {}
inner = {"assign", names, values}
obj = if scope\is_local(receiver) or #extracted_names == 1
receiver
else
with obj = NameProxy "obj"
inner = build.do {
build.assign_one obj, receiver
{"assign", names, values}
}
for tuple in *extracted_names
insert names, tuple[1]
chain = if obj
NameProxy.chain obj, unpack tuple[2]
else
"nil"
insert values, chain
build.group {
{"declare", names}
inner
}
-- applies to destructuring to a assign node
split_assign = (scope, assign) ->
names, values = unpack assign, 2
g = {}
total_names = #names
total_values = #values
-- We have to break apart the assign into groups of regular
-- assigns, and then the destructuring assignments
start = 1
for i, n in ipairs names
if ntype(n) == "table"
if i > start
stop = i - 1
insert g, {
"assign"
for i=start,stop
names[i]
for i=start,stop
values[i]
}
insert g, build_assign scope, n, values[i]
start = i + 1
if total_names >= start or total_values >= start
name_slice = if total_names < start
{"_"}
else
for i=start,total_names do names[i]
value_slice = if total_values < start
{"nil"}
else
for i=start,total_values do values[i]
insert g, {"assign", name_slice, value_slice}
build.group g
{ :has_destructure, :split_assign, :build_assign, :extract_assign_names }
| 21.945736 | 73 | 0.593077 |
086bfd1bdea4e9925ec80bb47ceb329f058b70b9 | 1,424 |
module "moonscript", package.seeall
require "moonscript.parse"
require "moonscript.compile"
require "moonscript.util"
import concat, insert from table
import split, dump from util
export moon_chunk, moon_loader, dirsep, line_tables
dirsep = "/"
line_tables = {}
-- create moon path package from lua package path
create_moonpath = (package_path) ->
paths = split package_path, ";"
for i, path in ipairs paths
p = path\match "^(.-)%.lua$"
if p then paths[i] = p..".moon"
concat paths, ";"
-- load the chunk function from a file objec:
moon_chunk = (file, file_path) ->
text = file\read "*a"
if not text then error "Could not read file"
tree, err = parse.string text
if not tree
error "Parse error: " .. err
code, ltable, pos = compile.tree tree
if not code
error compile.format_error ltable, pos, text
line_tables[file_path] = ltable
runner = -> with code do code = nil
load runner, file_path
moon_loader = (name) ->
name_path = name\gsub "%.", dirsep
file, file_path = nil, nil
for path in *split package.moonpath, ";"
file_path = path\gsub "?", name_path
file = io.open file_path
break if file
if file
moon_chunk file, file_path
else
nil, "Could not find moon file"
if not package.moonpath
package.moonpath = create_moonpath package.path
init_loader = ->
insert package.loaders, 2, moon_loader
init_loader! if not _G.moon_no_loader
| 22.25 | 51 | 0.693118 |
ef403340330fb2a1e838a13501a0fcaa88518970 | 1,862 |
-- Copyright (C) 2018-2020 DBotThePony
-- Permission is hereby granted, free of charge, to any person obtaining a copy
-- of this software and associated documentation files (the "Software"), to deal
-- in the Software without restriction, including without limitation the rights
-- to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies
-- of the Software, and to permit persons to whom the Software is furnished to do so,
-- subject to the following conditions:
-- The above copyright notice and this permission notice shall be included in all copies
-- or substantial portions of the Software.
-- THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED,
-- INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR
-- PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE
-- FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR
-- OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER
-- DEALINGS IN THE SOFTWARE.
import NULL, type, player, DPP2, string from _G
import HUDCommons, I18n from DLib
entMeta = FindMetaTable('Entity')
entMeta.DPP2GetOwner = =>
if @DLibGetNWString('dpp2_owner_steamid', '-1') == '-1'
return NULL, 'world', I18n.Localize('gui.dpp2.access.status.world'), 'world', -1
local ownerName
owner, ownerSteamID = @DLibGetNWEntity('dpp2_ownerent', NULL), @DLibGetNWString('dpp2_owner_steamid')
if IsValid(owner) and owner\IsPlayer()
ownerName = owner\Nick()
ownerName .. ' (' .. owner\SteamName() .. ')' if owner.SteamName and owner\SteamName() ~= ownerName
else
ownerName = DLib.LastNickFormatted(ownerSteamID)
return owner, ownerSteamID, ownerName, @DLibGetNWString('dpp2_owner_uid', 'world'), @DLibGetNWInt('dpp2_owner_pid', -1)
| 45.414634 | 120 | 0.755102 |
6d60007402dede70c2ceca882767cedf6f8c8ce0 | 1,216 | state = ...
base_map = bundle_load 'base_map'
import command from howl
local selection_start
cancel = (editor, mode = 'command') ->
editor.selection.persistent = false
editor.selection\remove!
state.change_mode editor, mode
cut = (editor) ->
editor.selection\cut!
cancel editor
copy = (editor) ->
editor.selection\copy!
cancel editor
substitute = (editor) ->
editor.selection\cut!
cancel editor, 'insert'
map = {
__meta: setmetatable {
name: 'VISUAL'
}, __index: base_map.__meta
editor: setmetatable {
d: cut
x: cut
y: copy
v: cancel
s: substitute
escape: cancel
i: (editor) ->
editor.selection.persistent = false
state.change_mode editor, 'insert'
':': -> command.run!
'>': (editor) ->
editor\shift_right!
cancel editor
'<': (editor) ->
editor\shift_left!
cancel editor
}, __index: base_map.editor
__on_selection_changed: (editor, selection) ->
if selection.empty and editor.cursor.pos != selection_start
cancel editor
}
setmetatable map, {
__index: base_map
__call: (_, editor) ->
with editor.selection
.persistent = true
selection_start = .anchor
}
return map
| 18.149254 | 63 | 0.647204 |
a2851d3c47f8cd21f594520adad2863e0fc0c7b7 | 1,329 | import style, ActionBuffer from howl.ui
import Buffer from howl
describe 'style', ->
local buffer
before_each ->
buffer = Buffer {}
it 'styles can be accessed using direct indexing', ->
t = styles: default: color: '#998877'
style.set_for_theme t
assert.equal style.default.color, t.styles.default.color
describe '.define(name, definition)', ->
it 'allows defining custom styles', ->
style.define 'custom', color: '#334455'
assert.equal style.custom.color, '#334455'
it 'allows aliasing styles using a string as <definition>', ->
style.define 'target', color: '#beefed'
style.define 'alias', 'target'
assert.equal '#beefed', style.alias.color
describe 'define_default(name, definition)', ->
it 'defines the style only if it is not already defined', ->
style.define_default 'preset', color: '#334455'
assert.equal style.preset.color, '#334455'
style.define_default 'preset', color: '#667788'
assert.equal style.preset.color, '#334455'
it '.at_pos(buffer, pos) returns name and style definition at pos', ->
style.define 'stylish', color: '#101010'
buffer = ActionBuffer!
buffer\insert 'hƏllo', 1, 'keyword'
buffer\insert 'Bačon', 6, 'stylish'
name = style.at_pos(buffer, 5)
assert.equal name, 'keyword'
| 32.414634 | 72 | 0.666667 |
591ba96e4264fe1c303bdbc62e3efd80d1b35621 | 2,464 |
describe "lapis.http", ->
local location, options
before_each ->
stack = require "lapis.spec.stack"
stack.push {
HTTP_GET: 1
HTTP_POST: 2
HTTP_PUT: 2
location: {
capture: (_location, _options) ->
location = _location
options = _options
{}
}
}
after_each ->
stack = require "lapis.spec.stack"
stack.pop!
describe "simple", ->
local simple
before_each ->
simple = require("lapis.http").simple
it "should call with string", ->
simple "http://leafo.net"
assert.same "/proxy", location
assert.same {
method: ngx.HTTP_GET
ctx: {}
vars: {
_url: "http://leafo.net/"
}
}, options
it "should call table", ->
simple {
url: "http://leafo.net/lapis"
}
assert.same "/proxy", location
assert.same {
method: ngx.HTTP_GET
ctx: {}
vars: {
_url: "http://leafo.net/lapis"
}
}, options
it "should call with body", ->
simple "http://leafo.net", "gold coins"
assert.same "/proxy", location
assert.same {
method: ngx.HTTP_POST
body: "gold coins"
ctx: {}
vars: {
_url: "http://leafo.net/"
}
}, options
it "should encode form", ->
simple "http://leafo.net/lapis", {
color: "blue's"
}
assert.same "/proxy", location
assert.same {
method: ngx.HTTP_POST
body: "color=blue%27s"
ctx: {
headers: {
"Content-type": "application/x-www-form-urlencoded"
}
}
vars: {
_url: "http://leafo.net/lapis"
}
}, options
it "should set method and body", ->
simple {
url: "http://leafo.net/lapis"
method: "PUT"
body: "yeah"
}
assert.same "/proxy", location
assert.same {
method: ngx.HTTP_PUT
body: "yeah"
ctx: { }
vars: { _url: "http://leafo.net/lapis" }
}, options
describe "request", ->
local request
before_each ->
request = require("lapis.http").request
it "should call with string", ->
request "http://leafo.net"
assert.same "/proxy", location
assert.same {
method: ngx.HTTP_GET
ctx: {}
vars: {
_url: "http://leafo.net/"
}
}, options
| 20.03252 | 63 | 0.495536 |
18662fffb23d233a1f1248cb3e7ae394461f3348 | 40 | M = {}
M.main = () ->
"n1"
return M | 10 | 15 | 0.375 |
1a76312934f29d56ca77ec2e4a535be46bfa4871 | 1,432 | https = require "ssl.https"
json = require "dkjson"
socket = require "socket"
sqlite3 = require "lsqlite3"
authors = {
["e4edb497-3f6f-4a7e-8ad4-0272ab8d3a47"]: true
}
db = assert sqlite3.open "../db/posts.db"
insert_stmt = assert db\prepare "INSERT INTO Users VALUES (NULL, ?, ?, ?)"
db\trace (ud, sql) ->
print sql
print [[ BEGIN TRANSACTION; ]]
for row in db\nrows "SELECT * FROM Posts"
do
for k,v in pairs row
print " -- #{k}: #{v}"
if authors[row.author]
-- print "Skipping dupe #{row.author}"
continue
author = row.author
authors[author] = true
print "-- #{os.date!} fetching for #{author}..."
reply, code, headers = https.request "https://derpibooru.org/profiles/#{author}.json"
if code ~= 200
db\exec [[ ROLLBACK; ]]
error reply
person, _, err = json.decode reply
if err
db\exec [[ ROLLBACK; ]]
error err
print "-- #{os.date} found #{person.name}"
person.avatar = "//derpicdn.net/assets/no_avatar_125x125-2c4e2d8e68cb13a208dae3c6d6877b45c5390dd367920d927c80dde1665bc0ed.png" unless person.avatar
do
insert_stmt\bind_values person.id, person.name, person.avatar
print "-- #{os.date!} adding #{person.id}, #{person.name}"
err = insert_stmt\step!
if err ~= sqlite3.OK and err ~= sqlite3.DONE
print err
db\exec [[ ROLLBACK; ]]
error db\errmsg!
insert_stmt\reset!
socket.sleep 1
db\exec [[ COMMIT; ]]
| 22.730159 | 149 | 0.646648 |
b0a9963d6856592425644b1a1c81a1a8d537500c | 2,878 | export modinfo = {
type: "command"
desc: "Chisana farusu"
alias: {"chifar"}
func: getDoPlayersFunction (v) ->
v.Character.Head.face.Texture = ConfigSystem("Get", "Hadaka no kao")
removeOldDick(v.Character)
D = CreateInstance"Model"{
Parent: v.Character
Name: ConfigSystem("Get", "Ero-mei")
}
bg = CreateInstance"BodyGyro"{
Parent: v.Character.Torso
}
d = CreateInstance"Part"{
TopSurface: 0
BottomSurface: 0
Name: "Main"
Parent: D
FormFactor: 3
Size: Vector3.new(0.6,1,0.6)
BrickColor: ConfigSystem("Get", "Ero-iro")
Position: v.Character.Head.Position
CanCollide: true
}
cy = CreateInstance"CylinderMesh"{
Parent: d
Scale: Vector3.new(1.1,2,1.1)
}
w = CreateInstance"Weld"{
Parent: v.Character.Head
Part0: d
Part1: v.Character.Head
C0: CFrame.new(0,-1,2.35)*CFrame.Angles(math.rad(90),0,0)
}
c = CreateInstance"Part"{
Name: "Mush"
BottomSurface: 0
TopSurface: 0
FormFactor: 3
Size: Vector3.new(0.6,0.6,0.6)
CFrame: CFrame.new(d.Position)
BrickColor: ConfigSystem("Get", "Ero sentan no iro")
CanCollide: true
Parent: D
}
msm = CreateInstance"SpecialMesh"{
Parent: c
MeshType: "Head"
Scale: Vector3.new(0.99,0.99,0.99)
}
cw = CreateInstance"Weld"{
Parent: c
Part0: d
Part1: c
C0: CFrame.new(0,1,0)
}
ball1 = CreateInstance"Part"{
Parent: D
Name: "Left Ball"
BottomSurface: 0
TopSurface: 0
CanCollide: true
FormFactor: 3
Size: Vector3.new(1,1,1)
CFrame: CFrame.new(v.Character["Left Leg"].Position)
BrickColor: ConfigSystem("Get", "Ero-iro")
}
bsm = CreateInstance"SpecialMesh"{
Parent: ball1
MeshType: "Sphere"
Scale: Vector3.new(0.8,0.8,0.8)
}
b1w = CreateInstance"Weld"{
Parent: ball1
Part0: v.Character["Left Leg"]
Part1: ball1
C0: CFrame.new(0.75,1,-0.6)
}
ball2 = CreateInstance"Part"{
Parent: D
Name: "Right Ball"
BottomSurface: 0
CanCollide: true
TopSurface: 0
FormFactor: 3
Size: Vector3.new(1,1,1)
CFrame: CFrame.new(v.Character["Right Leg"].Position)
BrickColor: ConfigSystem("Get", "Ero-iro")
}
b2sm = CreateInstance"SpecialMesh"{
Parent: ball2
MeshType: "Sphere"
Scale: Vector3.new(0.8,0.8,0.8)
}
b2w = CreateInstance"Weld"{
Parent: ball2
Part0: v.Character["Right Leg"]
Part1: ball2
C0: CFrame.new(-0.75,1,-0.6)
}
me = v
c = me.Character
rs = c.Torso["Right Shoulder"]
ls = c.Torso["Left Shoulder"]
t = c.Torso
lh = t["Left Hip"]
rh = t["Right Hip"]
n = t.Neck
anim = c.Animate
if (anim ~= nil) or (anim)
anim.Disabled = true
ls\SetDesiredAngle(0)
rs\SetDesiredAngle(0)
lh\SetDesiredAngle(0)
rh\SetDesiredAngle(0)
n\SetDesiredAngle(0)
for i=1,10
ls.C0 = ls.C0 * CFrame.Angles(0,math.rad(-1),math.rad(-2))
rs.C0 = rs.C0 * CFrame.Angles(0,math.rad(1),math.rad(2))
} | 23.785124 | 70 | 0.641765 |
745f6301edd826e0b3daf4869f37f8eef613de9b | 3,427 |
--
-- Copyright (C) 2017-2020 DBotThePony
-- Permission is hereby granted, free of charge, to any person obtaining a copy
-- of this software and associated documentation files (the "Software"), to deal
-- in the Software without restriction, including without limitation the rights
-- to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies
-- of the Software, and to permit persons to whom the Software is furnished to do so,
-- subject to the following conditions:
-- The above copyright notice and this permission notice shall be included in all copies
-- or substantial portions of the Software.
-- THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED,
-- INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR
-- PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE
-- FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR
-- OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER
-- DEALINGS IN THE SOFTWARE.
doPatch = =>
return if not @IsValid()
local target
for _, child in ipairs @GetChildren()
if child\GetName() == 'DIconLayout'
target = child
break
return if not target
local buttonTarget
for _, button in ipairs target\GetChildren()
buttonChilds = button\GetChildren()
cond1 = buttonChilds[1] and buttonChilds[1]\GetName() == 'DLabel'
cond2 = buttonChilds[2] and buttonChilds[2]\GetName() == 'DLabel'
if cond1 and buttonChilds[1]\GetText() == 'Player Model'
buttonTarget = button
break
elseif cond2 and buttonChilds[2]\GetText() == 'Player Model'
buttonTarget = button
break
return if not buttonTarget
{:title, :init, :icon, :width, :height, :onewindow} = list.Get('DesktopWindows').PlayerEditor
buttonTarget.DoClick = ->
return buttonTarget.Window\Center() if onewindow and IsValid(buttonTarget.Window)
buttonTarget.Window = @Add('DFrame')
with buttonTarget.Window
\SetSize(width, height)
\SetTitle(title)
\Center()
init(buttonTarget, buttonTarget.Window)
local targetModel
for _, child in ipairs buttonTarget.Window\GetChildren()
if child\GetName() == 'DModelPanel'
targetModel = child
break
return if not targetModel
targetModel.oldSetModel = targetModel.SetModel
targetModel.SetModel = (model) =>
oldModel = @Entity\GetModel()
oldPonyData = @Entity\GetPonyData()
@oldSetModel(model)
if IsValid(@Entity) and oldPonyData
oldPonyData\SetupEntity(@Entity)
oldPonyData\ModelChanges(oldModel, model)
targetModel.PreDrawModel = (ent) =>
return if not IsValid(ent)
controller = @ponyController
return if not controller
return if not ent\IsPony()
controller\SetupEntity(ent) if controller.ent ~= ent
controller\GetRenderController()\DrawModels()
controller\GetRenderController()\PreDraw(ent)
controller\GetRenderController()\HideModels(true)
bg = controller\GetBodygroupController()
bg\ApplyBodygroups() if bg
copy = PPM2.GetMainData()\Copy()
controller = copy\CreateCustomController(targetModel.Entity)
copy\SetNetworkObject(controller)
controller\SetDisableTask(true)
targetModel.ponyController = controller
hook.Run 'BuildPlayerModelMenu', buttonTarget, buttonTarget.Window
hook.Add 'ContextMenuCreated', 'PPM2.PatchPlayerModelMenu', => timer.Simple 0, -> doPatch(@)
| 35.697917 | 94 | 0.746717 |
45343c82d6bc9886c43b70d7ddde93a9dcf23f25 | 1,000 | local open_file
require 'moonscript'
package.cpath = package.cpath .. ';./src/fs/?.so;'
start = os.clock!
fs = require 'fs'
fl = require 'src.flags'
ps = require 'src.parse'
cl = require 'src.color'
import p from require 'moon'
usage = [[usage: romp [dir]
-w <d> watch directory for changes
-h print this message
]]
ar = fl.parse usage
ar[1] or= fs.info('wrkdir')
inf = {}
base_path = (path) ->
base_path = tostring(path)\match('^%.-/-([%w%s%-_]+)')
return base_path
do_file = (data) ->
fs.chdir(fs.info('wrkdir') .. '/'..open_file(ar[1]) .. '/')
os.execute inf.exec\gsub '%%f', inf.name
main = () ->
if ar.h
print usage
os.exit!
fs.mount(ar[1])
unless fs.exists 'romp'
print "no romp file"
os.exit!
fs.setWritePath(ar[1])
data = fs.read 'romp'
for line in data\gmatch '[^\n]+'
inf = ps.parse data
print cl.reset .. cl.fore.green .. '[compiled: %s]'\format(inf.name) .. cl.reset
print '[time: %0.2fs]'\format os.clock! - start
main()
| 21.276596 | 84 | 0.605 |
d46e1b822a42cd64405c1999879e6495c3110114 | 4,096 | export doNothing = ->
scriptContext = @
getHorizontalSizeScale = =>
@tileMode and (1000 * @widthRatio) or 8000
getVerticalSizeScale = =>
@tileMode and 1000 or 8000
getHorizontalPosScale = =>
@tileMode and @widthRatio or 8.3
getVerticalPosScale = =>
@tileMode and 1 or 8.3
convertElementPosition = (x, y) =>
halfHeightResolution = @heightResolution / 2
halfWidthResolution = halfHeightResolution * @widthRatio
x = (getHorizontalPosScale @) * (x - halfWidthResolution) / halfWidthResolution
y = (getVerticalPosScale @) * (y - halfHeightResolution) / halfHeightResolution
{ x, @drawDepth, y }
createElementProps = (element, overrides) =>
overrides = overrides or { }
widthResolution = @heightResolution * @widthRatio
rawPosition = overrides.position or { overrides.x or element.x, overrides.y or element.y }
{
width: (getHorizontalSizeScale @) * (overrides.width or element.width) / widthResolution
height: (getVerticalSizeScale @) * (overrides.height or element.height) / @heightResolution
position: convertElementPosition @, rawPosition[1], rawPosition[2]
label: overrides.text or element.text
font_size: (overrides.fontSize or element.fontSize) * 100
click_function: overrides.callback or "doNothing"
function_owner: scriptContext
}
getElementIndex = (element) =>
for i, e in ipairs @elements
return i - 1 if e == element
stripVectorXYZ = (vector) ->
(vector.__class == Vector) and (vector\strip { "x", "y", "z" }) or vector
standardBoardHeight = 9.125
export class Board
drawDepth: 59/100
heightResolution: 4000
offset: Transform { zPos: 2.5 }
tableType: TableTypes.CUSTOM_RECTANGLE
tileMode: false
widthRatio: 1
new: (options) =>
@elements = { }
if (type options) == "table"
@context = options.context
@drawDepth = options.drawDepth
@heightResolution = options.heightResolution
@offset = options.offset
@tableType = options.tableType
@tileMode = options.tileMode
@widthRatio = options.widthRatio
clear: =>
for i = #@elements, 1, -1
@elements[i]\erase @
addElement: (element, overrides) =>
assert @context != nil, "tts-board-ui: Attempted to call Board:addElement() but no API context was specified."
table.insert @elements, element
@context.createButton (createElementProps @, element, overrides)
removeElement: (element) =>
assert @context != nil, "tts-board-ui: Attempted to call Board:removeElement() but no API context was specified."
index = getElementIndex @, element
return false unless index
table.remove @elements, index + 1
@context.removeButton index
updateElement: (element, overrides) =>
assert @context != nil, "tts-board-ui: Attempted to call Board:updateElement() but no API context was specified."
index = getElementIndex @, element
return false unless index
props = createElementProps @, element, overrides
props.index = index
@context.editButton props
setPosition: (position) =>
assert @context != nil, "tts-board-ui: Attempted to call Board:setPosition() but no API context was specified."
@context.setPosition stripVectorXYZ position
setRotation: (rotation) =>
assert @context != nil, "tts-board-ui: Attempted to call Board:setRotation() but no API context was specified."
@context.setRotation stripVectorXYZ rotation
destroy: =>
assert @context != nil, "tts-board-ui: Attempted to call Board:destroy() but no API context was specified."
@context.destruct!
@context = nil
sendToPlayer: (playerId) =>
seatTransform = @tableType.transforms[playerId]
assert seatTransform != nil,
"tts-board-ui: Attempted to send board to player #{playerId} but this table does not include that player."
offsetTransform = Transform @offset
offsetTransform.position.data.z += standardBoardHeight / @widthRatio
offsetTransform\rotateAboutYAxis seatTransform.rotation.data.y
offsetTransform\translate seatTransform.position
@setPosition offsetTransform.position
@setRotation offsetTransform.rotation
| 36.247788 | 117 | 0.715332 |
bb6699f47cc7ea474a0edc0c038bffe8000ec41b | 3,544 | import config, signal from howl
import PropertyTable from howl.aux
by_extension = {}
by_pattern = {}
by_shebang = {}
modes = {}
live = setmetatable {}, __mode: 'k'
mode_variables = {}
local by_name
instance_for_mode = (m) ->
return live[m] if live[m]
error "Unknown mode specified as parent: '#{m.parent}'", 3 if m.parent and not modes[m.parent]
parent = if m.name != 'default' then by_name m.parent or 'default'
target = m.create m.name
mode_config = config.local_proxy!
if target.default_config
mode_config[k] = v for k,v in pairs target.default_config
mode_vars = mode_variables[m.name]
if mode_vars
mode_config[k] = v for k,v in pairs mode_vars
mode_config.chain_to parent.config if parent
instance = setmetatable {
name: m.name
config: mode_config
:parent
}, {
__index: (_, k) -> target[k] or parent and parent[k]
}
live[m] = instance
instance
by_name = (name) ->
modes[name] and instance_for_mode modes[name]
get_shebang = (file) ->
return nil unless file.readable
line = file\read!
line and line\match '^#!%s*(.+)$'
for_file = (file) ->
return by_name('default') unless file
pattern_match = (value, patterns) ->
return nil unless value
for pattern, mode in pairs patterns
return mode if value\umatch pattern
def = pattern_match tostring(file), by_pattern
def or= file.extension and by_extension[file.extension\lower!]
def or= pattern_match get_shebang(file), by_shebang
def or= modes['default']
instance = def and instance_for_mode def
error 'No mode available for "' .. file .. '"' if not instance
instance
for_extension = (extension) ->
by_extension[extension\lower!]
register = (mode = {}) ->
error 'Missing field `name` for mode', 2 if not mode.name
error 'Missing field `create` for mode', 2 if not mode.create
multi_value = (v = {}) -> type(v) == 'string' and { v } or v
by_extension[ext] = mode for ext in *multi_value mode.extensions
by_pattern[pattern] = mode for pattern in *multi_value mode.patterns
by_shebang[shebang] = mode for shebang in *multi_value mode.shebangs
modes[mode.name] = mode
modes[alias] = mode for alias in *multi_value mode.aliases
signal.emit 'mode-registered', name: mode.name
unregister = (name) ->
mode = modes[name]
if mode
remove_from = (table, mode) ->
keys = [k for k, m in pairs table when m == mode]
table[k] = nil for k in *keys
remove_from modes, mode
remove_from by_extension, mode
remove_from by_pattern, mode
remove_from by_shebang, mode
live[mode] = nil
signal.emit 'mode-unregistered', :name
configure = (mode_name, variables) ->
error 'Missing argument #1 (mode_name)', 2 unless mode_name
error 'Missing argument #2 (variables)', 2 unless variables
mode_vars = mode_variables[mode_name] or {}
mode_vars[k] = v for k,v in pairs variables
mode_variables[mode_name] = mode_vars
-- update any already instantiated modes
mode = modes[mode_name]
if mode
instance = live[mode]
if instance
instance.config[k] = v for k,v in pairs variables
signal.register 'mode-registered',
description: 'Signaled right after a mode was registered',
parameters:
name: 'The name of the mode'
signal.register 'mode-unregistered',
description: 'Signaled right after a mode was unregistered',
parameters:
name: 'The name of the mode'
return PropertyTable {
:for_file
:for_extension
:by_name
:register
:unregister
:configure
names: get: -> [name for name in pairs modes]
}
| 27.053435 | 96 | 0.694413 |
6cd29dc869b53961be29fe6ffab3220ee8ca0a53 | 258 | export modinfo = {
type: "command"
desc: "Run local Script"
alias: {"lscr"}
func: (Msg,Speaker) ->
if localScript(Msg,workspace)
Output("Local script running",{Colors.Green},Speaker)
else
Output("Local script not inited",{Colors.Red},Speaker)
} | 25.8 | 57 | 0.689922 |
14c6699c180bdf0485907cb98e9456333b823a94 | 1,937 | lapis = require "lapis"
db = require "lapis.db"
import Model from require "lapis.db.model"
import config from require "lapis.config"
import insert from table
import sort from table
import min, random from math
class Fortune extends Model
class World extends Model
class Benchmark extends lapis.Application
"/": =>
json: {message: "Hello, World!"}
"/db": =>
num_queries = tonumber(@params.queries) or 1
if num_queries < 2
w = World\find random(1, 10000)
return json: {id:w.id,randomNumber:w.randomnumber}
worlds = {}
num_queries = min(500, num_queries)
for i = 1, num_queries
w = World\find random(1, 10000)
insert worlds, {id:w.id,randomNumber:w.randomnumber}
json: worlds
"/fortunes": =>
@fortunes = Fortune\select ""
insert @fortunes, {id:0, message:"Additional fortune added at request time."}
sort @fortunes, (a, b) -> a.message < b.message
layout:false, @html ->
raw '<!DOCTYPE HTML>'
html ->
head ->
title "Fortunes"
body ->
element "table", ->
tr ->
th ->
text "id"
th ->
text "message"
for fortune in *@fortunes
tr ->
td ->
text fortune.id
td ->
text fortune.message
"/update": =>
num_queries = tonumber(@params.queries) or 1
if num_queries == 0
num_queries = 1
worlds = {}
num_queries = min(500, num_queries)
for i = 1, num_queries
wid = random(1, 10000)
world = World\find wid
world.randomnumber = random(1, 10000)
world\update "randomnumber"
insert worlds, {id:world.id,randomNumber:world.randomnumber}
if num_queries < 2
return json: worlds[1]
json: worlds
"/plaintext": =>
content_type:"text/plain", layout: false, "Hello, World!"
| 26.534247 | 81 | 0.574084 |
e3f4a5ffa7c03aaea33203b75655769b7bc99e37 | 24 | require "lapis.db.mysql" | 24 | 24 | 0.791667 |
c335a828a2d36d17718a741996080085e7116255 | 353 | import new from require 'buffet.resty'
describe 'settimeout()', ->
it 'should return nothing if not closed', ->
bf = new!
n = nargs bf\settimeout 1000
assert.are.equal 0, n
it 'should return nothing if closed', ->
bf = new!
bf\close!
n = nargs bf\settimeout 1000
assert.are.equal 0, n
| 22.0625 | 48 | 0.575071 |
e56a77683eb5d5924a656a2266404355f3271559 | 4,972 | Dorothy!
GlobalPanelView = require "View.Control.Trigger.GlobalPanel"
ExprItem = require "Control.Trigger.ExprItem"
ExprChooser = require "Control.Trigger.ExprChooser"
Button = require "Control.Basic.Button"
import Expressions,SetExprMeta,ToEditText from require "Data.TriggerDef"
import Path from require "Lib.Utils"
Class GlobalPanelView,
__init:(args)=>
{:owner,:filterType} = args
@curExpr = nil
@selectedItem = nil
@newBtn = nil
@curIndex = nil
@globalExpr = editor\getGlobalExpr!
@modified = false
selectVarItem = (exprItem)->
@selectedItem.checked = false if @selectedItem
@selectedItem = exprItem.checked and exprItem or nil
if exprItem.checked
@editMenu.visible = true
@editMenu.transformTarget = exprItem
@editMenu.position = oVec2 exprItem.width,0
if filterType
@pickBtn.visible = exprItem.expr[3].Type == filterType
else
@pickBtn.visible = false
for item in *@editMenu.children
with item
if .visible
.scaleX,.scaleY = 0,0
\perform oScale 0.3,1,1,oEase.OutQuad
else
@editMenu.visible = false
@editMenu.transformTarget = nil
updatePanelSize = ->
children = @menu.children
items = [child for child in *children[2,]]
table.sort items,(a,b)-> a.expr[2][2] < b.expr[2][2]
for i = 1,#items
item = items[i]
item.lineNumber = i
children[i+1] = item
@globalExpr[i+1] = item.expr
offset = @scrollArea.offset
@scrollArea.offset = oVec2.zero
size = @menu\alignItemsVertically 2
@scrollArea.viewSize = CCSize size.width,size.height+70
@scrollArea.offset = offset
addNewGlobal = ->
@modified = true
@curExpr = Expressions.InitGlobalNumber\Create!
table.insert @globalExpr,@curExpr
newItem = with ExprItem {
lineNumber:#@menu.children
expr:@curExpr
width:@menu.width-20
}
\updateText!
\slot "Tapped",selectVarItem
@menu\addChild newItem
newItem\emit "Tapped",newItem
updatePanelSize!
@scrollArea\scrollToPosY newItem.positionY
newItem.opacity = 0
@initBtn\emit "Tapped"
@schedule once ->
sleep 0.3
newItem.opacity = 1
addTheNewButton = ->
@newBtn = with Button {
text:"<NEW>"
width:150
height:40
fontName:"Arial"
fontSize:20
}
.color = ccColor3 0x80ff00
\slot "Tapped",->
@menu\removeChild @newBtn
addNewGlobal!
@menu\addChild @newBtn
updatePanelSize!
lineNumber = 0
for expr in *@globalExpr[2,]
lineNumber += 1
@menu\addChild with ExprItem {
lineNumber:lineNumber
expr:expr
width:@menu.width-20
}
\updateText!
\slot "Tapped",selectVarItem
if #@globalExpr == 1
addTheNewButton!
else
updatePanelSize!
hideItem = (item)->
item\perform CCSequence {
oOpacity 0.3,0,oEase.OutQuad
CCHide!
}
showItem = (item,opacity=1)->
item\perform CCSequence {
CCShow!
oOpacity 0.3,opacity,oEase.OutQuad
}
@initBtn\slot "Tapped",->
hideItem owner.panel
hideItem owner.opMenu
hideItem @panel
hideItem @opMenu
hideItem @
@previewOwner = ExprChooser.preview.owner
@curExpr = @selectedItem.expr
@curIndex = @menu.children\index @selectedItem
ExprChooser.preview.owner = @
ExprChooser.preview\update!
with ExprChooser {
valueType:"GlobalInit"
expr:@selectedItem.expr
noVar:true
backOnly:true
editorType:owner.type
}
\slot "Result",(newExpr)->
@modified = true
@curExpr = newExpr
@globalExpr[@curIndex] = newExpr
ExprChooser.preview\update!
@selectedItem.expr = newExpr
@selectedItem\updateText!
if filterType
@pickBtn.visible = newExpr[3].Type == filterType
\slot "Hide",->
showItem owner.panel
showItem owner.opMenu
showItem @panel
showItem @opMenu
showItem @,0.6
ExprChooser.preview.owner = @previewOwner
ExprChooser.preview\update!
updatePanelSize!
@addBtn\slot "Tapped",addNewGlobal
@delBtn\slot "Tapped",->
@modified = true
index = @menu.children\index @selectedItem
table.remove @globalExpr,index
item = @selectedItem
@selectedItem.checked = false
selectVarItem @selectedItem
@menu\removeChild item
index -= 1
if index > 1
item = @menu.children[index]
item.checked = true
selectVarItem item
elseif index == 1 and #@menu.children > 1
item = @menu.children[2]
item.checked = true
selectVarItem item
else
addTheNewButton!
updatePanelSize!
@pickBtn\slot "Tapped",->
editor\saveGlobalExpr!
@hide!
name = @selectedItem.expr[2][2]
name = name == "" and "InvalidName" or name
@emit "Result",name
@closeBtn\slot "Tapped",-> editor\saveGlobalExpr!
hide:=>
@__base.hide @
if @modified
editor\lintAllTriggers!
| 26.306878 | 73 | 0.645012 |
6a70ac7f0774d616f6afdd0a40f715fc31967435 | 1,332 | lapis = require "lapis"
import respond_to from require "lapis.application"
lifx = require "lifx"
yaml = require "yaml"
import getKeys, map, filterWithIndex, contains from require "utils"
loadLights = ->
f = io.open("lights.yml", "r")
content = f\read("*a")
lights = yaml.load(content)
f\close!
lights
lights = loadLights! -- load on startup
parseSelectedLightIps = (params) ->
indices = map(getKeys(params.selectedLights or {}), tonumber)
map(
filterWithIndex(lights, (i, v) -> contains(indices, i)),
(it) -> it.ip
)
class LightsApplication extends lapis.Application
@before_filter =>
@lights = lights
[lights: "/lights"]: respond_to {
GET: =>
render: true
POST: =>
@session.selectedLights = @params.selectedLights
@session.lightColor = @params.color
@session.transitionMs = @params.transitionMs
selectedLightIps = parseSelectedLightIps(@params)
switch @params.action
when "On"
lifx.on(selectedLightIps, @params.transitionMs or 0)
when "Off"
lifx.off(selectedLightIps, @params.transitionMs or 0)
when "Set"
lifx.set(selectedLightIps, @params.color, @params.transitionMs or 0)
else
error "Unknown action: " .. (@params.action or "nil")
redirect_to: @url_for "lights"
}
| 27.183673 | 78 | 0.653153 |
24f14fb5bcb0d797c6b00fb77a72dc87c727818f | 262 | export modinfo = {
type: "command"
desc: "Chat through chat beacon"
alias: {"b"}
func: (Msg,Speaker) ->
for i,v in pairs(workspace\GetChildren())
if v.Name == "ChatBeacon"
Service"Chat"\Chat(v.Head,string.format("%s: %s",CharacterName, Msg),"Red")
} | 29.111111 | 79 | 0.652672 |
aafc6048737b29373e3e691da047cf4dfeebb311 | 608 | Dorothy!
GroupChooserView = require "View.Control.Edit.GroupChooser"
Button = require "Control.Basic.Button"
Class GroupChooserView,
__init: =>
indices = [i for i = 1,12]
for i in *{oData.GroupTerrain,oData.GroupDetectPlayer,oData.GroupDetect,oData.GroupHide}
table.insert indices,i
sceneData = editor.sceneData
for i in *indices
@menu\addChild with Button {
text:sceneData.groups[i]
tag:i
width:180
height:40
fontSize:18
}
\slot "Tapped",(button)->
@emit "Selected",button.tag
@scrollArea.viewSize = @menu\alignItemsVertically!
| 26.434783 | 91 | 0.677632 |
e588c4edc10d3d7f6c481cc8f063378edfe48c57 | 728 | export class Graphic
new: =>
@texture = nil
@x = 0
@y = 0
@orientation = 0
@scale = x: 1, y: 1
@origin = x: 0, y: 0
@shearing = x: 0, y: 0
@opacity = 1
@color = { 255, 255, 255 }
update: (dt) =>
draw: (x=0, y=0, r=@orientation, [email protected], [email protected], [email protected], [email protected], [email protected], [email protected]) =>
if (@texture == nil)
return
cr, cg, cb, ca = love.graphics.getColor!
love.graphics.setColor(@color[1], @color[2], @color[3], @opacity)
love.graphics.draw(@texture, @x + x, @y + y, r, sx, sy, ox, oy, kx, ky)
love.graphics.setColor(cr, cg, cb, ca)
| 29.12 | 126 | 0.471154 |
54ecc036942dcb846ed4b705bc94f9e7b263f7c2 | 711 | DB = require 'src.Database'
class Website
new: (name, url) =>
@name = name
@url = url
@id = nil
save: =>
if @id
-- Update the thing with this id
res = DB.update_website(@id, @name, @url)
if res
return true
else
return false
else
-- Create a new entry on db and save ID
res = DB.create_website(@name, @url)
if res[1]
@id = res[1]["id"]
return true
else
-- Failed!
return false
load: (dict) =>
id, name, url= {dict}
@name = name
@url = url
@id = id
loadWithId: (id) =>
-- TODO: Get id from server and load
obj = nil
@\load obj
return {:Website}
| 17.775 | 49 | 0.50211 |
5e0e6d458eb5ad573d080453c5491a3f7aa7abde | 4,379 | fsmock = require "filesystem-mock"
package.path = "../?.lua;#{package.path}"
describe "content module", ->
with_mock_fs = (obj, vfs, openerr, readerr, fn) ->
fs = fsmock.new vfs
fs.err_on_read = {}
fs.err_on_open = {}
if readerr
for f in *readerr
fs.err_on_read[f] = true
if openerr
for f in *openerr
fs.err_on_open[f] = true
fs\inject obj
fn fs
fs\restore obj
setup ->
export _real_io = require "io"
package.loaded.io = fsmock.io
package.loaded["lapis.config"] = {
get: ->
content_prefix: "content/"
}
export content = require "content"
teardown ->
content = nil
package.loaded.io = _real_io
it "denies invalid names", ->
with_mock_fs content, {
-- empty
}, nil, nil, ->
badnames = {
"../../../../../../etc/passwd"
"ŠČĆĐunicodes"
"$$%%_specialChars"
"()()()()()"
}
for name in *badnames
ret, err = content\get name
assert.falsy ret
assert.equals "Invalid name: `#{name}`", err
it "fails with nonexistent files", ->
with_mock_fs content, {
-- empty
}, nil, nil, ->
ret, err = content\get "nonexistent"
assert.falsy ret
assert.equals "File `content/nonexistent.yaml` not found or could not be opened", err
it "gracefully handles an open error", ->
with_mock_fs content, {
"content":
"dummy.yaml": "Should not open"
}, { "content/dummy.yaml" }, nil, ->
ret, err = content\get "dummy"
assert.falsy ret
assert.equals "File `content/dummy.yaml` not found or could not be opened", err
it "gracefully handles a read error", ->
with_mock_fs content, {
"content":
"dummy.yaml": "Should not read"
}, nil, { "content/dummy.yaml" }, ->
ret, err = content\get "dummy"
assert.falsy ret
assert.equals "Error reading file `content/dummy.yaml`", err
it "can parse a basic YAML file", ->
with_mock_fs content, {
"content":
"dummy.yaml": [[
---
test: string
nested:
- one
- two
- three
hey:
you: are
my: kind
of: guy
]]
}, nil, nil, ->
ret, err = content\get "dummy"
assert.falsy err
assert.are.same {
test: "string"
nested: {
"one"
"two"
"three"
}
hey:
you: "are"
my: "kind"
of: "guy"
}, ret
it "can parse YAML files and use Markdown to parse them", ->
with_mock_fs content, {
"content":
"dummy.yaml": [[
---
nomarkdown: yaay
somemarkdown: |
$
# Heading 1
A paragraph
nested:
markdown: $ Paragraph
nomarkdown: happy
]]
}, nil, nil, ->
ret, err = content\get "dummy"
assert.falsy err
assert.are.same {
nomarkdown: "yaay",
somemarkdown: [[<h1>Heading 1</h1>
<p>A paragraph</p>
]],
nested:
markdown: [[<p>Paragraph</p>
]],
nomarkdown: 'happy'
}, ret
it "correctly coerces numbers to strings", ->
with_mock_fs content, {
"content":
"dummy.yaml": [[
---
anumber: 1234
mdnumber: $ 1234
]]
}, nil, nil, ->
ret, err = content\get "dummy"
assert.falsy err
assert.are.same {
anumber: "1234",
mdnumber: [[<p>1234</p>
]],
}, ret
it "keeps boolean values intact", ->
with_mock_fs content, {
"content":
"dummy.yaml": [[
---
abool: yes
]]
}, nil, nil, ->
ret, err = content\get "dummy"
assert.falsy err
assert.are.same {
abool: true
}, ret
| 25.166667 | 97 | 0.446906 |
36896824778402ebafca3104df246afea335b602 | 187 | [=[
File: Player
Helpers for dealing with player objects
]=]
[=[
Function: IsServerConsole
TODO
]=]
ulx.IsServerConsole = (obj using nil) ->
obj and obj.EntIndex and obj\EntIndex! == 0
| 15.583333 | 44 | 0.705882 |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.