instruction
stringlengths 52
2.16k
| output
stringlengths 1
833
| input
stringclasses 1
value |
|---|---|---|
The molecule is a nutritional supplement, a emulsifier, and a membrane stabilizer, and it impacts aging. The molecule is a surfactant and a cholesterol translocation that impacts diabetic heart disease, barth syndrome, and tangier disease. The molecule is a stabilizing cytochrome oxidase and a food additive, it impacts non-alcoholic fatty liver disease, and is smooth. The molecule is a proton trap for oxidative phosphorylation, energy storage, stabilizing mitochondrial structure, energy source, apoptosis. Use the above information to create a molecule. | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCC=CCC=CCC=CCC=CCC=CCC | |
Generate a molecule that fulfills the requirement: The molecule is a stabilizing mitochondrial structure that impacts aging, non-alcoholic fatty liver disease, tangier disease, and barth syndrome. The molecule is a cholesterol translocation, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, apoptosis that impacts diabetic heart disease. | CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCC | |
Build a molecule that meets the requirement: The molecule is both a protein kinase inhibitor and a kinase inhibitor. | CC(C)(O)CNC1CN(c2cc(C#N)cc(Nc3nc(NC4CC4)c4ncc(C#N)n4n3)c2Cl)CCC1NC(=O)O | |
Can you create a molecule that matches the given characteristics? The molecule is a fxr agonist. | COc1cc(C)cc2ncc(C(C)C)nc12 | |
Build a molecule that meets the requirement: The molecule is a neurological treatment. | Cc1cc(-c2cc(CO)ccn2)ccc1C(N)=O | |
Could you please return a molecule that adheres to this description? The molecule is a proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts aging and tangier disease. The molecule is a apoptosis and a cholesterol translocation that impacts diabetic heart disease, non-alcoholic fatty liver disease, and barth syndrome. | CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCC | |
Generate a molecule based on this description: The molecule is a stabilizing cytochrome oxidase and a apoptosis that impacts diabetic heart disease, non-alcoholic fatty liver disease, and aging. The molecule is a proton trap for oxidative phosphorylation, cholesterol translocation, stabilizing mitochondrial structure that impacts tangier disease and barth syndrome. | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCC=CCCCCCCCC | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a fat storage and belongs to the thyroxine treatment class of molecules, impacting cardiovascular disease. The molecule is a nutrient that impacts pancreatitis, metabolic syndrome, and atherosclerosis. | CCCCCC=CCC=CCC=CCC=CCCCC(=O)OCC(COC(=O)CCCCCCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC | |
Build a molecule that meets the requirement: The molecule is a cholesterol translocation that impacts barth syndrome, aging, tangier disease, and diabetic heart disease. The molecule is a apoptosis, stabilizing cytochrome oxidase, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease. | CCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C | |
Generate a molecule based on this description: The molecule is a nutrient. | COc1cc2c(=O)oc3c(O)c(O)cc4c(=O)oc(c1OC)c2c34 | |
Can you create a molecule that matches the given characteristics? The molecule is a stabilizing cytochrome oxidase, apoptosis, stabilizing mitochondrial structure that impacts barth syndrome and non-alcoholic fatty liver disease. The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation that impacts tangier disease, diabetic heart disease, and aging. | CCC=CCC=CCC=CCC=CCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC | |
Generate a molecule that fulfills the requirement: It influences both colorectal cancer and stomach cancer, as well as affecting parkinson's disease and alzheimer's disease. It has an effect on breast cancer, and impacts seizure, diabetes mellitus, and cardiovascular disease. | CCC=CCC=CCC=CCC=CCCCCCCC(=O)OCC(COP(=O)(O)OC1C(O)C(O)C(O)C(O)C1O)OC(=O)CCCC(O)C=CC=CCC=CC=CC(O)CCCCC | |
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a stabilizing cytochrome oxidase and a apoptosis that impacts barth syndrome, aging, and non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure, cholesterol translocation, proton trap for oxidative phosphorylation that impacts tangier disease and diabetic heart disease. | CCCCCCC=CC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCCCCC | |
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is alzheimer's treatment and it impacts epilepsy treatment. | FC(F)(F)C1CCOC2(CNC2)C1 | |
Conceptualize a molecule that meets the specified attribute(s): The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation that impacts aging, barth syndrome, and tangier disease. The molecule is a apoptosis, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts diabetic heart disease and non-alcoholic fatty liver disease. | CCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)CC | |
Generate a molecule that fulfills the requirement: The molecule is a proton trap for oxidative phosphorylation and a cholesterol translocation that impacts non-alcoholic fatty liver disease, tangier disease, and aging. The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, apoptosis that impacts barth syndrome and diabetic heart disease. | CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC | |
Come up with a molecule based on the description: The molecule is a stabilizing mitochondrial structure, a surfactant, and a membrane stabilizer, and it impacts non-alcoholic fatty liver disease. The molecule is a stabilizing cytochrome oxidase and a cholesterol translocation that impacts diabetic heart disease, barth syndrome, and aging. The molecule is a apoptosis and a emulsifier, it impacts tangier disease, and is smooth. The molecule is a energy source, food additive, proton trap for oxidative phosphorylation, energy storage, nutritional supplement. | CCC(C)CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C | |
Build a molecule that meets the requirement: The molecule is a aldose reductase inhibitor. | CC1C(=O)c2ccccc2C(CCNOCc2ccccc2)C1=C=O | |
Come up with a molecule based on the description: The molecule is a proton trap for oxidative phosphorylation and a stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease, diabetic heart disease, and aging. The molecule is a stabilizing mitochondrial structure, cholesterol translocation, apoptosis that impacts barth syndrome and tangier disease. | CCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCC(C)CC | |
Generate a molecule that fulfills the requirement: The molecule is a fat storage and a nutrient that impacts cancer, atherosclerosis, metabolic syndrome, and cardiovascular disease. The molecule is a inflammatory that impacts both obesity and pancreatitis. The molecule is a energy storage, a membrane stabilizer, and a energy source, and it impacts thyroxine treatment. | CCC(C)CCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC(C)C | |
The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, apoptosis, cholesterol translocation. It impacts tangier disease, aging, non-alcoholic fatty liver disease, diabetic heart disease, and barth syndrome. Use the above information to create a molecule. | CCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC | |
Generate a molecule based on this description: The molecule is a proton trap for oxidative phosphorylation and a stabilizing mitochondrial structure that impacts tangier disease, barth syndrome, and non-alcoholic fatty liver disease. The molecule is a stabilizing cytochrome oxidase, apoptosis, cholesterol translocation that impacts diabetic heart disease and aging. | CCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCC(C)C | |
I need a molecule that meets the following conditions: The molecule is a fat storage that impacts both cardiovascular disease and thyroxine treatment. The molecule is a nutrient that impacts atherosclerosis, pancreatitis, and metabolic syndrome. Please represent the molecule in SMILES. | CCCCC=CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCC=CCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC | |
Suppose there is a molecule that meets the following description: The molecule is a anti protozoal and belongs to the anti bacterial class of molecules. Please write the SMILES representation of it. | CC(C)(C)C(N)c1nc2ccccc2[nH]1 | |
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a 5ht2c receptor agonist. | O=C(Nc1cccnc1)c1ccc2c3c1CCN3CCNC2 | |
Conceptualize a molecule that meets the specified attribute(s): The molecule is a stabilizing cytochrome oxidase that impacts barth syndrome, aging, tangier disease, and diabetic heart disease. The molecule is a apoptosis, cholesterol translocation, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease. | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC | |
The molecule is a hiv inhibitor and belongs to the anti viral class of molecules. Use the above information to create a molecule. | CCOC(=O)C(OC(C)(C)C)c1c(C)c2c(c(C)c1-c1cc(F)c3c(c1C)CCCO3)CCN(S(=O)(=O)c1ccccc1[N+](=O)[O-])CC2 | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is anti inflammatory. | COc1ccc2c(c1)Sc1cccc(C(=O)O)c1N2 | |
Suppose there is a molecule that meets the following description: The molecule is a hcv inhibitor, a anti viral, a ns5a inhibitor, and anti viral compound. Please write the SMILES representation of it. | CCCNCc1nc2ccc(C#Cc3ccc(-c4cnc(CN(CCC)C(=O)OC(C)(C)C)[nH]4)cc3)cc2[nH]1 | |
Conceptualize a molecule that meets the specified attribute(s): The light-emitting molecule has an effect on light-emitting device. | CC(C)(C)c1ccc(-c2cc(-c3ccc(C(C)(C)C)cc3)cc(-c3cc(-c4cc(-c5ccc(C(C)(C)C)cc5)cc(-c5ccc(C(C)(C)C)cc5)c4)cc(N4c5ccc(Cl)cc5Oc5cc(Cl)ccc54)c3)c2)cc1 | |
Can you create a molecule that matches the given characteristics? The molecule is a apoptosis, cholesterol translocation, stabilizing cytochrome oxidase that impacts aging and diabetic heart disease. The molecule is a stabilizing mitochondrial structure and a proton trap for oxidative phosphorylation that impacts tangier disease, barth syndrome, and non-alcoholic fatty liver disease. | CCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCC(C)CC | |
Suppose there is a molecule that meets the following description: The molecule is a proton trap for oxidative phosphorylation and a cholesterol translocation that impacts tangier disease, diabetic heart disease, and barth syndrome. The molecule is a stabilizing cytochrome oxidase, apoptosis, stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease and aging. Please write the SMILES representation of it. | CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC | |
Can you create a molecule that matches the given characteristics? The molecule is a apoptosis that impacts barth syndrome, aging, diabetic heart disease, and tangier disease. The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, cholesterol translocation, stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease. | CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC | |
Based on the given information, generate a molecule that meets the desired specifications: It impacts metabolic syndrome, atherosclerosis, and cardiovascular disease. The molecule is a nutrient, a fat storage, and a thyroxine treatment, and it impacts pancreatitis. | CCCCCCC=CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCC=CCCCCCCCC)COC(=O)CCCCCCCCCCCCCCCCCCC | |
I need a molecule that meets the following conditions: The molecule is a proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease, barth syndrome, diabetic heart disease, and aging. The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, cholesterol translocation, apoptosis that impacts tangier disease. Please represent the molecule in SMILES. | CCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C | |
Conceptualize a molecule that meets the specified attribute(s): The molecule is a nutrient that impacts alzheimer's disease, diabetes mellitus type 2, parkinson's disease, and non-alcoholic fatty liver disease. | CCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CC=CC(O)CCCCC)COP(=O)(O)OCCN | |
Could you please return a molecule that adheres to this description? The molecule is a cholesterol translocation and a stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease, tangier disease, and diabetic heart disease. The molecule is a apoptosis, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts aging and barth syndrome. | CCCCCC=CCC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC | |
I need a molecule that meets the following conditions: The molecule is a nutrient that impacts non-alcoholic fatty liver disease, diabetes mellitus type 2, alzheimer's disease, and parkinson's disease. Please represent the molecule in SMILES. | CCCCCC=CCC=CCC=CCC1OC1CCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCCN | |
Suppose there is a molecule that meets the following description: The molecule is a stabilizing mitochondrial structure that impacts tangier disease, aging, non-alcoholic fatty liver disease, and barth syndrome. The molecule is a stabilizing cytochrome oxidase, cholesterol translocation, apoptosis, proton trap for oxidative phosphorylation that impacts diabetic heart disease. Please write the SMILES representation of it. | CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCCC(C)CC | |
Could you please return a molecule that adheres to this description? The molecule is a liquid crystal and belongs to the optoelectronic class of molecules. | CCCCCc1ccc2cc(-c3ccc(-c4cc(F)c(OC)c(F)c4)c(F)c3)ccc2c1 | |
I need a molecule that meets the following conditions: The molecule is a hsp90 inhibitor and belongs to the cancer treatment class of molecules. Please represent the molecule in SMILES. | CCNC(=O)c1nnc(-c2cc(C(C)C)c(O)cc2O)n1-c1ccc(S(=O)(=O)N2CCC(C(=O)N3CCC(CN(C)C(=O)Oc4ccc5nc6c(c(CC)c5c4)Cn4c-6cc5c(c4=O)COC(=O)C5(O)CC)CC3)CC2)cc1 | |
Conceptualize a molecule that meets the specified attribute(s): The molecule is a mmp inhibitor and belongs to the anti inflammatory class of molecules. | Cc1ccccc1S(=O)(=O)OCC1(CC(=O)O)COCCO1 | |
Can you create a molecule that matches the given characteristics? The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts barth syndrome and diabetic heart disease. The molecule is a cholesterol translocation and a apoptosis that impacts tangier disease, aging, and non-alcoholic fatty liver disease. | CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC | |
Conceptualize a molecule that meets the specified attribute(s): The molecule is a apoptosis, cholesterol translocation, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure that impacts tangier disease, diabetic heart disease, aging, and barth syndrome. | CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC(C)C | |
Come up with a molecule based on the description: The molecule is cancer treatment. | CN(C(=O)NCc1ccccc1)N1CC(=O)N2C(Cc3ccccc3)C(=O)N(Cc3cccc(F)c3)CC21 | |
Give me a molecule that satisfies the conditions outlined in the description: The electroluminescent molecule has an effect on electroluminescent device. | c1cnc(-c2cccc3c2oc2ccccc23)c(-c2cccnc2-n2c3ccccc3n3c4ccccc4nc23)c1 | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a apoptosis, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation that impacts aging and tangier disease. The molecule is a cholesterol translocation and a stabilizing mitochondrial structure that impacts diabetic heart disease, non-alcoholic fatty liver disease, and barth syndrome. | CCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCCCCCC | |
Build a molecule that meets the requirement: The molecule is a fat storage and thyroxine treatment, and it impacts metabolic syndrome. The molecule is a nutrient that impacts cardiovascular disease, atherosclerosis, and pancreatitis. | CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCCCCCCC | |
Could you please return a molecule that adheres to this description? The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure that impacts barth syndrome and diabetic heart disease. The molecule is a cholesterol translocation and a apoptosis that impacts tangier disease, non-alcoholic fatty liver disease, and aging. | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCCCC | |
Could you please return a molecule that adheres to this description? The molecule is a food additive, a stabilizing mitochondrial structure, a energy source, and smooth. The molecule is a energy storage, nutritional supplement, stabilizing cytochrome oxidase, emulsifier that impacts barth syndrome. The molecule is a proton trap for oxidative phosphorylation, a membrane stabilizer, and a surfactant, and it impacts diabetic heart disease. The molecule is a apoptosis and a cholesterol translocation that impacts tangier disease, non-alcoholic fatty liver disease, and aging. | CC(C)CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC(C)C | |
Generate a molecule that fulfills the requirement: The molecule is a nutritional supplement and a energy source, impacting both diabetic heart disease and non-alcoholic fatty liver disease. The molecule is a emulsifier, food additive, cholesterol translocation, surfactant that impacts tangier disease. The molecule is a stabilizing cytochrome oxidase, a energy storage, and a apoptosis, and it impacts barth syndrome. The molecule is a membrane stabilizer, a stabilizing mitochondrial structure, and a proton trap for oxidative phosphorylation, it impacts aging and is smooth. | CCC(C)CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCC(C)C | |
Could you please return a molecule that adheres to this description? The molecule is a stabilizing cytochrome oxidase, cholesterol translocation, proton trap for oxidative phosphorylation that impacts tangier disease and diabetic heart disease. The molecule is a apoptosis and a stabilizing mitochondrial structure that impacts barth syndrome, aging, and non-alcoholic fatty liver disease. | CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCC(C)C | |
Generate a molecule based on this description: The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation that impacts diabetic heart disease, aging, and barth syndrome. The molecule is a apoptosis, stabilizing mitochondrial structure, stabilizing cytochrome oxidase that impacts tangier disease and non-alcoholic fatty liver disease. | CCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCC(C)CC | |
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a thyroxine treatment and nutrient, and it impacts metabolic syndrome. The molecule is a fat storage that impacts cardiovascular disease, pancreatitis, and atherosclerosis. | CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCC | |
Come up with a molecule based on the description: The molecule is a inflammatory, energy source, energy storage that impacts cancer, cardiovascular disease, and atherosclerosis. The molecule is a membrane stabilizer and fat storage, and it impacts obesity. The molecule is a nutrient that impacts metabolic syndrome, pancreatitis, and thyroxine treatment. | CCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCC(C)C | |
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a proton trap for oxidative phosphorylation, stabilizing mitochondrial structure, stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease and barth syndrome. The molecule is a cholesterol translocation and a apoptosis that impacts diabetic heart disease, tangier disease, and aging. | CCC=CCC=CCC=CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC | |
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a proton trap for oxidative phosphorylation and a stabilizing cytochrome oxidase that impacts tangier disease, diabetic heart disease, and non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure, cholesterol translocation, apoptosis that impacts aging and barth syndrome. | CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC(C)C | |
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a nutrient that affects breast cancer by impacting cervical cancer, ulcerative colitis, and atherosclerosis. | CCC=CCC=CCC=CCC=CCC=CC=CC(O)CCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC | |
Suppose there is a molecule that meets the following description: The molecule is a factor xa inhibitor and belongs to the anti thrombotic class of molecules. Please write the SMILES representation of it. | NCC(C(=O)Nc1ccc(N2CCOCC2=O)cc1OC(F)F)N(CC(F)F)CC1CC1 | |
Suppose there is a molecule that meets the following description: The molecule is a apoptosis and a cholesterol translocation that impacts tangier disease, barth syndrome, and non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation, stabilizing mitochondrial structure, stabilizing cytochrome oxidase that impacts aging and diabetic heart disease. Please write the SMILES representation of it. | CCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC(C)C |
Subsets and Splits
No saved queries yet
Save your SQL queries to embed, download, and access them later. Queries will appear here once saved.