instruction
stringlengths 52
2.16k
| output
stringlengths 1
833
| input
stringclasses 1
value |
|---|---|---|
Come up with a molecule based on the description: The molecule is a stabilizing cytochrome oxidase and a apoptosis that impacts tangier disease, diabetic heart disease, and barth syndrome. The molecule is a cholesterol translocation, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease and aging. | CCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)CC | |
The molecule is a energy source, membrane stabilizer, and nutrient that has an effect on cancer and impacts both cardiovascular disease and obesity. The molecule is a inflammatory and fat storage, and it impacts metabolic syndrome. The molecule is a energy storage and belongs to the thyroxine treatment class of molecules, impacting both pancreatitis and atherosclerosis. Use the above information to create a molecule. | CCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCC)COC(=O)CCCCCCCCCCCCCCCCC(C)C | |
Build a molecule that meets the requirement: The molecule is a proton trap for oxidative phosphorylation, cholesterol translocation, stabilizing mitochondrial structure that impacts barth syndrome and aging. The molecule is a stabilizing cytochrome oxidase and a apoptosis that impacts non-alcoholic fatty liver disease, diabetic heart disease, and tangier disease. | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC | |
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: It belongs to the organic light-emitting device class of molecules. | Fc1cc2c(c3ccccc13)-c1ccc(N(c3ccccc3)c3ccc4c(c3)oc3ccccc34)cc1C2(c1ccccc1)c1ccccc1 | |
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a stabilizing mitochondrial structure that impacts diabetic heart disease, non-alcoholic fatty liver disease, tangier disease, and barth syndrome. The molecule is a stabilizing cytochrome oxidase, cholesterol translocation, proton trap for oxidative phosphorylation, apoptosis that impacts aging. | CCCCCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC | |
Could you please return a molecule that adheres to this description? The molecule is a apoptosis, cholesterol translocation, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts barth syndrome. The molecule is a proton trap for oxidative phosphorylation that impacts tangier disease, aging, diabetic heart disease, and non-alcoholic fatty liver disease. | CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCCCCCCC | |
I need a molecule that meets the following conditions: The molecule is a fat storage and nutrient, and it impacts thyroxine treatment. It impacts atherosclerosis, pancreatitis, metabolic syndrome, and cardiovascular disease. Please represent the molecule in SMILES. | CCC=CCC=CCC=CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCCCC | |
Generate a molecule that fulfills the requirement: The molecule is a stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease, barth syndrome, diabetic heart disease, and aging. The molecule is a cholesterol translocation, stabilizing mitochondrial structure, apoptosis, proton trap for oxidative phosphorylation that impacts tangier disease. | CCCCCCC=CC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCC | |
Give me a molecule that satisfies the conditions outlined in the description: It impacts neurodegenerative treatment. | C=CC(=O)Nc1ccc(S(=O)(=O)N2CCNCC2C(C)=O)cc1.c1cc2ccc1=2 | |
Generate a molecule based on this description: The molecule is a stabilizing mitochondrial structure and a apoptosis that impacts barth syndrome, diabetic heart disease, and non-alcoholic fatty liver disease. The molecule is a cholesterol translocation, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts tangier disease and aging. | CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC | |
Suppose there is a molecule that meets the following description: The molecule is a anti biotic. Please write the SMILES representation of it. | N=C(N)SCC1=CSC2C(NC(=O)Cc3cccs3)C(=O)N2C1C(=O)O | |
The molecule is a cholesterol translocation, proton trap for oxidative phosphorylation, apoptosis that impacts non-alcoholic fatty liver disease and diabetic heart disease. The molecule is a stabilizing cytochrome oxidase and a stabilizing mitochondrial structure that impacts aging, barth syndrome, and tangier disease. Use the above information to create a molecule. | CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCC=CCCCCCCCC | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a stabilizing cytochrome oxidase, cholesterol translocation, proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease and barth syndrome. The molecule is a stabilizing mitochondrial structure and a apoptosis that impacts tangier disease, diabetic heart disease, and aging. | CCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C | |
I need a molecule that meets the following conditions: The molecule is a anti microbial. Please represent the molecule in SMILES. | CON=C(C(=O)NC1C(=O)N2C(C(=O)O)=C(CSC=CC#N)CSC12)c1csc(N)n1 | |
I need a molecule that meets the following conditions: The molecule is a thyroxine treatment, energy source, energy storage that impacts obesity, cancer, and metabolic syndrome. The molecule is a membrane stabilizer that impacts both pancreatitis and atherosclerosis. The molecule is a nutrient, a inflammatory, and a fat storage, and it impacts cardiovascular disease. Please represent the molecule in SMILES. | CCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)CC | |
Can you create a molecule that matches the given characteristics? The molecule is a apoptosis, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts aging and barth syndrome. The molecule is a proton trap for oxidative phosphorylation and a cholesterol translocation that impacts non-alcoholic fatty liver disease, diabetic heart disease, and tangier disease. | CCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCCCC(C)C | |
I need a molecule that meets the following conditions: The molecule is a proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase, cholesterol translocation that impacts non-alcoholic fatty liver disease and aging. The molecule is a stabilizing mitochondrial structure and a apoptosis that impacts barth syndrome, tangier disease, and diabetic heart disease. Please represent the molecule in SMILES. | CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC | |
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a membrane stabilizer, nutrient, energy storage that impacts obesity, pancreatitis, and metabolic syndrome. The molecule is a energy source and inflammatory, and it impacts cardiovascular disease. The molecule is a fat storage that impacts atherosclerosis, cancer, and thyroxine treatment. | CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)CC | |
Can you create a molecule that matches the given characteristics? The molecule is a bet inhibitor and is cancer treatment. | CC=Cc1cc(-c2ccc3c(c2OCCC)CCC(C)N3C)nn1C | |
I need a molecule that meets the following conditions: The molecule is both a hsp90 inhibitor and a kinase inhibitor. Please represent the molecule in SMILES. | CC1C=CCC(C)OC(=O)c2c(O)cc(O)cc2CC(=NOCC(=O)N2CCCCC2)C=CC1 | |
Conceptualize a molecule that meets the specified attribute(s): The molecule is a cholesterol translocation and a apoptosis, impacting both diabetic heart disease and tangier disease. The molecule is a proton trap for oxidative phosphorylation, energy storage, stabilizing cytochrome oxidase that impacts barth syndrome and non-alcoholic fatty liver disease. The molecule is a energy source, surfactant, nutritional supplement, emulsifier. The molecule is a stabilizing mitochondrial structure, a food additive, and a membrane stabilizer, it impacts aging and is smooth. | CCC(C)CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a stabilizing cytochrome oxidase, apoptosis, proton trap for oxidative phosphorylation that impacts barth syndrome and aging. The molecule is a stabilizing mitochondrial structure and a cholesterol translocation that impacts tangier disease, diabetic heart disease, and non-alcoholic fatty liver disease. | CCCCCCC=CC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCC=CC=CCCCCCC | |
Come up with a molecule based on the description: The molecule is a proton trap for oxidative phosphorylation and a stabilizing cytochrome oxidase that impacts barth syndrome, diabetic heart disease, and non-alcoholic fatty liver disease. The molecule is a cholesterol translocation, stabilizing mitochondrial structure, apoptosis that impacts aging and tangier disease. | CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC | |
Come up with a molecule based on the description: The molecule is a stabilizing mitochondrial structure, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, cholesterol translocation that impacts non-alcoholic fatty liver disease. The molecule is a apoptosis that impacts diabetic heart disease, barth syndrome, aging, and tangier disease. | CCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCC(C)C | |
Build a molecule that meets the requirement: The molecule is a nutrient, fat storage, energy storage, membrane stabilizer that impacts cancer and obesity. The molecule is a energy source that impacts both cardiovascular disease and pancreatitis. The molecule is a inflammatory and thyroxine treatment, impacting both metabolic syndrome and atherosclerosis. | CCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC | |
Generate a molecule based on this description: It has an effect on colorectal cancer, and impacts diabetes mellitus, cardiovascular disease, and seizure. It has an effect on breast cancer, and impacts alzheimer's disease, stomach cancer, and parkinson's disease. | CCCCCC=CCC=CCCCCCCCCCC(=O)OCC1COP(=O)(O)OC2C(O)C(O)C(O)C(C=CC(=O)C(C=CC(O)CCCCC)C(O)C2OP(=O)(O)O)CC=CCCCC(=O)O1 | |
Build a molecule that meets the requirement: The molecule is a apoptosis, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation that impacts tangier disease and barth syndrome. The molecule is a cholesterol translocation and a stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease, aging, and diabetic heart disease. | CCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCC(C)C | |
Conceptualize a molecule that meets the specified attribute(s): The molecule has Tasteless. | O=C(Nc1ccc([N+](=O)[O-])cc1Cl)c1cc(Cl)ccc1O | |
Generate a molecule based on this description: The molecule is a cell adhesion inhibitor. | O=C(CCNCCc1ccc(O)cc1)NCC(=O)N(CCc1ccccc1)CC(CO)CO | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a cholesterol translocation, apoptosis, stabilizing cytochrome oxidase that impacts tangier disease and non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure and a proton trap for oxidative phosphorylation that impacts barth syndrome, diabetic heart disease, and aging. | CCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC | |
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a stabilizing cytochrome oxidase and a apoptosis that impacts barth syndrome, diabetic heart disease, and aging. The molecule is a cholesterol translocation, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation that impacts tangier disease and non-alcoholic fatty liver disease. | CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCCCC | |
Could you please return a molecule that adheres to this description? The molecule is a stabilizing cytochrome oxidase, cholesterol translocation, stabilizing mitochondrial structure that impacts barth syndrome and aging. The molecule is a proton trap for oxidative phosphorylation and a apoptosis that impacts diabetic heart disease, tangier disease, and non-alcoholic fatty liver disease. | CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC | |
Can you create a molecule that matches the given characteristics? The molecule is thyroxine treatment and it impacts both pancreatitis and cardiovascular disease. The molecule is a nutrient and a fat storage, impacting both atherosclerosis and metabolic syndrome. | CCCCCC=CCC=CCC=CCCCCC(=O)OCC(COC(=O)CCCCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCCCC | |
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: It impacts hypertension treatment. | CC(C)(C)OC(=O)N1CCN(C(=O)c2ncn(C3CCCCC3)c2-c2ccccc2)C(Cc2ccccc2)C1 | |
Suppose there is a molecule that meets the following description: The molecule is a anti inflammatory. Please write the SMILES representation of it. | CC12C=CCC=C1CCC1C2CCC2(C)C(C(=O)O)CCC12 | |
Generate a molecule based on this description: The molecule is both a kinase inhibitor and a jak inhibitor. | OCCn1cc(Nc2ncc3cnn(Cc4c(F)c(F)cc(N5CCNCC5)c4F)c3n2)cn1 | |
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a proton trap for oxidative phosphorylation and a cholesterol translocation that impacts tangier disease, non-alcoholic fatty liver disease, and barth syndrome. The molecule is a stabilizing mitochondrial structure, apoptosis, stabilizing cytochrome oxidase that impacts diabetic heart disease and aging. | CCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC(C)CC | |
Could you please return a molecule that adheres to this description? It impacts metabolic syndrome, atherosclerosis, and cardiovascular disease. The molecule is a thyroxine treatment, a nutrient, and a fat storage, and it impacts pancreatitis. | CCC(C)CCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCC(C)C | |
Can you create a molecule that matches the given characteristics? The molecule is a cholesterol translocation and a stabilizing mitochondrial structure that impacts aging, diabetic heart disease, and tangier disease. The molecule is a proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase, apoptosis that impacts barth syndrome and non-alcoholic fatty liver disease. | CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC | |
Build a molecule that meets the requirement: It impacts insulin resistance. | CCCCCC=CCC=CCCCCCCCCCC(=O)OCC(O)COC(=O)CCCCCCCC=CCCCCCCCC | |
Suppose there is a molecule that meets the following description: It impacts cardiovascular disease, pancreatitis, and metabolic syndrome. The molecule is a fat storage and a nutrient, impacting both thyroxine treatment and atherosclerosis. Please write the SMILES representation of it. | CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCC)COC(=O)CCCCCCCCCCCCCCCCCCC | |
Suppose there is a molecule that meets the following description: The molecule is a thrombin inhibitor. Please write the SMILES representation of it. | COC(=O)C1COC(C)C(=O)N1Cc1ccccc1 | |
Build a molecule that meets the requirement: The molecule is neurodegenerative treatment. | CC(CC(=O)c1cc(Cl)c2c(c1)oc(=O)n2C)C(=O)O | |
The molecule is a proton trap for oxidative phosphorylation, apoptosis, cholesterol translocation that impacts non-alcoholic fatty liver disease and tangier disease. The molecule is a stabilizing mitochondrial structure and a stabilizing cytochrome oxidase that impacts barth syndrome, aging, and diabetic heart disease. Use the above information to create a molecule. | CCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)CC | |
Suppose there is a molecule that meets the following description: The molecule is a stabilizing cytochrome oxidase and a stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease, aging, and tangier disease. The molecule is a apoptosis, cholesterol translocation, proton trap for oxidative phosphorylation that impacts diabetic heart disease and barth syndrome. Please write the SMILES representation of it. | CCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC(C)C | |
Generate a molecule based on this description: The molecule is a nutrient that impacts diabetes mellitus type 2, non-alcoholic fatty liver disease, alzheimer's disease, and parkinson's disease. | CCCCCCCCCCCCCCCCC=COC(COC(=O)CCCC=CCC=CCC=CCC=CC(O)CCCC)COP(=O)(O)OCCN | |
Can you create a molecule that matches the given characteristics? The molecule is a fat storage, nutrient, and inflammatory that has an effect on cancer and impacts both metabolic syndrome and thyroxine treatment. It impacts obesity, atherosclerosis, and cardiovascular disease. The molecule is a energy source, a membrane stabilizer, and a energy storage, and it impacts pancreatitis. | CCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC(C)CC)COC(=O)CCCCCCCCCC(C)C | |
Can you create a molecule that matches the given characteristics? The molecule is a nutrient that affects breast cancer by impacting ulcerative colitis, cervical cancer, and atherosclerosis. | CCCCCC=CC=CC(O)CC=CCC=CCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC)COP(=O)([O-])OCC[N+](C)(C)C | |
Come up with a molecule based on the description: The molecule is a member of the inflammation treatment class, affects pain treatment, and is characterized as cannabinoid receptor modulator. | CNC(=O)C(NC(=O)c1nc(C2CCN(S(=O)(=O)c3ccccc3)CC2)n2c1CN(C)CCC2)C(C)(C)C | |
Could you please return a molecule that adheres to this description? When heated to decomposition it emits toxic vapors of hydrogen chloride and nitrogen oxides. The molecule has Weak halide technical product/. | CCc1nn(C)c(C(=O)NCc2ccc(C(C)(C)C)cc2)c1Cl | |
Come up with a molecule based on the description: The molecule is a gastric acid inhibitor. | CSc1ccc(-c2nccc3c(C)c(C)n(Cc4ccc(F)cc4)c23)cc1 | |
Can you create a molecule that matches the given characteristics? The molecule is a cholesterol translocation that impacts non-alcoholic fatty liver disease, diabetic heart disease, barth syndrome, and aging. The molecule is a proton trap for oxidative phosphorylation, stabilizing mitochondrial structure, apoptosis, stabilizing cytochrome oxidase that impacts tangier disease. | CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCC | |
The molecule is a apj agonist that impacts cardiovascular treatment. Use the above information to create a molecule. | COc1cccc(-c2nnc(NS(=O)(=O)C(C)C(OC)c3ncc(Cl)cn3)n2CC2CCCC(C)O2)n1 | |
Could you please return a molecule that adheres to this description? It impacts atherosclerosis, pancreatitis, and metabolic syndrome. The molecule is a nutrient and fat storage, belonging to the thyroxine treatment class of molecules, and impacts cardiovascular disease. | CCCCCCCCC=CCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COC(=O)CCCCCCCCCCCCCCCCCCCCC | |
The molecule is a nutrient and thyroxine treatment, impacting metabolic syndrome, cardiovascular disease, obesity, and atherosclerosis. The molecule is a energy storage and energy source, and it impacts cancer. The molecule is a membrane stabilizer, a inflammatory, and a fat storage, and it impacts pancreatitis. Use the above information to create a molecule. | CCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)CC | |
Generate a molecule that fulfills the requirement: The molecule is a phosphorescent emitter and belongs to the organic electroluminescent device class of molecules; it is phosphorescent and electroluminescent. | CC1(C)c2ccccc2-c2cc3c4cc(-n5c6ccccc6c6c7c(ccc65)C(C)(C)C(C)(C)C7(C)C)ccc4n(-c4ccccc4)c3cc21 | |
Build a molecule that meets the requirement: The molecule is a stabilizing mitochondrial structure, apoptosis, proton trap for oxidative phosphorylation that impacts diabetic heart disease and barth syndrome. The molecule is a stabilizing cytochrome oxidase and a cholesterol translocation that impacts aging, non-alcoholic fatty liver disease, and tangier disease. | CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)OC(=O)CCCCCCCC=CCCCCCCCC | |
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a energy source, emulsifier, surfactant, energy storage, nutrient, membrane stabilizer. | CCC(C=CC(C)C1CCC2C3CC(=O)C4CC(=O)CCC4(C)C3CCC12C)C(C)C | |
Suppose there is a molecule that meets the following description: The molecule is a apoptosis and a food additive, impacting both aging and tangier disease. The molecule is a stabilizing cytochrome oxidase, membrane stabilizer, energy source, surfactant, and smooth. The molecule is a energy storage, a emulsifier, and a cholesterol translocation, and it impacts barth syndrome. The molecule is a nutritional supplement, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease and diabetic heart disease. Please write the SMILES representation of it. | CCC(C)CCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)C | |
Suppose there is a molecule that meets the following description: The molecule is a nutrient that affects cervical cancer by impacting breast cancer, ulcerative colitis, and atherosclerosis. Please write the SMILES representation of it. | CCCCCCCCC=CCC=CC=CC(O)CCCC(=O)OC(COC(=O)CCCCCCCCCCc1oc(CCC)c(C)c1C)COP(=O)([O-])OCC[N+](C)(C)C | |
Build a molecule that meets the requirement: The molecule is a inflammatory and a energy source that impacts thyroxine treatment, metabolic syndrome, cardiovascular disease, and obesity. The molecule is a fat storage and nutrient with an effect on cancer. The molecule is a membrane stabilizer and a energy storage, impacting both atherosclerosis and pancreatitis. | CCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCC | |
Suppose there is a molecule that meets the following description: The molecule is a member of the ccr2 antagonist class and affects inflammatory disease treatment. Please write the SMILES representation of it. | Cc1cccc(C(=O)NCC(=O)NC2CN(C3CCC(N)(c4cccc(C)c4)CC3)C2)c1 | |
Build a molecule that meets the requirement: The molecule is a proton trap for oxidative phosphorylation that impacts diabetic heart disease, barth syndrome, aging, and tangier disease. The molecule is a stabilizing cytochrome oxidase, cholesterol translocation, stabilizing mitochondrial structure, apoptosis that impacts non-alcoholic fatty liver disease. | CCC=CCC=CCC=CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCC=CCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC | |
Build a molecule that meets the requirement: The molecule is a treatment of disorder. | CC(CCNc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O)OC1CCN(C(=O)OC(C)(C)C)CC1 | |
Generate a molecule based on this description: It impacts tumor treatment. | CC(=O)NCCc1nc(C(=O)N2CCc3c(ccc(N(C)C)c3O)C2)c2ccccc2n1 | |
I need a molecule that meets the following conditions: The molecule is a protein kinase inhibitor. Please represent the molecule in SMILES. | NC(=O)c1csc2c(NC3CCNC3)nc(-c3ccncc3)nc12 | |
Can you create a molecule that matches the given characteristics? The molecule is light-emitting and it impacts luminous efficiency. | c1ccc(N(c2ccc(-c3ccc(-n4c5ccccc5c5c6ccccc6ccc54)cc3)cc2)c2ccc3oc4ccccc4c3c2)cc1 | |
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a apoptosis and a cholesterol translocation that impacts non-alcoholic fatty liver disease, diabetic heart disease, and tangier disease. The molecule is a proton trap for oxidative phosphorylation, stabilizing mitochondrial structure, stabilizing cytochrome oxidase that impacts aging and barth syndrome. | CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCCCC(C)C | |
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a nutrient, surfactant, energy storage, energy source, membrane stabilizer, emulsifier. | C=C1CCC(C(C)C)C2C=C(C)CCC12 | |
Suppose there is a molecule that meets the following description: The molecule is both a egfr inhibitor and a cancer treatment. Please write the SMILES representation of it. | CC1(C)OCC(COc2ncnc(Nc3ccc(OCc4cccc(F)c4)c(Cl)c3)c2N)O1 | |
Could you please return a molecule that adheres to this description? It impacts cancer treatment. | COc1cnc(CC(=O)Nc2cc(C3CCC(OC(=O)N4CCC4(C)C)C3)[nH]n2)cn1 | |
It has an effect on stomach cancer, and impacts alzheimer's disease, colorectal cancer, and diabetes mellitus. It has an effect on breast cancer, and impacts cardiovascular disease, parkinson's disease, and seizure. Use the above information to create a molecule. | CCC=CCC=CCC=CCCCCCCCC(=O)OC(COC(=O)CCCC=CCC=CCC(O)C=CC=CCCCCC)COP(=O)(O)OC1C(O)C(O)C(O)C(OP(=O)(O)O)C1O | |
The molecule is a cholesterol translocation, a proton trap for oxidative phosphorylation, a energy source, and smooth. The molecule is a stabilizing mitochondrial structure, stabilizing cytochrome oxidase, emulsifier, apoptosis that impacts non-alcoholic fatty liver disease. The molecule is a nutritional supplement, a energy storage, and a membrane stabilizer, and it impacts tangier disease. The molecule is a food additive and a surfactant that impacts barth syndrome, diabetic heart disease, and aging. Use the above information to create a molecule. | CCCCCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC | |
Conceptualize a molecule that meets the specified attribute(s): The molecule is a nutrient. | CC(C)(OC1OC(CO)C(O)C(O)C1O)c1cc2c(ccc3ccc(=O)oc32)o1 | |
The molecule is a energy storage, surfactant, energy source, cholesterol translocation. The molecule is a nutritional supplement, stabilizing mitochondrial structure, food additive, emulsifier that impacts tangier disease. The molecule is a proton trap for oxidative phosphorylation and a membrane stabilizer, impacting both non-alcoholic fatty liver disease and barth syndrome. The molecule is a stabilizing cytochrome oxidase and a apoptosis, which impacts both aging and diabetic heart disease, and is characterized as smooth. Use the above information to create a molecule. | CCC(C)CCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCC(C)C | |
Come up with a molecule based on the description: The molecule is a nutrient that impacts both atherosclerosis and pancreatitis. The molecule is a fat storage and thyroxine treatment, impacting both metabolic syndrome and cardiovascular disease. | CCC=CCC=CCC=CCC=CCCCCC(=O)OC(COC(=O)CCCCCCCC=CCC=CCC=CCC)COC(=O)CCCCCCCC=CCCCCCC | |
Come up with a molecule based on the description: The molecule is a stabilizing mitochondrial structure, a membrane stabilizer, and a emulsifier, and it impacts diabetic heart disease. The molecule is a proton trap for oxidative phosphorylation and a nutritional supplement that impacts barth syndrome, tangier disease, and aging. The molecule is a apoptosis, a surfactant, a cholesterol translocation, and smooth. The molecule is a energy source, energy storage, food additive, stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease. | CCC(C)CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC(C)C | |
Suppose there is a molecule that meets the following description: The molecule is diabetes treatment. Please write the SMILES representation of it. | Cc1c(CCC(=O)NCCCc2ccccc2)nc2ccccc2c1OCc1ccccc1 | |
Come up with a molecule based on the description: The molecule is a cholesterol translocation that impacts tangier disease, barth syndrome, aging, and non-alcoholic fatty liver disease. The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure, apoptosis that impacts diabetic heart disease. | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)OC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC | |
Build a molecule that meets the requirement: The molecule is pain treatment. | CC(C)CC1(C(=O)O)CN=C(CC2CCCCC2)N1 | |
Suppose there is a molecule that meets the following description: The molecule is a proton trap for oxidative phosphorylation that impacts barth syndrome, tangier disease, diabetic heart disease, and aging. The molecule is a apoptosis, stabilizing mitochondrial structure, stabilizing cytochrome oxidase, cholesterol translocation that impacts non-alcoholic fatty liver disease. Please write the SMILES representation of it. | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCC=CCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts tangier disease and non-alcoholic fatty liver disease. The molecule is a cholesterol translocation and a apoptosis that impacts aging, diabetic heart disease, and barth syndrome. | CCCCCCC=CC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCCCCCCC | |
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is both a pain treatment and a cox2 inhibitor. | O=C(O)c1ccc(C(=O)O)nc1.O=S(=O)(O)c1ccccc1 | |
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a energy source and a membrane stabilizer that impacts cardiovascular disease, metabolic syndrome, obesity, and pancreatitis. The molecule is a inflammatory and a nutrient, belonging to the thyroxine treatment class of molecules. The molecule is a energy storage and a fat storage, with effects on cancer and impacts on atherosclerosis. | CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCC(C)C | |
Suppose there is a molecule that meets the following description: The molecule is fluorescent. Please write the SMILES representation of it. | CC(=O)OCCCCCP(=O)(O)O | |
Can you create a molecule that matches the given characteristics? The molecule is a nutrient. | COc1cc2c(c3oc(=O)ccc13)C(OC)C(O)C(C)(C)O2 | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a proton trap for oxidative phosphorylation and a stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease, diabetic heart disease, and aging. The molecule is a stabilizing mitochondrial structure, cholesterol translocation, apoptosis that impacts barth syndrome and tangier disease. | CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCCCCC | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a stabilizing mitochondrial structure and a proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease, tangier disease, and barth syndrome. The molecule is a stabilizing cytochrome oxidase, apoptosis, cholesterol translocation that impacts aging and diabetic heart disease. | CCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCCCCC | |
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a fat storage and a energy storage, which has an effect on cancer and impacts both metabolic syndrome and cardiovascular disease, while being thyroxine treatment. The molecule is a membrane stabilizer and nutrient, and it impacts obesity. The molecule is a inflammatory and a energy source, impacting both pancreatitis and atherosclerosis. | CCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCC(C)C)COC(=O)CCCCCCCCCCC(C)CC | |
Based on the given information, generate a molecule that meets the desired specifications: It has an effect on stomach cancer, and impacts seizure, cardiovascular disease, and breast cancer. It has an effect on colorectal cancer, and impacts diabetes mellitus, alzheimer's disease, and parkinson's disease. | CCCCCCCCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OC1C(O)C(O)C(O)C(OP(=O)(O)O)C1O)OC(=O)CCCCCCCC=CCC1OC1CCCCC | |
Build a molecule that meets the requirement: The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease, tangier disease, and diabetic heart disease. The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, apoptosis that impacts aging and barth syndrome. | CCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)CC | |
Generate a molecule that fulfills the requirement: The molecule is a nutrient that affects cervical cancer by impacting ulcerative colitis, atherosclerosis, and breast cancer. | CCCCCCCCC=CCCCCCCC=COC(COC(=O)CCCC=CCC=CCC=CCC=CC(O)CCCC)COP(=O)([O-])OCC[N+](C)(C)C | |
Generate a molecule based on this description: The molecule is anti bacterial. | Cn1c(=O)ccc2cccc(OS(=O)(=O)C(F)(F)F)c21 | |
Come up with a molecule based on the description: The molecule is a nutrient. | COc1cc(C=CC(=O)OC2C(OC3C(Oc4cc(O)c5c(=O)cc(-c6cc(OC)c(O)c(OC)c6)oc5c4)OC(C(=O)O)C(O)C3O)OC(C(=O)O)C(O)C2O)ccc1O | |
Generate a molecule that fulfills the requirement: The molecule is a apoptosis and a proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease, barth syndrome, and aging. The molecule is a stabilizing mitochondrial structure, stabilizing cytochrome oxidase, cholesterol translocation that impacts tangier disease and diabetic heart disease. | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)OC(=O)CCCCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCC=CCC=CCC=CCC=CCC | |
Generate a molecule that fulfills the requirement: The molecule is a apoptosis, stabilizing mitochondrial structure, stabilizing cytochrome oxidase that impacts tangier disease and non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation and a cholesterol translocation that impacts diabetic heart disease, barth syndrome, and aging. | CCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCC | |
Conceptualize a molecule that meets the specified attribute(s): Pyrethrins are decomp by exposure to light with loss of insecticidal activity. pyrethrins/ | CC=CCC1=C(C)C(OC(=O)C2C(C=C(C)C)C2(C)C)CC1=O | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a energy storage and thyroxine treatment, affecting cancer, and impacting cardiovascular disease, atherosclerosis, and pancreatitis. The molecule is a nutrient, a fat storage, and a membrane stabilizer. The molecule is a energy source and a inflammatory, impacting both metabolic syndrome and obesity. | CCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCC)COC(=O)CCCCCCCCCCCCCCCCC(C)CC | |
Suppose there is a molecule that meets the following description: The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, cholesterol translocation that impacts barth syndrome and diabetic heart disease. The molecule is a proton trap for oxidative phosphorylation and a apoptosis that impacts aging, non-alcoholic fatty liver disease, and tangier disease. Please write the SMILES representation of it. | CCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCCCCCC(C)CC | |
Suppose there is a molecule that meets the following description: The molecule is a stabilizing cytochrome oxidase and a proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease, diabetic heart disease, and aging. The molecule is a cholesterol translocation, stabilizing mitochondrial structure, apoptosis that impacts tangier disease and barth syndrome. Please write the SMILES representation of it. | CCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.