instruction
stringlengths 39
871
| input
stringclasses 1
value | output
stringlengths 2
23
|
|---|---|---|
I'd like to know the molecular formula of I[Sn](c1ccccc1)(c1ccccc1)c1ccccc1 . Can you tell me? | C18H15ISn |
|
Given the representation S=P1(N(CCCl)CCCl)NCCCO1, what would be its molecular formula? | C7H15Cl2N2OPS |
|
Cc1c[n+]([O-])cc(C)c1[N+](=O)[O-] is the representation of a molecule. What is its molecular formula? | C7H8N2O3 |
|
Fc1ccccc1-c1nnc(-c2cccc3ccccc23)o1 is the representation of a molecule. What is its molecular formula? | C18H11FN2O |
|
Can you tell me the molecular formula of Clc1ccc(C#Cc2ccc(Cl)cc2)cc1 ? | C14H8Cl2 |
|
Convert the representation of a molecule CCCCCCCCC=CCCCCCCCC1=NCCO1 into molecular formula. | C20H37NO |
|
Given the representation CC(OC(N)=O)C(F)(F)C(F)F, what would be its molecular formula? | C5H7F4NO2 |
|
I'd like to know the molecular formula of ClC=C(c1ccc(Cl)cc1)c1ccc(Cl)cc1 . Can you tell me? | C14H9Cl3 |
|
Convert the representation of a molecule C=CCc1cc(CNCCCO)c(O)c(OC)c1 into molecular formula. | C14H21NO3 |
|
What is the molecular formula for the molecule denoted by CCN(CC)P(=O)(OC)OC ? | C6H16NO3P |
|
O=P1(N(CCCl)CCCl)NC(O)CCO1 is the representation of a molecule. What is its molecular formula? | C7H15Cl2N2O3P |
|
Considering the code CCOC(=O)C1=C(C)NC(C)=C(C(=O)OCC)C1c1cccnc1, can you determine the corresponding molecular formula? | C18H22N2O4 |
|
The representation O=C(O)C1(NO)CCCCC1 represents a specific molecule. Can you reveal its molecular formula? | C7H13NO3 |
|
Given the representation Nc1cccc(Cl)c1[N+](=O)[O-], what would be its molecular formula? | C6H5ClN2O2 |
|
Considering the code O=c1cc(Br)[nH]c(=O)[nH]1, can you determine the corresponding molecular formula? | C4H3BrN2O2 |
|
What is the molecular formula of CC(=O)OC1CCC23COC(CC4C5CCC(C(C)CCCC(C)C)C5(C)CCC42)C3(Br)C1 ? | C29H47BrO3 |
|
CC(C)c1ccc(OCC2CO2)cc1 is the representation of a molecule. What is its molecular formula? | C12H16O2 |
|
What is the molecular formula for the molecule denoted by CCOC(=O)C1CN(CC)c2nc(SC)ncc2C1=O ? | C13H17N3O3S |
|
What is the molecular formula of COC1(C)CCc2c(C)c(O)c(C)c(C)c2O1 ? | C14H20O3 |
|
Can you tell me the molecular formula of O=C(S)SSSSC(=O)S ? | C2H2O2S6 |
|
Convert the representation of a molecule N#CSc1ccc(N)c([N+](=O)[O-])c1 into molecular formula. | C7H5N3O2S |
|
Can you tell me the molecular formula of S=C(S)C1CCCN1 ? | C5H9NS2 |
|
The representation [Eu+3] represents a specific molecule. Can you reveal its molecular formula? | Eu+3 |
|
Convert the representation of a molecule Cc1ccc(C)c(Oc2cccc(C(=O)NC(C)(C)C)c2)c1 into molecular formula. | C19H23NO2 |
|
Can you give the molecular molecular formula of CC1=CC(C)CC(CO)C1 ? | C9H16O |
|
What is the formula of the molecule CCCC(=O)C(C)CC(=O)OCC ? | C10H18O3 |
|
Can you give the molecular molecular formula of N#CCCN(CCC#N)CC(O)CO ? | C9H15N3O2 |
|
Convert the representation of a molecule COC(C)COC(C)COB(OCC(C)OCC(C)OC)OCC(C)OCC(C)OC into molecular formula. | C21H45BO9 |
|
Considering the code CCCCCCCCCCCC[Si](C)(OCC)OCC, can you determine the corresponding molecular formula? | C17H38O2Si |
|
Can you tell me the molecular formula of COC(CC(C)CCCC(C)C)OC ? | C12H26O2 |
|
Given the representation CC(Br)CCCC(Cl)C(Br)CC(Br)CCl, what would be its molecular formula? | C10H17Br3Cl2 |
|
What is the molecular formula of O=C(Nc1ccc(N=Nc2c(O)ccc3ccccc23)cc1)c1ccc(N=Nc2c(O)ccc3ccccc23)cc1 ? | C33H23N5O3 |
|
What is the formula of the molecule CCCC(=O)OC1=C(C)CCC1=O ? | C10H14O3 |
|
I'd like to know the molecular formula of CCC(=O)OCCN(CCC#N)c1ccccc1 . Can you tell me? | C14H18N2O2 |
|
Please provide the molecular formula for CCC(CO)(CO)COC(=O)CCCCCCCCCCCCCCC(C)C . | C24H48O4 |
|
What is the formula of the molecule NC(CCc1ccccc1)c1ccccc1 ? | C15H17N |
|
Can you give the molecular molecular formula of CC1CCCN(CN2CCCC(C)C2)C1 ? | C13H26N2 |
|
What is the molecular formula for the molecule denoted by COC(=O)CN(C)C=O ? | C5H9NO3 |
|
Please write the molecular formula of the molecule CC(CCNCCC#N)CC(C)(C)CN . | C12H25N3 |
|
Can you give the molecular molecular formula of CCC(=Cc1sc2cc(OC)c(OC)cc2[n+]1CCCS(=O)(=O)O)C=C1Oc2ccc(-c3ccccc3)cc2N1CCC(C)S(=O)(=O)O ? | C34H39N2O9S3+ |
|
Can you tell me the molecular formula of CC(C)(C)c1ccc(SSc2cc(C(C)(C)C)ccc2O)c(O)c1 ? | C20H26O2S2 |
|
Can you tell me the molecular formula of CC1CN(C)C2Cc3c[nH]c4cccc(c34)C2C1O ? | C16H20N2O |
|
What is the molecular formula for the molecule denoted by CCC(=O)N1CC2CCC(C1)N2C(=O)CC ? | C12H20N2O2 |
|
I'd like to know the molecular formula of CN1C(=O)CC2(C1=O)c1ccccc1CCc1ccccc12 . Can you tell me? | C19H17NO2 |
|
Can you give the molecular molecular formula of CCCCC=NCCOC(=O)c1cccc(OC)c1OC ? | C16H23NO4 |
|
The representation Cc1ccc(NN=C(C#N)C#N)c([N+](=O)[O-])c1 represents a specific molecule. Can you reveal its molecular formula? | C10H7N5O2 |
|
What is the molecular formula of CCCCCOc1ccc(C(=O)CC(c2ccc(OCCCCC)cc2)C2CCCCC2=O)cc1 ? | C31H42O4 |
|
CCCC(C)(COC(N)=O)COC(=O)NCC is the representation of a molecule. What is its molecular formula? | C11H22N2O4 |
|
Cc1c2occc2cc2ccc(=O)oc12 is the representation of a molecule. What is its molecular formula? | C12H8O3 |
|
CNC#N is the representation of a molecule. What is its molecular formula? | C2H4N2 |
|
What is the molecular formula for the molecule denoted by CCOP(=O)(OCC)OP(=S)(OC)OC ? | C6H16O6P2S |
|
What is the molecular formula for the molecule denoted by CCCOP(=O)(OCCCl)Oc1ccc([N+](=O)[O-])cc1 ? | C11H15ClNO6P |
|
Given the representation OC1CCC2CN3CCc4c([nH]c5ccccc45)C3CC2C1CCl, what would be its molecular formula? | C20H25ClN2O |
|
What is the molecular formula of Cn1ncc(N2CCOCC2)c(Cl)c1=O ? | C9H12ClN3O2 |
|
What is the molecular formula for the molecule denoted by Cc1ncc(CSS(=O)(=O)O)c(CO)c1O ? | C8H11NO5S2 |
|
Can you give the molecular molecular formula of COc1nc(C)nc(OC)c1[N+](=O)[O-] ? | C7H9N3O4 |
|
Can you tell me the molecular formula of CC(NC(=O)C(Cc1ccccc1)NC(=O)CN)C(=O)NC(CC(=O)O)C(=O)O ? | C18H24N4O7 |
|
Can you tell me the molecular formula of CC(CCC(=O)NCCC[N+](C)(C)CC(O)CS(=O)(=O)[O-])C1CCC2C3C(O)CC4CC(O)CCC4(C)C3CC(O)C12C ? | C32H58N2O8S |
|
Can you give the molecular molecular formula of CC(=O)C(N=Nc1ccc(Cl)cc1[N+](=O)[O-])C(=O)Nc1ccc(Cl)cc1C ? | C17H14Cl2N4O4 |
|
What is the formula of the molecule Cc1cc(C)c(SCC[n+]2noc([O-])c2C)c(C)c1 ? | C14H18N2O2S |
|
Can you give the molecular molecular formula of O=C(NCCCl)Oc1ccc([N+](=O)[O-])cc1 ? | C9H9ClN2O4 |
|
The representation CCC(C)C(NC(=O)C(N)C(C)C)C(=O)NC(CCCCN)C(=O)Nc1ccc([N+](=O)[O-])cc1 represents a specific molecule. Can you reveal its molecular formula? | C23H38N6O5 |
|
The representation CCC(C)C(NC(=O)C1CCC(=O)N1)C(=O)NC(C(=O)NC(Cc1ccccc1)C(=O)NC(C(=O)N1CCCC1C(=O)NC(CC(N)=O)C(=O)NC(Cc1c[nH]c2ccccc12)C(N)=O)C(C)O)C(C)O represents a specific molecule. Can you reveal its molecular formula? | C48H65N11O12 |
|
NCC1CC(c2ccc(Cl)cc2)OC1=O is the representation of a molecule. What is its molecular formula? | C11H12ClNO2 |
|
The representation Oc1cccc2c1CCC1NCCCC21 represents a specific molecule. Can you reveal its molecular formula? | C13H17NO |
|
The representation CNC(C)Cc1cc2c(cc1O)OCO2 represents a specific molecule. Can you reveal its molecular formula? | C11H15NO3 |
|
Considering the code CN(C)C(=O)NN(CCCN)C(=O)Oc1ccc([N+](=O)[O-])cc1, can you determine the corresponding molecular formula? | C13H19N5O5 |
|
Convert the representation of a molecule COC1CCC(OC2CC(C3OC(C)(O)C(C)CC3C)OC2C2(C)CCC(C3(C)CCC4(CC(O)C(C)C(C(C)C5OC(O)(CC(=O)O)C(C)C(OC6CCC(OC)C(C)O6)C5OC)O4)O3)O2)OC1C into molecular formula. | C52H88O18 |
|
What is the formula of the molecule CCn1c(N=NN(C)C)nc2c1c(=O)n(C)c(=O)n2C ? | C11H17N7O2 |
|
CCCC[Sn](CCCC)(CCCC)c1c(OC)ccc(C(=O)ON2C(=O)CCC2=O)c1OC is the representation of a molecule. What is its molecular formula? | C25H39NO6Sn |
|
Considering the code CC(C)C(C)CCC(C)C1CC(O)C2C3CCC4CC(O)CCC4(C)C3CCC12C, can you determine the corresponding molecular formula? | C28H50O2 |
|
What is the molecular formula of CCCOc1ccc2[nH]cc(C3=CCNCC3)c2c1 ? | C16H20N2O |
|
Please provide the molecular formula for Cc1cc2c(N)c(=O)occ2c2nc(N)n(C)c12 . | C12H12N4O2 |
|
Please write the molecular formula of the molecule CN1CCC2(C)c3cc(OC(=O)N4CCc5ccccc5C4)ccc3N(C)C12 . | C23H27N3O2 |
|
What is the molecular formula of CC(C)c1nc(-c2ccc(F)cc2)c(-c2ccc(F)cc2)n1C=CC(O)CC(O)CC(=O)O ? | C25H26F2N2O4 |
|
Please write the molecular formula of the molecule Nc1ncnc2c1ncn2C1C=CC(C(O)CO)C1 . | C12H15N5O2 |
|
Given the representation Cc1ccc(O)cc1CCC1C(=O)CC(O)C2(C)C(=O)CCC12, what would be its molecular formula? | C19H24O4 |
|
Please write the molecular formula of the molecule CCCCCCCCC(O)CCCCCCC=CC(=O)O . | C18H34O3 |
|
What is the molecular formula of [N-]=[N+]=Nc1cccc2c(N=C=S)cccc12 ? | C11H6N4S |
|
What is the molecular formula for the molecule denoted by NC(=O)NNCCc1ccccc1 ? | C9H13N3O |
|
Given the representation NC(CCC(=O)NC(CSSCC(NC(=O)CCC(N)C(=O)O)C(=O)N(CC(=O)O)c1c([N+](=O)[O-])cc([N+](=O)[O-])cc1[N+](=O)[O-])C(=O)NCC(=O)O)C(=O)O, what would be its molecular formula? | C26H33N9O18S2 |
|
Please write the molecular formula of the molecule CC1OC(OP(=O)(O)O)C(O)C1O . | C5H11O7P |
|
Considering the code c1cnc2nccnc2n1, can you determine the corresponding molecular formula? | C6H4N4 |
|
The representation Fc1cccs1 represents a specific molecule. Can you reveal its molecular formula? | C4H3FS |
|
I'd like to know the molecular formula of C[Si](C)(C)O[Si](C)(O[Si](C)(C)C)c1ccccc1 . Can you tell me? | C13H26O2Si3 |
|
The representation CC(C)(C)c1cc(C(C)(C)C)c(C(C)(C)C)cc1C(C)(C)C represents a specific molecule. Can you reveal its molecular formula? | C22H38 |
|
What is the molecular formula for the molecule denoted by O=C1CC=CC=CC1 ? | C7H8O |
|
What is the formula of the molecule CCC=COCC ? | C6H12O |
|
Please provide the molecular formula for CCCCCOC(C)C . | C8H18O |
|
Can you tell me the molecular formula of CC(C)(C)c1ccco1 ? | C8H12O |
|
Considering the code C#CSC, can you determine the corresponding molecular formula? | C3H4S |
|
What is the molecular formula for the molecule denoted by Clc1ccc2c(c1)Sc1ccccc1O2 ? | C12H7ClOS |
|
What is the molecular formula of CCCC(C)C(C)CCC ? | C10H22 |
|
What is the molecular formula for the molecule denoted by Cc1cccc(N=Nc2cc(C)ccc2O)c1 ? | C14H14N2O |
|
I'd like to know the molecular formula of COC(=O)CC(C)(C)CC(=O)OC . Can you tell me? | C9H16O4 |
|
Please provide the molecular formula for CCCCc1ccc(F)cc1 . | C10H13F |
|
Convert the representation of a molecule C=CC(C=C)(C=C)C=C into molecular formula. | C9H12 |
|
Considering the code CC([N+](=O)[O-])([N+](=O)[O-])C(C)([N+](=O)[O-])[N+](=O)[O-], can you determine the corresponding molecular formula? | C4H6N4O8 |
|
Can you tell me the molecular formula of COC(=O)CCCc1ccc(Oc2ccccc2)cc1 ? | C17H18O3 |
|
What is the formula of the molecule Oc1cccc(N2CCOCC2)c1 ? | C10H13NO2 |
Subsets and Splits
No saved queries yet
Save your SQL queries to embed, download, and access them later. Queries will appear here once saved.