Dataset Viewer
instruction
stringlengths 52
2.16k
| output
stringlengths 1
833
| input
stringclasses 1
value |
|---|---|---|
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, cholesterol translocation that impacts barth syndrome and tangier disease. The molecule is a stabilizing cytochrome oxidase and a apoptosis that impacts aging, diabetic heart disease, and non-alcoholic fatty liver disease. | CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCC(C)C | |
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a apoptosis and a cholesterol translocation that impacts diabetic heart disease, barth syndrome, and aging. The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation that impacts tangier disease and non-alcoholic fatty liver disease. | CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCCC | |
Generate a molecule that fulfills the requirement: The molecule is a stabilizing mitochondrial structure and a apoptosis that impacts diabetic heart disease, tangier disease, and barth syndrome. The molecule is a cholesterol translocation, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts aging and non-alcoholic fatty liver disease. | CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCC(C)C | |
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a plasma kallikrein inhibitor. | CC(CNC(=O)c1cn(Cc2ccc(Cn3ccccc3=O)cc2)nc1N)Oc1cccc(Cl)c1 | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a stabilizing mitochondrial structure that impacts aging, diabetic heart disease, tangier disease, and non-alcoholic fatty liver disease. The molecule is a cholesterol translocation, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, apoptosis that impacts barth syndrome. | CCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCC | |
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a energy storage, nutrient, membrane stabilizer that impacts cardiovascular disease, metabolic syndrome, and pancreatitis. The molecule is a member of the thyroxine treatment class and affects both atherosclerosis and cancer. The molecule is a fat storage, a energy source, and a inflammatory, and it impacts obesity. | CCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCC(C)C | |
Conceptualize a molecule that meets the specified attribute(s): It belongs to the tgr5 agonist class of molecules. | N#Cc1ccc(CCNC(=O)C2CCN2c2cc(N3CCC(CCCC(=O)NC(CCCN=C(N)N)C(=O)O)CC3)nc(C(F)(F)F)n2)cc1 | |
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a nutrient and thyroxine treatment, and it impacts cardiovascular disease. The molecule is a fat storage that impacts atherosclerosis, pancreatitis, and metabolic syndrome. | CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COC(=O)CCCCCCC=CCC=CCC=CCCCCC)OC(=O)CCCCC=CCC=CCC=CCCCCC | |
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, apoptosis that impacts barth syndrome and aging. The molecule is a cholesterol translocation and a stabilizing mitochondrial structure that impacts diabetic heart disease, non-alcoholic fatty liver disease, and tangier disease. | CCC(C)CCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC(C)CC | |
Could you please return a molecule that adheres to this description? The molecule is a pain treatment that impacts inflammatory disease treatment. | Cc1c(Cl)cccc1-n1ccn2c(SCC(=O)c3ccccc3C(F)(F)F)nnc2c1=O | |
Build a molecule that meets the requirement: The molecule is a energy storage, inflammatory, membrane stabilizer that impacts cancer, atherosclerosis, and obesity. The molecule is a fat storage and a energy source, belonging to the thyroxine treatment class of molecules. The molecule is a nutrient that impacts pancreatitis, cardiovascular disease, and metabolic syndrome. | CCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC(C)C | |
Generate a molecule based on this description: The molecule is a cholesterol translocation, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure that impacts barth syndrome and tangier disease. The molecule is a stabilizing cytochrome oxidase and a apoptosis that impacts diabetic heart disease, aging, and non-alcoholic fatty liver disease. | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCC | |
Could you please return a molecule that adheres to this description? The molecule is a energy storage, energy source, membrane stabilizer, nutrient that impacts cancer and obesity. The molecule is a inflammatory that impacts both cardiovascular disease and pancreatitis. The molecule is a fat storage that impacts metabolic syndrome, atherosclerosis, and thyroxine treatment. | CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COC(=O)CCCCCCCCCCCCCCCCCC(C)C | |
I need a molecule that meets the following conditions: The molecule is a liquid crystal display and belongs to the liquid crystal class of molecules. Please represent the molecule in SMILES. | CC1CCC(C(C)C)C(Oc2ccc(CC(=O)O)cc2)C1 | |
Come up with a molecule based on the description: The molecule is a cholesterol translocation and a stabilizing cytochrome oxidase that impacts tangier disease, diabetic heart disease, and aging. The molecule is a proton trap for oxidative phosphorylation, stabilizing mitochondrial structure, apoptosis that impacts non-alcoholic fatty liver disease and barth syndrome. | CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC | |
Come up with a molecule based on the description: The molecule is a 11βhsd1 inhibitor that impacts diabetes treatment. | CC(C)n1c(-c2ccc3c(c2)CNC3=O)nnc1C(C)(C)Oc1c(F)cc(Cl)cc1F | |
Conceptualize a molecule that meets the specified attribute(s): The molecule is a energy source, stabilizing cytochrome oxidase, stabilizing mitochondrial structure, cholesterol translocation. The molecule is a emulsifier, energy storage, nutritional supplement that impacts diabetic heart disease and tangier disease. The molecule is a membrane stabilizer and a food additive, impacting both barth syndrome and non-alcoholic fatty liver disease. The molecule is a surfactant, a apoptosis, and a proton trap for oxidative phosphorylation, it impacts aging and is smooth. | CCCCCC=CCC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCCCCCC | |
Suppose there is a molecule that meets the following description: The molecule is a proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase, apoptosis that impacts tangier disease and aging. The molecule is a cholesterol translocation and a stabilizing mitochondrial structure that impacts barth syndrome, diabetic heart disease, and non-alcoholic fatty liver disease. Please write the SMILES representation of it. | CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC | |
The molecule is a stabilizing mitochondrial structure and a proton trap for oxidative phosphorylation that impacts aging, diabetic heart disease, and barth syndrome. The molecule is a stabilizing cytochrome oxidase, apoptosis, cholesterol translocation that impacts tangier disease and non-alcoholic fatty liver disease. Use the above information to create a molecule. | CCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C | |
Conceptualize a molecule that meets the specified attribute(s): The molecule is a nutrient. | COc1cc(CC(O)COC2OC(CO)C(O)C(O)C2O)cc(O)c1OC | |
Generate a molecule that fulfills the requirement: The molecule is a stabilizing cytochrome oxidase and a stabilizing mitochondrial structure that impacts diabetic heart disease, aging, and barth syndrome. The molecule is a cholesterol translocation, apoptosis, proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease and tangier disease. | CCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCC(C)C | |
Come up with a molecule based on the description: The molecule is a anti bacterial. | CC(C)(C)OC(=O)NC12CCC(CCN3C(=O)COc4ccc(Br)cc43)(CC1)OC2 | |
I need a molecule that meets the following conditions: The molecule is a apoptosis and a proton trap for oxidative phosphorylation that impacts aging, tangier disease, and barth syndrome. The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, cholesterol translocation that impacts diabetic heart disease and non-alcoholic fatty liver disease. Please represent the molecule in SMILES. | CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC | |
Generate a molecule based on this description: The molecule is a surfactant, emulsifier, energy source, nutritional supplement. The molecule is a proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase, food additive that impacts tangier disease and barth syndrome. The molecule is a apoptosis and a stabilizing mitochondrial structure, it impacts aging, and is smooth. The molecule is a cholesterol translocation, energy storage, membrane stabilizer that impacts non-alcoholic fatty liver disease and diabetic heart disease. | CCC(C)CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCC(C)C | |
The molecule is a protein kinase inhibitor and pdk1 inhibitor, and it impacts cancer treatment. Use the above information to create a molecule. | Cc1[nH]c(C=C2C(=O)Nc3cc(C=CCNc4ncccc4C(=O)NCc4ccc(F)c(F)c4)ccc32)c(C)c1C(=O)O | |
I need a molecule that meets the following conditions: When heated to decomposition it emits acrid smoke and irritating fumes. The molecule has both a Bitter and unpleasant taste and a Pleasant odor. Please represent the molecule in SMILES. | COc1ccc(C(C)=O)cc1 | |
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a nutrient that impacts parkinson's disease, alzheimer's disease, non-alcoholic fatty liver disease, and diabetes mellitus type 2. | CCCc1oc(CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCCN)OC(=O)CCCC=CCC=CCC=CCC=CCCCC(C)O)c(C)c1C | |
Can you create a molecule that matches the given characteristics? The molecule is a anti viral member of the anti viral compound class. | O=C(NC1CCCC(Nc2nc(-c3[nH]nc4ncc(Cl)cc34)ncc2F)C1)N1CCCC1CO | |
Generate a molecule based on this description: The molecule is a kinase inhibitor. | CC(C)Cc1ncc(-c2cc(-c3ccccc3CNC(=O)OC(C)(C)C)nc(NCCN(C)C)n2)s1 | |
Generate a molecule based on this description: The molecule is a apoptosis, stabilizing cytochrome oxidase, cholesterol translocation that impacts diabetic heart disease and tangier disease. The molecule is a stabilizing mitochondrial structure and a proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease, barth syndrome, and aging. | CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCCCCCCCC(C)C | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a surfactant, energy storage, energy source, emulsifier, membrane stabilizer, nutrient. | CSC=CC(=O)OC1CC(C)C2(C)CC(=C(C)C)C(=O)CC2C1 | |
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a orexin receptor antagonist. | Cc1nc2sccn2c1C(=O)NCC1CCCCN1C(=O)c1nc(C2CC2)sc1-c1cccc(C(F)(F)F)c1 | |
Conceptualize a molecule that meets the specified attribute(s): The molecule is a nutrient. | CC1(C)CCC2(C(=O)OC3OCC(O)C(OC4OC(CO)C(O)C(O)C4O)C3O)CCC3(C)C(=CCC4C5(C)CCC(OC6OC(CO)C(O)C(O)C6O)C(C)(COC6OC(CO)C(O)C(O)C6O)C5CCC43C)C2C1 | |
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a energy storage, nutrient, emulsifier, surfactant, energy source, membrane stabilizer. | CC=C(C)C(=O)OC1CC(C)(C)CC2C3=CCC4C5(C)CCC(OC6OC(C(=O)O)C(O)C(OC7OCC(O)C(O)C7OC7OC(CO)C(O)C(O)C7O)C6OC6OC(CO)C(O)C(O)C6O)C(C)(CO)C5CCC4(C)C3(C)CC(O)C12CO | |
Conceptualize a molecule that meets the specified attribute(s): The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease and tangier disease. The molecule is a apoptosis and a cholesterol translocation that impacts diabetic heart disease, aging, and barth syndrome. | CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC | |
Generate a molecule that fulfills the requirement: The molecule is a stabilizing mitochondrial structure, cholesterol translocation, apoptosis that impacts aging and non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation and a stabilizing cytochrome oxidase that impacts diabetic heart disease, tangier disease, and barth syndrome. | CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC | |
Suppose there is a molecule that meets the following description: The molecule is a apoptosis and a stabilizing mitochondrial structure that impacts tangier disease, aging, and non-alcoholic fatty liver disease. The molecule is a cholesterol translocation, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts diabetic heart disease and barth syndrome. Please write the SMILES representation of it. | CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCC(C)C | |
Come up with a molecule based on the description: The molecule is a proton trap for oxidative phosphorylation, a membrane stabilizer, and a surfactant, and it impacts non-alcoholic fatty liver disease. The molecule is a cholesterol translocation and a apoptosis, which impacts both diabetic heart disease and barth syndrome, and is characterized as smooth. The molecule is a food additive, a energy storage, and a emulsifier, and it impacts tangier disease. The molecule is a energy source, nutritional supplement, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts aging. | CC(C)CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC(C)C | |
Suppose there is a molecule that meets the following description: The molecule is a apoptosis and a cholesterol translocation that impacts barth syndrome, diabetic heart disease, and aging. The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease and tangier disease. Please write the SMILES representation of it. | CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC(C)C | |
Conceptualize a molecule that meets the specified attribute(s): It belongs to the diabetes treatment class of molecules. | O=P(O)(O)CN(c1ccc2c(ccn2-c2ccc(N3CCCNCC3)nn2)c1)S(=O)(=O)C1C=C(Cl)C=C(Cl)C1 | |
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a flavoring agent, savory, meaty, and sulfur. | COc1cc(C(=O)CO)cc(OC)c1O | |
I need a molecule that meets the following conditions: The molecule is a faah inhibitor. Please represent the molecule in SMILES. | CC1(C)COCN1C(=O)n1nnc2ncccc21 | |
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a stabilizing cytochrome oxidase and a apoptosis that impacts barth syndrome, tangier disease, and non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation, cholesterol translocation, stabilizing mitochondrial structure that impacts diabetic heart disease and aging. | CCC=CCC=CCC=CCC=CCCCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC | |
I need a molecule that meets the following conditions: The molecule is a nutrient that impacts both pancreatitis and atherosclerosis. The molecule is a fat storage that impacts cardiovascular disease, thyroxine treatment, and metabolic syndrome. Please represent the molecule in SMILES. | CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCC=CCC=CCC=CCC=CCCCCC)COC(=O)CCCCCCCCCCCCCC=CCCCCCCCC | |
Build a molecule that meets the requirement: The molecule is anti cancer. | CC(C)=CCCC(C)=CCn1cc(CN2CCCC2)c2cc(F)ccc21 | |
Could you please return a molecule that adheres to this description? The molecule is a apoptosis, cholesterol translocation, proton trap for oxidative phosphorylation that impacts barth syndrome and diabetic heart disease. The molecule is a stabilizing cytochrome oxidase and a stabilizing mitochondrial structure that impacts tangier disease, non-alcoholic fatty liver disease, and aging. | CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC | |
Generate a molecule that fulfills the requirement: The molecule is cancer treatment. | CC(=CC=CN)Cc1ccccn1 | |
Can you create a molecule that matches the given characteristics? The molecule is both a hcv inhibitor and a anti viral. | COc1ccc2c(c1)c(C#N)c(-c1ccc(NS(=O)(=O)C3CC3)cc1)n2C1CCC1 | |
Conceptualize a molecule that meets the specified attribute(s): Hazardous decomposition products formed under fire conditions: carbon oxides, silicon oxides. | C[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C | |
Give me a molecule that satisfies the conditions outlined in the description: The molecule is anti fungal and it impacts hypercholesterolemia treatment. | CC(C)(C)CN1C(=O)C(CCC#N)OC(c2ccccc2Cl)c2cc(Cl)ccc21 | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a cholesterol translocation and a stabilizing mitochondrial structure that impacts diabetic heart disease, non-alcoholic fatty liver disease, and aging. The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, apoptosis that impacts barth syndrome and tangier disease. | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC | |
Build a molecule that meets the requirement: The molecule is a anti allergic and is anti allergic agent. | COc1c(OC(=O)c2ccccc2)c2cccc(OC(C)(C)C)c2oc1=O | |
Come up with a molecule based on the description: It impacts thyroxine treatment, metabolic syndrome, and pancreatitis. The molecule is a fat storage and a nutrient, impacting both cardiovascular disease and atherosclerosis. | CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCC=CCC=CCCCCC)COC(=O)CCCCCCCCCCCC=CCCCCCCCC | |
Suppose there is a molecule that meets the following description: The molecule is anti bacterial. Please write the SMILES representation of it. | CC(=O)Nc1ccc([N+](=O)[O-])c(-c2ccncc2)n1 | |
The molecule is a apoptosis, proton trap for oxidative phosphorylation, cholesterol translocation that impacts barth syndrome and aging. The molecule is a stabilizing mitochondrial structure and a stabilizing cytochrome oxidase that impacts diabetic heart disease, non-alcoholic fatty liver disease, and tangier disease. Use the above information to create a molecule. | CCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C | |
It impacts atherosclerosis, metabolic syndrome, and pancreatitis. The molecule is a nutrient and a fat storage, it impacts cardiovascular disease, and is thyroxine treatment. Use the above information to create a molecule. | CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCCCC=CCCCCCCCC | |
Suppose there is a molecule that meets the following description: The molecule is a fat storage, energy source, and membrane stabilizer that has an effect on cancer and impacts both pancreatitis and atherosclerosis. The molecule is a inflammatory and energy storage, and it impacts cardiovascular disease. The molecule is a nutrient and belongs to the thyroxine treatment class of molecules, impacting both obesity and metabolic syndrome. Please write the SMILES representation of it. | CCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)C | |
Come up with a molecule based on the description: The molecule is a stabilizing mitochondrial structure and a cholesterol translocation that impacts barth syndrome, tangier disease, and diabetic heart disease. The molecule is a apoptosis, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts aging and non-alcoholic fatty liver disease. | CCC=CCC=CCC=CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC | |
Generate a molecule that fulfills the requirement: The molecule is a nutrient that affects breast cancer by impacting cervical cancer, atherosclerosis, and ulcerative colitis. | CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCCC(O)CC)COP(=O)([O-])OCC[N+](C)(C)C | |
Come up with a molecule based on the description: The molecule is a apoptosis and a membrane stabilizer, impacting both diabetic heart disease and tangier disease. The molecule is a emulsifier, a food additive, and a stabilizing mitochondrial structure, it impacts barth syndrome and is smooth. The molecule is a nutritional supplement, a cholesterol translocation, and a proton trap for oxidative phosphorylation, and it impacts non-alcoholic fatty liver disease. The molecule is a energy source, energy storage, stabilizing cytochrome oxidase, surfactant that impacts aging. | CCC(C)CCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC(C)C | |
Conceptualize a molecule that meets the specified attribute(s): The molecule is a hmgcoa reductase inhibitor. | CC(C)Cc1nc(N(C)S(C)(=O)=O)nc(-c2ccc(F)cc2)c1CO | |
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a stabilizing mitochondrial structure, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation that impacts tangier disease and non-alcoholic fatty liver disease. The molecule is a cholesterol translocation and a apoptosis that impacts aging, barth syndrome, and diabetic heart disease. | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCC | |
Give me a molecule that satisfies the conditions outlined in the description: The molecule is light-emitting. | Cc1ccccc1N(c1cccc(-c2cccc3c2oc2ccccc23)c1)c1ccc2ccc3c(N(c4cccc(-c5cccc6c5oc5ccccc56)c4)c4ccccc4C)ccc4ccc1c2c43 | |
Could you please return a molecule that adheres to this description? It impacts diabetes mellitus type 1, cardiovascular disease, and diabetes mellitus type 2. The molecule is a nutrient that impacts insulin resistance, atherosclerosis, and pick's disease. | CCC=CCC=CCC(O)C=CC=CCC=CCCCC(=O)NC(COP(=O)([O-])OCC[N+](C)(C)C)C(O)CCCCCCCCCCCCCCC | |
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a phosphorescent emitter and is both phosphorescent and belongs to the electroluminescent and organic electroluminescent material classes of molecules. | O=P1(c2ccccc2)c2ccccc2-c2ccc3c4ccccc4n(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3c2N1c1ccccc1 | |
Build a molecule that meets the requirement: The molecule is thyroxine treatment and it impacts both atherosclerosis and metabolic syndrome. The molecule is a fat storage and a nutrient, impacting both cardiovascular disease and pancreatitis. | CCCCCCC=CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COC(=O)CCCCCCCCCCCCCCCCCCCCCCC | |
Come up with a molecule based on the description: The molecule is anti oxidant. | C=C(C(=CC1C(O)=CC(O)=CC1C)CC1CC(O)C(O)C(O)C1O)c1ccc(O)c(O)c1 | |
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a ccr2 antagonist. | Cc1c(Nc2ccc(Cl)c(Cl)c2)nc(C2CC2)nc1C(=O)N1CCC(NC2CCOCC2F)CC1 | |
Generate a molecule based on this description: The molecule is a stabilizing cytochrome oxidase and a stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease, tangier disease, and diabetic heart disease. The molecule is a proton trap for oxidative phosphorylation, cholesterol translocation, apoptosis that impacts aging and barth syndrome. | CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC | |
Can you create a molecule that matches the given characteristics? The molecule is a energy source that impacts inflammatory bowel disease, cardiovascular disease, and renal cell carcinoma. It impacts celiac disease, breast cancer, diabetes mellitus type 2, and heart failure. | CCCCCC=CCCCCCC(=O)OC(CC(=O)[O-])C[N+](C)(C)C | |
Suppose there is a molecule that meets the following description: The molecule is a stabilizing mitochondrial structure and a stabilizing cytochrome oxidase that impacts barth syndrome, non-alcoholic fatty liver disease, and aging. The molecule is a proton trap for oxidative phosphorylation, cholesterol translocation, apoptosis that impacts diabetic heart disease and tangier disease. Please write the SMILES representation of it. | CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCC | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a apoptosis, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease and diabetic heart disease. The molecule is a stabilizing cytochrome oxidase and a cholesterol translocation that impacts barth syndrome, tangier disease, and aging. | CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, cholesterol translocation, apoptosis that impacts aging. The molecule is a stabilizing cytochrome oxidase that impacts tangier disease, diabetic heart disease, non-alcoholic fatty liver disease, and barth syndrome. | CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC | |
I need a molecule that meets the following conditions: The molecule is a stabilizing mitochondrial structure, apoptosis, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts tangier disease. The molecule is a cholesterol translocation that impacts barth syndrome, diabetic heart disease, aging, and non-alcoholic fatty liver disease. Please represent the molecule in SMILES. | CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCCCC(C)C | |
Generate a molecule that fulfills the requirement: The molecule is anti bacterial. | CCSc1c(C)[nH]c2c(Br)cc(F)c(F)c12 | |
Can you create a molecule that matches the given characteristics? The molecule is a nutrient that affects breast cancer by impacting atherosclerosis, cervical cancer, and ulcerative colitis. | CCCCCCCCCCCCCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCC=CCC=CCC=CC=CC(O)CCCCC | |
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a apoptosis and a cholesterol translocation that impacts diabetic heart disease, non-alcoholic fatty liver disease, and aging. The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure that impacts tangier disease and barth syndrome. | CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCC | |
Can you create a molecule that matches the given characteristics? The molecule is a energy source, nutrient, energy storage, membrane stabilizer. | CCC(CCCC(=O)O)C(=O)O | |
The molecule is a member of the thyroxine treatment class and affects both metabolic syndrome and cardiovascular disease. The molecule is a fat storage and a nutrient, impacting both pancreatitis and atherosclerosis. Use the above information to create a molecule. | CCCCC=CCCCCCCCC(=O)OCC(COCCCCCCCCCCCCCCCCCC)OC(=O)CCCC=CCC=CCC=CCCCCCCCC | |
Build a molecule that meets the requirement: The molecule is a thrombin inhibitor and belongs to the thrombosis treatment class of molecules. | COC(=O)Cc1cn(-c2cc(C)ccn2)cn1 | |
Build a molecule that meets the requirement: The molecule is a apoptosis that impacts tangier disease, barth syndrome, non-alcoholic fatty liver disease, and aging. The molecule is a cholesterol translocation, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts diabetic heart disease. | CCCCCC=CCC=CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCC=CCCCCCC | |
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a anti viral. | CCC(C)(C)C1CC(F)(F)CC1C(N)=O | |
Conceptualize a molecule that meets the specified attribute(s): The molecule is a nutrient. | CCCCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(N)C(=O)O)OC(=O)CCCCCCCC=CC=CC(=O)CCCCC | |
Give me a molecule that satisfies the conditions outlined in the description: It impacts cardiovascular disease, stomach cancer, parkinson's disease, and colorectal cancer. It has an effect on breast cancer, and impacts alzheimer's disease, diabetes mellitus, and seizure. | CCCCCCCCC=CCCCCCCCC(=O)OC1COC(=O)CCCC=CCC2C=CC(=O)C(C=CC(O)CCCCC)C(O)C(O)C(OP(=O)(O)OC1)C(O)C(O)C2O | |
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a anti viral. | COC(=O)CC1c2cccc(F)c2N=C(N2CCN(c3cccc(C)c3)CC2)N1c1cc(C(F)(F)F)ccc1SC | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is thyroxine treatment and it impacts both metabolic syndrome and pancreatitis. The molecule is a fat storage and a nutrient, impacting both cardiovascular disease and atherosclerosis. | CCCCCCCCC=CCCCCCCCCCC(=O)OCC(COCCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCC | |
Based on the given information, generate a molecule that meets the desired specifications: It has an effect on stomach cancer, and impacts seizure, parkinson's disease, and breast cancer. It has an effect on colorectal cancer, and impacts alzheimer's disease, diabetes mellitus, and cardiovascular disease. | CCCCCC=CCC=CCCCCCCCCCC(=O)OCC1COP(=O)(O)OC2C(O)C(O)C(O)C(CCCCCCC(=O)O1)C(=O)CC(O)C(C=CC(O)CCCCC)C(O)C2O | |
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a apoptosis and a proton trap for oxidative phosphorylation that impacts diabetic heart disease, barth syndrome, and non-alcoholic fatty liver disease. The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, cholesterol translocation that impacts aging and tangier disease. | CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C | |
Build a molecule that meets the requirement: The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, cholesterol translocation that impacts barth syndrome and diabetic heart disease. The molecule is a apoptosis and a stabilizing mitochondrial structure that impacts tangier disease, non-alcoholic fatty liver disease, and aging. | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCC=CCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCCCCC | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a energy source, inflammatory, energy storage, nutrient that belongs to the thyroxine treatment class of molecules and impacts atherosclerosis. The molecule is a membrane stabilizer that affects cancer by impacting pancreatitis. The molecule is a fat storage that impacts metabolic syndrome, cardiovascular disease, and obesity. | CCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCC(C)CC | |
Suppose there is a molecule that meets the following description: The molecule is a stabilizing cytochrome oxidase and a apoptosis that impacts barth syndrome, diabetic heart disease, and aging. The molecule is a stabilizing mitochondrial structure, cholesterol translocation, proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease and tangier disease. Please write the SMILES representation of it. | CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCC | |
I need a molecule that meets the following conditions: The molecule is a apoptosis and a stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease, diabetic heart disease, and barth syndrome. The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, cholesterol translocation that impacts tangier disease and aging. Please represent the molecule in SMILES. | CCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC(C)C | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a stabilizing mitochondrial structure and a proton trap for oxidative phosphorylation that impacts diabetic heart disease, tangier disease, and barth syndrome. The molecule is a stabilizing cytochrome oxidase, apoptosis, cholesterol translocation that impacts non-alcoholic fatty liver disease and aging. | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCC=CCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC | |
Generate a molecule based on this description: The molecule is a serotonin antagonist. | CCN1CCN(c2nc(-c3ccc(OCCO)cc3)cc3cc(F)ccc23)CC1.Cl.Cl | |
Can you create a molecule that matches the given characteristics? The molecule is a cholesterol translocation, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease and tangier disease. The molecule is a proton trap for oxidative phosphorylation and a apoptosis that impacts aging, barth syndrome, and diabetic heart disease. | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a stabilizing cytochrome oxidase, cholesterol translocation, proton trap for oxidative phosphorylation that impacts tangier disease and non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure and a apoptosis that impacts diabetic heart disease, barth syndrome, and aging. | CCCCCCC=CC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCC(C)C | |
Come up with a molecule based on the description: The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation that impacts aging, non-alcoholic fatty liver disease, and barth syndrome. The molecule is a stabilizing cytochrome oxidase, apoptosis, stabilizing mitochondrial structure that impacts tangier disease and diabetic heart disease. | CCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCC(C)CC | |
The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts diabetic heart disease and tangier disease. The molecule is a cholesterol translocation and a apoptosis that impacts barth syndrome, aging, and non-alcoholic fatty liver disease. Use the above information to create a molecule. | CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCC)OC(=O)CCCCCCCCCCC(C)C | |
Can you create a molecule that matches the given characteristics? The molecule is a anti bacterial. | Cc1ncc(SCC2=C(C(=O)O)N3C(=O)C(O)C3SC2)s1 | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a cholesterol translocation and a stabilizing cytochrome oxidase that impacts tangier disease, aging, and barth syndrome. The molecule is a apoptosis, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure that impacts diabetic heart disease and non-alcoholic fatty liver disease. | CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCCCC |
End of preview. Expand
in Data Studio
README.md exists but content is empty.
- Downloads last month
- 20