instruction
stringlengths 52
2.16k
| output
stringlengths 1
833
| input
stringclasses 1
value |
|---|---|---|
Build a molecule that meets the requirement: The molecule is a proton trap for oxidative phosphorylation, cholesterol translocation, stabilizing mitochondrial structure that impacts tangier disease and barth syndrome. The molecule is a stabilizing cytochrome oxidase and a apoptosis that impacts aging, non-alcoholic fatty liver disease, and diabetic heart disease. | CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCC | |
Generate a molecule that fulfills the requirement: The molecule is a nutrient that impacts non-alcoholic fatty liver disease, parkinson's disease, diabetes mellitus type 2, and alzheimer's disease. | CCCCCC=CCC=CCC=CCCCCC(=O)OCC(COP(=O)(O)OCCN)OC(=O)CCCC=CCC1OC1CC=CCC=CCCCCC | |
Generate a molecule that fulfills the requirement: The molecule is a stabilizing mitochondrial structure, stabilizing cytochrome oxidase, apoptosis, cholesterol translocation that impacts diabetic heart disease. The molecule is a proton trap for oxidative phosphorylation that impacts aging, barth syndrome, tangier disease, and non-alcoholic fatty liver disease. | CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC | |
Could you please return a molecule that adheres to this description? The molecule is a apoptosis, stabilizing mitochondrial structure, cholesterol translocation that impacts aging and tangier disease. The molecule is a stabilizing cytochrome oxidase and a proton trap for oxidative phosphorylation that impacts barth syndrome, diabetic heart disease, and non-alcoholic fatty liver disease. | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCCCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC | |
Conceptualize a molecule that meets the specified attribute(s): The molecule is a stabilizing cytochrome oxidase and a cholesterol translocation that impacts non-alcoholic fatty liver disease, tangier disease, and aging. The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, apoptosis that impacts barth syndrome and diabetic heart disease. | CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCC)OC(=O)CCCCCCCCCCCC | |
Suppose there is a molecule that meets the following description: The molecule is anti bacterial. Please write the SMILES representation of it. | CC(=O)CN1CCN(c2c(F)c(N)c3c(=O)c(OC(=O)O)cn(C4CC4)c3c2F)CC1 | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a energy source and a inflammatory that impacts pancreatitis, obesity, atherosclerosis, and cancer. The molecule is a membrane stabilizer and nutrient, and it impacts cardiovascular disease. The molecule is a fat storage, a energy storage, and a thyroxine treatment, and it impacts metabolic syndrome. | CCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC(C)C | |
I need a molecule that meets the following conditions: It belongs to the pain treatment class of molecules. Please represent the molecule in SMILES. | CC1C(NC(=O)c2noc3c2CN(S(=O)(=O)N(C)C)CC3)CC2CC1C2(C)C | |
The molecule is a proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease, barth syndrome, diabetic heart disease, and aging. The molecule is a stabilizing mitochondrial structure, cholesterol translocation, apoptosis, stabilizing cytochrome oxidase that impacts tangier disease. Use the above information to create a molecule. | CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCCC | |
Can you create a molecule that matches the given characteristics? The molecule has Sharp, penetrating. | C=C(C)CCl | |
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a cholesterol translocation and a stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease, barth syndrome, and aging. The molecule is a apoptosis, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts tangier disease and diabetic heart disease. | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCCCCCC | |
Conceptualize a molecule that meets the specified attribute(s): It belongs to the anti viral class of molecules. | Cc1c(CN(C)CC(O)c2cccnc2)sc2c(=O)c(C(=O)NCc3ccc(F)cc3)cn(C)c12 | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a inflammatory, energy source, membrane stabilizer, energy storage that has an effect on lipotoxicity and impacts metabolic syndrome. | CCCCCCCCCCCCCCCCC(=O)OCC(CO)OC(=O)CCCCCCCCCCCCCCC | |
Suppose there is a molecule that meets the following description: The molecule is a proton trap for oxidative phosphorylation that impacts aging, barth syndrome, non-alcoholic fatty liver disease, and diabetic heart disease. The molecule is a stabilizing mitochondrial structure, stabilizing cytochrome oxidase, apoptosis, cholesterol translocation that impacts tangier disease. Please write the SMILES representation of it. | CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a anti tumor and belongs to both the kinase modulator and anti tumor agent classes of molecules. | CC(C)(C)OC(=O)N1CCC(n2cc(-c3ccnc(F)c3)c(-c3cccc(NCOCS(=O)(=O)c4cc(F)ccc4F)c3F)n2)CC1 | |
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a cholesterol translocation and a stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease, barth syndrome, and aging. The molecule is a proton trap for oxidative phosphorylation, apoptosis, stabilizing cytochrome oxidase that impacts tangier disease and diabetic heart disease. | CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCCCCCCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC | |
Come up with a molecule based on the description: The molecule is a apoptosis that impacts non-alcoholic fatty liver disease, tangier disease, aging, and barth syndrome. The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, cholesterol translocation, stabilizing mitochondrial structure that impacts diabetic heart disease. | CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)OC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCCCC | |
Give me a molecule that satisfies the conditions outlined in the description: It has an effect on breast cancer, and impacts stomach cancer, colorectal cancer, and alzheimer's disease. It impacts diabetes mellitus, cardiovascular disease, parkinson's disease, and seizure. | CCCCCC=CCC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCC=CCCCCCCCC)COP(=O)(O)OC1C(O)C(O)C(O)C(O)C1O | |
Come up with a molecule based on the description: The molecule is a proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase, apoptosis, stabilizing mitochondrial structure that impacts aging. The molecule is a cholesterol translocation that impacts tangier disease, non-alcoholic fatty liver disease, diabetic heart disease, and barth syndrome. | CCC=CCC=CCC=CCC=CCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCC=CCC=CCC=CCC=CCC | |
Can you create a molecule that matches the given characteristics? The molecule is a energy source, a stabilizing mitochondrial structure, a emulsifier, and smooth. The molecule is a stabilizing cytochrome oxidase, energy storage, nutritional supplement that impacts tangier disease and aging. The molecule is a membrane stabilizer and a proton trap for oxidative phosphorylation, impacting both barth syndrome and non-alcoholic fatty liver disease. The molecule is a food additive, cholesterol translocation, apoptosis, surfactant that impacts diabetic heart disease. | CCC(C)CCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCC(C)C | |
Build a molecule that meets the requirement: It has an effect on stomach cancer, and impacts diabetes mellitus, seizure, and colorectal cancer. It impacts alzheimer's disease, parkinson's disease, breast cancer, and cardiovascular disease. | CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OC1C(O)C(O)C(O)C(O)C1O)OC(=O)CCCC1OC1CC=CCC=CCC=CCCCCC | |
Generate a molecule based on this description: The molecule is a membrane stabilizer, a nutrient, and a inflammatory that impacts both cardiovascular disease and metabolic syndrome, and is thyroxine treatment. The molecule is a energy source and energy storage, and it impacts pancreatitis. The molecule is a fat storage that impacts obesity, cancer, and atherosclerosis. | CCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C | |
Conceptualize a molecule that meets the specified attribute(s): The molecule is a stabilizing cytochrome oxidase, apoptosis, proton trap for oxidative phosphorylation that impacts diabetic heart disease and tangier disease. The molecule is a cholesterol translocation and a stabilizing mitochondrial structure that impacts aging, barth syndrome, and non-alcoholic fatty liver disease. | CCCCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)CC | |
Conceptualize a molecule that meets the specified attribute(s): The molecule is a apoptosis, stabilizing mitochondrial structure, stabilizing cytochrome oxidase, cholesterol translocation that impacts diabetic heart disease. The molecule is a proton trap for oxidative phosphorylation that impacts barth syndrome, aging, non-alcoholic fatty liver disease, and tangier disease. | CCC=CCC=CCC=CCC=CCCCCC(=O)OC(COC(=O)CCCCCCCC=CCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCC | |
Build a molecule that meets the requirement: The molecule is a anti biotic and is anti bacterial. | CC(C)(ON=C(C(=O)NC1CN(C(=O)NS(=O)(=O)CC2OC(=O)NC2NC(=O)c2cc(=O)c(O)c[nH]2)C1=O)c1csc(N)n1)C(=O)O | |
Suppose there is a molecule that meets the following description: The molecule is a proton trap for oxidative phosphorylation, stabilizing mitochondrial structure, cholesterol translocation, apoptosis that impacts tangier disease. The molecule is a stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease, aging, diabetic heart disease, and barth syndrome. Please write the SMILES representation of it. | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCC=CCC=CCC=CCC=CCC | |
The molecule is a membrane stabilizer, a cholesterol translocation, and a proton trap for oxidative phosphorylation, and it impacts aging. The molecule is a nutritional supplement and a food additive that impacts barth syndrome, non-alcoholic fatty liver disease, and diabetic heart disease. The molecule is a emulsifier, a energy source, and a stabilizing cytochrome oxidase, and it impacts tangier disease. The molecule is a apoptosis, surfactant, stabilizing mitochondrial structure, energy storage, and smooth. Use the above information to create a molecule. | CCC(C)CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCC(C)C | |
Build a molecule that meets the requirement: The molecule is a cholesterol translocation, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation that impacts barth syndrome and aging. The molecule is a apoptosis and a stabilizing mitochondrial structure that impacts diabetic heart disease, tangier disease, and non-alcoholic fatty liver disease. | CCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCCCCCC | |
Based on the given information, generate a molecule that meets the desired specifications: It has an effect on breast cancer, and impacts cardiovascular disease, colorectal cancer, and parkinson's disease. It has an effect on stomach cancer, and impacts diabetes mellitus, alzheimer's disease, and seizure. | CCCC=CCC=CCCCCCCCC(=O)OCC(COP(=O)(O)OC1C(O)C(O)C(O)C(OP(=O)(O)O)C1O)OC(=O)CCCC=CCC=CCC=CCC=CC=CC(O)CC | |
I need a molecule that meets the following conditions: The molecule is a nutrient. Please represent the molecule in SMILES. | CCC=CCC=CCC=CCC=CC=CC(O)CCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)COP(=O)(O)OCC(N)C(=O)O | |
Generate a molecule that fulfills the requirement: The molecule is a inflammatory and a nutrient that impacts thyroxine treatment, pancreatitis, metabolic syndrome, and cancer. The molecule is a fat storage that impacts both cardiovascular disease and atherosclerosis. The molecule is a energy source, a energy storage, and a membrane stabilizer, and it impacts obesity. | CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC(C)C | |
Come up with a molecule based on the description: The molecule is a energy source, membrane stabilizer, energy storage, nutrient, and pharmaceutical. | CC(O)(CCO)CC(=O)O | |
Give me a molecule that satisfies the conditions outlined in the description: The molecule is both a protein kinase inhibitor and a kinase inhibitor. | CC(=O)c1c(C)csc1N | |
Generate a molecule based on this description: The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease and aging. The molecule is a cholesterol translocation and a apoptosis that impacts diabetic heart disease, barth syndrome, and tangier disease. | CCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCC(C)C | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a immunomodulator, protein tyrosine kinase inhibitor, protein kinase inhibitor, jak inhibitor, and autoimmune disease treatment. | O=C(c1cccc2[nH]ccc12)N1C2CCC1CN(c1ncnc3[nH]ccc13)C2 | |
Generate a molecule based on this description: The molecule is a stabilizing cytochrome oxidase and a apoptosis that impacts aging, tangier disease, and barth syndrome. The molecule is a proton trap for oxidative phosphorylation, stabilizing mitochondrial structure, cholesterol translocation that impacts non-alcoholic fatty liver disease and diabetic heart disease. | CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCCCC | |
Generate a molecule based on this description: The molecule is a stabilizing mitochondrial structure that impacts aging, tangier disease, barth syndrome, and non-alcoholic fatty liver disease. The molecule is a cholesterol translocation, apoptosis, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation that impacts diabetic heart disease. | CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC | |
Generate a molecule that fulfills the requirement: The molecule is a member of the dielectric class and affects negative dielectric anisotropy. | CCCC1CCC(C2Cc3ccc(-c4ccc(C5CCC(CC)CC5)cc4)c(F)c3C(=O)O2)CC1 | |
Generate a molecule that fulfills the requirement: The molecule is a proton trap for oxidative phosphorylation and a stabilizing cytochrome oxidase that impacts diabetic heart disease, tangier disease, and barth syndrome. The molecule is a cholesterol translocation, stabilizing mitochondrial structure, apoptosis that impacts aging and non-alcoholic fatty liver disease. | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCC=CCC=CCC=CCC=CCC=CCC | |
Can you create a molecule that matches the given characteristics? The molecule is a stabilizing cytochrome oxidase and a cholesterol translocation that impacts non-alcoholic fatty liver disease, diabetic heart disease, and aging. The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, apoptosis that impacts tangier disease and barth syndrome. | CCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCC(C)C | |
The molecule is a nutrient, inflammatory, energy storage that impacts obesity, cardiovascular disease, and atherosclerosis. The molecule is a membrane stabilizer and energy source, and it impacts pancreatitis. The molecule is a thyroxine treatment and a fat storage, with effects on cancer and impacts on metabolic syndrome. Use the above information to create a molecule. | CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCC(C)C | |
I need a molecule that meets the following conditions: It belongs to the anti thrombotic class of molecules. Please represent the molecule in SMILES. | Cc1cc(NC(=O)C(c2cccnc2)c2nc3ccc(Cl)cc3[nH]2)ccc1C(=O)N1CC=CC1 | |
Build a molecule that meets the requirement: The molecule is a stabilizing mitochondrial structure that impacts aging, barth syndrome, diabetic heart disease, and tangier disease. The molecule is a apoptosis, stabilizing cytochrome oxidase, cholesterol translocation, proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease. | CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C | |
Can you create a molecule that matches the given characteristics? It impacts cardiovascular disease, breast cancer, colorectal cancer, and parkinson's disease. It impacts seizure, stomach cancer, alzheimer's disease, and diabetes mellitus. | CCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCCO)COP(=O)(O)OC1C(O)C(O)C(O)C(O)C1O | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a nutrient. | CCCCCC=CCC=CCC=CCC1OC1CCCC(=O)OC(COC(=O)CCCCCCCC=CCCCCCCCC)COP(=O)(O)OCC(N)C(=O)O | |
I need a molecule that meets the following conditions: The molecule is a anti arrhythmic. Please represent the molecule in SMILES. | COc1cc(Cl)c(C(=O)N=C(N)N)cc1C(F)(F)F | |
Come up with a molecule based on the description: The molecule is a emulsifier, membrane stabilizer, surfactant, energy storage, nutrient, energy source. | CCCCCCCCCCCCCC(O)CC(=O)c1ccccc1 | |
Build a molecule that meets the requirement: The molecule has Pleasant, characteristic odor. | CC(=O)c1ccc(N)cc1 | |
The molecule is a nutrient that impacts alzheimer's disease, non-alcoholic fatty liver disease, diabetes mellitus type 2, and parkinson's disease. Use the above information to create a molecule. | CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCC1C(O)CC(=O)C1C=CC(O)CCCCC)COP(=O)(O)OCCN | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a stabilizing mitochondrial structure that impacts barth syndrome, aging, diabetic heart disease, and non-alcoholic fatty liver disease. The molecule is a apoptosis, stabilizing cytochrome oxidase, cholesterol translocation, proton trap for oxidative phosphorylation that impacts tangier disease. | CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC | |
The molecule is a cholesterol translocation, stabilizing mitochondrial structure, apoptosis, stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation that impacts diabetic heart disease, aging, barth syndrome, and tangier disease. Use the above information to create a molecule. | CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC(C)C | |
I need a molecule that meets the following conditions: The molecule is a nutrient. Please represent the molecule in SMILES. | CCCCCC=CCC=CC=CC=CC(SCC(N)C(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(N)C(=O)O)C(O)CCCC(=O)O | |
Suppose there is a molecule that meets the following description: The molecule is a emulsifier, surfactant, energy source, membrane stabilizer, energy storage, signalling molecule. Please write the SMILES representation of it. | CCCCCCCC(=O)OCC[N+](C)(C)C | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a apoptosis that impacts tangier disease, barth syndrome, diabetic heart disease, and non-alcoholic fatty liver disease. The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure, cholesterol translocation that impacts aging. | CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)CC | |
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a apoptosis and a cholesterol translocation that impacts non-alcoholic fatty liver disease, aging, and tangier disease. The molecule is a stabilizing mitochondrial structure, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation that impacts diabetic heart disease and barth syndrome. | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCC=CCC=CCC=CCC=CCC=CCC | |
Conceptualize a molecule that meets the specified attribute(s): The molecule is a stabilizing cytochrome oxidase and a stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease, diabetic heart disease, and tangier disease. The molecule is a apoptosis, proton trap for oxidative phosphorylation, cholesterol translocation that impacts barth syndrome and aging. | CCC=CCC=CCC=CCC=CCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC)OC(=O)CCCCCCCC=CCCCCCCCC | |
Come up with a molecule based on the description: The molecule is a fat storage and a nutrient that impacts atherosclerosis, metabolic syndrome, obesity, and cancer. The molecule is a energy storage that impacts both pancreatitis and cardiovascular disease. The molecule is a inflammatory, a membrane stabilizer, and a energy source, and it impacts thyroxine treatment. | CC(C)CCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCC(C)C | |
Could you please return a molecule that adheres to this description? The molecule is a cholesterol translocation and a apoptosis that impacts tangier disease, barth syndrome, and diabetic heart disease. The molecule is a stabilizing mitochondrial structure, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease and aging. | CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCCCC(C)CC | |
Come up with a molecule based on the description: The molecule is a ns3 protease inhibitor and hcv inhibitor, belonging to the anti viral compound class of molecules, and is anti viral. | CC1CCC=CC2CC2(C(=O)NS(=O)(=O)C2(C)CC2)NC(=O)C2CC(OC(=O)Nc3ccccc3C(F)(F)F)CN2C(=O)CC(C)C1 | |
Generate a molecule that fulfills the requirement: The molecule is a proton trap for oxidative phosphorylation that impacts tangier disease, diabetic heart disease, aging, and barth syndrome. The molecule is a cholesterol translocation, stabilizing cytochrome oxidase, apoptosis, stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease. | CCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)C | |
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a stabilizing mitochondrial structure and a stabilizing cytochrome oxidase that impacts barth syndrome, aging, and non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation, cholesterol translocation, apoptosis that impacts diabetic heart disease and tangier disease. | CCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCC(C)C | |
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a cholesterol translocation, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease and aging. The molecule is a apoptosis and a stabilizing mitochondrial structure that impacts barth syndrome, tangier disease, and diabetic heart disease. | CCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)CC | |
I need a molecule that meets the following conditions: The molecule is cancer treatment. Please represent the molecule in SMILES. | O=C(C1CC1)N1CCC(Cn2nnnc2-c2ccc(Br)cc2)C1 | |
Generate a molecule that fulfills the requirement: The molecule is a stabilizing mitochondrial structure, cholesterol translocation, apoptosis, proton trap for oxidative phosphorylation that impacts aging. The molecule is a stabilizing cytochrome oxidase that impacts tangier disease, non-alcoholic fatty liver disease, barth syndrome, and diabetic heart disease. | CCC=CCC=CCC=CCC=CCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC | |
The molecule is a energy storage, fat storage, thyroxine treatment, inflammatory that has an effect on cancer and impacts pancreatitis. The molecule is a energy source that impacts both metabolic syndrome and obesity. The molecule is a nutrient and a membrane stabilizer, impacting both cardiovascular disease and atherosclerosis. Use the above information to create a molecule. | CCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCC | |
Generate a molecule based on this description: The molecule is a stabilizing mitochondrial structure and a proton trap for oxidative phosphorylation that impacts tangier disease, diabetic heart disease, and non-alcoholic fatty liver disease. The molecule is a stabilizing cytochrome oxidase, cholesterol translocation, apoptosis that impacts barth syndrome and aging. | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC | |
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a cholesterol translocation, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts aging and barth syndrome. The molecule is a apoptosis and a stabilizing mitochondrial structure that impacts diabetic heart disease, non-alcoholic fatty liver disease, and tangier disease. | CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC | |
Could you please return a molecule that adheres to this description? The molecule is a fgfr inhibitor. | c1ccc(CN2CCOCC2Cn2cccn2)cc1 | |
Can you create a molecule that matches the given characteristics? It has an effect on breast cancer, and impacts seizure, cardiovascular disease, and parkinson's disease. It impacts diabetes mellitus, stomach cancer, colorectal cancer, and alzheimer's disease. | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCC(O)C(O)CC=CCCCCC)COP(=O)(O)OC1C(O)C(O)C(O)C(O)C1O | |
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a stabilizing mitochondrial structure, cholesterol translocation, proton trap for oxidative phosphorylation that impacts tangier disease and diabetic heart disease. The molecule is a stabilizing cytochrome oxidase and a apoptosis that impacts barth syndrome, aging, and non-alcoholic fatty liver disease. | CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a energy source, inflammatory, fat storage, energy storage that has an effect on cancer and impacts metabolic syndrome. The molecule is a member of the thyroxine treatment class and affects both cardiovascular disease and atherosclerosis. The molecule is a nutrient and a membrane stabilizer, impacting both pancreatitis and obesity. | CCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC(C)CC)COC(=O)CCCCCCCCCCCC(C)C | |
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a cancer treatment. | CC(Oc1ccc(C2(S(=O)(=O)c3ccc(F)cc3)CCN(C(=O)C3CCS(=O)(=O)CC3)C2)cc1)c1ccccc1 | |
Can you create a molecule that matches the given characteristics? The molecule is a apoptosis and a stabilizing cytochrome oxidase that impacts barth syndrome, non-alcoholic fatty liver disease, and tangier disease. The molecule is a stabilizing mitochondrial structure, cholesterol translocation, proton trap for oxidative phosphorylation that impacts aging and diabetic heart disease. | CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC | |
Generate a molecule based on this description: The molecule is a energy storage, energy source, nutrient, emulsifier. The molecule is a nutritional supplement, surfactant, membrane stabilizer, food additive, and smooth. | CCCCCCCCC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(N)C(=O)O)OC(=O)CCCCCCCCCCCCCCC | |
Generate a molecule based on this description: The molecule is a energy source that impacts inflammatory bowel disease, celiac disease, and heart failure. It has an effect on breast cancer, and impacts diabetes mellitus type 2, cardiovascular disease, and renal cell carcinoma. | CCCC=CC=CCCCCCCCCC(=O)OC(CC(=O)[O-])C[N+](C)(C)C | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a energy source that impacts heart failure, inflammatory bowel disease, and cardiovascular disease. It impacts renal cell carcinoma, diabetes mellitus type 2, celiac disease, and breast cancer. | C[N+](C)(C)CC(CC(=O)[O-])OC(=O)CCCCC(=O)OCCO | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a proton trap for oxidative phosphorylation that impacts barth syndrome, tangier disease, aging, and diabetic heart disease. The molecule is a stabilizing mitochondrial structure, cholesterol translocation, stabilizing cytochrome oxidase, apoptosis that impacts non-alcoholic fatty liver disease. | CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCC=CCC=CCC=CCC=CCC | |
Generate a molecule based on this description: The molecule is anti viral. | CCCCCOc1ccc(NC(=O)N(S)C(=O)c2ccc(CO)nc2)cc1C(F)(F)F | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a jak3 inhibitor. | CC12CCC(C(=O)O)C1(C)OC2=O | |
Can you create a molecule that matches the given characteristics? It belongs to both the organic optoelectronic device and optoelectronic classes of molecules. | CC1(C)c2ccccc2-c2ccc(N(c3cc(-c4ccccc4)cc(-c4ccccc4)c3)c3ccc4cc(-c5ccc6oc7ccccc7c6c5)ccc4c3)cc21 | |
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a proton trap for oxidative phosphorylation and a apoptosis that impacts aging, tangier disease, and barth syndrome. The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, cholesterol translocation that impacts non-alcoholic fatty liver disease and diabetic heart disease. | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC | |
Conceptualize a molecule that meets the specified attribute(s): The molecule is a cholesterol translocation, proton trap for oxidative phosphorylation, apoptosis that impacts tangier disease and aging. The molecule is a stabilizing cytochrome oxidase and a stabilizing mitochondrial structure that impacts barth syndrome, non-alcoholic fatty liver disease, and diabetic heart disease. | CCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCC(C)C | |
Can you create a molecule that matches the given characteristics? The molecule is a prmt5 inhibitor. | CSCC1OC(n2ccc3cncnc32)CC1C | |
Come up with a molecule based on the description: The molecule is a nutrient that impacts both metabolic syndrome and cardiovascular disease. The molecule is a fat storage and belongs to the thyroxine treatment class of molecules, impacting both atherosclerosis and pancreatitis. | CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCCCCCCC=CCC=CCC=CCC)COC(=O)CCCCCCCCCCCCCC | |
Generate a molecule based on this description: The molecule is a nutrient that affects cervical cancer by impacting breast cancer, ulcerative colitis, and atherosclerosis. | CCC=CCC=CCC=CCC=CCCCCCCC(=O)OC(COC(=O)CCCCCCCC=CCCCCCCCC)COP(=O)([O-])OCC[N+](C)(C)C | |
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a surfactant, energy storage, waste product, membrane stabilizer. The molecule is a drug metabolite, emulsifier, signalling molecule, energy source. | CC12CCC3c4ccc(OS(=O)(=O)O)cc4CCC3C1CC(OC1OC(C(=O)O)C(O)C(O)C1O)C2O | |
The molecule is a cholesterol translocation, proton trap for oxidative phosphorylation, apoptosis that impacts tangier disease and aging. The molecule is a stabilizing cytochrome oxidase and a stabilizing mitochondrial structure that impacts diabetic heart disease, non-alcoholic fatty liver disease, and barth syndrome. Use the above information to create a molecule. | CCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC(C)C | |
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease and diabetic heart disease. The molecule is a apoptosis and a cholesterol translocation that impacts barth syndrome, tangier disease, and aging. | CCC=CCC=CCC=CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC | |
Conceptualize a molecule that meets the specified attribute(s): It belongs to the nmda receptor modulator class of molecules. | CC(O)C(NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C1CC2CC2N1C(=O)C(NC(=O)OC(C)(C)C)C(C)O)C(N)=O | |
Come up with a molecule based on the description: It impacts insulin resistance. | CCCCCC=CCC=CCCCCCCCCCCCC(=O)OCC(O)COC(=O)CCCCCCCC=CCCCCCCCC | |
I need a molecule that meets the following conditions: The molecule is a nutrient that impacts both pancreatitis and cardiovascular disease. The molecule is a thyroxine treatment and a fat storage, impacting both atherosclerosis and metabolic syndrome. Please represent the molecule in SMILES. | CCCCCCCCC=CCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, cholesterol translocation that impacts diabetic heart disease and barth syndrome. The molecule is a apoptosis and a proton trap for oxidative phosphorylation that impacts tangier disease, aging, and non-alcoholic fatty liver disease. | CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCC=CCC=CCC=CCC=CCC | |
Suppose there is a molecule that meets the following description: The molecule is a stabilizing mitochondrial structure, stabilizing cytochrome oxidase, apoptosis that impacts diabetic heart disease and barth syndrome. The molecule is a proton trap for oxidative phosphorylation and a cholesterol translocation that impacts aging, tangier disease, and non-alcoholic fatty liver disease. Please write the SMILES representation of it. | CCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCC(C)C | |
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a cholesterol translocation, a proton trap for oxidative phosphorylation, and a energy source, and it impacts non-alcoholic fatty liver disease. The molecule is a surfactant and a apoptosis, which impacts both aging and barth syndrome, and is characterized as smooth. The molecule is a nutritional supplement, a stabilizing cytochrome oxidase, and a stabilizing mitochondrial structure, and it impacts diabetic heart disease. The molecule is a food additive, membrane stabilizer, energy storage, emulsifier that impacts tangier disease. | CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCC=CCC=CCC=CCC=CCC=CCC | |
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation that impacts tangier disease, aging, and diabetic heart disease. The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, apoptosis that impacts barth syndrome and non-alcoholic fatty liver disease. | CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC(C)C | |
Can you create a molecule that matches the given characteristics? The molecule is a inflammatory and a membrane stabilizer, which impacts metabolic syndrome, obesity, and atherosclerosis, and is characterized as thyroxine treatment. The molecule is a nutrient and energy source, and it impacts cardiovascular disease. The molecule is a fat storage and a energy storage, impacting both pancreatitis and cancer. | CCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCC(C)C | |
Build a molecule that meets the requirement: The molecule is a stabilizing mitochondrial structure that impacts barth syndrome, diabetic heart disease, tangier disease, and aging. The molecule is a cholesterol translocation, apoptosis, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease. | CCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)C | |
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a liquid crystal compound and belongs to the liquid crystal class of molecules. | CC1CC2CC(c3cc(F)c(C(F)(F)Oc4cc(F)c(-c5cc(F)c(F)c(F)c5)c(F)c4)c(F)c3)CC2C1 | |
Come up with a molecule based on the description: The molecule is a asthma treatment. | CCCCCCCCCCCCCCCCC(CO)OP(=O)([O-])OCC[N+](C)(C)C | |
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a nutrient that affects breast cancer by impacting ulcerative colitis, atherosclerosis, and cervical cancer. | CCCCCc1oc(CCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCC2C(O)CC(O)C2C=CC(O)CCCCC)COP(=O)([O-])OCC[N+](C)(C)C)c(C)c1C |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.