instruction
stringlengths
51
2.18k
output
stringlengths
1
833
input
stringclasses
1 value
Build a molecule that meets the requirement: The molecule is a flavoring agent, meaty, savory, and sulfur.
COc1cc(C(=O)CO)cc(OC)c1O
I need a molecule that meets the following conditions: The molecule is a flavoring agent that is meaty and sulfur. The molecule is savory. Please represent the molecule in SMILES.
COc1cc(C(=O)CO)cc(OC)c1O
Could you please return a molecule that adheres to this description? The molecule is a flavoring agent, savory, sulfur, and meaty.
COc1cc(C(=O)CO)cc(OC)c1O
Based on the given information, generate a molecule that meets the desired specifications: The molecule is meaty, sulfur, and savory. The molecule is a flavoring agent.
COc1cc(C(=O)CO)cc(OC)c1O
I need a molecule that meets the following conditions: The molecule is a flavoring agent that is savory and sulfur. The molecule is meaty. Please represent the molecule in SMILES.
COc1cc(C(=O)CO)cc(OC)c1O
Suppose there is a molecule that meets the following description: The molecule is a faah inhibitor. Please write the SMILES representation of it.
CC1(C)COCN1C(=O)n1nnc2ncccc21
Build a molecule that meets the requirement: The molecule is a faah inhibitor.
CC1(C)COCN1C(=O)n1nnc2ncccc21
The molecule is a faah inhibitor. Use the above information to create a molecule.
CC1(C)COCN1C(=O)n1nnc2ncccc21
Conceptualize a molecule that meets the specified attribute(s): The molecule is a faah inhibitor.
CC1(C)COCN1C(=O)n1nnc2ncccc21
I need a molecule that meets the following conditions: The molecule is a faah inhibitor. Please represent the molecule in SMILES.
CC1(C)COCN1C(=O)n1nnc2ncccc21
Generate a molecule that fulfills the requirement: The molecule is a proton trap for oxidative phosphorylation and a apoptosis that impacts tangier disease, aging, and non-alcoholic fatty liver disease. The molecule is a cholesterol translocation, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts diabetic heart disease and barth syndrome.
CCC=CCC=CCC=CCC=CCCCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC
Build a molecule that meets the requirement: The molecule is a apoptosis that impacts tangier disease, barth syndrome, aging, and non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure, cholesterol translocation, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation that impacts diabetic heart disease.
CCC=CCC=CCC=CCC=CCCCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC
Come up with a molecule based on the description: The molecule is a cholesterol translocation. The molecule is a apoptosis, a stabilizing cytochrome oxidase, and a stabilizing mitochondrial structure, and it impacts barth syndrome. The molecule is a proton trap for oxidative phosphorylation that impacts diabetic heart disease, non-alcoholic fatty liver disease, tangier disease, and aging.
CCC=CCC=CCC=CCC=CCCCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC
I need a molecule that meets the following conditions: The molecule is a cholesterol translocation. The molecule is a stabilizing cytochrome oxidase and a proton trap for oxidative phosphorylation, impacting both barth syndrome and aging. The molecule is a stabilizing mitochondrial structure and a apoptosis that impacts non-alcoholic fatty liver disease, diabetic heart disease, and tangier disease. Please represent the molecule in SMILES.
CCC=CCC=CCC=CCC=CCCCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC
Generate a molecule that fulfills the requirement: The molecule is a cholesterol translocation, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation that impacts tangier disease and aging. The molecule is a stabilizing cytochrome oxidase and a apoptosis that impacts barth syndrome, diabetic heart disease, and non-alcoholic fatty liver disease.
CCC=CCC=CCC=CCC=CCCCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC
Can you create a molecule that matches the given characteristics? It impacts cardiovascular disease, atherosclerosis, and metabolic syndrome. The molecule is a nutrient and a fat storage, impacting both pancreatitis and thyroxine treatment.
CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCC=CCC=CCC=CCC=CCCCCC)COC(=O)CCCCCCCCCCCCCC=CCCCCCCCC
The molecule is a nutrient that impacts cardiovascular disease, pancreatitis, atherosclerosis, and metabolic syndrome. The molecule is a fat storage that impacts thyroxine treatment. Use the above information to create a molecule.
CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCC=CCC=CCC=CCC=CCCCCC)COC(=O)CCCCCCCCCCCCCC=CCCCCCCCC
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a fat storage that impacts both atherosclerosis and pancreatitis. The molecule is a nutrient and thyroxine treatment, impacting both metabolic syndrome and cardiovascular disease.
CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCC=CCC=CCC=CCC=CCCCCC)COC(=O)CCCCCCCCCCCCCC=CCCCCCCCC
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a nutrient and is part of the thyroxine treatment class, affecting metabolic syndrome, atherosclerosis, cardiovascular disease, and pancreatitis. The molecule is a fat storage.
CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCC=CCC=CCC=CCC=CCCCCC)COC(=O)CCCCCCCCCCCCCC=CCCCCCCCC
Generate a molecule that fulfills the requirement: The molecule is a fat storage and a nutrient, which impacts both pancreatitis and atherosclerosis, and is characterized as thyroxine treatment. It impacts both cardiovascular disease and metabolic syndrome.
CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCC=CCC=CCC=CCC=CCCCCC)COC(=O)CCCCCCCCCCCCCC=CCCCCCCCC
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a anti cancer.
CC(C)=CCCC(C)=CCn1cc(CN2CCCC2)c2cc(F)ccc21
Give me a molecule that satisfies the conditions outlined in the description: It belongs to the anti cancer class of molecules.
CC(C)=CCCC(C)=CCn1cc(CN2CCCC2)c2cc(F)ccc21
Build a molecule that meets the requirement: The molecule is anti cancer.
CC(C)=CCCC(C)=CCn1cc(CN2CCCC2)c2cc(F)ccc21
Suppose there is a molecule that meets the following description: The molecule is anti cancer. Please write the SMILES representation of it.
CC(C)=CCCC(C)=CCn1cc(CN2CCCC2)c2cc(F)ccc21
Conceptualize a molecule that meets the specified attribute(s): It belongs to the anti cancer class of molecules.
CC(C)=CCCC(C)=CCn1cc(CN2CCCC2)c2cc(F)ccc21
I need a molecule that meets the following conditions: The molecule is a stabilizing cytochrome oxidase and a apoptosis that impacts tangier disease, diabetic heart disease, and aging. The molecule is a stabilizing mitochondrial structure, cholesterol translocation, proton trap for oxidative phosphorylation that impacts barth syndrome and non-alcoholic fatty liver disease. Please represent the molecule in SMILES.
CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC
Generate a molecule that fulfills the requirement: The molecule is a apoptosis. The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation, impacting both barth syndrome and non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure and a stabilizing cytochrome oxidase that impacts aging, diabetic heart disease, and tangier disease.
CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC
Generate a molecule based on this description: It impacts non-alcoholic fatty liver disease, aging, barth syndrome, and diabetic heart disease. The molecule is a stabilizing mitochondrial structure, a cholesterol translocation, and a stabilizing cytochrome oxidase, and it impacts tangier disease. The molecule is both a apoptosis and a proton trap for oxidative phosphorylation.
CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC
Generate a molecule that fulfills the requirement: It impacts tangier disease. The molecule is a proton trap for oxidative phosphorylation, a cholesterol translocation, and a apoptosis, and it impacts non-alcoholic fatty liver disease. The molecule is a stabilizing cytochrome oxidase and a stabilizing mitochondrial structure that impacts barth syndrome, aging, and diabetic heart disease.
CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC
Generate a molecule that fulfills the requirement: The molecule is a stabilizing cytochrome oxidase that impacts both non-alcoholic fatty liver disease and aging. The molecule is a cholesterol translocation and stabilizing mitochondrial structure, and it impacts tangier disease. The molecule is a apoptosis and a proton trap for oxidative phosphorylation, impacting both diabetic heart disease and barth syndrome.
CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC
Based on the given information, generate a molecule that meets the desired specifications: It impacts cancer treatment.
CC(=CC=CN)Cc1ccccn1
Build a molecule that meets the requirement: It belongs to the cancer treatment class of molecules.
CC(=CC=CN)Cc1ccccn1
Can you create a molecule that matches the given characteristics? The molecule is cancer treatment.
CC(=CC=CN)Cc1ccccn1
Build a molecule that meets the requirement: The molecule is cancer treatment.
CC(=CC=CN)Cc1ccccn1
Suppose there is a molecule that meets the following description: It impacts cancer treatment. Please write the SMILES representation of it.
CC(=CC=CN)Cc1ccccn1
Could you please return a molecule that adheres to this description? The molecule is a hcv inhibitor and is anti viral.
COc1ccc2c(c1)c(C#N)c(-c1ccc(NS(=O)(=O)C3CC3)cc1)n2C1CCC1
Can you create a molecule that matches the given characteristics? The molecule is a hcv inhibitor and is anti viral.
COc1ccc2c(c1)c(C#N)c(-c1ccc(NS(=O)(=O)C3CC3)cc1)n2C1CCC1
Give me a molecule that satisfies the conditions outlined in the description: The molecule is both a hcv inhibitor and a anti viral.
COc1ccc2c(c1)c(C#N)c(-c1ccc(NS(=O)(=O)C3CC3)cc1)n2C1CCC1
Generate a molecule based on this description: The molecule is a hcv inhibitor and belongs to the anti viral class of molecules.
COc1ccc2c(c1)c(C#N)c(-c1ccc(NS(=O)(=O)C3CC3)cc1)n2C1CCC1
Generate a molecule that fulfills the requirement: The molecule is a hcv inhibitor and is anti viral.
COc1ccc2c(c1)c(C#N)c(-c1ccc(NS(=O)(=O)C3CC3)cc1)n2C1CCC1
Come up with a molecule based on the description: Hazardous decomposition products formed under fire conditions: carbon oxides, silicon oxides.
C[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C
Can you create a molecule that matches the given characteristics? Hazardous decomposition products formed under fire conditions: carbon oxides, silicon oxides.
C[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C
Give me a molecule that satisfies the conditions outlined in the description: Hazardous decomposition products formed under fire conditions: carbon oxides, silicon oxides.
C[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C
Based on the given information, generate a molecule that meets the desired specifications: Hazardous decomposition products formed under fire conditions: carbon oxides, silicon oxides.
C[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C
Suppose there is a molecule that meets the following description: Hazardous decomposition products formed under fire conditions: carbon oxides, silicon oxides. Please write the SMILES representation of it.
C[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C
Build a molecule that meets the requirement: The molecule is both a anti fungal and a hypercholesterolemia treatment.
CC(C)(C)CN1C(=O)C(CCC#N)OC(c2ccccc2Cl)c2cc(Cl)ccc21
Could you please return a molecule that adheres to this description? The molecule is a member of the anti fungal class and affects hypercholesterolemia treatment.
CC(C)(C)CN1C(=O)C(CCC#N)OC(c2ccccc2Cl)c2cc(Cl)ccc21
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a anti fungal that impacts hypercholesterolemia treatment.
CC(C)(C)CN1C(=O)C(CCC#N)OC(c2ccccc2Cl)c2cc(Cl)ccc21
Could you please return a molecule that adheres to this description? The molecule is a anti fungal and is hypercholesterolemia treatment.
CC(C)(C)CN1C(=O)C(CCC#N)OC(c2ccccc2Cl)c2cc(Cl)ccc21
Conceptualize a molecule that meets the specified attribute(s): The molecule is a hypercholesterolemia treatment and is anti fungal.
CC(C)(C)CN1C(=O)C(CCC#N)OC(c2ccccc2Cl)c2cc(Cl)ccc21
The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts aging and diabetic heart disease. The molecule is a apoptosis and a cholesterol translocation that impacts tangier disease, barth syndrome, and non-alcoholic fatty liver disease. Use the above information to create a molecule.
CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC
Conceptualize a molecule that meets the specified attribute(s): The molecule is a proton trap for oxidative phosphorylation and a apoptosis, impacting both non-alcoholic fatty liver disease and tangier disease. The molecule is a stabilizing mitochondrial structure, stabilizing cytochrome oxidase, cholesterol translocation that impacts diabetic heart disease and aging. It impacts barth syndrome.
CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a apoptosis and a cholesterol translocation that impacts barth syndrome, tangier disease, aging, and non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure, a proton trap for oxidative phosphorylation, and a stabilizing cytochrome oxidase, and it impacts diabetic heart disease.
CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC
Suppose there is a molecule that meets the following description: The molecule is a stabilizing mitochondrial structure, cholesterol translocation, stabilizing cytochrome oxidase that impacts diabetic heart disease, non-alcoholic fatty liver disease, and aging. The molecule is a apoptosis and a proton trap for oxidative phosphorylation, impacting both tangier disease and barth syndrome. Please write the SMILES representation of it.
CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a cholesterol translocation that impacts diabetic heart disease. The molecule is a stabilizing mitochondrial structure, apoptosis, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation. It impacts aging, non-alcoholic fatty liver disease, barth syndrome, and tangier disease.
CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC
Generate a molecule based on this description: The molecule is a anti allergic agent and belongs to the anti allergic class of molecules.
COc1c(OC(=O)c2ccccc2)c2cccc(OC(C)(C)C)c2oc1=O
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a anti allergic and belongs to the anti allergic agent class of molecules.
COc1c(OC(=O)c2ccccc2)c2cccc(OC(C)(C)C)c2oc1=O
Can you create a molecule that matches the given characteristics? The molecule is anti allergic and anti allergic agent.
COc1c(OC(=O)c2ccccc2)c2cccc(OC(C)(C)C)c2oc1=O
The molecule is a anti allergic and is anti allergic agent. Use the above information to create a molecule.
COc1c(OC(=O)c2ccccc2)c2cccc(OC(C)(C)C)c2oc1=O
I need a molecule that meets the following conditions: The molecule is a anti allergic member of the anti allergic agent class. Please represent the molecule in SMILES.
COc1c(OC(=O)c2ccccc2)c2cccc(OC(C)(C)C)c2oc1=O
Build a molecule that meets the requirement: It impacts thyroxine treatment. The molecule is a fat storage and a nutrient that impacts pancreatitis, atherosclerosis, cardiovascular disease, and metabolic syndrome.
CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCC=CCC=CCCCCC)COC(=O)CCCCCCCCCCCC=CCCCCCCCC
Conceptualize a molecule that meets the specified attribute(s): The molecule is a nutrient and a fat storage, impacting both metabolic syndrome and pancreatitis. The molecule is a thyroxine treatment that impacts both cardiovascular disease and atherosclerosis.
CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCC=CCC=CCCCCC)COC(=O)CCCCCCCCCCCC=CCCCCCCCC
Could you please return a molecule that adheres to this description? The molecule is a fat storage that impacts atherosclerosis. The molecule is a nutrient that belongs to the thyroxine treatment class of molecules, impacting pancreatitis, cardiovascular disease, and metabolic syndrome.
CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCC=CCC=CCCCCC)COC(=O)CCCCCCCCCCCC=CCCCCCCCC
Conceptualize a molecule that meets the specified attribute(s): The molecule is a nutrient that impacts both atherosclerosis and cardiovascular disease. The molecule is a fat storage and thyroxine treatment, impacting both metabolic syndrome and pancreatitis.
CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCC=CCC=CCCCCC)COC(=O)CCCCCCCCCCCC=CCCCCCCCC
Conceptualize a molecule that meets the specified attribute(s): The molecule is a nutrient, thyroxine treatment, fat storage that impacts cardiovascular disease, atherosclerosis, and metabolic syndrome. It impacts pancreatitis.
CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCC=CCC=CCCCCC)COC(=O)CCCCCCCCCCCC=CCCCCCCCC
Could you please return a molecule that adheres to this description? The molecule is anti bacterial.
CC(=O)Nc1ccc([N+](=O)[O-])c(-c2ccncc2)n1
Generate a molecule based on this description: The molecule is anti bacterial.
CC(=O)Nc1ccc([N+](=O)[O-])c(-c2ccncc2)n1
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a anti bacterial.
CC(=O)Nc1ccc([N+](=O)[O-])c(-c2ccncc2)n1
Based on the given information, generate a molecule that meets the desired specifications: It belongs to the anti bacterial class of molecules.
CC(=O)Nc1ccc([N+](=O)[O-])c(-c2ccncc2)n1
Could you please return a molecule that adheres to this description? The molecule is a anti bacterial.
CC(=O)Nc1ccc([N+](=O)[O-])c(-c2ccncc2)n1
Suppose there is a molecule that meets the following description: The molecule is a stabilizing cytochrome oxidase and a stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease, aging, and tangier disease. The molecule is a proton trap for oxidative phosphorylation, apoptosis, cholesterol translocation that impacts barth syndrome and diabetic heart disease. Please write the SMILES representation of it.
CCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C
Suppose there is a molecule that meets the following description: The molecule is a apoptosis and a cholesterol translocation that impacts tangier disease, aging, and diabetic heart disease. The molecule is a stabilizing mitochondrial structure, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation that impacts barth syndrome and non-alcoholic fatty liver disease. Please write the SMILES representation of it.
CCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C
Generate a molecule that fulfills the requirement: The molecule is a stabilizing mitochondrial structure, a stabilizing cytochrome oxidase, and a cholesterol translocation, and it impacts tangier disease. The molecule is a apoptosis and a proton trap for oxidative phosphorylation that impacts aging, barth syndrome, non-alcoholic fatty liver disease, and diabetic heart disease.
CCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C
Generate a molecule based on this description: The molecule is a stabilizing mitochondrial structure and a proton trap for oxidative phosphorylation, impacting both non-alcoholic fatty liver disease and aging. The molecule is a apoptosis and a stabilizing cytochrome oxidase that impacts tangier disease, barth syndrome, and diabetic heart disease. The molecule is a cholesterol translocation.
CCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C
Generate a molecule based on this description: The molecule is a proton trap for oxidative phosphorylation, cholesterol translocation, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts tangier disease and non-alcoholic fatty liver disease. The molecule is a apoptosis that impacts aging, barth syndrome, and diabetic heart disease.
CCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C
Can you create a molecule that matches the given characteristics? The molecule is a fat storage that impacts both cardiovascular disease and atherosclerosis. The molecule is a nutrient that impacts metabolic syndrome, thyroxine treatment, and pancreatitis.
CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCCCC=CCCCCCCCC
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a nutrient that impacts both cardiovascular disease and pancreatitis. The molecule is a fat storage and belongs to the thyroxine treatment class of molecules, impacting both metabolic syndrome and atherosclerosis.
CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCCCC=CCCCCCCCC
It impacts both metabolic syndrome and atherosclerosis. The molecule is a fat storage and a nutrient that impacts cardiovascular disease, pancreatitis, and thyroxine treatment. Use the above information to create a molecule.
CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCCCC=CCCCCCCCC
Conceptualize a molecule that meets the specified attribute(s): The molecule is a fat storage that impacts both cardiovascular disease and atherosclerosis. The molecule is a nutrient and a thyroxine treatment, impacting both pancreatitis and metabolic syndrome.
CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCCCC=CCCCCCCCC
The molecule is a nutrient that impacts both pancreatitis and atherosclerosis. The molecule is a fat storage and belongs to the thyroxine treatment class of molecules, impacting both cardiovascular disease and metabolic syndrome. Use the above information to create a molecule.
CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCCCC=CCCCCCCCC
Can you create a molecule that matches the given characteristics? It impacts obesity. The molecule is a energy storage, energy source, membrane stabilizer, inflammatory that impacts pancreatitis and atherosclerosis. The molecule is a fat storage and nutrient, belonging to the thyroxine treatment class of molecules, and impacts metabolic syndrome, cancer, and cardiovascular disease.
CCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)C
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a nutrient that impacts both metabolic syndrome and obesity. The molecule is a fat storage and a inflammatory, impacting both cardiovascular disease and atherosclerosis. The molecule is a membrane stabilizer, a energy source, and a energy storage that impacts both cancer and pancreatitis, and is thyroxine treatment.
CCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)C
Come up with a molecule based on the description: The molecule is a fat storage, energy storage, membrane stabilizer that impacts cancer, obesity, and pancreatitis. The molecule is a inflammatory, a nutrient, and a energy source that impacts both cardiovascular disease and metabolic syndrome, and is thyroxine treatment. It impacts atherosclerosis.
CCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)C
Build a molecule that meets the requirement: The molecule is a inflammatory that impacts pancreatitis. The molecule is a energy source, fat storage, energy storage, thyroxine treatment that impacts atherosclerosis. The molecule is a membrane stabilizer and a nutrient that impacts cancer, obesity, metabolic syndrome, and cardiovascular disease.
CCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)C
Conceptualize a molecule that meets the specified attribute(s): The molecule is a membrane stabilizer, energy storage, inflammatory that impacts cancer and cardiovascular disease. The molecule is a nutrient, energy source, fat storage that impacts obesity, thyroxine treatment, and metabolic syndrome. It impacts both pancreatitis and atherosclerosis.
CCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)C
I need a molecule that meets the following conditions: The molecule is a cholesterol translocation, apoptosis, stabilizing cytochrome oxidase that impacts diabetic heart disease and barth syndrome. The molecule is a proton trap for oxidative phosphorylation and a stabilizing mitochondrial structure that impacts aging, non-alcoholic fatty liver disease, and tangier disease. Please represent the molecule in SMILES.
CCC=CCC=CCC=CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a proton trap for oxidative phosphorylation and a apoptosis that impacts non-alcoholic fatty liver disease, tangier disease, and aging. The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, cholesterol translocation that impacts diabetic heart disease and barth syndrome.
CCC=CCC=CCC=CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a stabilizing mitochondrial structure that impacts both tangier disease and barth syndrome. The molecule is a stabilizing cytochrome oxidase that impacts both aging and non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation, a apoptosis, and a cholesterol translocation, and it impacts diabetic heart disease.
CCC=CCC=CCC=CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC
Generate a molecule that fulfills the requirement: The molecule is a apoptosis that impacts non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation and a stabilizing cytochrome oxidase, impacting both diabetic heart disease and aging. The molecule is a stabilizing mitochondrial structure and a cholesterol translocation, impacting both barth syndrome and tangier disease.
CCC=CCC=CCC=CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC
Suppose there is a molecule that meets the following description: The molecule is a stabilizing cytochrome oxidase and a proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease, diabetic heart disease, and aging. The molecule is a stabilizing mitochondrial structure, apoptosis, cholesterol translocation that impacts barth syndrome and tangier disease. Please write the SMILES representation of it.
CCC=CCC=CCC=CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a nutrient that impacts atherosclerosis, breast cancer, ulcerative colitis, and cervical cancer.
CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCCC(O)CC)COP(=O)([O-])OCC[N+](C)(C)C
The molecule is a nutrient that affects cervical cancer by impacting atherosclerosis, ulcerative colitis, and breast cancer. Use the above information to create a molecule.
CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCCC(O)CC)COP(=O)([O-])OCC[N+](C)(C)C
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a nutrient that affects breast cancer by impacting atherosclerosis, ulcerative colitis, and cervical cancer.
CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCCC(O)CC)COP(=O)([O-])OCC[N+](C)(C)C
Conceptualize a molecule that meets the specified attribute(s): The molecule is a nutrient that impacts both breast cancer and atherosclerosis. It influences cervical cancer and ulcerative colitis.
CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCCC(O)CC)COP(=O)([O-])OCC[N+](C)(C)C
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a nutrient that impacts atherosclerosis, ulcerative colitis, breast cancer, and cervical cancer.
CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCCC(O)CC)COP(=O)([O-])OCC[N+](C)(C)C
Could you please return a molecule that adheres to this description? The molecule is a emulsifier, proton trap for oxidative phosphorylation, surfactant, energy storage that impacts non-alcoholic fatty liver disease and diabetic heart disease. The molecule is a energy source and smooth, and it impacts barth syndrome. The molecule is a stabilizing mitochondrial structure, a membrane stabilizer, and a cholesterol translocation, and it impacts aging. The molecule is a nutritional supplement, apoptosis, stabilizing cytochrome oxidase, food additive that impacts tangier disease.
CCC(C)CCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC(C)C
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a food additive and apoptosis, and it impacts barth syndrome. The molecule is a stabilizing cytochrome oxidase, a emulsifier, and a surfactant, and it impacts aging. The molecule is a stabilizing mitochondrial structure and a proton trap for oxidative phosphorylation, impacting both non-alcoholic fatty liver disease and diabetic heart disease. The molecule is a energy storage and a nutritional supplement, it impacts tangier disease, and is smooth. The molecule is a energy source, a cholesterol translocation, and a membrane stabilizer.
CCC(C)CCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC(C)C
Conceptualize a molecule that meets the specified attribute(s): The molecule is a membrane stabilizer, food additive, surfactant, nutritional supplement, stabilizing cytochrome oxidase that impacts tangier disease. The molecule is a emulsifier, energy source, cholesterol translocation, and apoptosis, impacts aging, and is smooth. The molecule is a energy storage, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure that impacts barth syndrome, diabetic heart disease, and non-alcoholic fatty liver disease.
CCC(C)CCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC(C)C
Build a molecule that meets the requirement: The molecule is a surfactant, a proton trap for oxidative phosphorylation, and a nutritional supplement. The molecule is a energy source, a cholesterol translocation, and a membrane stabilizer, and it impacts tangier disease. The molecule is a stabilizing mitochondrial structure and a emulsifier, impacting both diabetic heart disease and non-alcoholic fatty liver disease. The molecule is a energy storage and a apoptosis, it impacts barth syndrome, and is smooth. The molecule is a food additive and stabilizing cytochrome oxidase, and it impacts aging.
CCC(C)CCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC(C)C
Generate a molecule that fulfills the requirement: The molecule is a emulsifier and smooth, impacting both aging and diabetic heart disease. The molecule is a stabilizing mitochondrial structure, a energy storage, and a stabilizing cytochrome oxidase. The molecule is a apoptosis, a cholesterol translocation, and a nutritional supplement, and it impacts non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation and membrane stabilizer, and it impacts barth syndrome. The molecule is a energy source, a food additive, and a surfactant, and it impacts tangier disease.
CCC(C)CCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC(C)C