instruction
stringlengths 52
2.16k
| output
stringlengths 1
833
| input
stringclasses 1
value |
|---|---|---|
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a stabilizing cytochrome oxidase, apoptosis, stabilizing mitochondrial structure that impacts aging and non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation and a cholesterol translocation that impacts barth syndrome, diabetic heart disease, and tangier disease. | CCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C | |
Can you create a molecule that matches the given characteristics? The molecule is a fat storage, inflammatory, energy source that impacts atherosclerosis, metabolic syndrome, and cardiovascular disease. The molecule is a nutrient, a energy storage, and a membrane stabilizer. It is a member of the thyroxine treatment class of molecules that affects cancer and has an impact on both obesity and pancreatitis. | CCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCC(C)C)COC(=O)CCCCCCCCCCCCCCCCC(C)C | |
The molecule is a nutrient that impacts both atherosclerosis and metabolic syndrome. The molecule is a fat storage and thyroxine treatment, impacting both pancreatitis and cardiovascular disease. Use the above information to create a molecule. | CCC=CCC=CCC=CCC=CCCCCCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCCCCCCCC)COC(=O)CCCCCCCC=CCCCCCC | |
Build a molecule that meets the requirement: The molecule is anti body. | CCCCn1cc2c(n1)c(Cl)nc1ccccc12 | |
Generate a molecule based on this description: The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, cholesterol translocation that impacts aging and non-alcoholic fatty liver disease. The molecule is a apoptosis and a proton trap for oxidative phosphorylation that impacts barth syndrome, diabetic heart disease, and tangier disease. | CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCC(C)C | |
The molecule is a stabilizing cytochrome oxidase and a cholesterol translocation that impacts barth syndrome, aging, and non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation, stabilizing mitochondrial structure, apoptosis that impacts diabetic heart disease and tangier disease. Use the above information to create a molecule. | CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCC=CCC=CCC=CCC=CCC | |
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a hpk1 antagonist. | Cn1ccc2c(-c3ccc(Nc4ccc(S(C)(=O)=O)cn4)c4c3CNC4=O)ccnc21 | |
Conceptualize a molecule that meets the specified attribute(s): The molecule is a proton trap for oxidative phosphorylation and a apoptosis that impacts diabetic heart disease, aging, and tangier disease. The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, cholesterol translocation that impacts barth syndrome and non-alcoholic fatty liver disease. | CCC=CCC=CCC=CCC=CCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC | |
I need a molecule that meets the following conditions: The molecule is a fat storage, nutrient, energy storage that impacts atherosclerosis, cancer, and obesity. The molecule is a energy source and inflammatory, and it impacts pancreatitis. The molecule is a membrane stabilizer and thyroxine treatment, impacting both metabolic syndrome and cardiovascular disease. Please represent the molecule in SMILES. | CCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C | |
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a platelet aggregation inhibitor and belongs to the paf antagonist class of molecules. | CCCOc1c(OCCn2ccnc2)cc(C2CCC(c3cc(OC)c(OC)c(OC)c3)O2)cc1S(=O)(=O)CC(C)O | |
The molecule is a jak inhibitor. Use the above information to create a molecule. | C=CC(=O)N1CCCC(n2cc(Nc3ncc(C(N)=O)c(Nc4c(C)cc(C(=O)NC5CCC5)cc4OC)n3)cn2)C1 | |
Suppose there is a molecule that meets the following description: It impacts insulin resistance. Please write the SMILES representation of it. | CCCCC=CCCCCCCCC(=O)OCC(CO)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC | |
Could you please return a molecule that adheres to this description? The molecule is a nutrient, a flavoring agent, spicy, cinnamon, and floral. | OCC1OC(OC2C(CO)OC(O)C(O)C2O)C(O)C(O)C1O | |
Can you create a molecule that matches the given characteristics? The molecule is a diabetes treatment. | COC(=O)C(=Cc1cncc(Br)c1C)N=[N+]=[N-] | |
Based on the given information, generate a molecule that meets the desired specifications: It belongs to the anti viral class of molecules. | O=C(O)c1cn(Cc2ccccc2Sc2ccc(Cl)cc2)c2cc(Br)cnc2c1=O | |
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a proton trap for oxidative phosphorylation and a stabilizing cytochrome oxidase that impacts diabetic heart disease, non-alcoholic fatty liver disease, and tangier disease. The molecule is a apoptosis, cholesterol translocation, stabilizing mitochondrial structure that impacts barth syndrome and aging. | CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCC | |
Conceptualize a molecule that meets the specified attribute(s): The molecule is both a glycogen phosphorylase inhibitor and a diabetes treatment. | O=C(NC(Cc1ccc(F)cc1)C(=O)N1CCCN(CCO)CC1)c1cc2cc(Cl)ncc2[nH]1 | |
Can you create a molecule that matches the given characteristics? The molecule is a type 2 diabetes treatment, a jnk inhibitor, and obesity treatment. | CC(=O)N1CCC(NC(=O)c2cccc3cnc(NC4CCC(O)CC4)nc23)CC1 | |
Generate a molecule that fulfills the requirement: The molecule is a nutrient and fat storage, and it impacts atherosclerosis. It impacts metabolic syndrome, thyroxine treatment, cardiovascular disease, and pancreatitis. | CCCCCC=CCC=CCC=CCC=CCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCC)OCCCCCCCCCCCCCCCCCC | |
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a apoptosis and a proton trap for oxidative phosphorylation that impacts diabetic heart disease, barth syndrome, and tangier disease. The molecule is a cholesterol translocation, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease and aging. | CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCC(C)C | |
Conceptualize a molecule that meets the specified attribute(s): The molecule is a apoptosis and a proton trap for oxidative phosphorylation that impacts diabetic heart disease, non-alcoholic fatty liver disease, and tangier disease. The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, cholesterol translocation that impacts barth syndrome and aging. | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC | |
The molecule is a inflammatory, energy source, membrane stabilizer, energy storage that impacts lipotoxicity and metabolic syndrome. Use the above information to create a molecule. | CCCCCCCCCCCCCCCC(=O)OCC(CO)OC(=O)CCCCCCCCCCCCCCCCCC(C)C | |
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a apoptosis and a stabilizing cytochrome oxidase that impacts diabetic heart disease, non-alcoholic fatty liver disease, and aging. The molecule is a proton trap for oxidative phosphorylation, cholesterol translocation, stabilizing mitochondrial structure that impacts tangier disease and barth syndrome. | CCCCCCC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCC | |
Generate a molecule based on this description: The molecule is a stabilizing cytochrome oxidase and a stabilizing mitochondrial structure that impacts diabetic heart disease, non-alcoholic fatty liver disease, and aging. The molecule is a apoptosis, proton trap for oxidative phosphorylation, cholesterol translocation that impacts tangier disease and barth syndrome. | CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCCCCCCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a pi3 kinase inhibitor. | C=CC(=O)N1CCC(O)(C#Cc2cc3nc(-c4cccc5[nH]ncc45)nc(N4CCOCC4)c3s2)CC1 | |
Generate a molecule that fulfills the requirement: The molecule is a nutrient that impacts alzheimer's disease, non-alcoholic fatty liver disease, parkinson's disease, and diabetes mellitus type 2. | CCCCCC=CCC=CCC=CCCCCC(=O)OCC(COP(=O)(O)OCCN)OC(=O)CCCC=CCC=CCC=CCC=CCCC(O)CC | |
Come up with a molecule based on the description: The molecule is a inflammatory, fat storage, membrane stabilizer that impacts cardiovascular disease, pancreatitis, and metabolic syndrome. The molecule is a nutrient and thyroxine treatment, and it impacts cancer. The molecule is a energy source and a energy storage, impacting both atherosclerosis and obesity. | CCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)C | |
Suppose there is a molecule that meets the following description: The substance may polymerize. When heated to decomposition it emits acrid smoke and fumes. The molecule has Slightly aromatic odor. Please write the SMILES representation of it. | C=CCC | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a apoptosis, stabilizing mitochondrial structure, stabilizing cytochrome oxidase that impacts aging and tangier disease. The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation that impacts barth syndrome, non-alcoholic fatty liver disease, and diabetic heart disease. | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCCCCCCC | |
I need a molecule that meets the following conditions: The molecule is a cancer treatment. Please represent the molecule in SMILES. | Cc1cc(NC(=O)c2ccc(NS(=O)(=O)CCO)cc2N2CCC3(CC2)CC3)cc(N2CCC(F)(F)CC2)c1 | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a proton trap for oxidative phosphorylation and a apoptosis that impacts barth syndrome, aging, and diabetic heart disease. The molecule is a stabilizing mitochondrial structure, cholesterol translocation, stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease and tangier disease. | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC | |
Can you create a molecule that matches the given characteristics? It impacts atherosclerosis, cardiovascular disease, and pancreatitis. The molecule is a fat storage and nutrient, belonging to the thyroxine treatment class of molecules, and impacts metabolic syndrome. | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COC(=O)CCCCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCC=CCCCCCC | |
Generate a molecule that fulfills the requirement: The molecule is a calcium receptor antagonist. | CCOC(=O)CCc1ccc(OCC(O)CNC(C)(C)Cc2ccc3c(c2)CCCC3)c(C#N)c1 | |
I need a molecule that meets the following conditions: The molecule is a cholesterol translocation that impacts barth syndrome, aging, diabetic heart disease, and tangier disease. The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure, apoptosis that impacts non-alcoholic fatty liver disease. Please represent the molecule in SMILES. | CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCC | |
Come up with a molecule based on the description: The molecule is a nutrient. | CCC=CCC=CC=CC(O)CCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(N)C(=O)O | |
Conceptualize a molecule that meets the specified attribute(s): The molecule is a proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase, cholesterol translocation, stabilizing mitochondrial structure that impacts tangier disease. The molecule is a apoptosis that impacts diabetic heart disease, aging, barth syndrome, and non-alcoholic fatty liver disease. | CCC=CCC=CCC=CCC=CCCCCC(=O)OC(COC(=O)CCCCCCCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCCCC | |
The molecule is a nutrient. Use the above information to create a molecule. | O=c1c(-c2ccc3c(c2)OCO3)coc2cc(O)ccc12 | |
Generate a molecule that fulfills the requirement: The molecule is a nutrient that impacts diabetes mellitus type 2, parkinson's disease, alzheimer's disease, and non-alcoholic fatty liver disease. | CCCCCC=CCC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCCN)OC(=O)CCCC=CC=CC(O)CC=CCC=CCCCCC | |
I need a molecule that meets the following conditions: The molecule is a electronic device, organic electroluminescent material, and electroluminescent compound. Please represent the molecule in SMILES. | c1ccc(-n2c3ccccc3c3cc(-c4ccc(N(c5ccc(-c6cccc(-c7ccc8ccccc8c7)c6)cc5)c5ccc(-c6ccc7c(c6)sc6ccccc67)cc5)cc4)ccc32)cc1 | |
Could you please return a molecule that adheres to this description? The molecule is a cholesterol translocation, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation that impacts tangier disease and non-alcoholic fatty liver disease. The molecule is a stabilizing cytochrome oxidase and a apoptosis that impacts barth syndrome, diabetic heart disease, and aging. | CCCCCC=CCC=CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC | |
I need a molecule that meets the following conditions: The molecule is a stabilizing cytochrome oxidase and a stabilizing mitochondrial structure that impacts tangier disease, barth syndrome, and non-alcoholic fatty liver disease. The molecule is a cholesterol translocation, apoptosis, proton trap for oxidative phosphorylation that impacts diabetic heart disease and aging. Please represent the molecule in SMILES. | CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)CC | |
Can you create a molecule that matches the given characteristics? The molecule is a anti inflammatory and is anti microbial. | CCCCCCCCN1CC(CCCCCCCn2c(=O)c3c(ncn3C)n(C)c2=O)OC1=O | |
Generate a molecule that fulfills the requirement: The molecule is a kinase inhibitor that impacts cancer treatment. | CNC(=O)c1cc(-n2ccc3cc(NC(=O)Nc4cccc(C(F)(F)F)c4)ccc32)ccn1 | |
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a nutrient. | C=C1CCC2C3C(C(C)(C)O)CCC2(C)C13 | |
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a member of the anti viral class and affects hcv treatment. | CC=CCC(C)C(O)C1C(=O)NC(CC)C(=O)N(C)CC(=O)N(C)C(C(C)OCCCCS)C(=O)NC(C(C)C)C(=O)N(C)C(CC(C)C)C(=O)NC(C)C(=O)NC(C)C(=O)N(C)C(CC(C)C)C(=O)N(C)C(CC(C)C)C(=O)N(C)C(C(C)C)C(=O)N1C | |
Conceptualize a molecule that meets the specified attribute(s): The molecule is a proton trap for oxidative phosphorylation and a cholesterol translocation that impacts aging, non-alcoholic fatty liver disease, and barth syndrome. The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, apoptosis that impacts tangier disease and diabetic heart disease. | CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC | |
Conceptualize a molecule that meets the specified attribute(s): The molecule is a emulsifier and a stabilizing cytochrome oxidase, impacting both non-alcoholic fatty liver disease and diabetic heart disease. The molecule is a energy source and a apoptosis that impacts aging, barth syndrome, and tangier disease. The molecule is a food additive, cholesterol translocation, membrane stabilizer, stabilizing mitochondrial structure. The molecule is a nutritional supplement, energy storage, proton trap for oxidative phosphorylation, surfactant, and smooth. | CCC(C)CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C | |
The molecule is a cholesterol translocation, apoptosis, proton trap for oxidative phosphorylation that impacts diabetic heart disease and non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure and a stabilizing cytochrome oxidase that impacts barth syndrome, aging, and tangier disease. Use the above information to create a molecule. | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC | |
Can you create a molecule that matches the given characteristics? The molecule is a organic electroluminescent member of the electroluminescent class. | Cc1cccc(N(c2ccc3cc4c5cccc6c7cc8ccc(N(c9cccc(C)c9)C9CC=Cc%10c9oc9ccccc%109)cc8cc7n(c4cc3c2)c56)c2cccc3c2oc2ccccc23)c1 | |
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: When heated to decomp it emits very toxic fumes of hydrogen chloride and nitrogen oxides. | CC(C)(N)Cc1ccc(Cl)cc1 | |
Come up with a molecule based on the description: The molecule is a protein kinase inhibitor. | CCCN(Cc1ccc(C(=O)Nc2ccc(C)c(Nc3nccc(-c4cccnc4)n3)c2)o1)CC1CC1 | |
Could you please return a molecule that adheres to this description? The molecule is a apoptosis, stabilizing mitochondrial structure, cholesterol translocation that impacts non-alcoholic fatty liver disease and tangier disease. The molecule is a stabilizing cytochrome oxidase and a proton trap for oxidative phosphorylation that impacts barth syndrome, aging, and diabetic heart disease. | CCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCC(C)C | |
Could you please return a molecule that adheres to this description? The molecule is a nutrient and belongs to the thyroxine treatment class of molecules, impacting cardiovascular disease. The molecule is a fat storage that impacts atherosclerosis, pancreatitis, and metabolic syndrome. | CCC=CCC=CCC=CCC=CCCCCCCC(=O)OCC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OCCCCCCCCCCCCCCCCCC | |
Generate a molecule that fulfills the requirement: The molecule is a nutrient that impacts diabetes mellitus type 2, non-alcoholic fatty liver disease, parkinson's disease, and alzheimer's disease. | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCCN)OC(=O)CCCC(O)C=CC=CCC=CC=CC(O)CCCCC | |
Conceptualize a molecule that meets the specified attribute(s): The molecule is a apoptosis and a stabilizing mitochondrial structure that impacts aging, tangier disease, and non-alcoholic fatty liver disease. The molecule is a cholesterol translocation, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts diabetic heart disease and barth syndrome. | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCCCC=CCCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC | |
Conceptualize a molecule that meets the specified attribute(s): The molecule is a pain treatment and belongs to the cb2 agonist class of molecules. | N#Cc1ccc(NC(=O)c2nc(CN3CCS(O)(O)CC3)c3ccccn23)nc1 | |
Come up with a molecule based on the description: The molecule is a stabilizing mitochondrial structure and a cholesterol translocation that impacts tangier disease, diabetic heart disease, and aging. The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, apoptosis that impacts barth syndrome and non-alcoholic fatty liver disease. | CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCC | |
I need a molecule that meets the following conditions: It impacts copd treatment. Please represent the molecule in SMILES. | C=C1c2cc(F)ccc2SN1c1ccc(Cl)cc1 | |
Generate a molecule that fulfills the requirement: The molecule is a nutrient. | CCCCCC=CCC=CCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCC=CCCCCCC)COP(=O)(O)OCC(N)C(=O)O | |
Conceptualize a molecule that meets the specified attribute(s): It belongs to the dielectric class of molecules. | CCCCCCCCSc1nc(N)nc(SCCCCCCCC)n1 | |
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a protein kinase inhibitor. | COC(C)C(=O)Nc1ccc2c(Nc3cc(C)[nH]n3)nn(Cc3cc(F)cc(F)c3)c(=O)c2c1 | |
Come up with a molecule based on the description: The molecule is a apoptosis that impacts diabetic heart disease, aging, barth syndrome, and non-alcoholic fatty liver disease. The molecule is a stabilizing cytochrome oxidase, cholesterol translocation, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation that impacts tangier disease. | CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCCCC | |
Generate a molecule based on this description: The molecule is a fat storage and nutrient, and it impacts metabolic syndrome. The molecule is thyroxine treatment and impacts pancreatitis, atherosclerosis, and cardiovascular disease. | CCCCCC=CCC=CCC=CCC=CCCCC(=O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC | |
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a nutrient. | CCC=CCC=CCC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(N)C(=O)O)OC(=O)CCCC(O)C=CC=CCC=CCCCCCCCC | |
I need a molecule that meets the following conditions: The molecule is a proton trap for oxidative phosphorylation and a cholesterol translocation that impacts barth syndrome, aging, and non-alcoholic fatty liver disease. The molecule is a apoptosis, stabilizing mitochondrial structure, stabilizing cytochrome oxidase that impacts diabetic heart disease and tangier disease. Please represent the molecule in SMILES. | CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCC(C)C | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a stabilizing mitochondrial structure, apoptosis, stabilizing cytochrome oxidase that impacts aging and non-alcoholic fatty liver disease. The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation that impacts tangier disease, diabetic heart disease, and barth syndrome. | CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCC | |
Generate a molecule based on this description: The molecule is a energy source that impacts celiac disease, renal cell carcinoma, and cardiovascular disease. It has an effect on breast cancer, and impacts diabetes mellitus type 2, heart failure, and inflammatory bowel disease. | CCC=CCC(O)C(O)C=CC(O)CCCCCCCC(=O)OC(CC(=O)[O-])C[N+](C)(C)C | |
Can you create a molecule that matches the given characteristics? The molecule is a apoptosis, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts tangier disease and barth syndrome. The molecule is a proton trap for oxidative phosphorylation and a cholesterol translocation that impacts non-alcoholic fatty liver disease, aging, and diabetic heart disease. | CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC | |
The molecule is a stabilizing mitochondrial structure, cholesterol translocation, stabilizing cytochrome oxidase that impacts barth syndrome and diabetic heart disease. The molecule is a proton trap for oxidative phosphorylation and a apoptosis that impacts aging, non-alcoholic fatty liver disease, and tangier disease. Use the above information to create a molecule. | CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCC | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a rorc modulator. | Cn1nc(C2CCCC(C=C(N)c3c(F)cccc3F)=C2N)oc1=O | |
The molecule is a stabilizing mitochondrial structure that impacts diabetic heart disease, barth syndrome, aging, and non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation, cholesterol translocation, stabilizing cytochrome oxidase, apoptosis that impacts tangier disease. Use the above information to create a molecule. | CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCC | |
Conceptualize a molecule that meets the specified attribute(s): The molecule is a stabilizing cytochrome oxidase and a cholesterol translocation that impacts barth syndrome, aging, and non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, apoptosis that impacts tangier disease and diabetic heart disease. | CCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCC(C)C | |
Build a molecule that meets the requirement: The molecule is a stabilizing cytochrome oxidase, cholesterol translocation, apoptosis that impacts tangier disease and non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation and a stabilizing mitochondrial structure that impacts barth syndrome, aging, and diabetic heart disease. | CCCCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C | |
Could you please return a molecule that adheres to this description? The molecule is a inflammatory and energy source, belonging to the thyroxine treatment class of molecules, and impacts metabolic syndrome, obesity, and pancreatitis. The molecule is a membrane stabilizer, a fat storage, and a energy storage. The molecule is a nutrient that impacts cancer, atherosclerosis, and cardiovascular disease. | CCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCC | |
Can you create a molecule that matches the given characteristics? The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, cholesterol translocation that impacts non-alcoholic fatty liver disease and barth syndrome. The molecule is a apoptosis and a stabilizing cytochrome oxidase that impacts tangier disease, aging, and diabetic heart disease. | CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC | |
Generate a molecule that fulfills the requirement: The molecule is a hiv treatment and is anti retroviral. | COc1ccc(-c2nc3c(C(=O)N4CCN(C(CO)c5cccc(F)c5)CC4C)cnn3c(C(F)(F)F)c2C)cc1 | |
Give me a molecule that satisfies the conditions outlined in the description: When heated to decomposition it emits highly toxic fumes of sulfur and nitrogen oxides. The molecule has Aromatic odor. | CCCCN(CC)C(=O)SCCC | |
I need a molecule that meets the following conditions: The molecule is a stabilizing cytochrome oxidase, apoptosis, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease. The molecule is a cholesterol translocation that impacts tangier disease, barth syndrome, diabetic heart disease, and aging. Please represent the molecule in SMILES. | CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C | |
I need a molecule that meets the following conditions: The molecule is a stabilizing mitochondrial structure, stabilizing cytochrome oxidase, cholesterol translocation, proton trap for oxidative phosphorylation, apoptosis. It impacts aging, non-alcoholic fatty liver disease, tangier disease, diabetic heart disease, and barth syndrome. Please represent the molecule in SMILES. | CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCC=CCC=CCC=CCC=CCC=CCC | |
I need a molecule that meets the following conditions: The molecule is a fat storage and nutrient, affecting cancer, and impacting metabolic syndrome, pancreatitis, and cardiovascular disease. The molecule is a thyroxine treatment that impacts both obesity and atherosclerosis. The molecule is a energy source, membrane stabilizer, energy storage, inflammatory. Please represent the molecule in SMILES. | CCC(C)CCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCC(C)C)COC(=O)CCCCCCCCCCC(C)CC | |
Conceptualize a molecule that meets the specified attribute(s): The molecule is a stabilizing mitochondrial structure, stabilizing cytochrome oxidase, cholesterol translocation that impacts aging and diabetic heart disease. The molecule is a apoptosis and a proton trap for oxidative phosphorylation that impacts tangier disease, barth syndrome, and non-alcoholic fatty liver disease. | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCC=CCC=CCC=CCC=CCC | |
Could you please return a molecule that adheres to this description? The molecule is a nutrient that impacts diabetes mellitus type 2, non-alcoholic fatty liver disease, parkinson's disease, and alzheimer's disease. | CCCCCC=CCC=CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCCN)OC(=O)CCCC=CCC=CCC1OC1CC=CCCCCC | |
Can you create a molecule that matches the given characteristics? The molecule is a kinase inhibitor and belongs to the cancer treatment class of molecules. | CN1CC2CCC(C1)N2Cc1ccc(Nc2ncc(F)c(-c3cc(F)c4nc5n(c4c3)C(C)(C)CC5)n2)nc1 | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a energy source and a energy storage that impacts thyroxine treatment, cancer, metabolic syndrome, and atherosclerosis. The molecule is a membrane stabilizer and fat storage, and it impacts cardiovascular disease. The molecule is a inflammatory and a nutrient, impacting both pancreatitis and obesity. | CCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCCCC(C)CC)COC(=O)CCCCCCCCCCCCC(C)C | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is anti fouling. | C=C(C(=O)O)C(CC(=O)OC1CCC(C)CC1)(CC(=O)OC1CCC(C)CC1)C(=O)O | |
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a food additive, a energy storage, and a stabilizing cytochrome oxidase, and it impacts tangier disease. The molecule is a proton trap for oxidative phosphorylation, cholesterol translocation, surfactant that impacts aging and barth syndrome. The molecule is a emulsifier, a membrane stabilizer, and a apoptosis, and it impacts diabetic heart disease. The molecule is a nutritional supplement, a energy source, and a stabilizing mitochondrial structure, it impacts non-alcoholic fatty liver disease and is smooth. | CCC(C)CCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC(C)CC | |
Can you create a molecule that matches the given characteristics? The molecule is a protein tyrosine kinase inhibitor and hyperproliferative disorder treatment, and it impacts cancer treatment. | COc1cc2c(Oc3ccc(NC(=O)c4c(C)n(C)n(-c5ccc(C)cc5)c4=O)cc3)ccnc2cc1OCC(C)O | |
Come up with a molecule based on the description: It belongs to the anti psychotic class of molecules. | CCCCNC(=O)c1cc(-c2cccc3ccccc23)c2c(c1)C(N1CCNCC1)c1ccccc1-2.Cl | |
Come up with a molecule based on the description: The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation that impacts aging and non-alcoholic fatty liver disease. The molecule is a cholesterol translocation and a apoptosis that impacts barth syndrome, tangier disease, and diabetic heart disease. | CCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCC(C)C | |
The molecule is a member of the thyroxine treatment class and affects both pancreatitis and atherosclerosis. The molecule is a nutrient and a fat storage, impacting both cardiovascular disease and metabolic syndrome. Use the above information to create a molecule. | CCCCCCCCC=CCCCCCCCCCC(=O)OCC(COCCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCC | |
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a stabilizing cytochrome oxidase, apoptosis, proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease and aging. The molecule is a cholesterol translocation and a stabilizing mitochondrial structure that impacts tangier disease, diabetic heart disease, and barth syndrome. | CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCCCCCCCC(C)C | |
Build a molecule that meets the requirement: The molecule is a liquid crystal. | C=C(C)C(=O)OCCCc1cc(-c2ccc(OC(=O)CCc3ccc(CCCCCC)cc3)cc2)ccc1OCC(COC(=O)C(=C)C)(COC(=O)C(C)=O)COC(=O)C(C)=O | |
Generate a molecule based on this description: The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure that impacts aging and barth syndrome. The molecule is a apoptosis and a cholesterol translocation that impacts tangier disease, non-alcoholic fatty liver disease, and diabetic heart disease. | CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC | |
Generate a molecule that fulfills the requirement: The molecule is a cholesterol translocation, energy source, energy storage, apoptosis. The molecule is a surfactant, proton trap for oxidative phosphorylation, nutritional supplement, membrane stabilizer that impacts non-alcoholic fatty liver disease. The molecule is a stabilizing cytochrome oxidase and smooth, impacting both diabetic heart disease and barth syndrome. The molecule is a emulsifier, stabilizing mitochondrial structure, food additive that impacts tangier disease and aging. | CCC(C)CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCC(C)C | |
Can you create a molecule that matches the given characteristics? The molecule is a apoptosis, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease and diabetic heart disease. The molecule is a cholesterol translocation and a stabilizing cytochrome oxidase that impacts tangier disease, barth syndrome, and aging. | CCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC(C)C | |
Generate a molecule based on this description: The molecule is a kinase inhibitor. | CN(C)CCC1CCN(c2nccc(C=C3SC(=O)CC3=O)n2)CC1 | |
Generate a molecule based on this description: The molecule is a liquid crystal. | CCCCCCc1ccc(C2CCC(C#Cc3ccc(CCCCCC)c(Cl)c3)CC2)cc1 | |
I need a molecule that meets the following conditions: The molecule is a nutrient. Please represent the molecule in SMILES. | CCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CC(O)CCCC)COP(=O)(O)OCC(N)C(=O)O | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is both a egfr inhibitor and a cancer treatment. | CNc1ccc(F)c(Nc2nc(Nc3cc(C)ns3)ncc2Cl)c1 | |
Come up with a molecule based on the description: The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation that impacts diabetic heart disease, tangier disease, and aging. The molecule is a stabilizing mitochondrial structure, apoptosis, stabilizing cytochrome oxidase that impacts barth syndrome and non-alcoholic fatty liver disease. | CCC=CCC=CCC=CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCC |
Subsets and Splits
No saved queries yet
Save your SQL queries to embed, download, and access them later. Queries will appear here once saved.