instruction
stringlengths 51
2.18k
| output
stringlengths 1
833
| input
stringclasses 1
value |
|---|---|---|
Conceptualize a molecule that meets the specified attribute(s): The molecule is a stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation and a cholesterol translocation, impacting both tangier disease and aging. The molecule is a stabilizing cytochrome oxidase and a apoptosis, impacting both diabetic heart disease and barth syndrome. | CCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCC(C)C | |
Come up with a molecule based on the description: The molecule is a cholesterol translocation, a stabilizing mitochondrial structure, and a apoptosis, and it impacts aging. The molecule is a proton trap for oxidative phosphorylation and a stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease, tangier disease, barth syndrome, and diabetic heart disease. | CCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCC(C)C | |
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a stabilizing mitochondrial structure and a apoptosis that impacts diabetic heart disease, barth syndrome, and aging. The molecule is a cholesterol translocation, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts tangier disease and non-alcoholic fatty liver disease. | CCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCC(C)C | |
Give me a molecule that satisfies the conditions outlined in the description: The molecule is both a cholesterol translocation and a stabilizing mitochondrial structure. The molecule is a proton trap for oxidative phosphorylation that impacts barth syndrome, aging, and diabetic heart disease. The molecule is a stabilizing cytochrome oxidase and a apoptosis, impacting both non-alcoholic fatty liver disease and tangier disease. | CCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCC(C)C | |
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a stabilizing mitochondrial structure that impacts both aging and non-alcoholic fatty liver disease. The molecule is a stabilizing cytochrome oxidase that impacts both barth syndrome and tangier disease. The molecule is a apoptosis, a proton trap for oxidative phosphorylation, and a cholesterol translocation, and it impacts diabetic heart disease. | CCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCC(C)C | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is anti bacterial. | CC(C)(C)OC(=O)NC12CCC(CCN3C(=O)COc4ccc(Br)cc43)(CC1)OC2 | |
Could you please return a molecule that adheres to this description? The molecule is anti bacterial. | CC(C)(C)OC(=O)NC12CCC(CCN3C(=O)COc4ccc(Br)cc43)(CC1)OC2 | |
Generate a molecule that fulfills the requirement: The molecule is anti bacterial. | CC(C)(C)OC(=O)NC12CCC(CCN3C(=O)COc4ccc(Br)cc43)(CC1)OC2 | |
Give me a molecule that satisfies the conditions outlined in the description: The molecule is anti bacterial. | CC(C)(C)OC(=O)NC12CCC(CCN3C(=O)COc4ccc(Br)cc43)(CC1)OC2 | |
Come up with a molecule based on the description: It belongs to the anti bacterial class of molecules. | CC(C)(C)OC(=O)NC12CCC(CCN3C(=O)COc4ccc(Br)cc43)(CC1)OC2 | |
Come up with a molecule based on the description: The molecule is a apoptosis and a cholesterol translocation, impacting both tangier disease and diabetic heart disease. The molecule is a stabilizing cytochrome oxidase, a proton trap for oxidative phosphorylation, and a stabilizing mitochondrial structure, and it impacts non-alcoholic fatty liver disease. It impacts both aging and barth syndrome. | CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC | |
Based on the given information, generate a molecule that meets the desired specifications: It impacts both aging and barth syndrome. The molecule is a proton trap for oxidative phosphorylation and a apoptosis, impacting both non-alcoholic fatty liver disease and tangier disease. The molecule is a stabilizing mitochondrial structure, a cholesterol translocation, and a stabilizing cytochrome oxidase, and it impacts diabetic heart disease. | CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC | |
I need a molecule that meets the following conditions: The molecule is a stabilizing cytochrome oxidase and a stabilizing mitochondrial structure, impacting both tangier disease and non-alcoholic fatty liver disease. The molecule is a apoptosis, cholesterol translocation, proton trap for oxidative phosphorylation that impacts diabetic heart disease and aging. It impacts barth syndrome. Please represent the molecule in SMILES. | CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC | |
Suppose there is a molecule that meets the following description: The molecule is a stabilizing cytochrome oxidase and a stabilizing mitochondrial structure, impacting both aging and non-alcoholic fatty liver disease. The molecule is a apoptosis and a cholesterol translocation, impacting both tangier disease and barth syndrome. The molecule is a proton trap for oxidative phosphorylation that impacts diabetic heart disease. Please write the SMILES representation of it. | CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC | |
Generate a molecule that fulfills the requirement: The molecule is a apoptosis that impacts diabetic heart disease, tangier disease, and aging. The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, cholesterol translocation, stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease. It impacts barth syndrome. | CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC | |
I need a molecule that meets the following conditions: The molecule is a emulsifier, a food additive, and a cholesterol translocation. The molecule is a energy storage and energy source, and it impacts barth syndrome. The molecule is a stabilizing cytochrome oxidase, a proton trap for oxidative phosphorylation, and a apoptosis, and it impacts non-alcoholic fatty liver disease. The molecule is a surfactant and a membrane stabilizer, impacting both tangier disease and aging. The molecule is a nutritional supplement and a stabilizing mitochondrial structure, it impacts diabetic heart disease, and is smooth. Please represent the molecule in SMILES. | CCC(C)CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCC(C)C | |
Suppose there is a molecule that meets the following description: The molecule is a energy source and a stabilizing cytochrome oxidase, impacting both barth syndrome and non-alcoholic fatty liver disease. The molecule is a membrane stabilizer, apoptosis, surfactant that impacts aging and tangier disease. The molecule is a food additive and a nutritional supplement, it impacts diabetic heart disease, and is smooth. The molecule is a stabilizing mitochondrial structure, cholesterol translocation, energy storage, proton trap for oxidative phosphorylation, emulsifier. Please write the SMILES representation of it. | CCC(C)CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCC(C)C | |
Come up with a molecule based on the description: The molecule is both a nutritional supplement and a stabilizing mitochondrial structure. The molecule is a food additive, emulsifier, membrane stabilizer, energy source. The molecule is a proton trap for oxidative phosphorylation and a apoptosis, impacting both aging and non-alcoholic fatty liver disease. The molecule is a surfactant and smooth, impacting both barth syndrome and tangier disease. The molecule is a cholesterol translocation, a energy storage, and a stabilizing cytochrome oxidase, and it impacts diabetic heart disease. | CCC(C)CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCC(C)C | |
Could you please return a molecule that adheres to this description? The molecule is a nutritional supplement and smooth, impacting both aging and barth syndrome. The molecule is a emulsifier that impacts both non-alcoholic fatty liver disease and tangier disease. The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, membrane stabilizer, surfactant. The molecule is a stabilizing mitochondrial structure, a cholesterol translocation, and a apoptosis. The molecule is a energy source, a energy storage, and a food additive, and it impacts diabetic heart disease. | CCC(C)CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCC(C)C | |
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a proton trap for oxidative phosphorylation, a membrane stabilizer, and a stabilizing cytochrome oxidase. The molecule is a nutritional supplement and cholesterol translocation, and it impacts barth syndrome. The molecule is a food additive and smooth, impacting both non-alcoholic fatty liver disease and diabetic heart disease. The molecule is a stabilizing mitochondrial structure and a energy storage, impacting both tangier disease and aging. The molecule is a emulsifier, energy source, surfactant, apoptosis. | CCC(C)CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCC(C)C | |
Could you please return a molecule that adheres to this description? The molecule is a pdk1 inhibitor that impacts cancer treatment. The molecule is a protein kinase inhibitor. | Cc1[nH]c(C=C2C(=O)Nc3cc(C=CCNc4ncccc4C(=O)NCc4ccc(F)c(F)c4)ccc32)c(C)c1C(=O)O | |
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a pdk1 inhibitor and a protein kinase inhibitor, belonging to the cancer treatment class of molecules. | Cc1[nH]c(C=C2C(=O)Nc3cc(C=CCNc4ncccc4C(=O)NCc4ccc(F)c(F)c4)ccc32)c(C)c1C(=O)O | |
I need a molecule that meets the following conditions: The molecule is a protein kinase inhibitor. The molecule is a pdk1 inhibitor and is cancer treatment. Please represent the molecule in SMILES. | Cc1[nH]c(C=C2C(=O)Nc3cc(C=CCNc4ncccc4C(=O)NCc4ccc(F)c(F)c4)ccc32)c(C)c1C(=O)O | |
Come up with a molecule based on the description: The molecule is a pdk1 inhibitor and a protein kinase inhibitor, belonging to the cancer treatment class of molecules. | Cc1[nH]c(C=C2C(=O)Nc3cc(C=CCNc4ncccc4C(=O)NCc4ccc(F)c(F)c4)ccc32)c(C)c1C(=O)O | |
I need a molecule that meets the following conditions: The molecule is both a protein kinase inhibitor and a pdk1 inhibitor. The molecule is cancer treatment. Please represent the molecule in SMILES. | Cc1[nH]c(C=C2C(=O)Nc3cc(C=CCNc4ncccc4C(=O)NCc4ccc(F)c(F)c4)ccc32)c(C)c1C(=O)O | |
I need a molecule that meets the following conditions: The molecule has Bitter and unpleasant taste. When heated to decomposition it emits acrid smoke and irritating fumes. The molecule has Pleasant odor. Please represent the molecule in SMILES. | COc1ccc(C(C)=O)cc1 | |
Give me a molecule that satisfies the conditions outlined in the description: When heated to decomposition it emits acrid smoke and irritating fumes. The molecule has both a Pleasant odor and a Bitter and unpleasant taste. | COc1ccc(C(C)=O)cc1 | |
I need a molecule that meets the following conditions: The molecule has Pleasant odor. The molecule has Bitter and unpleasant taste. When heated to decomposition it emits acrid smoke and irritating fumes. Please represent the molecule in SMILES. | COc1ccc(C(C)=O)cc1 | |
Give me a molecule that satisfies the conditions outlined in the description: The molecule has Pleasant odor. When heated to decomposition it emits acrid smoke and irritating fumes. The molecule has Bitter and unpleasant taste. | COc1ccc(C(C)=O)cc1 | |
Could you please return a molecule that adheres to this description? The molecule has Pleasant odor. When heated to decomposition it emits acrid smoke and irritating fumes. The molecule has Bitter and unpleasant taste. | COc1ccc(C(C)=O)cc1 | |
I need a molecule that meets the following conditions: The molecule is a nutrient that impacts both parkinson's disease and non-alcoholic fatty liver disease. It impacts both alzheimer's disease and diabetes mellitus type 2. Please represent the molecule in SMILES. | CCCc1oc(CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCCN)OC(=O)CCCC=CCC=CCC=CCC=CCCCC(C)O)c(C)c1C | |
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a nutrient that impacts non-alcoholic fatty liver disease, parkinson's disease, diabetes mellitus type 2, and alzheimer's disease. | CCCc1oc(CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCCN)OC(=O)CCCC=CCC=CCC=CCC=CCCCC(C)O)c(C)c1C | |
I need a molecule that meets the following conditions: The molecule is a nutrient that impacts alzheimer's disease, non-alcoholic fatty liver disease, diabetes mellitus type 2, and parkinson's disease. Please represent the molecule in SMILES. | CCCc1oc(CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCCN)OC(=O)CCCC=CCC=CCC=CCC=CCCCC(C)O)c(C)c1C | |
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a nutrient that impacts non-alcoholic fatty liver disease, diabetes mellitus type 2, alzheimer's disease, and parkinson's disease. | CCCc1oc(CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCCN)OC(=O)CCCC=CCC=CCC=CCC=CCCCC(C)O)c(C)c1C | |
Can you create a molecule that matches the given characteristics? The molecule is a nutrient that impacts both alzheimer's disease and parkinson's disease. It impacts both diabetes mellitus type 2 and non-alcoholic fatty liver disease. | CCCc1oc(CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCCN)OC(=O)CCCC=CCC=CCC=CCC=CCCCC(C)O)c(C)c1C | |
Build a molecule that meets the requirement: The molecule is a anti viral compound and is anti viral. | O=C(NC1CCCC(Nc2nc(-c3[nH]nc4ncc(Cl)cc34)ncc2F)C1)N1CCCC1CO | |
Conceptualize a molecule that meets the specified attribute(s): The molecule is a anti viral and belongs to the anti viral compound class of molecules. | O=C(NC1CCCC(Nc2nc(-c3[nH]nc4ncc(Cl)cc34)ncc2F)C1)N1CCCC1CO | |
Conceptualize a molecule that meets the specified attribute(s): The molecule is both a anti viral compound and a anti viral. | O=C(NC1CCCC(Nc2nc(-c3[nH]nc4ncc(Cl)cc34)ncc2F)C1)N1CCCC1CO | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a anti viral compound and belongs to the anti viral class of molecules. | O=C(NC1CCCC(Nc2nc(-c3[nH]nc4ncc(Cl)cc34)ncc2F)C1)N1CCCC1CO | |
Could you please return a molecule that adheres to this description? The molecule is a anti viral compound member of the anti viral class. | O=C(NC1CCCC(Nc2nc(-c3[nH]nc4ncc(Cl)cc34)ncc2F)C1)N1CCCC1CO | |
Generate a molecule based on this description: The molecule is a kinase inhibitor. | CC(C)Cc1ncc(-c2cc(-c3ccccc3CNC(=O)OC(C)(C)C)nc(NCCN(C)C)n2)s1 | |
Suppose there is a molecule that meets the following description: The molecule is a kinase inhibitor. Please write the SMILES representation of it. | CC(C)Cc1ncc(-c2cc(-c3ccccc3CNC(=O)OC(C)(C)C)nc(NCCN(C)C)n2)s1 | |
Conceptualize a molecule that meets the specified attribute(s): The molecule is a kinase inhibitor. | CC(C)Cc1ncc(-c2cc(-c3ccccc3CNC(=O)OC(C)(C)C)nc(NCCN(C)C)n2)s1 | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a kinase inhibitor. | CC(C)Cc1ncc(-c2cc(-c3ccccc3CNC(=O)OC(C)(C)C)nc(NCCN(C)C)n2)s1 | |
Suppose there is a molecule that meets the following description: The molecule is a kinase inhibitor. Please write the SMILES representation of it. | CC(C)Cc1ncc(-c2cc(-c3ccccc3CNC(=O)OC(C)(C)C)nc(NCCN(C)C)n2)s1 | |
The molecule is a stabilizing cytochrome oxidase and a cholesterol translocation, impacting both diabetic heart disease and barth syndrome. The molecule is a proton trap for oxidative phosphorylation and a apoptosis that impacts non-alcoholic fatty liver disease, aging, and tangier disease. The molecule is a stabilizing mitochondrial structure. Use the above information to create a molecule. | CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCCCCCCCC(C)C | |
I need a molecule that meets the following conditions: The molecule is a cholesterol translocation and a stabilizing cytochrome oxidase that impacts aging, tangier disease, non-alcoholic fatty liver disease, and diabetic heart disease. The molecule is a apoptosis, a stabilizing mitochondrial structure, and a proton trap for oxidative phosphorylation, and it impacts barth syndrome. Please represent the molecule in SMILES. | CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCCCCCCCC(C)C | |
Come up with a molecule based on the description: The molecule is a proton trap for oxidative phosphorylation and apoptosis, and it impacts aging. The molecule is a stabilizing cytochrome oxidase that impacts both diabetic heart disease and barth syndrome. The molecule is a stabilizing mitochondrial structure and a cholesterol translocation, impacting both tangier disease and non-alcoholic fatty liver disease. | CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCCCCCCCC(C)C | |
Conceptualize a molecule that meets the specified attribute(s): The molecule is a apoptosis, stabilizing mitochondrial structure, cholesterol translocation, proton trap for oxidative phosphorylation that impacts diabetic heart disease. The molecule is a stabilizing cytochrome oxidase that impacts aging, tangier disease, barth syndrome, and non-alcoholic fatty liver disease. | CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCCCCCCCC(C)C | |
Can you create a molecule that matches the given characteristics? The molecule is both a stabilizing cytochrome oxidase and a stabilizing mitochondrial structure. It impacts non-alcoholic fatty liver disease, tangier disease, diabetic heart disease, and aging. The molecule is a cholesterol translocation, a proton trap for oxidative phosphorylation, and a apoptosis, and it impacts barth syndrome. | CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCCCCCCCC(C)C | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a emulsifier, energy storage, surfactant, energy source, membrane stabilizer, nutrient. | CSC=CC(=O)OC1CC(C)C2(C)CC(=C(C)C)C(=O)CC2C1 | |
Could you please return a molecule that adheres to this description? The molecule is a surfactant, a energy source, and a nutrient. The molecule is a emulsifier, a energy storage, and a membrane stabilizer. | CSC=CC(=O)OC1CC(C)C2(C)CC(=C(C)C)C(=O)CC2C1 | |
Can you create a molecule that matches the given characteristics? The molecule is a nutrient, membrane stabilizer, energy storage, emulsifier, energy source, surfactant. | CSC=CC(=O)OC1CC(C)C2(C)CC(=C(C)C)C(=O)CC2C1 | |
Generate a molecule that fulfills the requirement: The molecule is a membrane stabilizer, nutrient, energy source, energy storage, surfactant, emulsifier. | CSC=CC(=O)OC1CC(C)C2(C)CC(=C(C)C)C(=O)CC2C1 | |
Suppose there is a molecule that meets the following description: The molecule is a energy storage, nutrient, surfactant, emulsifier, energy source, membrane stabilizer. Please write the SMILES representation of it. | CSC=CC(=O)OC1CC(C)C2(C)CC(=C(C)C)C(=O)CC2C1 | |
It belongs to the orexin receptor antagonist class of molecules. Use the above information to create a molecule. | Cc1nc2sccn2c1C(=O)NCC1CCCCN1C(=O)c1nc(C2CC2)sc1-c1cccc(C(F)(F)F)c1 | |
Conceptualize a molecule that meets the specified attribute(s): The molecule is a orexin receptor antagonist. | Cc1nc2sccn2c1C(=O)NCC1CCCCN1C(=O)c1nc(C2CC2)sc1-c1cccc(C(F)(F)F)c1 | |
Suppose there is a molecule that meets the following description: The molecule is a orexin receptor antagonist. Please write the SMILES representation of it. | Cc1nc2sccn2c1C(=O)NCC1CCCCN1C(=O)c1nc(C2CC2)sc1-c1cccc(C(F)(F)F)c1 | |
Build a molecule that meets the requirement: It belongs to the orexin receptor antagonist class of molecules. | Cc1nc2sccn2c1C(=O)NCC1CCCCN1C(=O)c1nc(C2CC2)sc1-c1cccc(C(F)(F)F)c1 | |
The molecule is a orexin receptor antagonist. Use the above information to create a molecule. | Cc1nc2sccn2c1C(=O)NCC1CCCCN1C(=O)c1nc(C2CC2)sc1-c1cccc(C(F)(F)F)c1 | |
Can you create a molecule that matches the given characteristics? The molecule is a nutrient. | CC1(C)CCC2(C(=O)OC3OCC(O)C(OC4OC(CO)C(O)C(O)C4O)C3O)CCC3(C)C(=CCC4C5(C)CCC(OC6OC(CO)C(O)C(O)C6O)C(C)(COC6OC(CO)C(O)C(O)C6O)C5CCC43C)C2C1 | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a nutrient. | CC1(C)CCC2(C(=O)OC3OCC(O)C(OC4OC(CO)C(O)C(O)C4O)C3O)CCC3(C)C(=CCC4C5(C)CCC(OC6OC(CO)C(O)C(O)C6O)C(C)(COC6OC(CO)C(O)C(O)C6O)C5CCC43C)C2C1 | |
Come up with a molecule based on the description: The molecule is a nutrient. | CC1(C)CCC2(C(=O)OC3OCC(O)C(OC4OC(CO)C(O)C(O)C4O)C3O)CCC3(C)C(=CCC4C5(C)CCC(OC6OC(CO)C(O)C(O)C6O)C(C)(COC6OC(CO)C(O)C(O)C6O)C5CCC43C)C2C1 | |
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a nutrient. | CC1(C)CCC2(C(=O)OC3OCC(O)C(OC4OC(CO)C(O)C(O)C4O)C3O)CCC3(C)C(=CCC4C5(C)CCC(OC6OC(CO)C(O)C(O)C6O)C(C)(COC6OC(CO)C(O)C(O)C6O)C5CCC43C)C2C1 | |
Generate a molecule that fulfills the requirement: The molecule is a nutrient. | CC1(C)CCC2(C(=O)OC3OCC(O)C(OC4OC(CO)C(O)C(O)C4O)C3O)CCC3(C)C(=CCC4C5(C)CCC(OC6OC(CO)C(O)C(O)C6O)C(C)(COC6OC(CO)C(O)C(O)C6O)C5CCC43C)C2C1 | |
Generate a molecule based on this description: The molecule is both a membrane stabilizer and a nutrient. The molecule is a energy source, energy storage, emulsifier, surfactant. | CC=C(C)C(=O)OC1CC(C)(C)CC2C3=CCC4C5(C)CCC(OC6OC(C(=O)O)C(O)C(OC7OCC(O)C(O)C7OC7OC(CO)C(O)C(O)C7O)C6OC6OC(CO)C(O)C(O)C6O)C(C)(CO)C5CCC4(C)C3(C)CC(O)C12CO | |
Generate a molecule that fulfills the requirement: The molecule is a energy storage, nutrient, energy source, surfactant, emulsifier. The molecule is a membrane stabilizer. | CC=C(C)C(=O)OC1CC(C)(C)CC2C3=CCC4C5(C)CCC(OC6OC(C(=O)O)C(O)C(OC7OCC(O)C(O)C7OC7OC(CO)C(O)C(O)C7O)C6OC6OC(CO)C(O)C(O)C6O)C(C)(CO)C5CCC4(C)C3(C)CC(O)C12CO | |
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a surfactant. The molecule is a energy storage, energy source, emulsifier, membrane stabilizer, nutrient. | CC=C(C)C(=O)OC1CC(C)(C)CC2C3=CCC4C5(C)CCC(OC6OC(C(=O)O)C(O)C(OC7OCC(O)C(O)C7OC7OC(CO)C(O)C(O)C7O)C6OC6OC(CO)C(O)C(O)C6O)C(C)(CO)C5CCC4(C)C3(C)CC(O)C12CO | |
Suppose there is a molecule that meets the following description: The molecule is a surfactant, membrane stabilizer, energy source, emulsifier. The molecule is both a energy storage and a nutrient. Please write the SMILES representation of it. | CC=C(C)C(=O)OC1CC(C)(C)CC2C3=CCC4C5(C)CCC(OC6OC(C(=O)O)C(O)C(OC7OCC(O)C(O)C7OC7OC(CO)C(O)C(O)C7O)C6OC6OC(CO)C(O)C(O)C6O)C(C)(CO)C5CCC4(C)C3(C)CC(O)C12CO | |
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a surfactant, nutrient, energy storage, membrane stabilizer, emulsifier, energy source. | CC=C(C)C(=O)OC1CC(C)(C)CC2C3=CCC4C5(C)CCC(OC6OC(C(=O)O)C(O)C(OC7OCC(O)C(O)C7OC7OC(CO)C(O)C(O)C7O)C6OC6OC(CO)C(O)C(O)C6O)C(C)(CO)C5CCC4(C)C3(C)CC(O)C12CO | |
Generate a molecule based on this description: The molecule is a cholesterol translocation, a proton trap for oxidative phosphorylation, and a stabilizing mitochondrial structure, and it impacts barth syndrome. The molecule is a apoptosis and a stabilizing cytochrome oxidase, impacting both diabetic heart disease and tangier disease. It impacts both non-alcoholic fatty liver disease and aging. | CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a cholesterol translocation and a apoptosis, impacting both tangier disease and non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation that impacts aging, barth syndrome, and diabetic heart disease. | CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC | |
Suppose there is a molecule that meets the following description: The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, cholesterol translocation, apoptosis that impacts barth syndrome and aging. The molecule is a stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease, diabetic heart disease, and tangier disease. Please write the SMILES representation of it. | CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC | |
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a cholesterol translocation, a proton trap for oxidative phosphorylation, and a apoptosis. The molecule is a stabilizing mitochondrial structure and stabilizing cytochrome oxidase, and it impacts diabetic heart disease. It impacts non-alcoholic fatty liver disease, tangier disease, barth syndrome, and aging. | CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC | |
Generate a molecule that fulfills the requirement: The molecule is a apoptosis, a stabilizing cytochrome oxidase, and a stabilizing mitochondrial structure, and it impacts barth syndrome. The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation that impacts tangier disease, non-alcoholic fatty liver disease, aging, and diabetic heart disease. | CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC | |
Suppose there is a molecule that meets the following description: The molecule is a apoptosis and a stabilizing cytochrome oxidase that impacts diabetic heart disease, tangier disease, and non-alcoholic fatty liver disease. The molecule is a cholesterol translocation, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation that impacts aging and barth syndrome. Please write the SMILES representation of it. | CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC | |
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a stabilizing cytochrome oxidase and cholesterol translocation, and it impacts aging. The molecule is a proton trap for oxidative phosphorylation that impacts both tangier disease and barth syndrome. The molecule is a stabilizing mitochondrial structure and a apoptosis, impacting both diabetic heart disease and non-alcoholic fatty liver disease. | CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC | |
Can you create a molecule that matches the given characteristics? The molecule is a proton trap for oxidative phosphorylation. The molecule is a cholesterol translocation, a stabilizing cytochrome oxidase, and a stabilizing mitochondrial structure, and it impacts barth syndrome. The molecule is a apoptosis that impacts diabetic heart disease, tangier disease, aging, and non-alcoholic fatty liver disease. | CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC | |
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a stabilizing mitochondrial structure that impacts tangier disease, aging, and non-alcoholic fatty liver disease. The molecule is a stabilizing cytochrome oxidase, a proton trap for oxidative phosphorylation, and a apoptosis, and it impacts diabetic heart disease. The molecule is a cholesterol translocation that impacts barth syndrome. | CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC | |
Generate a molecule based on this description: The molecule is a apoptosis, stabilizing mitochondrial structure, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, cholesterol translocation. It impacts barth syndrome, non-alcoholic fatty liver disease, tangier disease, diabetic heart disease, and aging. | CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC | |
The molecule is a apoptosis, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts tangier disease, non-alcoholic fatty liver disease, and aging. The molecule is a proton trap for oxidative phosphorylation and a cholesterol translocation, impacting both diabetic heart disease and barth syndrome. Use the above information to create a molecule. | CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCC(C)C | |
Can you create a molecule that matches the given characteristics? The molecule is both a apoptosis and a proton trap for oxidative phosphorylation. The molecule is a cholesterol translocation and a stabilizing mitochondrial structure, impacting both non-alcoholic fatty liver disease and tangier disease. The molecule is a stabilizing cytochrome oxidase that impacts aging, diabetic heart disease, and barth syndrome. | CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCC(C)C | |
Conceptualize a molecule that meets the specified attribute(s): The molecule is a proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts aging and tangier disease. The molecule is a apoptosis and a cholesterol translocation that impacts diabetic heart disease, non-alcoholic fatty liver disease, and barth syndrome. | CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCC(C)C | |
I need a molecule that meets the following conditions: The molecule is a stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation that impacts diabetic heart disease, barth syndrome, and aging. The molecule is a stabilizing cytochrome oxidase, a apoptosis, and a cholesterol translocation, and it impacts tangier disease. Please represent the molecule in SMILES. | CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCC(C)C | |
Can you create a molecule that matches the given characteristics? The molecule is a cholesterol translocation and a stabilizing cytochrome oxidase that impacts barth syndrome, diabetic heart disease, aging, and non-alcoholic fatty liver disease. The molecule is a apoptosis, a proton trap for oxidative phosphorylation, and a stabilizing mitochondrial structure, and it impacts tangier disease. | CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCC(C)C | |
I need a molecule that meets the following conditions: The molecule is a stabilizing mitochondrial structure, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, apoptosis, nutritional supplement that impacts tangier disease. The molecule is a energy source, a emulsifier, and a surfactant that impacts both diabetic heart disease and non-alcoholic fatty liver disease, and is smooth. The molecule is a food additive, cholesterol translocation, energy storage, membrane stabilizer that impacts aging and barth syndrome. Please represent the molecule in SMILES. | CC(C)CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC(C)C | |
Generate a molecule based on this description: The molecule is a food additive and emulsifier, and it impacts tangier disease. The molecule is a membrane stabilizer and stabilizing mitochondrial structure, and it impacts aging. The molecule is a proton trap for oxidative phosphorylation, a stabilizing cytochrome oxidase, and a energy storage, and it impacts diabetic heart disease. The molecule is a surfactant, a nutritional supplement, and a energy source, and it impacts non-alcoholic fatty liver disease. The molecule is a apoptosis and a cholesterol translocation, it impacts barth syndrome, and is smooth. | CC(C)CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC(C)C | |
I need a molecule that meets the following conditions: The molecule is a energy storage, a apoptosis, and a nutritional supplement. It impacts diabetic heart disease, barth syndrome, and aging. The molecule is a proton trap for oxidative phosphorylation and a cholesterol translocation, impacting both non-alcoholic fatty liver disease and tangier disease. The molecule is a emulsifier, energy source, food additive, membrane stabilizer. The molecule is a stabilizing cytochrome oxidase, a surfactant, a stabilizing mitochondrial structure, and smooth. Please represent the molecule in SMILES. | CC(C)CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC(C)C | |
The molecule is a stabilizing mitochondrial structure, a energy storage, and a food additive, and it impacts diabetic heart disease. The molecule is a cholesterol translocation and a surfactant, it impacts non-alcoholic fatty liver disease, and is smooth. The molecule is a stabilizing cytochrome oxidase, a proton trap for oxidative phosphorylation, and a energy source, and it impacts tangier disease. The molecule is a apoptosis, emulsifier, nutritional supplement that impacts aging and barth syndrome. The molecule is a membrane stabilizer. Use the above information to create a molecule. | CC(C)CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC(C)C | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a proton trap for oxidative phosphorylation, stabilizing mitochondrial structure, energy storage that impacts non-alcoholic fatty liver disease and barth syndrome. The molecule is a nutritional supplement, emulsifier, food additive, apoptosis that impacts aging and tangier disease. The molecule is a cholesterol translocation and stabilizing cytochrome oxidase, and it impacts diabetic heart disease. The molecule is a membrane stabilizer, a energy source, a surfactant, and smooth. | CC(C)CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC(C)C | |
Suppose there is a molecule that meets the following description: It impacts aging, non-alcoholic fatty liver disease, diabetic heart disease, and barth syndrome. The molecule is a apoptosis, stabilizing cytochrome oxidase, stabilizing mitochondrial structure, cholesterol translocation. The molecule is a proton trap for oxidative phosphorylation that impacts tangier disease. Please write the SMILES representation of it. | CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC(C)C | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation, impacting both diabetic heart disease and non-alcoholic fatty liver disease. The molecule is a stabilizing cytochrome oxidase and a apoptosis, impacting both aging and tangier disease. The molecule is a stabilizing mitochondrial structure that impacts barth syndrome. | CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC(C)C | |
Come up with a molecule based on the description: The molecule is a cholesterol translocation, stabilizing cytochrome oxidase, stabilizing mitochondrial structure, apoptosis that impacts non-alcoholic fatty liver disease and diabetic heart disease. The molecule is a proton trap for oxidative phosphorylation that impacts tangier disease, aging, and barth syndrome. | CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC(C)C | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a apoptosis, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation that impacts tangier disease and non-alcoholic fatty liver disease. The molecule is a cholesterol translocation and a stabilizing cytochrome oxidase that impacts barth syndrome, diabetic heart disease, and aging. | CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC(C)C | |
Can you create a molecule that matches the given characteristics? The molecule is a stabilizing cytochrome oxidase and a apoptosis, impacting both diabetic heart disease and tangier disease. The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation that impacts aging, barth syndrome, and non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure. | CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC(C)C | |
Suppose there is a molecule that meets the following description: It impacts diabetes treatment. Please write the SMILES representation of it. | O=P(O)(O)CN(c1ccc2c(ccn2-c2ccc(N3CCCNCC3)nn2)c1)S(=O)(=O)C1C=C(Cl)C=C(Cl)C1 | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a diabetes treatment. | O=P(O)(O)CN(c1ccc2c(ccn2-c2ccc(N3CCCNCC3)nn2)c1)S(=O)(=O)C1C=C(Cl)C=C(Cl)C1 | |
Suppose there is a molecule that meets the following description: It belongs to the diabetes treatment class of molecules. Please write the SMILES representation of it. | O=P(O)(O)CN(c1ccc2c(ccn2-c2ccc(N3CCCNCC3)nn2)c1)S(=O)(=O)C1C=C(Cl)C=C(Cl)C1 | |
Generate a molecule that fulfills the requirement: It impacts diabetes treatment. | O=P(O)(O)CN(c1ccc2c(ccn2-c2ccc(N3CCCNCC3)nn2)c1)S(=O)(=O)C1C=C(Cl)C=C(Cl)C1 | |
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a diabetes treatment. | O=P(O)(O)CN(c1ccc2c(ccn2-c2ccc(N3CCCNCC3)nn2)c1)S(=O)(=O)C1C=C(Cl)C=C(Cl)C1 |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.