instruction
stringlengths 39
871
| input
stringclasses 1
value | output
stringlengths 2
23
|
|---|---|---|
Convert the representation of a molecule CC(C)COc1ccc(CN(CCO)CCO)cc1[N+](=O)[O-] into molecular formula. | C15H24N2O5 |
|
CCC(C)OP(=O)(Oc1cccc([N+](C)(C)C)c1)OC(C)CC is the representation of a molecule. What is its molecular formula? | C17H31NO4P+ |
|
I'd like to know the molecular formula of CN(C)CCOCCOC(=O)c1ccc(N)cc1 . Can you tell me? | C13H20N2O3 |
|
Convert the representation of a molecule CN1CCOC1c1ccc(C#N)cc1 into molecular formula. | C11H12N2O |
|
Can you tell me the molecular formula of O=Cc1ccc(OCCCN2CCN(c3ccccc3)CC2)cc1 ? | C20H24N2O2 |
|
Can you give the molecular molecular formula of COc1cc(C(=O)OC2CN3CCC2CC3)cc(OC)c1OC ? | C17H23NO5 |
|
What is the formula of the molecule CC(NCCN(C)C)C(=O)O ? | C7H16N2O2 |
|
What is the molecular formula for the molecule denoted by CC1=C(COC(=O)C(O)(c2ccccc2)C2CCCC2)CN(C)CC1 ? | C21H29NO3 |
|
Given the representation CCCC(=O)N(C)C(=O)ON=C1CSCCS1, what would be its molecular formula? | C10H16N2O3S2 |
|
Please provide the molecular formula for COc1ccc(C(=O)Nc2ccc(C(=O)NN=Cc3ccc(OC)c(OC)c3)cc2)cc1 . | C24H23N3O5 |
|
Considering the code C=CCOc1c(CC=C)cc(C(=O)O)cc1CC=C, can you determine the corresponding molecular formula? | C16H18O3 |
|
Please provide the molecular formula for CCCCn1cc(C(=O)C(=O)N(C)C)c2ccccc21 . | C16H20N2O2 |
|
O=C1N=CCN1c1ncc([N+](=O)[O-])s1 is the representation of a molecule. What is its molecular formula? | C6H4N4O3S |
|
What is the molecular formula for the molecule denoted by C=C(C)C(O)(C(=O)OC1CC(C)N(C)C(C)(C)C1)c1ccccc1 ? | C20H29NO3 |
|
Considering the code CC#CC(O)(C(=O)OC1CN2CCC1CC2)c1ccccc1, can you determine the corresponding molecular formula? | C18H21NO3 |
|
What is the molecular formula for the molecule denoted by CCOC(=O)C(CN(CCCl)CCCl)(C(=O)OCC)[N+](=O)[O-] ? | C12H20Cl2N2O6 |
|
CCN(CC)CCSCC(=O)Nc1ccccc1C is the representation of a molecule. What is its molecular formula? | C15H24N2OS |
|
The representation C[N+](C)(C)CCCN1CC2CCCC(C1)[N+]2(C)C represents a specific molecule. Can you reveal its molecular formula? | C15H33N3+2 |
|
Considering the code CCOC(=O)C(CCc1ccccc1)NC(C)C(=O)N1N=C(C(C)(C)C)SC1C(=O)O, can you determine the corresponding molecular formula? | C22H31N3O5S |
|
What is the molecular formula of O=C(O)CNCC(O)NCC(=O)O ? | C6H12N2O5 |
|
Given the representation CCCCOCCOC(C)CO, what would be its molecular formula? | C9H20O3 |
|
Convert the representation of a molecule Cc1nc2ccccc2c(=O)n1CCCN1CCCCC1 into molecular formula. | C17H23N3O |
|
The representation Cc1c(O)cccc1-n1c(CF)nc2ccc(N)cc2c1=O represents a specific molecule. Can you reveal its molecular formula? | C16H14FN3O2 |
|
Considering the code O=C(NCCC12CC3CC(CC(C3)C1)C2)c1ccccn1, can you determine the corresponding molecular formula? | C18H24N2O |
|
COc1ccc(CCN(C)CCCN2CCc3cc(OC)c(OC)cc3CC2=O)cc1OC is the representation of a molecule. What is its molecular formula? | C26H36N2O5 |
|
What is the molecular formula for the molecule denoted by NC(=O)c1nc[nH]c1C(N)=O ? | C5H6N4O2 |
|
Convert the representation of a molecule CC(C)c1nnc(NS(=O)(=O)c2ccc(N)cc2)s1 into molecular formula. | C11H14N4O2S2 |
|
What is the molecular formula of O=C(O)c1nccnc1C(=O)O ? | C6H4N2O4 |
|
Please write the molecular formula of the molecule CC(C)OCCC#N . | C6H11NO |
|
Can you tell me the molecular formula of O=C(Nc1ccc2c(O)cc(S(=O)(=O)O)cc2c1)c1ccc([N+](=O)[O-])cc1 ? | C17H12N2O7S |
|
What is the formula of the molecule O=C(Nc1cccc([N+](=O)[O-])c1)c1ccc([N+](=O)[O-])cc1 ? | C13H9N3O5 |
|
Can you tell me the molecular formula of N#CC(F)(F)C(F)(F)F ? | C3F5N |
|
What is the formula of the molecule CCOc1cccc(C=O)c1O ? | C9H10O3 |
|
I'd like to know the molecular formula of CCN(CC)CCOC(=O)C1N2C(=O)C(NC(=O)c3c(OC)cccc3OC)C2SC1(C)C . Can you tell me? | C23H33N3O6S |
|
Given the representation O=C1C=C(O)C(=O)C=C1O, what would be its molecular formula? | C6H4O4 |
|
Please provide the molecular formula for c1ccc2c(c1)CC2 . | C8H8 |
|
Given the representation O=S(=O)(Cl)CCF, what would be its molecular formula? | C2H4ClFO2S |
|
C[SiH2]c1ccccc1 is the representation of a molecule. What is its molecular formula? | C7H10Si |
|
Considering the code CC(C)(C)OC(=O)NN, can you determine the corresponding molecular formula? | C5H12N2O2 |
|
The representation NNC(=O)Cc1ccccc1 represents a specific molecule. Can you reveal its molecular formula? | C8H10N2O |
|
Convert the representation of a molecule C[Si](c1ccccc1)(c1ccccc1)[Si](C)(c1ccccc1)c1ccccc1 into molecular formula. | C26H26Si2 |
|
Can you tell me the molecular formula of CC1(C)SC2C(NC(=O)C(Oc3ccccc3)c3ccccc3)C(=O)N2C1C(=O)O ? | C22H22N2O5S |
|
The representation CC(C)NCC(O)COc1cccc2[nH]c3ccccc3c12 represents a specific molecule. Can you reveal its molecular formula? | C18H22N2O2 |
|
Cc1cn(C2CC(O)C(CO)O2)c(=O)[nH]c1=O is the representation of a molecule. What is its molecular formula? | C10H14N2O5 |
|
I'd like to know the molecular formula of CC(C)C(NC(=O)C(CCCN=C(N)N)NC(=O)NC(Cc1ccccc1)C(=O)O)C(=O)NC(C=O)Cc1ccccc1 . Can you tell me? | C30H41N7O6 |
|
Can you tell me the molecular formula of O=c1[nH]c(=O)n(COCCO)cc1F ? | C7H9FN2O4 |
|
Considering the code C=C1C(=O)OC2CC3(C)CCCC(C)C3=CC12, can you determine the corresponding molecular formula? | C15H20O2 |
|
I'd like to know the molecular formula of Nc1ccc2c(c1)C(=O)NC2=O . Can you tell me? | C8H6N2O2 |
|
Considering the code COc1ccc(C2CC(=O)c3c(O)cc(OC4OC(CO)C(O)C(O)C4OC4OC(C)C(O)C(O)C4O)cc3O2)cc1O, can you determine the corresponding molecular formula? | C28H34O15 |
|
What is the molecular formula of N#CN1CCOCC1 ? | C5H8N2O |
|
What is the molecular formula of ClC(Cl)[Si](Cl)(Cl)Cl ? | CHCl5Si |
|
Convert the representation of a molecule COC(=O)CCCC(=O)Cl into molecular formula. | C6H9ClO3 |
|
Can you give the molecular molecular formula of c1ccc(-c2ccc(-c3ccccc3)s2)cc1 ? | C16H12S |
|
Convert the representation of a molecule OCCn1ccnc1 into molecular formula. | C5H8N2O |
|
Considering the code C[Si]1(C)O[Si](C)(C)O[Si](c2ccccc2)(c2ccccc2)O[Si](C)(C)O1, can you determine the corresponding molecular formula? | C18H28O4Si4 |
|
What is the molecular formula of C=C(C)O[Si](C)(C)C ? | C6H14OSi |
|
What is the formula of the molecule Cc1cccc(N=Nc2ccc(N=Nc3cc(C)ccc3O)cc2C)c1 ? | C21H20N4O |
|
Can you tell me the molecular formula of CC(=O)Nc1ccc(C(=O)OCCN(C)C)cc1 ? | C13H18N2O3 |
|
I'd like to know the molecular formula of Nc1ccc2c(ccc3ccccc32)c1 . Can you tell me? | C14H11N |
|
Please provide the molecular formula for Cc1cc(C)[n+]([O-])c(C)c1 . | C8H11NO |
|
Please write the molecular formula of the molecule O=C(CS(=O)(=O)c1ccccc1)c1ccccc1 . | C14H12O3S |
|
Please write the molecular formula of the molecule FC(F)=C(F)CCSc1ncccn1 . | C8H7F3N2S |
|
What is the molecular formula for the molecule denoted by O=C(CBr)C(F)(F)F ? | C3H2BrF3O |
|
What is the molecular formula for the molecule denoted by O=C(S)CCl ? | C2H3ClOS |
|
I'd like to know the molecular formula of CCCCCCCCCCCCSC(=NC)NC . Can you tell me? | C15H32N2S |
|
What is the molecular formula for the molecule denoted by CCN(CC)CCCNC ? | C8H20N2 |
|
What is the molecular formula for the molecule denoted by CC1(C)OC(=O)C2(CC2)C(=O)O1 ? | C8H10O4 |
|
Given the representation C1CCCCNCCC1, what would be its molecular formula? | C8H17N |
|
What is the molecular formula for the molecule denoted by Cc1ccc(S(=O)(=O)CC#N)cc1 ? | C9H9NO2S |
|
What is the molecular formula of O=C(Oc1ccccc1O)c1ccccc1 ? | C13H10O3 |
|
What is the molecular formula of O=C1OC(=O)c2ccc([N+](=O)[O-])c3cccc1c23 ? | C12H5NO5 |
|
Can you tell me the molecular formula of C=CC(=O)OCC(CC)(CO)CO ? | C9H16O4 |
|
Convert the representation of a molecule O=C(NO)Nc1ccccc1 into molecular formula. | C7H8N2O2 |
|
Can you give the molecular molecular formula of CCC[Sn](=O)CCC ? | C6H14OSn |
|
Please write the molecular formula of the molecule COCCN1CCOCC1 . | C7H15NO2 |
|
Convert the representation of a molecule COc1ccc([N+](=O)[O-])cc1C#N into molecular formula. | C8H6N2O3 |
|
What is the molecular formula of CCCSP(C)(=O)OCC ? | C6H15O2PS |
|
Please provide the molecular formula for COC(=O)C1C(CC(=O)c2ccccc2)CC2CCC1N2C . | C18H23NO3 |
|
Considering the code O=C(CCCCC1C2NC(=O)NC2CS1=O)NCCNC(=O)CCc1ccc(O)c(I)c1, can you determine the corresponding molecular formula? | C21H29IN4O5S |
|
What is the molecular formula of COC(=O)c1nc(Cl)c(Cl)c(N)c1Cl ? | C7H5Cl3N2O2 |
|
Please write the molecular formula of the molecule CC1(C)COP(=O)(Cc2ccccc2)OC1 . | C12H17O3P |
|
Can you tell me the molecular formula of CCOC1(c2ccccc2)OCCN(C)C1C ? | C14H21NO2 |
|
Convert the representation of a molecule CC(C)OC(=O)C1(S(=O)(=O)c2ccc([N+](=O)[O-])cc2)CCC1 into molecular formula. | C14H17NO6S |
|
Please provide the molecular formula for ClC1=C(Cl)C2(Cl)C3C(Br)C(Br)CC3C1(Cl)C2(Cl)Cl . | C10H6Br2Cl6 |
|
Can you give the molecular molecular formula of CCCC1(CCC(C)C)C(=O)NC(=O)NC1=O ? | C12H20N2O3 |
|
Can you give the molecular molecular formula of C[Si](C)(C)OC(=O)CC(=O)O[Si](C)(C)C ? | C9H20O4Si2 |
|
What is the molecular formula of CCCCCCCCC(=O)OCCOCCCC ? | C15H30O3 |
|
Please provide the molecular formula for CCN(CC)c1ccc(C(=O)O)c(O)c1 . | C11H15NO3 |
|
Convert the representation of a molecule Cc1onc(-c2ccccc2Cl)c1C(=O)O into molecular formula. | C11H8ClNO3 |
|
Given the representation O=C1CCC(=O)N1c1cc(Cl)cc(Cl)c1, what would be its molecular formula? | C10H7Cl2NO2 |
|
Can you give the molecular molecular formula of CCc1ccccc1NS(=O)(=O)C1=CC(=[N+]=[N-])C=CC1=NS(=O)(=O)c1ccc(C)cc1 ? | C21H20N4O4S2 |
|
What is the formula of the molecule CCC(C)OC(=O)C(C)C ? | C8H16O2 |
|
What is the molecular formula of N#CC(OC1OC(CO)C(O)C(O)C1O)c1ccccc1 ? | C14H17NO6 |
|
I'd like to know the molecular formula of CC1=CCCC2(C)OC2CC1 . Can you tell me? | C10H16O |
|
I'd like to know the molecular formula of CC1(C)CCC2(C)CC=C3C(C)(CCC4C3(C)CCC3C(C)(C)C(O)CCC43C)C2C1 . Can you tell me? | C30H50O |
|
Can you tell me the molecular formula of CCCCCCCCP(=O)(CCCCCC)CCCCCCCC ? | C22H47OP |
|
I'd like to know the molecular formula of CC(=CC=O)CCCC(C)C . Can you tell me? | C10H18O |
|
The representation CCOP(OCC)n1cncn1 represents a specific molecule. Can you reveal its molecular formula? | C6H12N3O2P |
|
Given the representation CC(C)=CC#N, what would be its molecular formula? | C5H7N |
|
Please provide the molecular formula for CCC1(COP(C)(=O)OCC2(CC)COP(C)(=O)OC2)COP(C)(=O)OC1 . | C15H31O9P3 |
Subsets and Splits
No saved queries yet
Save your SQL queries to embed, download, and access them later. Queries will appear here once saved.