instruction
stringlengths 52
2.16k
| output
stringlengths 1
833
| input
stringclasses 1
value |
|---|---|---|
Come up with a molecule based on the description: The molecule is a cholesterol translocation that impacts diabetic heart disease, non-alcoholic fatty liver disease, barth syndrome, and aging. The molecule is a apoptosis, stabilizing mitochondrial structure, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation that impacts tangier disease. | CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCCCCCCCCCC | |
Suppose there is a molecule that meets the following description: The molecule is a fat storage that impacts thyroxine treatment, obesity, atherosclerosis, pancreatitis, and cardiovascular disease. The molecule is a energy source and nutrient, and it impacts metabolic syndrome. The molecule is a inflammatory, energy storage, membrane stabilizer with an effect on cancer. Please write the SMILES representation of it. | CCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCC(C)C | |
Come up with a molecule based on the description: It impacts diabetic heart disease, non-alcoholic fatty liver disease, tangier disease, aging, and barth syndrome. The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, cholesterol translocation, stabilizing cytochrome oxidase, apoptosis. | CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC)OC(=O)CCCCCCCC=CCC=CCCCCC | |
Generate a molecule that fulfills the requirement: The molecule is a stabilizing mitochondrial structure, apoptosis, cholesterol translocation that impacts barth syndrome and tangier disease. The molecule is a proton trap for oxidative phosphorylation and a stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease, aging, and diabetic heart disease. | CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC | |
Can you create a molecule that matches the given characteristics? The molecule is a stabilizing cytochrome oxidase, cholesterol translocation, stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease and barth syndrome. The molecule is a proton trap for oxidative phosphorylation and a apoptosis that impacts diabetic heart disease, tangier disease, and aging. | CCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)C | |
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a fat storage that impacts both cardiovascular disease and metabolic syndrome. The molecule is a nutrient that impacts thyroxine treatment, pancreatitis, and atherosclerosis. | CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COC(=O)CCCCCCCCCC=CCCCCCC)OC(=O)CCCCCC=CCC=CCC=CCC=CCCCCC | |
Suppose there is a molecule that meets the following description: The molecule is a cholesterol translocation, stabilizing mitochondrial structure, apoptosis that impacts tangier disease and barth syndrome. The molecule is a proton trap for oxidative phosphorylation and a stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease, diabetic heart disease, and aging. Please write the SMILES representation of it. | CCCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCC)OC(=O)CCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)CC | |
Build a molecule that meets the requirement: The molecule is a cholesterol translocation, apoptosis, stabilizing cytochrome oxidase that impacts tangier disease and non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure and a proton trap for oxidative phosphorylation that impacts diabetic heart disease, aging, and barth syndrome. | CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)C | |
Build a molecule that meets the requirement: The molecule is a protein kinase inhibitor, a kinase inhibitor, and a protein tyrosine kinase inhibitor. | CN1CCN(Cc2ccc3c(c2)Cc2c(-c4csc(C#CCOC5CCOCC5)c4)n[nH]c2-3)CC1 | |
I need a molecule that meets the following conditions: It impacts atherosclerosis, pancreatitis, and thyroxine treatment. The molecule is a fat storage and a nutrient, impacting both metabolic syndrome and cardiovascular disease. Please represent the molecule in SMILES. | CCCCCC=CCC=CCC=CCC=CCCCC(=O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCC=CCCCCCC | |
Based on the given information, generate a molecule that meets the desired specifications: When heated to decomp it emits acrid smoke and fumes. | COC(=O)c1cccc(C(=O)OC)c1 | |
Conceptualize a molecule that meets the specified attribute(s): The molecule is a energy storage, surfactant, energy source, membrane stabilizer, nutrient, emulsifier. | CC(C)=C1CCC(C)C2=C(C1)C(C)CC2 | |
Build a molecule that meets the requirement: The molecule is a inflammatory and fat storage, affecting cancer, and impacting pancreatitis, metabolic syndrome, and obesity. The molecule is a nutrient and energy storage, and it impacts cardiovascular disease. The molecule is a membrane stabilizer, a energy source, and a thyroxine treatment, and it impacts atherosclerosis. | CCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)CC | |
I need a molecule that meets the following conditions: The molecule is a pi3k inhibitor and belongs to the cancer treatment class of molecules. Please represent the molecule in SMILES. | C[Si](C)(C)CCOCn1c(N2CCC2)nc2ccccc21 | |
Can you create a molecule that matches the given characteristics? The molecule is a cancer treatment. | CCCOCCNCc1cc(S)ccc1C(=O)OC | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a fat storage and nutrient, and it impacts atherosclerosis. The molecule is a member of the thyroxine treatment class and affects cardiovascular disease, pancreatitis, and metabolic syndrome. | CCCCCCC=CCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC | |
The molecule is a apoptosis, cholesterol translocation, stabilizing cytochrome oxidase that impacts diabetic heart disease and tangier disease. The molecule is a stabilizing mitochondrial structure and a proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease, aging, and barth syndrome. Use the above information to create a molecule. | CCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)CC | |
Could you please return a molecule that adheres to this description? The molecule is a surfactant, nutritional supplement, membrane stabilizer, energy storage. The molecule is a food additive, a stabilizing mitochondrial structure, and a energy source, it impacts barth syndrome and is smooth. The molecule is a apoptosis that impacts diabetic heart disease, tangier disease, and non-alcoholic fatty liver disease. The molecule is a cholesterol translocation, emulsifier, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts aging. | CCCCCCC=CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCCCCCCC | |
Could you please return a molecule that adheres to this description? The molecule is a anti bacterial agent and belongs to the anti bacterial class of molecules. | CC(=O)OCC1=C(C(=O)O)N2C(=O)C(NC(=O)C(OC(C)=O)c3ccccc3)C2SC1 | |
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a organic light-emitting device. | CC(C)(C)C1=CC(C2CC3C(CC4C5=C(CCCC5)C5C=CCC3C54)C3=C2CC2C(C3)C3C=CCC4C(Br)CCC2C34)C(C2=CCC(C(C)(C)C)CC2)CC1 | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a energy source, membrane stabilizer, nutrient, fat storage that impacts atherosclerosis and metabolic syndrome. The molecule is a energy storage that impacts both cardiovascular disease and cancer. The molecule is a inflammatory that impacts obesity, pancreatitis, and thyroxine treatment. | CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C)COC(=O)CCCCCCCCCCCCCCC(C)C | |
Generate a molecule that fulfills the requirement: The molecule is a membrane stabilizer, surfactant, nutrient, energy storage, energy source, emulsifier. | CCCCCCCCCCCC(=O)[O-].CCCCCCCCCCCC(=O)[O-].CCCCCCCCCCCC(=O)[O-].[Al+3] | |
Come up with a molecule based on the description: The molecule is a energy storage, fat storage, nutrient, inflammatory that impacts obesity and cancer. The molecule is a energy source that impacts both pancreatitis and thyroxine treatment. The molecule is a membrane stabilizer that impacts metabolic syndrome, atherosclerosis, and cardiovascular disease. | CCC(C)CCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)CC | |
Conceptualize a molecule that meets the specified attribute(s): The molecule is a cholesterol translocation and a apoptosis that impacts barth syndrome, tangier disease, and aging. The molecule is a proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease and diabetic heart disease. | CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC | |
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a stabilizing mitochondrial structure, apoptosis, cholesterol translocation that impacts diabetic heart disease and non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation and a stabilizing cytochrome oxidase that impacts aging, tangier disease, and barth syndrome. | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCC=CCC=CCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCC | |
Build a molecule that meets the requirement: The molecule is a nutrient, inflammatory, energy storage that impacts pancreatitis, cancer, and atherosclerosis. The molecule is a fat storage and membrane stabilizer, and it impacts metabolic syndrome. The molecule is a energy source that impacts obesity, thyroxine treatment, and cardiovascular disease. | CC(C)CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCC(C)C | |
Conceptualize a molecule that meets the specified attribute(s): The molecule is a proton trap for oxidative phosphorylation and a stabilizing mitochondrial structure, impacting both aging and barth syndrome. The molecule is a emulsifier, a membrane stabilizer, and a apoptosis, it impacts diabetic heart disease and is smooth. The molecule is a surfactant, a stabilizing cytochrome oxidase, and a food additive, and it impacts non-alcoholic fatty liver disease. The molecule is a nutritional supplement, energy storage, cholesterol translocation, energy source that impacts tangier disease. | CC(C)CCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC(C)C | |
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a nutrient that impacts both metabolic syndrome and thyroxine treatment. The molecule is a fat storage that impacts pancreatitis, atherosclerosis, and cardiovascular disease. | CCCCCC=CCC=CCC=CCCCCC(=O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OCCCCCCCCCCCCCCCCCC | |
Generate a molecule based on this description: The molecule is a stabilizing mitochondrial structure, stabilizing cytochrome oxidase, cholesterol translocation that impacts aging and diabetic heart disease. The molecule is a apoptosis and a proton trap for oxidative phosphorylation that impacts tangier disease, barth syndrome, and non-alcoholic fatty liver disease. | CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC | |
Can you create a molecule that matches the given characteristics? The molecule is a stabilizing mitochondrial structure, stabilizing cytochrome oxidase, apoptosis that impacts non-alcoholic fatty liver disease and barth syndrome. The molecule is a proton trap for oxidative phosphorylation and a cholesterol translocation that impacts diabetic heart disease, aging, and tangier disease. | CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCC)OC(=O)CCCCC=CCC=CCC=CCC=CCC | |
I need a molecule that meets the following conditions: The molecule is a stabilizing cytochrome oxidase and a proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease, diabetic heart disease, and barth syndrome. The molecule is a cholesterol translocation, stabilizing mitochondrial structure, apoptosis that impacts tangier disease and aging. Please represent the molecule in SMILES. | CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCCCC | |
Come up with a molecule based on the description: The molecule has Odorless. Hazardous decomposition products formed under fire conditions. - carbon oxides | O=C(O)CO | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a proton trap for oxidative phosphorylation and a apoptosis that impacts aging, tangier disease, and barth syndrome. The molecule is a cholesterol translocation, stabilizing mitochondrial structure, stabilizing cytochrome oxidase that impacts diabetic heart disease and non-alcoholic fatty liver disease. | CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC | |
Could you please return a molecule that adheres to this description? The molecule is a parkinson's treatment and belongs to the alzheimer's treatment class of molecules. | COc1cc(OC)c(CN(C=O)CCc2ccc(O)cc2)cc1O | |
Build a molecule that meets the requirement: It has an effect on breast cancer, and impacts cardiovascular disease, colorectal cancer, and seizure. It has an effect on stomach cancer, and impacts alzheimer's disease, diabetes mellitus, and parkinson's disease. | CCCCCC=CCC=CC=CC=CC(SCC(N)C(=O)OCC(COP(=O)(O)OC1C(O)C(O)C(O)C(O)C1O)OC(=O)CCCCCCCC=CCC=CCCCCC)C(O)CCCC(=O)O | |
I need a molecule that meets the following conditions: The molecule is a proton trap for oxidative phosphorylation, apoptosis, stabilizing mitochondrial structure that impacts aging and diabetic heart disease. The molecule is a stabilizing cytochrome oxidase and a cholesterol translocation that impacts barth syndrome, tangier disease, and non-alcoholic fatty liver disease. Please represent the molecule in SMILES. | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC | |
Come up with a molecule based on the description: The molecule is a stabilizing cytochrome oxidase, cholesterol translocation, stabilizing mitochondrial structure that impacts diabetic heart disease and tangier disease. The molecule is a proton trap for oxidative phosphorylation and a apoptosis that impacts aging, barth syndrome, and non-alcoholic fatty liver disease. | CCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCC | |
Suppose there is a molecule that meets the following description: The molecule is a inflammatory disease treatment. Please write the SMILES representation of it. | CCC1CN(c2ncc(Nc3c(NC4CC4)c(=O)c3=O)cc2Cl)CCN1C1CCN(Cc2ccc(Cl)cc2F)CC1 | |
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a proton trap for oxidative phosphorylation and a stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease, diabetic heart disease, and aging. The molecule is a stabilizing mitochondrial structure, cholesterol translocation, apoptosis that impacts tangier disease and barth syndrome. | CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC | |
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: It belongs to the anti viral class of molecules. | CC1(NS(=O)C(C)(C)C)COc2c1cc(C(O)(CNC(=O)c1ccc(OC3CC3)c(OCCO)c1)C(F)(F)F)nc2-c1ccc(F)cc1 | |
Can you create a molecule that matches the given characteristics? The molecule is a ns3 protease inhibitor, a anti viral compound, a hcv inhibitor, and anti viral. | C=CCC(C)(NC(=O)C1CC(Oc2cc3c(Cl)nccc3c3c2OCO3)CN1C(=O)C(NC(=O)OC(C)(C)C)C(C)(C)C)C(=O)NS(=O)(=O)C1CC1 | |
Could you please return a molecule that adheres to this description? The molecule is a stabilizing mitochondrial structure, cholesterol translocation, apoptosis, stabilizing cytochrome oxidase that impacts diabetic heart disease. The molecule is a proton trap for oxidative phosphorylation that impacts barth syndrome, aging, tangier disease, and non-alcoholic fatty liver disease. | CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCC=CCCCCCC | |
Conceptualize a molecule that meets the specified attribute(s): The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, apoptosis that impacts aging and tangier disease. The molecule is a proton trap for oxidative phosphorylation and a cholesterol translocation that impacts diabetic heart disease, barth syndrome, and non-alcoholic fatty liver disease. | CCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)CC | |
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a energy source and a inflammatory, which impacts metabolic syndrome, obesity, and pancreatitis, and is characterized as thyroxine treatment. The molecule is a energy storage that impacts both atherosclerosis and cardiovascular disease. The molecule is a nutrient, a fat storage, and a membrane stabilizer, and it impacts cancer. | CCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC)COC(=O)CCCCCCCCCCCCCCCCCC(C)C | |
Come up with a molecule based on the description: The molecule is a electronic device, organic electroluminescent material, and electroluminescent compound. | c1ccc(-c2cc(-c3cccc(-n4c5ccccc5c5c6c7ccccc7oc6c6sc7ccccc7c6c54)c3)nc(-c3ccccc3)n2)cc1 | |
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a apoptosis and a proton trap for oxidative phosphorylation that impacts barth syndrome, non-alcoholic fatty liver disease, and tangier disease. The molecule is a stabilizing cytochrome oxidase, cholesterol translocation, stabilizing mitochondrial structure that impacts aging and diabetic heart disease. | CCCCCCC=CC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCCCC | |
I need a molecule that meets the following conditions: The molecule is a membrane stabilizer, inflammatory, energy source, energy storage that has an effect on lipotoxicity and impacts metabolic syndrome. Please represent the molecule in SMILES. | CCCCCCCCCCCCCCCCCCCCCC(=O)OCC(O)COC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C | |
The molecule is a cholesterol translocation, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation that impacts tangier disease and aging. The molecule is a apoptosis and a stabilizing mitochondrial structure that impacts barth syndrome, non-alcoholic fatty liver disease, and diabetic heart disease. Use the above information to create a molecule. | CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC | |
Can you create a molecule that matches the given characteristics? The molecule is a nutrient that affects cervical cancer by impacting ulcerative colitis, breast cancer, and atherosclerosis. | CCCCCC=CCC=CCC1OC1CC=CCCCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCCCCCCc1oc(CCC)c(C)c1C | |
Suppose there is a molecule that meets the following description: The molecule is a apoptosis, cholesterol translocation, proton trap for oxidative phosphorylation that impacts tangier disease and barth syndrome. The molecule is a stabilizing mitochondrial structure and a stabilizing cytochrome oxidase that impacts diabetic heart disease, non-alcoholic fatty liver disease, and aging. Please write the SMILES representation of it. | CCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCC(C)CC | |
Could you please return a molecule that adheres to this description? The molecule is a nutrient. | CCCCC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCC1C(O)CC(=O)C1C=CC(O)CCCCC)COP(=O)(O)OCC(N)C(=O)O | |
Can you create a molecule that matches the given characteristics? The molecule is a inflammatory, energy storage, nutrient, fat storage that has an effect on cancer and impacts atherosclerosis. The molecule is a membrane stabilizer and energy source, and it impacts metabolic syndrome. The molecule is a thyroxine treatment that impacts obesity, pancreatitis, and cardiovascular disease. | CCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCC(C)C | |
Suppose there is a molecule that meets the following description: The molecule is a proton trap for oxidative phosphorylation and a stabilizing cytochrome oxidase that impacts tangier disease, barth syndrome, and diabetic heart disease. The molecule is a cholesterol translocation, stabilizing mitochondrial structure, apoptosis that impacts aging and non-alcoholic fatty liver disease. Please write the SMILES representation of it. | CCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCC)OC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCC(C)C | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a membrane stabilizer, fat storage, nutrient that impacts pancreatitis, atherosclerosis, and obesity. The molecule is a inflammatory that impacts both metabolic syndrome and cancer. The molecule is a energy source and energy storage, belonging to the thyroxine treatment class of molecules, and impacts cardiovascular disease. | CCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCC(C)C | |
Build a molecule that meets the requirement: It has an effect on luminous efficiency. | c1ccc2c(c1)[nH]c1c3oc4ccccc4c3c3c4ccccc4sc3c21 | |
I need a molecule that meets the following conditions: The molecule is a nutritional supplement and a surfactant, impacting both tangier disease and barth syndrome. The molecule is a energy source, stabilizing cytochrome oxidase, emulsifier, proton trap for oxidative phosphorylation that impacts aging. The molecule is a energy storage, a food additive, and a apoptosis, and it impacts non-alcoholic fatty liver disease. The molecule is a membrane stabilizer, a cholesterol translocation, and a stabilizing mitochondrial structure, it impacts diabetic heart disease and is smooth. Please represent the molecule in SMILES. | CCC(C)CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)C | |
Could you please return a molecule that adheres to this description? The molecule is a proton trap for oxidative phosphorylation and a stabilizing cytochrome oxidase that impacts aging, tangier disease, and diabetic heart disease. The molecule is a cholesterol translocation, apoptosis, stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease and barth syndrome. | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC | |
Conceptualize a molecule that meets the specified attribute(s): The molecule is a energy source and a fat storage that impacts obesity, cardiovascular disease, pancreatitis, and atherosclerosis. The molecule is a energy storage and membrane stabilizer with an effect on cancer. The molecule is a inflammatory, a nutrient, and a thyroxine treatment, and it impacts metabolic syndrome. | CCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC(C)C | |
Build a molecule that meets the requirement: The molecule is a stabilizing mitochondrial structure and a apoptosis that impacts barth syndrome, tangier disease, and diabetic heart disease. The molecule is a cholesterol translocation, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts aging and non-alcoholic fatty liver disease. | CCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCCCCC | |
Build a molecule that meets the requirement: The molecule is alzheimer's treatment. | CCNc1cc(C(=O)NC(Cc2ccccc2)C(O)CNC(C)c2cccc(OC)c2)cc(N2CCCC2=O)c1 | |
Conceptualize a molecule that meets the specified attribute(s): It impacts pancreatitis, cardiovascular disease, and metabolic syndrome. The molecule is a fat storage and nutrient, belonging to the thyroxine treatment class of molecules, and impacts atherosclerosis. | CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COC(=O)CCCCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCCCC=CCCCCCCCC | |
Generate a molecule based on this description: The molecule is a apoptosis and a stabilizing cytochrome oxidase that impacts aging, diabetic heart disease, and non-alcoholic fatty liver disease. The molecule is a cholesterol translocation, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation that impacts tangier disease and barth syndrome. | CCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)C | |
The molecule is a proton trap for oxidative phosphorylation, cholesterol translocation, apoptosis, stabilizing cytochrome oxidase that impacts barth syndrome. The molecule is a stabilizing mitochondrial structure that impacts aging, tangier disease, non-alcoholic fatty liver disease, and diabetic heart disease. Use the above information to create a molecule. | CCC=CCC=CCC=CCC=CCCCCC(=O)OC(COC(=O)CCCCCCCC=CCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCC | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a proton trap for oxidative phosphorylation and a apoptosis that impacts barth syndrome, aging, and tangier disease. The molecule is a cholesterol translocation, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease and diabetic heart disease. | CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCC(C)C | |
Conceptualize a molecule that meets the specified attribute(s): The molecule is a stabilizing mitochondrial structure, cholesterol translocation, stabilizing cytochrome oxidase that impacts barth syndrome and aging. The molecule is a apoptosis and a proton trap for oxidative phosphorylation that impacts diabetic heart disease, tangier disease, and non-alcoholic fatty liver disease. | CCCCCCC=CC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC(C)CC | |
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a fat storage that impacts both cardiovascular disease and pancreatitis. The molecule is a nutrient and thyroxine treatment, impacting both metabolic syndrome and atherosclerosis. | CCCCC=CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCC | |
Generate a molecule that fulfills the requirement: The molecule is a nutrient, energy storage, and energy source that has an effect on cancer and impacts both cardiovascular disease and atherosclerosis. The molecule is a inflammatory and membrane stabilizer, and it impacts pancreatitis. The molecule is a fat storage that impacts metabolic syndrome, thyroxine treatment, and obesity. | CCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC(C)CC | |
Generate a molecule based on this description: The molecule is a nutrient. | CCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(N)C(=O)O)OC(=O)CCCC=CCC=CCC=CCC=CC=CC(O)CC | |
Suppose there is a molecule that meets the following description: The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, apoptosis, proton trap for oxidative phosphorylation that impacts aging. The molecule is a cholesterol translocation that impacts diabetic heart disease, barth syndrome, non-alcoholic fatty liver disease, and tangier disease. Please write the SMILES representation of it. | CCC=CCC=CCC=CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC | |
Suppose there is a molecule that meets the following description: The molecule is a apoptosis, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation that impacts aging and non-alcoholic fatty liver disease. The molecule is a cholesterol translocation and a stabilizing cytochrome oxidase that impacts barth syndrome, diabetic heart disease, and tangier disease. Please write the SMILES representation of it. | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC | |
Come up with a molecule based on the description: The molecule is a cholesterol translocation and a stabilizing mitochondrial structure that impacts diabetic heart disease, non-alcoholic fatty liver disease, and aging. The molecule is a apoptosis, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation that impacts tangier disease and barth syndrome. | CCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCC(C)C | |
Give me a molecule that satisfies the conditions outlined in the description: It impacts cardiovascular disease, alzheimer's disease, seizure, and parkinson's disease. It impacts breast cancer, stomach cancer, colorectal cancer, and diabetes mellitus. | CCCCCCC=CCC=CCC=CCCCCCCCCC(=O)OC1COC(=O)CCCC=CCC2C(O)CC(=O)C(C=CC(O)CCCCC)C(O)C(OP(=O)(O)O)C(OP(=O)(O)OC1)C(O)C(O)C2O | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a energy source and a membrane stabilizer that impacts atherosclerosis, cardiovascular disease, obesity, and pancreatitis. The molecule is a nutrient and energy storage with an effect on cancer. The molecule is a fat storage and a inflammatory, it impacts metabolic syndrome, and is thyroxine treatment. | CC(C)CCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC(C)C | |
The molecule is a stabilizing mitochondrial structure and a apoptosis that impacts diabetic heart disease, aging, and barth syndrome. The molecule is a stabilizing cytochrome oxidase, cholesterol translocation, proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease and tangier disease. Use the above information to create a molecule. | CCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC(C)C | |
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a cholesterol translocation, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation that impacts diabetic heart disease and tangier disease. The molecule is a stabilizing cytochrome oxidase and a apoptosis that impacts aging, non-alcoholic fatty liver disease, and barth syndrome. | CCCCCCC=CC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCC | |
I need a molecule that meets the following conditions: The molecule is a flt3 inhibitor, a kinase inhibitor, and cancer treatment. Please represent the molecule in SMILES. | O=C(Nc1ccc(=O)[nH]c1)C1CCCN1c1nc2c(c(Nc3cc(C4CCCCC4)[nH]n3)n1)CCC2 | |
Conceptualize a molecule that meets the specified attribute(s): The molecule is a proton trap for oxidative phosphorylation that impacts aging, diabetic heart disease, barth syndrome, and tangier disease. The molecule is a cholesterol translocation, stabilizing mitochondrial structure, stabilizing cytochrome oxidase, apoptosis that impacts non-alcoholic fatty liver disease. | CCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCCCC | |
Generate a molecule based on this description: The molecule is a cholesterol translocation and a stabilizing mitochondrial structure that impacts diabetic heart disease, tangier disease, and barth syndrome. The molecule is a apoptosis, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation that impacts aging and non-alcoholic fatty liver disease. | CCC=CCC=CCC=CCC=CCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCC=CCC=CCC=CCC=CCC | |
Come up with a molecule based on the description: The molecule is a kinase modulator. | O=Cc1cc(O)c(OCc2nc3ccccc3[nH]2)cc1F | |
Come up with a molecule based on the description: The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, cholesterol translocation that impacts tangier disease and barth syndrome. The molecule is a apoptosis and a stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease, diabetic heart disease, and aging. | CCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)CC | |
Generate a molecule that fulfills the requirement: The molecule is a cholesterol translocation that impacts barth syndrome, tangier disease, diabetic heart disease, and aging. The molecule is a stabilizing cytochrome oxidase, apoptosis, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease. | CCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC | |
Suppose there is a molecule that meets the following description: When strongly heated, they emit highly toxic fumes of hydrogen bromide. bromides/ Please write the SMILES representation of it. | [Cu]Br | |
The molecule is a stabilizing cytochrome oxidase and a stabilizing mitochondrial structure that impacts aging, diabetic heart disease, and tangier disease. The molecule is a cholesterol translocation, apoptosis, proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease and barth syndrome. Use the above information to create a molecule. | CCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C | |
Come up with a molecule based on the description: The molecule is a rna polymerase inhibitor. | IC1c2ccccc2-c2nccn2-c2ccccc21 | |
Conceptualize a molecule that meets the specified attribute(s): It impacts stomach cancer, seizure, cardiovascular disease, and alzheimer's disease. It impacts parkinson's disease, diabetes mellitus, breast cancer, and colorectal cancer. | CCC=CCC=CCC=CCC=CCC=CC=CC(O)CCC(=O)OCC(COP(=O)(O)OC1C(O)C(O)C(O)C(OP(=O)(O)O)C1O)OC(=O)CCCCCCCCCCCCCCCCCCC | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a stabilizing mitochondrial structure that impacts tangier disease, barth syndrome, non-alcoholic fatty liver disease, and diabetic heart disease. The molecule is a stabilizing cytochrome oxidase, cholesterol translocation, apoptosis, proton trap for oxidative phosphorylation that impacts aging. | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCC=CCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC | |
I need a molecule that meets the following conditions: The molecule is a cholesterol translocation, a proton trap for oxidative phosphorylation, and a energy source, and it impacts diabetic heart disease. The molecule is a stabilizing cytochrome oxidase, a nutritional supplement, and a apoptosis, it impacts barth syndrome and is smooth. The molecule is a membrane stabilizer, a emulsifier, and a stabilizing mitochondrial structure, and it impacts non-alcoholic fatty liver disease. The molecule is a food additive, energy storage, surfactant that impacts tangier disease and aging. Please represent the molecule in SMILES. | CCC(C)CCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC(C)CC | |
Could you please return a molecule that adheres to this description? It belongs to the organic light-emitting device class of molecules. | NC(C(=C1NC(c2ccccc2)=Cc2cc(-c3nc(-c4ccccc4)nc(-c4ccc(-n5c6ccccc6c6ccccc65)cc4)n3)ccc21)c1ccccc1)c1ccccc1 | |
Suppose there is a molecule that meets the following description: The molecule is a energy source, emulsifier, stabilizing cytochrome oxidase, energy storage. The molecule is a apoptosis that impacts non-alcoholic fatty liver disease, diabetic heart disease, tangier disease, and aging. The molecule is a cholesterol translocation, a stabilizing mitochondrial structure, a nutritional supplement, and smooth. The molecule is a proton trap for oxidative phosphorylation, surfactant, membrane stabilizer, food additive that impacts barth syndrome. Please write the SMILES representation of it. | CC(C)CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCC(C)C | |
Build a molecule that meets the requirement: The molecule is a stabilizing mitochondrial structure, stabilizing cytochrome oxidase, cholesterol translocation that impacts non-alcoholic fatty liver disease and diabetic heart disease. The molecule is a apoptosis and a proton trap for oxidative phosphorylation that impacts tangier disease, barth syndrome, and aging. | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCCCCC | |
Build a molecule that meets the requirement: The molecule is a energy source, energy storage, membrane stabilizer, nutrient, fat storage that impacts atherosclerosis. It impacts pancreatitis, cancer, and cardiovascular disease. The molecule is a inflammatory and belongs to the thyroxine treatment class of molecules, impacting both metabolic syndrome and obesity. | CC(C)CCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCC(C)C)COC(=O)CCCCCCCCC(C)C | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a stabilizing cytochrome oxidase, apoptosis, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation that impacts diabetic heart disease. The molecule is a cholesterol translocation that impacts aging, tangier disease, non-alcoholic fatty liver disease, and barth syndrome. | CCC=CCC=CCC=CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC | |
Come up with a molecule based on the description: The molecule is a proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase, apoptosis, cholesterol translocation that impacts aging. The molecule is a stabilizing mitochondrial structure that impacts diabetic heart disease, tangier disease, barth syndrome, and non-alcoholic fatty liver disease. | CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC | |
Could you please return a molecule that adheres to this description? The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease, diabetic heart disease, and tangier disease. The molecule is a apoptosis, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts aging and barth syndrome. | CCC=CCC=CCC=CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC | |
Build a molecule that meets the requirement: It belongs to the cancer treatment class of molecules. | NCCCC(NC(=O)c1ccc(-c2ccnc3[nH]ccc23)s1)c1ccccc1 | |
Build a molecule that meets the requirement: The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, apoptosis that impacts tangier disease and barth syndrome. The molecule is a stabilizing mitochondrial structure and a cholesterol translocation that impacts diabetic heart disease, non-alcoholic fatty liver disease, and aging. | CCCCCC=CCC=CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCCCCCC | |
Can you create a molecule that matches the given characteristics? The molecule is a stabilizing cytochrome oxidase, apoptosis, proton trap for oxidative phosphorylation that impacts aging and non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure and a cholesterol translocation that impacts tangier disease, diabetic heart disease, and barth syndrome. | CCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCCCCC(C)C | |
Give me a molecule that satisfies the conditions outlined in the description: The molecule is both a mch receptor antagonist and a mch antagonist. | CC1CN(C(=O)OC(C)(C)C)C(C)CN1CCCCl | |
Generate a molecule based on this description: The molecule is a optoelectronic member of the organic optoelectronic device class. | c1cc(-n2c3ccccc3c3ccccc32)cc(-n2c3ccccc3c3c2ccc2c4ccccc4n(-c4cccc5ccccc45)c23)c1 | |
Come up with a molecule based on the description: The molecule is a nutrient that impacts non-alcoholic fatty liver disease, parkinson's disease, alzheimer's disease, and diabetes mellitus type 2. | CCCCCCC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCCN)OC(=O)CCCCCCCCCCCCCCCCCCCCCCC |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.